Water

Updated 24 Mar 2026
Sub-topics
2 sub-topics
  1. 1Physical and Chemical Properties
  2. 2Structure of Water and Ice

Water, chemically represented as H2OH_2O, is a simple triatomic molecule consisting of two hydrogen atoms covalently bonded to one oxygen atom. Its bent molecular geometry and the significant electronegativity difference between oxygen and hydrogen atoms result in a highly polar molecule. This polarity, coupled with the ability to form extensive hydrogen bonds, endows water with a unique set of phy…

Quick Summary

Water (H2OH_2O) is a polar molecule with a bent structure, where oxygen is bonded to two hydrogen atoms. This polarity leads to extensive hydrogen bonding between water molecules, which is responsible for its unique properties.

These include high melting and boiling points, high specific heat capacity, high latent heats of fusion and vaporization, and anomalous expansion (maximum density at 4C4^\circ C). Water acts as an excellent 'universal solvent' due to its polarity and high dielectric constant.

Natural water often contains dissolved mineral salts, leading to 'hardness'. Temporary hardness is caused by bicarbonates of calcium and magnesium and can be removed by boiling or Clark's method. Permanent hardness, due to chlorides and sulfates of calcium and magnesium, requires methods like washing soda, Calgon, or ion-exchange.

Heavy water (D2OD_2O), an isotopic variant, has higher physical constants and is used as a nuclear moderator and tracer. Water exhibits amphoteric behavior, acting as both an acid and a base, and participates in various redox and hydrolysis reactions.

Full explanation

Water (H2OH_2O) is arguably the most vital chemical compound on Earth, underpinning all known forms of life and playing a central role in geological and atmospheric processes. Its seemingly simple molecular formula belies a complex array of properties derived from its unique molecular structure and intermolecular forces.

Conceptual Foundation: Structure and Polarity

The water molecule consists of one oxygen atom covalently bonded to two hydrogen atoms. The oxygen atom undergoes sp3sp^3 hybridization, leading to a tetrahedral electron geometry. However, due to the presence of two lone pairs of electrons on the oxygen atom, the molecular geometry is bent or V-shaped, not linear.

The ideal bond angle for sp3sp^3 hybridization is 109.5109.5^\circ, but in water, the lone pair-lone pair repulsion and lone pair-bond pair repulsion are stronger than bond pair-bond pair repulsion, compressing the H-O-H bond angle to approximately $104.

5^\circ$.

Oxygen is significantly more electronegative (3.44 on the Pauling scale) than hydrogen (2.20). This difference in electronegativity causes the shared electrons in the O-H covalent bonds to be pulled closer to the oxygen atom, creating a partial negative charge (δ\delta^-) on the oxygen and partial positive charges (δ+\delta^+) on the hydrogen atoms.

Because of its bent geometry, these bond dipoles do not cancel out, resulting in a net molecular dipole moment. This makes water a highly polar molecule.

Key Principles: Hydrogen Bonding and its Consequences

The polarity of water molecules allows them to form strong intermolecular attractions called hydrogen bonds. A hydrogen bond forms when a hydrogen atom covalently bonded to a highly electronegative atom (like O, N, or F) is attracted to another electronegative atom in an adjacent molecule.

In water, each oxygen atom can form two hydrogen bonds (one with each lone pair), and each hydrogen atom can participate in one hydrogen bond. This means each water molecule can potentially form up to four hydrogen bonds with neighboring water molecules.

    1
  1. High Melting and Boiling PointsCompared to hydrides of other Group 16 elements (e.g., H2SH_2S, H2SeH_2Se), water has exceptionally high melting (0C0^\circ C) and boiling (100C100^\circ C) points. A significant amount of energy is required to overcome these strong hydrogen bonds to transition from solid to liquid and liquid to gas phases.
  2. 2
  3. High Specific Heat CapacityWater has a remarkably high specific heat capacity (4.184J/gC4.184\,\text{J/g}^\circ C). This means it can absorb or release a large amount of heat with only a small change in its own temperature. This property is crucial for regulating Earth's climate and maintaining stable body temperatures in living organisms.
  4. 3
  5. High Latent Heats of Fusion and VaporizationSimilarly, a large amount of energy is needed to melt ice (latent heat of fusion, 334J/g334\,\text{J/g}) or vaporize liquid water (latent heat of vaporization, 2260J/g2260\,\text{J/g}). This makes water an effective coolant and helps moderate temperature changes.
  6. 4
  7. High Surface Tension and ViscosityThe strong cohesive forces due to hydrogen bonding lead to high surface tension (allowing insects to walk on water) and relatively high viscosity.
  8. 5
  9. Anomalous ExpansionUnlike most substances that contract continuously upon cooling, water contracts until 4C4^\circ C, then expands as it cools further to 0C0^\circ C and freezes. This means ice is less dense than liquid water, which is why ice floats. This property is vital for aquatic life, as ice forms on the surface of lakes and insulates the water below, preventing entire bodies of water from freezing solid.

