Chemistry·Explained

Equilibrium — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

The concept of equilibrium is a cornerstone of chemistry, providing insights into the extent to which reactions proceed and how they respond to external influences. It's not just about reactions stopping; it's about a dynamic balance where opposing processes occur at equal rates.

Conceptual Foundation: Reversible Reactions and Dynamic Equilibrium

Chemical reactions can be broadly classified into two types: irreversible and reversible.

    1
  1. Irreversible Reactions:These reactions proceed predominantly in one direction, from reactants to products, until one of the reactants is consumed. They are often characterized by the formation of a precipitate, gas evolution that escapes the system, or a highly exothermic process. For example, the combustion of methane: CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(l).
    1
  1. Reversible Reactions:These reactions can proceed in both forward and reverse directions. Products can react to reform reactants. They are denoted by a double arrow (\rightleftharpoons) between reactants and products. For example, the formation of ammonia in the Haber process: N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g).

Dynamic Equilibrium: In a reversible reaction, when reactants are mixed, the forward reaction begins. As products accumulate, the reverse reaction starts. Over time, the rate of the forward reaction decreases (as reactant concentrations fall), and the rate of the reverse reaction increases (as product concentrations rise).

Eventually, a state is reached where the rate of the forward reaction becomes exactly equal to the rate of the reverse reaction. This is dynamic equilibrium. At this point, the net change in concentrations of reactants and products is zero, but the reactions are still occurring continuously at the molecular level.

Macroscopic properties like color, pressure, and concentration remain constant.

Key Principles and Laws Governing Equilibrium

1. Law of Mass Action and Equilibrium Constant

The Law of Mass Action, proposed by Guldberg and Waage, states that at a given temperature, the rate of a chemical reaction is directly proportional to the product of the molar concentrations of the reactants, each raised to the power of its stoichiometric coefficient in the balanced chemical equation.

For a general reversible reaction: aA+bBcC+dDaA + bB \rightleftharpoons cC + dD

  • Rate of forward reaction (RfR_f) =kf[A]a[B]b= k_f[A]^a[B]^b
  • Rate of reverse reaction (RrR_r) =kr[C]c[D]d= k_r[C]^c[D]^d

At equilibrium, Rf=RrR_f = R_r, so kf[A]a[B]b=kr[C]c[D]dk_f[A]^a[B]^b = k_r[C]^c[D]^d. Rearranging this, we get: kfkr=[C]c[D]d[A]a[B]b\frac{k_f}{k_r} = \frac{[C]^c[D]^d}{[A]^a[B]^b}

The ratio of the rate constants, kf/krk_f/k_r, is defined as the equilibrium constant, KcK_c (when concentrations are in molarity).

Kc=[C]c[D]d[A]a[B]bK_c = \frac{[C]^c[D]^d}{[A]^a[B]^b}

  • Equilibrium Constant in terms of Partial Pressures ($K_p$):For reactions involving gases, it's often more convenient to express concentrations in terms of partial pressures. For the same reaction:

Kp=(PC)c(PD)d(PA)a(PB)bK_p = \frac{(P_C)^c(P_D)^d}{(P_A)^a(P_B)^b}

  • Relationship between $K_c$ and $K_p$:Assuming ideal gas behavior, PV=nRTP=(n/V)RT=CRTPV = nRT \Rightarrow P = (n/V)RT = CRT. Substituting partial pressures with molar concentrations:

Kp=Kc(RT)ΔngK_p = K_c(RT)^{\Delta n_g}
where Δng=(c+d)(a+b)\Delta n_g = (c+d) - (a+b) is the change in the number of moles of gaseous products minus gaseous reactants.

