Chemistry·MCQ Practice

Enthalpy — MCQ Practice

NEET UG
Updated 22 Mar 2026

Interactive MCQ Practice

Test your knowledge. Click “Solve” to reveal options, select your answer, then check the result. 7 questions available.

Q1medium

For the reaction 2SO2(g)+O2(g)2SO3(g)2SO_2(g) + O_2(g) \rightarrow 2SO_3(g), if ΔH=198kJ\Delta H = -198\,\text{kJ} at 298K298\,\text{K}, what is the value of ΔU\Delta U for the reaction at the same temperature? (Given R=8.314J mol1K1R = 8.314\,\text{J mol}^{-1}\text{K}^{-1})

Q2easy

Which of the following statements about enthalpy is INCORRECT?

Q3medium

Given the following standard enthalpies of formation:\nΔHf(C2H4(g))=+52.3kJ mol1\Delta H_f^\circ (C_2H_4(g)) = +52.3\,\text{kJ mol}^{-1}\nΔHf(CO2(g))=393.5kJ mol1\Delta H_f^\circ (CO_2(g)) = -393.5\,\text{kJ mol}^{-1}\nΔHf(H2O(l))=285.8kJ mol1\Delta H_f^\circ (H_2O(l)) = -285.8\,\text{kJ mol}^{-1}\nCalculate the standard enthalpy of combustion (ΔHc\Delta H_c^\circ) for ethene (C2H4(g)C_2H_4(g)).

Q4easy

Which of the following processes is associated with a positive ΔH\Delta H?

Q5medium

The enthalpy of vaporization of water at 100°C100\,\text{°C} is 40.66kJ mol140.66\,\text{kJ mol}^{-1}. Calculate the internal energy change (ΔU\Delta U) when one mole of water is vaporized at 100°C100\,\text{°C} and 1atm1\,\text{atm} pressure. (Assume ideal gas behavior for steam, R=8.314J mol1K1R = 8.314\,\text{J mol}^{-1}\text{K}^{-1})

Q6hard

Given the following reactions:\n1. C(s)+O2(g)CO2(g)C(s) + O_2(g) \rightarrow CO_2(g), ΔH1=393.5kJ\Delta H_1 = -393.5\,\text{kJ}\n2. H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2}O_2(g) \rightarrow H_2O(l), ΔH2=285.8kJ\Delta H_2 = -285.8\,\text{kJ}\n3. C2H6(g)+72O2(g)2CO2(g)+3H2O(l)C_2H_6(g) + \frac{7}{2}O_2(g) \rightarrow 2CO_2(g) + 3H_2O(l), ΔH3=1560.0kJ\Delta H_3 = -1560.0\,\text{kJ}\nCalculate the standard enthalpy of formation of ethane (C2H6(g)C_2H_6(g)).

Q7medium

Which of the following conditions would lead to ΔH=ΔU\Delta H = \Delta U for a chemical reaction?