Physical and Chemical Properties

Updated 22 Mar 2026

Alkanes, being saturated hydrocarbons, are characterized by their relatively low reactivity due to the presence of strong, non-polar C-C and C-H sigma bonds. Their physical properties, such as boiling point, melting point, density, and solubility, are primarily governed by the strength of intermolecular van der Waals forces, which are influenced by molecular size and shape. Chemically, alkanes und…

Quick Summary

Alkanes are saturated hydrocarbons with the general formula CnH2n+2C_nH_{2n+2}, featuring only strong, non-polar C-C and C-H single bonds. Their physical properties are governed by weak van der Waals forces.

As chain length increases, boiling points, melting points, and density generally increase. Branching, however, decreases boiling points due to reduced surface area for intermolecular interactions. Alkanes are non-polar, making them insoluble in water but soluble in non-polar organic solvents.

Chemically, alkanes are relatively unreactive ('paraffins'). Their key reactions include complete combustion (producing CO2CO_2 and H2OH_2O) and incomplete combustion (COCO or CC), both highly exothermic.

Halogenation occurs via a free radical substitution mechanism under UV light or heat, showing selectivity for tertiary > secondary > primary hydrogen atoms. Pyrolysis (cracking) breaks larger alkanes into smaller alkanes and alkenes at high temperatures, vital for the petroleum industry.

Isomerisation converts straight-chain alkanes to branched ones using AlCl3/HClAlCl_3/HCl catalyst, improving fuel quality. Aromatization converts higher alkanes to aromatic compounds. These properties define their utility as fuels, solvents, and chemical feedstocks.

Full explanation

Alkanes form the foundational class of organic compounds, serving as the simplest saturated hydrocarbons. Their general formula is CnH2n+2C_nH_{2n+2}, where 'n' represents the number of carbon atoms. The study of their physical and chemical properties is crucial for understanding their behavior, applications, and their role as starting materials in various industrial processes.

Conceptual Foundation

Alkanes are characterized by the presence of only single covalent bonds between carbon-carbon (C-C) and carbon-hydrogen (C-H) atoms. These bonds are strong and, importantly, largely non-polar. The electronegativity difference between carbon (2.

55) and hydrogen (2.20) is small (0.350.35), leading to very little polarity in the C-H bond. The C-C bond is, by definition, non-polar. This lack of significant polarity is the primary reason for the relatively low reactivity of alkanes, earning them the historical name 'paraffins' (from Latin 'parum affinis', meaning 'little affinity').

Their tetrahedral geometry around each carbon atom, with bond angles of approximately 109.5109.5^\circ, contributes to their overall non-polar molecular structure. The absence of functional groups containing highly electronegative atoms or pi bonds means alkanes lack sites for typical polar or electrophilic/nucleophilic reactions.

Key Principles/Laws Governing Properties

    1
  1. Intermolecular Forces (van der Waals forces)The physical properties of alkanes are predominantly determined by the strength of van der Waals forces, specifically London Dispersion Forces (LDFs). These are temporary, induced dipole-induced dipole interactions that arise from the instantaneous fluctuations in electron distribution around a molecule. LDFs are present in all molecules but are the only significant intermolecular forces in non-polar molecules like alkanes. The strength of LDFs increases with:

* Molecular size/mass: Larger molecules have more electrons, leading to greater polarizability and stronger temporary dipoles. * Surface area: Molecules with larger surface areas allow for more points of contact and thus stronger overall LDFs. Branching reduces surface area, impacting these forces.

    1
  1. Free Radical MechanismMany chemical reactions of alkanes, particularly halogenation, proceed via a free radical mechanism. A free radical is an atom or molecule with one or more unpaired electrons, making it highly reactive. This mechanism typically involves three steps: initiation (formation of radicals), propagation (reaction of radicals with stable molecules to form new radicals), and termination (combination of radicals to form stable molecules).

Physical Properties of Alkanes

    1
  1. Physical StateAt room temperature (25C25^\circ C) and atmospheric pressure:

* **C1C_1 to C4C_4 alkanes** (Methane, Ethane, Propane, Butane) are gases. For example, methane is the main component of natural gas, and propane/butane are used as LPG. * **C5C_5 to C17C_{17} alkanes** are liquids. Examples include pentane, hexane, octane (components of gasoline/petrol), and kerosene. * **Alkanes with C18C_{18} or more carbons** are solids. Examples include paraffin wax. This trend is a direct consequence of increasing van der Waals forces with increasing molecular size.

