Physical and Chemical Properties

Updated 22 Mar 2026

Amines, derived from ammonia by replacement of one or more hydrogen atoms by alkyl or aryl groups, exhibit a fascinating array of physical and chemical properties that are central to their diverse roles in organic chemistry and biological systems. Their fundamental properties are primarily governed by the presence of the nitrogen atom with its lone pair of electrons, which dictates their basicity,…

Quick Summary

Amines are organic compounds derived from ammonia, characterized by a nitrogen atom bonded to alkyl or aryl groups. Their physical properties are largely influenced by hydrogen bonding. Lower amines are gases with fishy odours, while higher ones are liquids or solids.

Primary (11^\circ) and secondary (22^\circ) amines can form intermolecular hydrogen bonds due to N-H bonds, leading to higher boiling points than tertiary (33^\circ) amines of similar molecular mass, which lack N-H bonds.

Lower amines are water-soluble due to hydrogen bonding with water. Chemically, amines are basic and nucleophilic because of the lone pair on nitrogen. Basicity is enhanced by electron-donating groups (alkyl groups) but reduced by resonance (aromatic amines).

In aqueous solution, solvation effects modify the basicity order. Amines undergo alkylation (forming higher amines and quaternary salts), acylation (forming amides), and specific reactions like the carbylamine test (for 11^\circ amines) and reactions with nitrous acid (differentiating 1,2,31^\circ, 2^\circ, 3^\circ amines).

Aromatic amines are highly activated towards electrophilic substitution, primarily at ortho and para positions, but require protection of the amino group to control substitution.

Full explanation

Amines are fundamental organic compounds, essentially derivatives of ammonia (NH3_3) where one, two, or all three hydrogen atoms are replaced by alkyl or aryl groups. Their properties are profoundly influenced by the nitrogen atom's lone pair of electrons and its electronegativity, leading to characteristic physical and chemical behaviors.

\n\nI. Physical Properties of Amines\n\n1. Physical State and Odour:\n * Lower aliphatic amines (e.g., methylamine, ethylamine) are gases at room temperature. They possess a characteristic 'fishy' or ammonia-like odour.

This odour becomes more pronounced and unpleasant with increasing molecular weight.\n Primary amines with three or more carbon atoms are liquids. Higher amines are solids.\n Aromatic amines, such as aniline, are typically colourless liquids or low-melting solids.

However, they are prone to oxidation upon exposure to air and light, which often causes them to turn dark or brownish.\n\n2. Boiling Points:\n * Amines generally have higher boiling points compared to non-polar compounds (like alkanes) of comparable molecular mass.

This is attributed to the presence of intermolecular hydrogen bonding.\n * Hydrogen Bonding: Primary (11^\circ) and secondary (22^\circ) amines have hydrogen atoms directly bonded to the electronegative nitrogen atom (N-H bonds).

This allows them to form intermolecular hydrogen bonds, albeit weaker than those formed by alcohols (O-H bonds) because nitrogen is less electronegative than oxygen. The strength of hydrogen bonding follows the order: Alcohols > Primary amines > Secondary amines.

\n * Tertiary (33^\circ) amines lack hydrogen atoms directly attached to nitrogen, so they cannot form intermolecular hydrogen bonds among themselves. Consequently, their boiling points are lower than those of 11^\circ and 22^\circ amines of comparable molecular mass.

However, 33^\circ amines can still act as hydrogen bond acceptors with protic solvents like water or alcohols.\n * Order of Boiling Points (for isomeric amines): 1>2>31^\circ > 2^\circ > 3^\circ. For example, among C4_4H9_9NH2_2 (butylamine), (C2_2H5_5)2_2NH (diethylamine), and (CH3_3)3_3N (trimethylamine), butylamine will have the highest boiling point, followed by diethylamine, and then trimethylamine.

\n\n3. Solubility in Water:\n * Lower molecular weight amines (up to 5-6 carbon atoms) are appreciably soluble in water. This solubility is due to their ability to form hydrogen bonds with water molecules.

The nitrogen atom's lone pair can accept hydrogen bonds from water, and the N-H hydrogens (in 11^\circ and 22^\circ amines) can donate hydrogen bonds to water oxygen.\n * As the size of the hydrophobic alkyl or aryl group increases, the extent of hydrogen bonding with water becomes less significant compared to the non-polar interactions, leading to a decrease in water solubility.

For instance, aniline is only sparingly soluble in water.\n * All amines are generally soluble in common organic solvents such as alcohol, ether, and benzene, due to similar intermolecular forces.\n\n**II.

