Chemistry·Prelims Questions

Hess's Law of Constant Heat Summation — Prelims Questions

NEET UG
Version 1Updated 22 Mar 2026
Q1medium

Given the following thermochemical equations: 1. C(s)+O2(g)CO2(g)C(s) + O_2(g) \to CO_2(g), ΔH1=393.5 kJ\Delta H_1 = -393.5 \text{ kJ} 2. H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2}O_2(g) \to H_2O(l), ΔH2=285.8 kJ\Delta H_2 = -285.8 \text{ kJ} 3. CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \to CO_2(g) + 2H_2O(l), ΔH3=890.3 kJ\Delta H_3 = -890.3 \text{ kJ} Calculate the standard enthalpy of formation of methane, CH4(g)CH_4(g), i.e., ΔHf\Delta H_f^\circ for the reaction: C(s)+2H2(g)CH4(g)C(s) + 2H_2(g) \to CH_4(g).

Q2easy

Which of the following statements about Hess's Law is INCORRECT?

Q3hard

Given the following standard enthalpy of combustion values: ΔHc(C2H6(g))=1560 kJ/mol\Delta H_c^\circ (C_2H_6(g)) = -1560 \text{ kJ/mol} ΔHc(C(s))=393.5 kJ/mol\Delta H_c^\circ (C(s)) = -393.5 \text{ kJ/mol} ΔHc(H2(g))=285.8 kJ/mol\Delta H_c^\circ (H_2(g)) = -285.8 \text{ kJ/mol} Calculate the standard enthalpy of formation of ethane, C2H6(g)C_2H_6(g).

Q4medium

Given the following reactions: 1. S(s)+O2(g)SO2(g)S(s) + O_2(g) \to SO_2(g), ΔH1=296.8 kJ\Delta H_1 = -296.8 \text{ kJ} 2. SO2(g)+12O2(g)SO3(g)SO_2(g) + \frac{1}{2}O_2(g) \to SO_3(g), ΔH2=98.9 kJ\Delta H_2 = -98.9 \text{ kJ} Calculate the enthalpy change for the reaction: 2S(s)+3O2(g)2SO3(g)2S(s) + 3O_2(g) \to 2SO_3(g).

Q5easy

The standard enthalpy of formation of NH3(g)NH_3(g) is 46.1 kJ/mol-46.1 \text{ kJ/mol}. What is the enthalpy change for the decomposition of 2 moles2 \text{ moles} of NH3(g)NH_3(g) into its elements?

Q6hard

Given: C2H4(g)+3O2(g)2CO2(g)+2H2O(l)C_2H_4(g) + 3O_2(g) \to 2CO_2(g) + 2H_2O(l), ΔH=1411 kJ\Delta H = -1411 \text{ kJ} C2H6(g)+72O2(g)2CO2(g)+3H2O(l)C_2H_6(g) + \frac{7}{2}O_2(g) \to 2CO_2(g) + 3H_2O(l), ΔH=1560 kJ\Delta H = -1560 \text{ kJ} H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2}O_2(g) \to H_2O(l), ΔH=285.8 kJ\Delta H = -285.8 \text{ kJ} Calculate the enthalpy change for the hydrogenation of ethene: C2H4(g)+H2(g)C2H6(g)C_2H_4(g) + H_2(g) \to C_2H_6(g).

Q7medium

The enthalpy of combustion of C(s)C(s) is 393.5 kJ/mol-393.5 \text{ kJ/mol}. The enthalpy of combustion of CO(g)CO(g) is 283.0 kJ/mol-283.0 \text{ kJ/mol}. What is the enthalpy of formation of CO(g)CO(g)?

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.