Solvent Properties: The 'Universal Solvent'

Water's polarity and ability to form hydrogen bonds make it an excellent solvent for a wide range of substances, earning it the title 'universal solvent'.

    1
  1. Dissolving Ionic CompoundsWater molecules surround positive ions (cations) with their negatively charged oxygen ends and negative ions (anions) with their positively charged hydrogen ends. This process, called hydration, effectively separates the ions from the crystal lattice and keeps them dissolved.
  2. 2
  3. Dissolving Polar Covalent CompoundsWater can form hydrogen bonds with other polar molecules (e.g., alcohols, sugars), leading to their dissolution.
  4. 3
  5. High Dielectric ConstantWater has a very high dielectric constant (approximately 80 at 25C25^\circ C). This property reduces the electrostatic attraction between oppositely charged ions in a solution, making it easier for them to dissociate and remain dissolved.

Hardness of Water

Water is rarely found in its pure form in nature. It often contains dissolved mineral salts, primarily bicarbonates, chlorides, and sulfates of calcium (Ca2+Ca^{2+}) and magnesium (Mg2+Mg^{2+}). The presence of these dissolved salts makes water 'hard'.

Types of Hardness:

    1
  1. Temporary HardnessCaused by the presence of dissolved bicarbonates of calcium and magnesium (Ca(HCO3)2Ca(HCO_3)_2 and Mg(HCO3)2Mg(HCO_3)_2). It is called 'temporary' because it can be easily removed by boiling.

* Removal by Boiling: Heating decomposes the soluble bicarbonates into insoluble carbonates, which precipitate out.

Ca(HCO3)2(aq)heatCaCO3(s)+H2O(l)+CO2(g)Ca(HCO_3)_2(aq) \xrightarrow{\text{heat}} CaCO_3(s) \downarrow + H_2O(l) + CO_2(g)
Mg(HCO3)2(aq)heatMgCO3(s)+H2O(l)+CO2(g)Mg(HCO_3)_2(aq) \xrightarrow{\text{heat}} MgCO_3(s) \downarrow + H_2O(l) + CO_2(g)
Note: MgCO3MgCO_3 is slightly soluble, so it's often removed as Mg(OH)2Mg(OH)_2 at higher pH.

* Clark's Method: Adding a calculated amount of lime (calcium hydroxide, Ca(OH)2Ca(OH)_2) precipitates calcium carbonate and magnesium hydroxide.

    1
  1. Permanent HardnessCaused by the presence of dissolved chlorides and sulfates of calcium and magnesium (CaCl2CaCl_2, MgCl2MgCl_2, CaSO4CaSO_4, MgSO4MgSO_4). This type of hardness cannot be removed by boiling.

* Removal Methods for Permanent Hardness: * Washing Soda Method (Sodium Carbonate Method): Adding sodium carbonate (Na2CO3Na_2CO_3) precipitates calcium and magnesium ions as their carbonates.

CaCl2(aq)+Na2CO3(aq)CaCO3(s)+2NaCl(aq)CaCl_2(aq) + Na_2CO_3(aq) \rightarrow CaCO_3(s) \downarrow + 2NaCl(aq)
MgSO4(aq)+Na2CO3(aq)MgCO3(s)+Na2SO4(aq)MgSO_4(aq) + Na_2CO_3(aq) \rightarrow MgCO_3(s) \downarrow + Na_2SO_4(aq)
* Calgon Method (Sodium Hexametaphosphate): Sodium hexametaphosphate (Na6P6O18Na_6P_6O_{18}) forms soluble complex ions with Ca2+Ca^{2+} and Mg2+Mg^{2+} ions, effectively sequestering them and preventing them from reacting with soap.