    1
  1. Melting and Boiling PointsThese are critical physical properties that reflect the energy required to overcome intermolecular forces.

* Effect of Chain Length: As the number of carbon atoms in a straight-chain alkane increases, both the melting point and boiling point increase. This is because larger molecules have more electrons and greater surface area, leading to stronger van der Waals forces that require more energy to overcome.

* Effect of Branching: For a given molecular formula (i.e., isomers), branched-chain alkanes generally have lower boiling points than their straight-chain counterparts. Branching makes the molecule more spherical, reducing its surface area available for intermolecular contact.

This weakens the van der Waals forces, requiring less energy to separate the molecules. For example, n-pentane (36C36^\circ C) has a higher boiling point than isopentane (28C28^\circ C), which in turn has a higher boiling point than neopentane ($9.

5^\circ C$). * Melting Points and Symmetry: While branching generally lowers boiling points, its effect on melting points can be more complex. Highly symmetrical branched alkanes (like neopentane) can pack more efficiently into a crystal lattice, sometimes leading to higher melting points compared to less symmetrical isomers, despite having lower boiling points.

However, generally, melting points also increase with chain length.

    1
  1. DensityAlkanes are generally less dense than water (1g/mL1\,\text{g/mL}). Their density increases with increasing molecular weight (number of carbon atoms) due to the more efficient packing of larger molecules. However, even the heaviest alkanes are typically less dense than water, meaning they will float on water.
    1
  1. SolubilityAlkanes are non-polar compounds. According to the principle 'like dissolves like', they are:

* Insoluble in water: Water is a highly polar solvent, and alkanes cannot form hydrogen bonds or significant dipole-dipole interactions with water molecules. The energy required to disrupt the strong hydrogen bonds in water to accommodate non-polar alkane molecules is not compensated by the weak alkane-water interactions.

* Soluble in non-polar solvents: Alkanes readily dissolve in other non-polar organic solvents such as benzene, ether, carbon tetrachloride, and other alkanes. This is because the intermolecular forces in both the solute and solvent are of similar strength (van der Waals forces), making the mixing energetically favorable.

Chemical Properties of Alkanes

Alkanes are relatively unreactive due to the strength and non-polarity of their C-C and C-H bonds. However, they undergo several important reactions under specific conditions.

    1
  1. Combustion (Oxidation)

Alkanes burn readily in the presence of sufficient oxygen, releasing a large amount of heat. This exothermic reaction makes them excellent fuels. * Complete Combustion: Produces carbon dioxide and water.

CnH2n+2+(3n+12)O2nCO2+(n+1)H2O+HeatC_nH_{2n+2} + \left(\frac{3n+1}{2}\right)O_2 \longrightarrow nCO_2 + (n+1)H_2O + \text{Heat}
Example: Methane combustion
CH4+2O2CO2+2H2O+HeatCH_4 + 2O_2 \longrightarrow CO_2 + 2H_2O + \text{Heat}
* Incomplete Combustion: Occurs when oxygen supply is limited, producing carbon monoxide (a toxic gas) and/or soot (carbon particles) in addition to water.

    1
  1. Halogenation (Free Radical Substitution)

Alkanes react with halogens (Cl2Cl_2, Br2Br_2) in the presence of ultraviolet (UV) light or high temperatures (250400C250-400^\circ C) to form haloalkanes. This is a free radical substitution reaction where a hydrogen atom is replaced by a halogen atom.

CH4+Cl2hν or heatCH3Cl+HClCH_4 + Cl_2 \xrightarrow{h\nu \text{ or heat}} CH_3Cl + HCl
The reaction can proceed further, leading to polysubstitution (e.g., CH2Cl2CH_2Cl_2, CHCl3CHCl_3, CCl4CCl_4). * Mechanism: Involves three steps: * Initiation: Homolytic cleavage of the halogen molecule by UV light or heat to form halogen free radicals.