Characteristics of Equilibrium Constant:

  • It is constant for a given reaction at a specific temperature, regardless of initial concentrations.
  • Its value indicates the extent of the reaction at equilibrium. A large KK means products are favored; a small KK means reactants are favored.
  • If the reaction is reversed, the new KK' is 1/K1/K.
  • If the reaction is multiplied by a factor 'n', the new KK'' is KnK^n.
  • If reactions are added, their equilibrium constants are multiplied.
  • Pure solids and liquids do not appear in the equilibrium constant expression because their concentrations are considered constant.

2. Le Chatelier's Principle

This principle states that if a change of condition is applied to a system in equilibrium, the system will shift in a direction that relieves the stress. The 'stress' can be a change in concentration, pressure, or temperature.

  • Effect of Concentration Change:Adding a reactant shifts the equilibrium to the right (towards products) to consume the added reactant. Removing a product shifts it to the right to replenish the product. Conversely, removing a reactant or adding a product shifts it to the left (towards reactants).
  • Effect of Pressure Change:This applies only to reactions involving gases where Δng0\Delta n_g \neq 0.

* Increasing pressure (by decreasing volume) shifts the equilibrium towards the side with fewer moles of gas to reduce the pressure. * Decreasing pressure (by increasing volume) shifts the equilibrium towards the side with more moles of gas. * If Δng=0\Delta n_g = 0, pressure change has no effect.

  • Effect of Temperature Change:This is the only factor that changes the value of the equilibrium constant (KK).

* For endothermic reactions (ΔH>0\Delta H > 0, heat is a reactant): Increasing temperature shifts equilibrium to the right (favors products), increasing KK. Decreasing temperature shifts it to the left. * For exothermic reactions (ΔH<0\Delta H < 0, heat is a product): Increasing temperature shifts equilibrium to the left (favors reactants), decreasing KK. Decreasing temperature shifts it to the right.

  • Effect of Adding an Inert Gas:

* At constant volume: Adding an inert gas does not change the partial pressures of reactants/products, so no effect on equilibrium. * At constant pressure: Adding an inert gas increases the total volume, decreasing partial pressures of reactants/products. This is similar to decreasing pressure, so the equilibrium shifts towards the side with more moles of gas.

  • Effect of Catalyst:A catalyst increases the rates of both forward and reverse reactions equally. It helps the system reach equilibrium faster but does not change the equilibrium position or the value of KK.

Types of Equilibrium

    1
  1. Homogeneous Equilibrium:All reactants and products are in the same physical phase (e.g., all gases or all liquids).

Example: N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g)

    1
  1. Heterogeneous Equilibrium:Reactants and products are in different physical phases.

Example: CaCO3(s)CaO(s)+CO2(g)CaCO_3(s) \rightleftharpoons CaO(s) + CO_2(g) Note: Concentrations of pure solids and liquids are constant and are not included in the KK expression. For the example above, Kc=[CO2]K_c = [CO_2] and Kp=PCO2K_p = P_{CO_2}.

Ionic Equilibrium

This branch deals with the equilibrium established in solutions of electrolytes (acids, bases, salts) where ions are involved.

1. Acids and Bases

  • Arrhenius Concept:Acids produce H+H^+ ions in water; bases produce OHOH^- ions in water.
  • Brønsted-Lowry Concept:Acids are proton (H+H^+) donors; bases are proton acceptors. This introduces conjugate acid-base pairs.

Example: HCl+H2OH3O++ClHCl + H_2O \rightleftharpoons H_3O^+ + Cl^-. Here, HClHCl is an acid, H2OH_2O is a base. H3O+H_3O^+ is the conjugate acid of H2OH_2O, and ClCl^- is the conjugate base of HClHCl.

  • Lewis Concept:Acids are electron pair acceptors; bases are electron pair donors. This is the broadest definition.

2. Ionization of Weak Acids and Bases

Weak acids and bases only partially ionize in water, establishing an equilibrium.