Na6P6O182Na++Na4P6O182Na_6P_6O_{18} \rightarrow 2Na^+ + Na_4P_6O_{18}^{2-}
Na4P6O182+2Ca2+Na2[Ca2P6O18]2+2Na+Na_4P_6O_{18}^{2-} + 2Ca^{2+} \rightarrow Na_2[Ca_2P_6O_{18}]^{2-} + 2Na^+
(soluble complex) * Ion-Exchange Method (Zeolite/Permutit Process): Zeolites are hydrated sodium aluminosilicates (Na2Al2Si2O8xH2ONa_2Al_2Si_2O_8 \cdot xH_2O, or NaZNaZ).

Hardness-causing ions (Ca2+Ca^{2+}, Mg2+Mg^{2+}) exchange with Na+Na^+ ions in the zeolite.

2NaZ(s)+Ca2+(aq)CaZ2(s)+2Na+(aq)2NaZ(s) + Ca^{2+}(aq) \rightarrow CaZ_2(s) + 2Na^+(aq)
The exhausted zeolite can be regenerated by treating it with a concentrated NaCl solution.

CaZ2(s)+2NaCl(aq)2NaZ(s)+CaCl2(aq)CaZ_2(s) + 2NaCl(aq) \rightarrow 2NaZ(s) + CaCl_2(aq)
* Synthetic Resins Method (Deionization): This is the most effective method for producing demineralized or deionized water. It uses two types of ion-exchange resins: a cation exchange resin (containing SO3H-SO_3H groups) and an anion exchange resin (containing NH3OH-NH_3OH groups).

* Cation Exchange: Resins exchange H+H^+ ions for Ca2+Ca^{2+} and Mg2+Mg^{2+} ions.

2RSO3H(s)+Ca2+(aq)(RSO3)2Ca(s)+2H+(aq)2RSO_3H(s) + Ca^{2+}(aq) \rightarrow (RSO_3)_2Ca(s) + 2H^+(aq)
* Anion Exchange: Resins exchange OHOH^- ions for anions like ClCl^-, SO42SO_4^{2-}, HCO3HCO_3^-.

RNH3OH(s)+Cl(aq)RNH3Cl(s)+OH(aq)RNH_3OH(s) + Cl^-(aq) \rightarrow RNH_3Cl(s) + OH^-(aq)
The H+H^+ and OHOH^- ions then combine to form water, effectively removing all dissolved mineral salts.
H+(aq)+OH(aq)H2O(l)H^+(aq) + OH^-(aq) \rightarrow H_2O(l)
* Reverse Osmosis (RO): Water is forced under pressure through a semi-permeable membrane, which allows water molecules to pass but rejects dissolved salts and other impurities.

Disadvantages of Hard Water:

  • Soap WastageCa2+Ca^{2+} and Mg2+Mg^{2+} ions react with soap (sodium stearate) to form insoluble precipitates (scum), reducing lather formation and wasting soap.

2C17H35COONa(aq)+Ca2+(aq)(C17H35COO)2Ca(s)+2Na+(aq)2C_{17}H_{35}COONa(aq) + Ca^{2+}(aq) \rightarrow (C_{17}H_{35}COO)_2Ca(s) \downarrow + 2Na^+(aq)

  • Scaling in BoilersHard water forms scale (e.g., CaCO3CaCO_3, Mg(OH)2Mg(OH)_2) in boilers and pipes, reducing heating efficiency, causing corrosion, and potentially leading to boiler explosions.
  • Poor TasteCan affect the taste of food and beverages.

Heavy Water ($D_2O$)

Heavy water is water in which the hydrogen atoms are replaced by deuterium (D), an isotope of hydrogen with one proton and one neutron. It is chemically similar to normal water (H2OH_2O) but has distinct physical properties due to the higher mass of deuterium.

Preparation: Primarily obtained by the prolonged electrolysis of ordinary water. Since D2OD_2O has a higher boiling point and lower vapor pressure, it concentrates in the residual liquid during electrolysis.