ClClhνClcdot+ClcdotCl-Cl \xrightarrow{h\nu} Clcdot + Clcdot
* Propagation: A chain reaction where radicals react with stable molecules to form new radicals.
CH3H+ClcdotCH3+HClCH_3-H + Clcdot \longrightarrow CH_3\cdot + HCl
CH3+ClClCH3Cl+ClcdotCH_3\cdot + Cl-Cl \longrightarrow CH_3Cl + Clcdot
* Termination: Combination of any two radicals to form a stable molecule, ending the chain.

Clcdot+ClcdotCl2Clcdot + Clcdot \longrightarrow Cl_2
CH3+CH3CH3CH3CH_3\cdot + CH_3\cdot \longrightarrow CH_3-CH_3
CH3+ClcdotCH3ClCH_3\cdot + Clcdot \longrightarrow CH_3Cl
* Reactivity of Halogens: F2>Cl2>Br2>I2F_2 > Cl_2 > Br_2 > I_2.

Fluorination is too violent and difficult to control. Iodination is very slow and reversible. * Selectivity: The ease of abstracting a hydrogen atom by a halogen radical follows the order: tertiary H > secondary H > primary H.

This is because the stability of the alkyl radical formed follows the same order (tertiary > secondary > primary). Therefore, in the halogenation of higher alkanes, the major product will be formed by the substitution of a tertiary hydrogen, if available.

For example, in the monochlorination of isobutane, the tertiary hydrogen is preferentially substituted.

    1
  1. Pyrolysis (Cracking)

When alkanes are heated to high temperatures (400700C400-700^\circ C) in the absence of air (or with steam), larger alkane molecules break down into smaller alkanes and alkenes. This process is called pyrolysis or cracking.

It is a free radical process.

C6H14heatC4H10+C2H4C_6H_{14} \xrightarrow{heat} C_4H_{10} + C_2H_4
C6H14heatC3H8+C3H6C_6H_{14} \xrightarrow{heat} C_3H_8 + C_3H_6
This is industrially vital for converting high-boiling petroleum fractions into more valuable gasoline components (smaller alkanes) and raw materials for polymers (alkenes).

    1
  1. Isomerisation

Straight-chain alkanes can be converted into branched-chain isomers when heated with anhydrous aluminum chloride (AlCl3AlCl_3) and hydrogen chloride (HClHCl) gas at about 200C200^\circ C and 35atm35\,\text{atm} pressure. This reaction is important for improving the octane number of gasoline, as branched alkanes burn more smoothly than straight-chain alkanes.

CH3CH2CH2CH3AlCl3/HClCH3CH(CH3)CH3CH_3-CH_2-CH_2-CH_3 \xrightarrow{AlCl_3/HCl} CH_3-CH(CH_3)-CH_3
(n-Butane to Isobutane)

    1
  1. Aromatization

Alkanes with six or more carbon atoms, when heated to 500600C500-600^\circ C under high pressure in the presence of catalysts like Cr2O3Cr_2O_3 or MoO2MoO_2 supported on alumina, undergo dehydrogenation and cyclization to form aromatic compounds. For example, n-hexane yields benzene.

CH3(CH2)4CH3Cr2O3/Al2O3,500CC6H6+4H2CH_3(CH_2)_4CH_3 \xrightarrow{Cr_2O_3/Al_2O_3, 500^\circ C} C_6H_6 + 4H_2
(n-Hexane to Benzene)

    1
  1. Reaction with Steam

Methane reacts with steam at high temperatures (800900C800-900^\circ C) in the presence of a nickel catalyst to produce carbon monoxide and hydrogen (synthesis gas or syngas).

CH4+H2ONi,800900CCO+3H2CH_4 + H_2O \xrightarrow{Ni, 800-900^\circ C} CO + 3H_2
This is an important industrial method for producing hydrogen.

Real-World Applications

  • FuelsAlkanes are primary components of various fuels like natural gas (methane), LPG (propane, butane), gasoline/petrol (C5-C12 alkanes), diesel (C15-C18 alkanes), and kerosene. Their high heat of combustion makes them excellent energy sources.
  • Petrochemical FeedstocksCracking of larger alkanes provides smaller alkenes (e.g., ethene, propene) which are crucial raw materials for the polymer industry (e.g., polyethylene, polypropylene).
  • SolventsLower alkanes like hexane are used as non-polar solvents in laboratories and industries for extraction and purification processes.
  • Lubricants and WaxesHigher alkanes are used as lubricants (oils) and in paraffin wax for candles, polishes, and protective coatings.