  • For a weak acid, HAH++AHA \rightleftharpoons H^+ + A^-, the acid dissociation constant is Ka=[H+][A][HA]K_a = \frac{[H^+][A^-]}{[HA]}.
  • For a weak base, BOHB++OHBOH \rightleftharpoons B^+ + OH^-, the base dissociation constant is Kb=[B+][OH][BOH]K_b = \frac{[B^+][OH^-]}{[BOH]}.
  • The strength of an acid/base is inversely related to its pKapK_a or pKbpK_b (pKa=logKapK_a = -logK_a, pKb=logKbpK_b = -logK_b). Smaller pKapK_a means stronger acid.

3. pH Scale

  • pH is a measure of the acidity or alkalinity of an aqueous solution: pH=log[H+]pH = -log[H^+].
  • Similarly, pOH=log[OH]pOH = -log[OH^-].
  • At 25circC25^circ C, pH+pOH=14pH + pOH = 14. Also, the ion product of water, Kw=[H+][OH]=1.0×1014K_w = [H^+][OH^-] = 1.0 \times 10^{-14}.

4. Common Ion Effect

The suppression of the dissociation of a weak electrolyte (acid or base) by the addition of a strong electrolyte containing a common ion. For example, adding HClHCl (strong acid) to a solution of CH3COOHCH_3COOH (weak acid) suppresses the dissociation of CH3COOHCH_3COOH, shifting its equilibrium to the left.

5. Buffer Solutions

Solutions that resist changes in pH upon the addition of small amounts of acid or base. They typically consist of a weak acid and its conjugate base (e.g., CH3COOH/CH3COOCH_3COOH/CH_3COO^-) or a weak base and its conjugate acid (e.g., NH4OH/NH4+NH_4OH/NH_4^+).

  • Henderson-Hasselbalch Equation (for acidic buffer):pH=pKa+log[Salt][Acid]pH = pK_a + log\frac{[Salt]}{[Acid]}
  • Henderson-Hasselbalch Equation (for basic buffer):pOH=pKb+log[Salt][Base]pOH = pK_b + log\frac{[Salt]}{[Base]}

6. Solubility Product ($K_{sp}$)

For sparingly soluble ionic compounds, an equilibrium exists between the undissolved solid and its ions in a saturated solution. The solubility product constant (KspK_{sp}) is the product of the molar concentrations of the ions, each raised to the power of its stoichiometric coefficient, at equilibrium. Example: For AgCl(s)Ag+(aq)+Cl(aq)AgCl(s) \rightleftharpoons Ag^+(aq) + Cl^-(aq), Ksp=[Ag+][Cl]K_{sp} = [Ag^+][Cl^-].

  • If ionic product (QspQ_{sp}) < KspK_{sp}, solution is unsaturated, no precipitation.
  • If QspQ_{sp} = KspK_{sp}, solution is saturated, equilibrium.
  • If QspQ_{sp} > KspK_{sp}, solution is supersaturated, precipitation occurs.

Derivations Where Relevant

  • **Derivation of Kp=Kc(RT)ΔngK_p = K_c(RT)^{\Delta n_g}:**

For aA(g)+bB(g)cC(g)+dD(g)aA(g) + bB(g) \rightleftharpoons cC(g) + dD(g) Kc=[C]c[D]d[A]a[B]bK_c = \frac{[C]^c[D]^d}{[A]^a[B]^b} We know Pi=[i]RTP_i = [i]RT, so [i]=Pi/RT[i] = P_i/RT. Substitute into KcK_c expression: Kc=(PC/RT)c(PD/RT)d(PA/RT)a(PB/RT)b=PCcPDdPAaPBb×(RT)a+b(RT)c+dK_c = \frac{(P_C/RT)^c (P_D/RT)^d}{(P_A/RT)^a (P_B/RT)^b} = \frac{P_C^c P_D^d}{P_A^a P_B^b} \times \frac{(RT)^{a+b}}{(RT)^{c+d}} Kc=Kp×(RT)(a+b)(c+d)=Kp×(RT)ΔngK_c = K_p \times (RT)^{(a+b)-(c+d)} = K_p \times (RT)^{-\Delta n_g} Therefore, Kp=Kc(RT)ΔngK_p = K_c(RT)^{\Delta n_g}.