Chemical Properties of Amines\n\nChemical properties of amines are primarily dictated by the lone pair of electrons on the nitrogen atom, making them basic and nucleophilic.\n\n1. Basicity of Amines:**\n * Amines are Brønsted-Lowry bases (proton acceptors) and Lewis bases (electron pair donors) due to the presence of the lone pair of electrons on the nitrogen atom.

They react with acids to form ammonium salts.\n * Factors Affecting Basicity:\n * Inductive Effect: Electron-donating groups (like alkyl groups) increase electron density on nitrogen, making the lone pair more available for protonation, thus increasing basicity.

Electron-withdrawing groups decrease basicity.\n * Resonance Effect: In aromatic amines (e.g., aniline), the lone pair on nitrogen is delocalized into the benzene ring through resonance. This delocalization makes the lone pair less available for protonation, significantly reducing basicity compared to aliphatic amines or ammonia.

\n * Steric Hindrance: In the gas phase, basicity order is 3>2>1>NH33^\circ > 2^\circ > 1^\circ > NH_3 due to the cumulative inductive effect. However, in aqueous solution, solvation effects play a crucial role.

The stability of the conjugate acid (ammonium ion) formed after protonation is enhanced by hydrogen bonding with water molecules. The more hydrogen atoms on the nitrogen of the ammonium ion, the more extensive the solvation.

This leads to a different order of basicity in aqueous solution:\n * For methyl-substituted amines: 2>1>3>NH32^\circ > 1^\circ > 3^\circ > NH_3 (e.g., (CH3_3)2_2NH > CH3_3NH2_2 > (CH3_3)3_3N > NH3_3)\n * For ethyl-substituted amines: 2>3>1>NH32^\circ > 3^\circ > 1^\circ > NH_3 (e.

g., (C2_2H5_5)2_2NH > (C2_2H5_5)3_3N > C2_2H5_5NH2_2 > NH3_3)\n The exact order depends on the balance between inductive effect, steric hindrance (which hinders solvation), and solvation effects.

Generally, secondary amines are the strongest bases in aqueous solution.\n\n2. Alkylation (Reaction with Alkyl Halides):\n * Amines act as nucleophiles and react with alkyl halides (R-X) in a nucleophilic substitution (SN_N2) reaction.

This reaction is known as Hofmann Ammonolysis.\n * A primary amine (11^\circ) reacts with an alkyl halide to form a secondary amine (22^\circ). The 22^\circ amine can further react to form a tertiary amine (33^\circ), and finally, a quaternary ammonium salt.

\n * Example: RNH2+RXRNHR+HXR2NR+HXR3NR+HXR3N+RXRNH_2 + R'X \rightarrow RNHR' + HX \rightarrow R_2NR' + HX \rightarrow R_3NR' + HX \rightarrow R_3N^+R'X^- (Quaternary ammonium salt)\n * This reaction often leads to a mixture of products (2,32^\circ, 3^\circ amines, and quaternary salts), making it less suitable for preparing specific higher amines.

To favor the formation of a primary amine, a large excess of ammonia can be used.\n\n3. Acylation (Reaction with Acid Chlorides, Anhydrides, Esters):\n * Primary and secondary amines react with acid chlorides, acid anhydrides, or esters to form amides.

This reaction involves the nucleophilic attack of the amine nitrogen on the carbonyl carbon, followed by the elimination of a leaving group.\n * Reaction with Acid Chlorides: RNH2+RCOClRNHCOR+HClRNH_2 + R'COCl \rightarrow RNHCOR' + HCl (Amide)\n * Reaction with Acid Anhydrides: RNH2+(RCO)2ORNHCOR+RCOOHRNH_2 + (R'CO)_2O \rightarrow RNHCOR' + R'COOH\n * Tertiary amines do not undergo acylation because they lack a replaceable hydrogen atom on the nitrogen atom.

\n * Aromatic amines also undergo acylation. For example, aniline reacts with acetyl chloride to form acetanilide.\n\n4. Carbylamine Reaction (Isocyanide Test):\n * This reaction is a characteristic test for primary amines (both aliphatic and aromatic).

When a primary amine is heated with chloroform (CHCl3_3) and an alcoholic solution of potassium hydroxide (KOH), it forms an isocyanide (or carbylamine), which has a highly offensive smell.\n * RNH2+CHCl3+3KOHheatRNC+3KCl+3H2ORNH_2 + CHCl_3 + 3KOH \xrightarrow{\text{heat}} R-NC + 3KCl + 3H_2O\n * Secondary and tertiary amines do not give this reaction.