Common Misconceptions

  • Alkanes are completely inertWhile relatively unreactive, alkanes do undergo specific reactions under appropriate conditions (e.g., combustion, halogenation). They are not 'inert' in an absolute sense.
  • Branching always increases boiling pointThis is incorrect. Branching decreases boiling point due to reduced surface area for van der Waals interactions. It's a common trap in NEET questions.
  • Halogenation is a simple ionic substitutionHalogenation of alkanes is a free radical mechanism, not an ionic one. Understanding the radical nature is key to predicting products and understanding selectivity.
  • All C-H bonds are equally reactiveIn free radical halogenation, tertiary C-H bonds are more reactive than secondary, which are more reactive than primary, due to the stability of the intermediate alkyl radicals.

NEET-Specific Angle

For NEET, focus on:

  • Trends in physical propertiesHow boiling point, melting point, and density change with chain length and branching. Be able to compare isomers.
  • Reagents and conditions for chemical reactionsKnow the specific catalysts, temperatures, and light requirements for reactions like halogenation, pyrolysis, isomerisation, and aromatization.
  • MechanismsWhile detailed mechanisms are less frequently asked, understanding the free radical nature of halogenation and the relative stability of alkyl radicals is crucial for predicting major products.
  • Product predictionGiven an alkane and reaction conditions, predict the major organic product, especially for halogenation (considering selectivity) and pyrolysis.
  • Nomenclature of productsBe able to name the haloalkanes or other products formed.
  • ApplicationsRelate properties to real-world uses (e.g., why branched alkanes are preferred in gasoline).

Key Concepts

Effect of Molecular Size and Branching on Boiling Point

The boiling point of alkanes is directly related to the strength of intermolecular van der Waals forces. As…

Free Radical Halogenation Mechanism

The halogenation of alkanes (e.g., with Cl2Cl_2 or Br2Br_2) under UV light or heat proceeds via a free radical…

Selectivity in Halogenation and Alkyl Radical Stability

In the free radical halogenation of alkanes with more than one type of hydrogen atom (primary, secondary,…

Often confused with

Side-by-side differences the NEET paper likes to test.

Physical and Chemical Properties vs Branched Alkanes
AspectPhysical and Chemical PropertiesBranched Alkanes
Boiling PointHigher (due to larger surface area for van der Waals forces)Lower (due to reduced surface area and more spherical shape)
Melting PointGenerally lower than highly symmetrical branched alkanes, but increases with chain lengthCan be higher for highly symmetrical branched alkanes due to efficient crystal packing, but generally increases with chain length
DensityIncreases with chain length, generally slightly higher for same carbon number due to tighter packingIncreases with chain length, generally slightly lower for same carbon number due to less efficient packing
Fuel Quality (Octane Number)Lower (tend to cause knocking in engines)Higher (burn more smoothly, less knocking)

Straight-chain alkanes, also known as n-alkanes, typically exhibit higher boiling points compared to their branched isomers of the same carbon count. This is attributed to their extended shape, which allows for greater surface area contact between molecules, leading to stronger intermolecular van der Waals forces.

Conversely, branched alkanes, being more compact and spherical, have reduced surface area, resulting in weaker intermolecular forces and thus lower boiling points. While melting points generally increase with chain length for both, highly symmetrical branched alkanes can sometimes have higher melting points due to more efficient crystal lattice packing.

Branched alkanes are also preferred in gasoline due to their higher octane number, indicating smoother combustion.

Why it is tested: For NEET, understanding the comparative physical properties, especially boiling points, between straight-chain and branched alkanes is crucial. Questions often test the ability to rank isomers based on their boiling points. The concept of octane number and why branched alkanes are superior fuels is also relevant, linking chemical properties to practical applications.

Questions students ask

5 answered on this topic.

Why are alkanes considered relatively unreactive?

Alkanes are considered relatively unreactive primarily because they consist only of strong, non-polar C-C and C-H single bonds. The small electronegativity difference between carbon and hydrogen means these bonds have very little polarity, making them resistant to attack by polar reagents like acids, bases, or oxidizing/reducing agents.