  • Derivation of Henderson-Hasselbalch Equation (Acidic Buffer):

For a weak acid HAHA and its salt NaANaA (which provides AA^-): HAH++AHA \rightleftharpoons H^+ + A^- Ka=[H+][A][HA]K_a = \frac{[H^+][A^-]}{[HA]} Rearranging for [H+][H^+]: [H+]=Ka[HA][A][H^+] = K_a \frac{[HA]}{[A^-]} Taking negative logarithm on both sides: log[H+]=logKalog[HA][A]-log[H^+] = -logK_a - log\frac{[HA]}{[A^-]} pH=pKa+log[A][HA]pH = pK_a + log\frac{[A^-]}{[HA]} Since the salt NaANaA is a strong electrolyte, [A][A^-] from the salt is approximately equal to the initial concentration of the salt.

The concentration of undissociated acid [HA][HA] is approximately its initial concentration. So, pH=pKa+log[Salt][Acid]pH = pK_a + log\frac{[Salt]}{[Acid]}.

Real-World Applications

  • Industrial Processes:The Haber-Bosch process for ammonia synthesis (N2+3H22NH3N_2 + 3H_2 \rightleftharpoons 2NH_3) is a classic example where Le Chatelier's principle is applied to maximize yield (high pressure, moderate temperature, catalyst). The Contact process for sulfuric acid production also relies on equilibrium principles.
  • Biological Systems:Blood pH is maintained within a narrow range (7.35-7.45) by buffer systems (e.g., bicarbonate buffer, phosphate buffer, protein buffer). Any significant deviation can be life-threatening. The equilibrium between CO2CO_2 and carbonic acid in blood is crucial for gas transport and pH regulation.
  • Environmental Chemistry:Acid rain's impact on aquatic life is related to the equilibrium of carbonates in water bodies. Solubility product is important in understanding mineral formation and dissolution.

Common Misconceptions

  • Equilibrium means equal concentrations:This is incorrect. Equilibrium means the *rates* of forward and reverse reactions are equal, leading to *constant* concentrations, but these constant concentrations are rarely equal. The relative amounts depend on the value of KK.
  • Catalyst affects equilibrium position:A catalyst only speeds up the attainment of equilibrium; it does not change the equilibrium constant or the relative amounts of reactants and products at equilibrium.
  • Equilibrium is static:It is a dynamic process where reactions are continuously occurring.
  • Solubility product is the same as solubility:KspK_{sp} is a constant for a given compound at a given temperature, while solubility is the amount of substance that dissolves. They are related but not identical.

NEET-Specific Angle

For NEET, a strong grasp of equilibrium concepts is vital. Questions frequently test:

  • Calculations involving $K_c$ and $K_p$:Determining equilibrium concentrations or partial pressures given initial conditions and KK, or calculating KK from equilibrium data.
  • Le Chatelier's Principle:Predicting the shift in equilibrium due to changes in concentration, pressure, or temperature. This is a very common conceptual question type.
  • pH calculations:For strong acids/bases, weak acids/bases, and buffer solutions. Understanding the common ion effect is crucial here.
  • Buffer solutions:Identifying buffer components, calculating pH using the Henderson-Hasselbalch equation, and understanding buffer capacity.
  • Solubility product:Calculating KspK_{sp} from solubility, or solubility from KspK_{sp}. Predicting precipitation based on ionic product (QspQ_{sp}) vs KspK_{sp}.
  • **Relationship between KcK_c and KpK_p and Δng\Delta n_g.**
  • Conceptual understanding of dynamic equilibrium and catalyst effect.

Mastering these areas requires both theoretical understanding and extensive practice with numerical problems.

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.