\n\n5. **Reaction with Nitrous Acid (HNO2_2):**\n * Nitrous acid is unstable and is usually generated in situ by mixing sodium nitrite (NaNO2_2) and dilute hydrochloric acid (HCl) at low temperatures (0-5 ^\circC).

\n * Primary Aliphatic Amines: React with nitrous acid to form highly unstable aliphatic diazonium salts, which immediately decompose to form alcohols with the evolution of nitrogen gas. This is a useful method for converting 11^\circ amines to alcohols.

\n RNH2+HNO205C[RN2+Cl]ROH+N2+HClRNH_2 + HNO_2 \xrightarrow{0-5^\circ C} [R-N_2^+Cl^-] \rightarrow ROH + N_2 \uparrow + HCl\n * Primary Aromatic Amines: React with nitrous acid at low temperatures (0-5 ^\circC) to form relatively stable aromatic diazonium salts.

These diazonium salts are important intermediates in organic synthesis (e.g., Sandmeyer reaction, Gattermann reaction, coupling reactions).\n ArNH2+HNO205CArN2+Cl+2H2OArNH_2 + HNO_2 \xrightarrow{0-5^\circ C} Ar-N_2^+Cl^- + 2H_2O\n * Secondary Amines (Aliphatic and Aromatic): React with nitrous acid to form N-nitrosoamines (yellow oily compounds).

These compounds are generally carcinogenic.\n R2NH+HNO2R2NN=O+H2OR_2NH + HNO_2 \rightarrow R_2N-N=O + H_2O\n * Tertiary Aliphatic Amines: React with nitrous acid to form trialkylammonium nitrite salts.\n R3N+HNO2R3NH+NO2R_3N + HNO_2 \rightarrow R_3NH^+NO_2^- (salt)\n * Tertiary Aromatic Amines: Undergo electrophilic substitution at the para position (if available) to form p-nitroso-N,N-dialkylaniline.

\n\n6. Electrophilic Substitution (for Aromatic Amines):\n * The amino group (NH2-NH_2) in aromatic amines (like aniline) is a powerful activating group and an ortho-para director due to the resonance effect, which increases electron density at these positions.

\n * Bromination: Aniline reacts with bromine water at room temperature to give 2,4,6-tribromoaniline as a white precipitate. The activating effect is so strong that all three ortho and para positions are substituted.

\n C6H5NH2+3Br2H2OC6H2(Br)3NH2+3HBrC_6H_5NH_2 + 3Br_2 \xrightarrow{H_2O} C_6H_2(Br)_3NH_2 + 3HBr\n * To obtain monobrominated aniline, the activating effect of the amino group must be reduced. This is achieved by acetylation (acylation with acetic anhydride) to form acetanilide.

The lone pair on nitrogen is then delocalized into both the benzene ring and the carbonyl group, reducing its activating power. After bromination, the acetyl group can be hydrolyzed back to the amino group.

\n * Nitration: Direct nitration of aniline with nitrating mixture (conc. HNO3_3 + conc. H2_2SO4_4) yields a mixture of ortho, meta, and para products, with a significant amount of meta-nitroaniline (around 47%) due to the formation of anilinium ion (C6H5NH3+C_6H_5NH_3^+) in strongly acidic medium, which is meta-directing and deactivating.

To obtain para-nitroaniline as the major product, the amino group is protected by acetylation first.\n * Sulphonation: Aniline reacts with concentrated sulphuric acid to form anilinium hydrogen sulphate, which on heating to 453-473 K produces sulphanilic acid (p-aminobenzenesulphonic acid).

Sulphanilic acid exists as a zwitterion.\n\n7. Oxidation:\n * Amines are susceptible to oxidation. Primary and secondary amines can be oxidized to various products depending on the oxidizing agent and conditions.

For example, primary amines can be oxidized to nitroso compounds, nitro compounds, or even carboxylic acids.\n * Aromatic amines, especially aniline, are readily oxidized in air, leading to the formation of coloured products (often dark brown or black) due to complex polymerization reactions.

This is why aniline should be stored in dark, airtight bottles.

