Chemistry·MCQ Practice

Equilibrium Constant — MCQ Practice

NEET UG
Version 1Updated 22 Mar 2026

Interactive MCQ Practice

Test your knowledge. Click “Solve” to reveal options, select your answer, then check the result. 7 questions available.

Q1medium

For the reaction 2SO2(g)+O2(g)2SO3(g)2SO_2(g) + O_2(g) \rightleftharpoons 2SO_3(g), at 727circC727^circ C, the equilibrium concentrations are [SO2]=0.60,M[SO_2] = 0.60,\text{M}, [O2]=0.82,M[O_2] = 0.82,\text{M}, and [SO3]=1.90,M[SO_3] = 1.90,\text{M}. Calculate the value of the equilibrium constant, KcK_c, for this reaction.

Q2medium

For the reaction N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g), the value of KcK_c is 0.061,M20.061,\text{M}^{-2} at 500,K500,\text{K}. What is the value of KpK_p for this reaction at the same temperature? (Given R=0.0821,L atm mol1 K1R = 0.0821,\text{L atm mol}^{-1}\text{ K}^{-1})

Q3medium

For the reaction A(g)+B(g)C(g)A(g) + B(g) \rightleftharpoons C(g), if the initial concentrations are [A]=2.0,M[A] = 2.0,\text{M} and [B]=1.0,M[B] = 1.0,\text{M}, and at equilibrium, [C]=0.8,M[C] = 0.8,\text{M}. What is the value of KcK_c?

Q4medium

For the reaction 2NOCl(g)2NO(g)+Cl2(g)2NOCl(g) \rightleftharpoons 2NO(g) + Cl_2(g), the value of KcK_c is 4.0×104,M4.0 \times 10^{-4},\text{M} at 25circC25^circ C. If at a certain moment, the concentrations are [NOCl]=0.2,M[NOCl] = 0.2,\text{M}, [NO]=0.01,M[NO] = 0.01,\text{M}, and [Cl2]=0.01,M[Cl_2] = 0.01,\text{M}, in which direction will the reaction proceed?

Q5easy

Which of the following statements about the equilibrium constant (KK) is INCORRECT?

Q6easy

For the reaction C(s)+H2O(g)CO(g)+H2(g)C(s) + H_2O(g) \rightleftharpoons CO(g) + H_2(g), which of the following is the correct expression for KpK_p?

Q7hard

If the equilibrium constant KcK_c for the reaction A+BCA + B \rightleftharpoons C is 2.02.0, what is the equilibrium constant for the reaction 2C2A+2B2C \rightleftharpoons 2A + 2B?

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.