Chemistry

Stoichiometry and Stoichiometric Calculations

Chemistry·MCQ Practice

Theoretical and Percentage Yield — MCQ Practice

NEET UG
Version 1Updated 21 Mar 2026

Interactive MCQ Practice

Test your knowledge. Click “Solve” to reveal options, select your answer, then check the result. 7 questions available.

Q1medium

Consider the reaction: 2Al(s)+3Cl2(g)2AlCl3(s)2Al(s) + 3Cl_2(g) \rightarrow 2AlCl_3(s). If 54,g54,\text{g} of Aluminum reacts with 71,g71,\text{g} of Chlorine, and 100,g100,\text{g} of Aluminum chloride is actually produced, what is the percentage yield of the reaction? (Atomic masses: Al = 27,g/mol27,\text{g/mol}, Cl = 35.5,g/mol35.5,\text{g/mol})

Q2medium

In the reaction C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l), if 22,g22,\text{g} of propane (C3H8C_3H_8) reacts with 96,g96,\text{g} of oxygen (O2O_2), what is the theoretical yield of carbon dioxide (CO2CO_2) in grams? (Atomic masses: C = 12,g/mol12,\text{g/mol}, H = 1,g/mol1,\text{g/mol}, O = 16,g/mol16,\text{g/mol})

Q3easy

If the theoretical yield of a reaction is 150,g150,\text{g} and the actual yield obtained is 120,g120,\text{g}, what is the percentage yield?

Q4medium

Which of the following factors would NOT typically lead to an actual yield being lower than the theoretical yield?

Q5hard

For the reaction Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)Fe_2O_3(s) + 3CO(g) \rightarrow 2Fe(s) + 3CO_2(g), if 160,g160,\text{g} of Fe2O3Fe_2O_3 reacts with 84,g84,\text{g} of COCO, and the percentage yield is 75%75\%, what is the actual mass of Fe produced? (Atomic masses: Fe = 56,g/mol56,\text{g/mol}, O = 16,g/mol16,\text{g/mol}, C = 12,g/mol12,\text{g/mol})

Q6easy

Which statement best describes the relationship between theoretical yield and actual yield?

Q7easy

A student performs a reaction where the theoretical yield of product X is 20.0,g20.0,\text{g}. If the student achieves a percentage yield of 90.0%90.0\%, what mass of product X did they actually obtain?

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.