Key Concepts

Basicity in Aqueous Solution

The basicity of amines in aqueous solution is a complex interplay of three factors: the electron-donating…

Acylation of Amines

Acylation is a nucleophilic acyl substitution reaction where primary and secondary amines react with…

Reaction with Nitrous Acid for Differentiation

The reaction with nitrous acid (HNO2_2), typically generated *in situ* from NaNO2_2 and HCl at 0-5…

Often confused with

Side-by-side differences the NEET paper likes to test.

Physical and Chemical Properties vs Primary, Secondary, and Tertiary Amines
AspectPhysical and Chemical PropertiesPrimary, Secondary, and Tertiary Amines
StructurePrimary (1°) Amine: One alkyl/aryl group attached to nitrogen (R-NH₂)Secondary (2°) Amine: Two alkyl/aryl groups attached to nitrogen (R₂NH)
Hydrogen Bonding (Intermolecular)Strongest (two N-H bonds)Moderate (one N-H bond)
Boiling Point (for isomers)HighestIntermediate
Solubility in WaterMost soluble (due to two H-bond donor sites)Moderately soluble (one H-bond donor site)
Basicity (Aqueous Solution, e.g., methylamines)Intermediate (e.g., CH₃NH₂)Strongest (e.g., (CH₃)₂NH)
Carbylamine ReactionPositive (forms foul-smelling isocyanide)Negative
Reaction with Nitrous Acid (HNO₂)Aliphatic: N₂ gas evolution, alcohol formation. Aromatic: Stable diazonium salt.Forms N-nitrosoamine (yellow oily layer).
AcylationUndergoes acylation to form N-substituted amides.Undergoes acylation to form N,N-disubstituted amides.

The classification of amines into primary, secondary, and tertiary is based on the number of alkyl or aryl groups attached to the nitrogen atom. This structural difference profoundly impacts their physical properties, particularly boiling points and solubility, due to varying abilities to form intermolecular hydrogen bonds.

Chemically, their reactivity, especially basicity, nucleophilicity, and characteristic reactions like the carbylamine test and reaction with nitrous acid, are distinctly different across the three classes.

Understanding these distinctions is crucial for identifying amines and designing synthetic routes in organic chemistry, making it a frequently tested concept in NEET.

Why it is tested: This comparison is highly relevant for NEET as it forms the basis for distinguishing between different types of amines using chemical tests and for predicting their relative physical properties. Questions often involve identifying an unknown amine based on its reaction with specific reagents or ranking amines by boiling point or basicity. A clear understanding of these differences is essential for solving both conceptual and reaction-based problems.

Questions students ask

6 answered on this topic.

Why are amines basic in nature?

Amines are basic due to the presence of a lone pair of electrons on the nitrogen atom. This lone pair can readily accept a proton (H+^+) from an acid, acting as a Brønsted-Lowry base, or donate an electron pair to a Lewis acid, acting as a Lewis base.

The availability of this lone pair is crucial for their basicity. Factors like inductive effects from alkyl groups (electron-donating) increase electron density on nitrogen, enhancing basicity, while resonance effects (as in aromatic amines) delocalize the lone pair, reducing its availability and thus decreasing basicity.

Explain the order of basicity of primary, secondary, and tertiary amines in the gas phase versus aqueous solution.

In the gas phase, basicity is solely determined by the inductive effect of alkyl groups. Alkyl groups are electron-donating, increasing electron density on nitrogen and stabilizing the positive charge on the conjugate acid.

Thus, the order is 3>2>1>NH33^\circ > 2^\circ > 1^\circ > NH_3. In aqueous solution, solvation effects (hydrogen bonding with water) also play a significant role. The conjugate acid (ammonium ion) is stabilized by hydrogen bonding.

Primary ammonium ions can form more hydrogen bonds than secondary, which form more than tertiary. This solvation effect counteracts steric hindrance and inductive effects, leading to a typical order of 2>1>3>NH32^\circ > 1^\circ > 3^\circ > NH_3 for methylamines, and 2>3>1>NH32^\circ > 3^\circ > 1^\circ > NH_3 for ethylamines.

Why do primary and secondary amines have higher boiling points than tertiary amines of comparable molecular mass?

Primary (11^\circ) and secondary (22^\circ) amines possess hydrogen atoms directly attached to the electronegative nitrogen atom (N-H bonds). This allows them to form intermolecular hydrogen bonds with each other.

These hydrogen bonds require additional energy to break, leading to higher boiling points. Tertiary (33^\circ) amines, however, do not have any hydrogen atoms directly bonded to nitrogen. Therefore, they cannot form intermolecular hydrogen bonds among themselves, resulting in weaker intermolecular forces (only van der Waals forces) and consequently lower boiling points compared to 11^\circ and 22^\circ amines of similar molecular mass.