Additionally, the absence of pi bonds or lone pairs of electrons means there are no readily available sites for electrophilic or nucleophilic attack, contributing to their overall stability under normal conditions.

How does branching affect the boiling point of alkanes?

Branching in alkanes generally decreases their boiling point. This is because branching makes the molecule more compact and spherical, reducing its overall surface area. A smaller surface area leads to fewer points of contact between adjacent molecules, thereby weakening the intermolecular van der Waals (London Dispersion) forces. Less energy is then required to overcome these weaker forces, resulting in a lower boiling point compared to a straight-chain isomer of the same molecular formula.

What is the role of UV light or heat in the halogenation of alkanes?

UV light or heat provides the necessary energy for the initiation step of the free radical halogenation reaction. Specifically, it causes the homolytic cleavage of the halogen molecule (e.g., Cl2Cl_2 or Br2Br_2) into two highly reactive halogen free radicals. Without this initial energy input, the strong covalent bond in the halogen molecule would not break, and the chain reaction would not be able to start. It's a crucial condition for overcoming the activation energy barrier.

Why are alkanes insoluble in water but soluble in organic solvents?

Alkanes are non-polar molecules, while water is a highly polar solvent capable of extensive hydrogen bonding. According to the 'like dissolves like' principle, non-polar substances do not dissolve in polar solvents.

For an alkane to dissolve in water, the strong hydrogen bonds between water molecules would need to be broken, and the weak van der Waals forces between alkane and water molecules would not provide enough energy to compensate for this disruption.

Conversely, alkanes readily dissolve in non-polar organic solvents (like benzene or ether) because the intermolecular forces in both the alkane and the solvent are similar (van der Waals forces), making the mixing energetically favorable.

What is pyrolysis, and why is it important in the petroleum industry?

Pyrolysis, also known as cracking, is the process of heating larger alkane molecules to high temperatures (typically 400700C400-700^\circ C) in the absence of air, causing them to break down into smaller alkanes and alkenes.

This process is of immense industrial importance because it converts less valuable, long-chain hydrocarbons found in crude oil (like those in fuel oil or bitumen) into more valuable, shorter-chain hydrocarbons used as gasoline components (e.

g., C5C12C_5-C_{12} alkanes) and, crucially, into alkenes (e.g., ethene, propene) which are fundamental raw materials for the petrochemical industry, used in the production of plastics and other chemicals.

Revise in 30 seconds

  • General FormulaCnH2n+2C_nH_{2n+2}
  • Physical StateC1C4C_1-C_4 (gas), C5C17C_5-C_{17} (liquid), C18+C_{18+} (solid)
  • Boiling Point (BP)Increases with chain length. Decreases with branching.
  • Melting Point (MP)Increases with chain length. Can be higher for symmetrical branched alkanes.
  • DensityIncreases with chain length, less than water.
  • SolubilityInsoluble in water (non-polar), soluble in non-polar organic solvents.
  • CombustionCnH2n+2+(3n+12)O2nCO2+(n+1)H2OC_nH_{2n+2} + (\frac{3n+1}{2})O_2 \longrightarrow nCO_2 + (n+1)H_2O (Complete)
  • HalogenationFree radical substitution, X2X_2 (Cl, Br) + UV light/heat.

- Reactivity: F2>Cl2>Br2>I2F_2 > Cl_2 > Br_2 > I_2 - Selectivity: 3H>2H>1H3^\circ H > 2^\circ H > 1^\circ H (due to radical stability)

  • Pyrolysis (Cracking)High temp (400700C400-700^\circ C), no air. Larger alkanes \longrightarrow smaller alkanes + alkenes.
  • IsomerisationAlCl3/HClAlCl_3/HCl, 200C200^\circ C. n-alkane \longrightarrow branched alkane.
  • AromatizationC6+C_6+ alkane, Cr2O3/Al2O3Cr_2O_3/Al_2O_3, 500600C500-600^\circ C. Alkane \longrightarrow Aromatic compound.

To remember the reactivity order of hydrogens in halogenation: Three Seconds Pass. (Tertiary > Secondary > Primary)