What is the carbylamine reaction and what is its significance?

The carbylamine reaction, also known as the isocyanide test, is a distinguishing chemical test specifically for primary amines (both aliphatic and aromatic). In this reaction, a primary amine is heated with chloroform (CHCl3_3) and an alcoholic solution of potassium hydroxide (KOH) to produce an isocyanide (R-NC).

Isocyanides are characterized by their extremely foul and offensive odour. The significance of this reaction lies in its selectivity; secondary and tertiary amines do not undergo this reaction, making it a valuable tool for identifying the presence of a primary amino group in an unknown compound.

How does the amino group influence electrophilic substitution in aromatic amines like aniline?

The amino (NH2-NH_2) group is a powerful activating group and an ortho-para director in electrophilic aromatic substitution reactions. This is due to the resonance effect, where the lone pair of electrons on the nitrogen atom is delocalized into the benzene ring, increasing electron density particularly at the ortho and para positions.

This makes these positions highly susceptible to attack by electrophiles. However, the strong activation can lead to polysubstitution (e.g., tribromination with bromine water). Also, in acidic conditions, the amino group can be protonated to form the anilinium ion (NH3+-NH_3^+), which is deactivating and meta-directing, complicating reactions like nitration.

Why are aromatic amines generally weaker bases than aliphatic amines?

Aromatic amines are significantly weaker bases than aliphatic amines due to the resonance effect. In aromatic amines, the lone pair of electrons on the nitrogen atom is involved in resonance with the benzene ring.

This delocalization of the lone pair makes it less available for protonation. In contrast, in aliphatic amines, the lone pair is localized on the nitrogen and is made even more available by the electron-donating inductive effect of alkyl groups.

The reduced availability of the lone pair in aromatic amines means they are less capable of accepting a proton, hence their weaker basicity.

Revise in 30 seconds

  • Basicity:Lone pair on N. Aliphatic > NH3_3 > Aromatic. Aqueous basicity: 2>1>32^\circ > 1^\circ > 3^\circ (methyl), 2>3>12^\circ > 3^\circ > 1^\circ (ethyl). Aromatic amines are weaker due to resonance.\n- Boiling Point: 1>2>31^\circ > 2^\circ > 3^\circ (isomeric) due to H-bonding. Alcohols > Amines.\n- Solubility: Lower amines water soluble due to H-bonding with water.\n- Carbylamine Test: Only 11^\circ amines (R-NH2_2) CHCl3,KOH\xrightarrow{CHCl_3, KOH} R-NC (foul smell).\n- **Nitrous Acid (HNO2_2, 0-5 ^\circC):**\n * 11^\circ Aliphatic: ROH + N2_2 gas.\n * 11^\circ Aromatic: Ar-N2+_2^+Cl^- (stable diazonium salt).\n * 22^\circ: R2_2N-N=O (N-nitrosoamine, yellow oily).\n * 33^\circ Aliphatic: R3_3NH+^+NO2_2^- (salt).\n- Acylation: 1,21^\circ, 2^\circ amines RCOCl/(RCO)2O\xrightarrow{R'COCl / (R'CO)_2O} Amides. 33^\circ amines do not react.\n- Alkylation: RNH2RXRNH_2 \xrightarrow{R'X} RNHRRXRNHR' \xrightarrow{R'X} R2NRRXR_2NR' \xrightarrow{R'X} R3N+RXR_3N^+R'X^-. (Mixture of products).\n- Electrophilic Substitution (Aromatic Amines): NH2-NH_2 is strong activating, ortho-para director. Polysubstitution (e.g., tribromination). Protection (acetylation) needed for mono-substitution.

To remember the basicity order of methylamines in water: Secondary Primary Tertiary Ammonia (SPT A) - (CH3_3)2_2NH > CH3_3NH2_2 > (CH3_3)3_3N > NH3_3. \n\nFor Nitrous Acid reactions: 1Alcohol, 1Aromatic Diazonium, 2Nitroso, 3Salt.

\n* 1Alcohol: 11^\circ Aliphatic \rightarrow Alcohol + N2_2 gas. \n* 1Aromatic Diazonium: 11^\circ Aromatic \rightarrow Diazonium salt. \n* 2Nitroso: 22^\circ Amine \rightarrow N-nitrosoamine (yellow oil).

\n* 3Salt: 33^\circ Aliphatic \rightarrow Ammonium Salt.