Properties:

  • PhysicalHigher density (1.1044g/cm31.1044\,\text{g/cm}^3 at 25C25^\circ C vs. 0.997g/cm30.997\,\text{g/cm}^3 for H2OH_2O), higher melting point (3.8C3.8^\circ C vs. 0C0^\circ C), higher boiling point (101.4C101.4^\circ C vs. 100C100^\circ C), higher viscosity, and lower dielectric constant than normal water.
  • ChemicalReactions are generally slower than those of H2OH_2O (kinetic isotope effect). It can exchange D for H in compounds containing exchangeable hydrogen atoms.

NaOH+D2ONaOD+HDONaOH + D_2O \rightarrow NaOD + HDO
CH4+D2OCH3D+HDOCH_4 + D_2O \rightarrow CH_3D + HDO
(under specific conditions)

Uses:

  • Nuclear ReactorsUsed as a moderator to slow down neutrons in nuclear reactors, allowing for sustained chain reactions.
  • Tracer CompoundUsed in studies of reaction mechanisms and metabolic pathways in biological systems.
  • NMR SpectroscopyAs a solvent in Nuclear Magnetic Resonance (NMR) spectroscopy, as deuterium nuclei do not interfere with proton NMR signals.

Chemical Reactions of Water

    1
  1. Amphoteric NatureWater can act as both an acid and a base (amphoteric).

* As an acid (donating H+H^+): H2O+NH3OH+NH4+H_2O + NH_3 \rightleftharpoons OH^- + NH_4^+ (Bronsted-Lowry acid) * As a base (accepting H+H^+): H2O+HClH3O++ClH_2O + HCl \rightleftharpoons H_3O^+ + Cl^- (Bronsted-Lowry base) * Autoionization: 2H2O(l)H3O+(aq)+OH(aq)2H_2O(l) \rightleftharpoons H_3O^+(aq) + OH^-(aq)

    1
  1. Redox ReactionsWater can be reduced by highly electropositive metals (e.g., alkali metals) and oxidized by highly electronegative elements (e.g., fluorine).

* Reduction: 2Na(s)+2H2O(l)2NaOH(aq)+H2(g)2Na(s) + 2H_2O(l) \rightarrow 2NaOH(aq) + H_2(g) * Oxidation: 2F2(g)+2H2O(l)4HF(aq)+O2(g)2F_2(g) + 2H_2O(l) \rightarrow 4HF(aq) + O_2(g)

    1
  1. Hydrolysis ReactionsWater reacts with many compounds (ionic and covalent) to break them down. Examples include hydrolysis of salts (e.g., Na2CO3Na_2CO_3, NH4ClNH_4Cl), carbides (e.g., CaC2CaC_2), nitrides, and esters.

CaC2(s)+2H2O(l)Ca(OH)2(aq)+C2H2(g)CaC_2(s) + 2H_2O(l) \rightarrow Ca(OH)_2(aq) + C_2H_2(g)
P4O10(s)+6H2O(l)4H3PO4(aq)P_4O_{10}(s) + 6H_2O(l) \rightarrow 4H_3PO_4(aq)

Common Misconceptions & NEET-Specific Angle

  • MisconceptionWater is a simple, inert molecule. Correction: Water's bent structure and hydrogen bonding make it highly reactive and crucial for many chemical and biological processes.
  • MisconceptionAll solvents behave like water. Correction: Water's high polarity and dielectric constant are unique, making it an exceptional solvent for ionic and polar compounds, unlike non-polar solvents.
  • NEET FocusQuestions often revolve around the consequences of hydrogen bonding (anomalous properties), the distinction between temporary and permanent hardness, the various methods for removing hardness (especially their chemical reactions), and the properties and uses of heavy water. Understanding the underlying chemical principles for each hardness removal method is key, as direct reaction equations are frequently tested. The amphoteric nature and hydrolysis reactions are also important conceptual areas.

Key Concepts

Hydrogen Bonding in Water

Hydrogen bonding is the cornerstone of water's unique physical and chemical properties. Each water molecule…

Hardness of Water and its Removal by Ion-Exchange

Water hardness refers to the concentration of dissolved multivalent metallic cations, primarily calcium…

Heavy Water (D2OD_2O) Properties and Uses

Heavy water, or deuterium oxide (D2OD_2O), is an isotopic variant of water where the hydrogen atoms are…

Often confused with

Side-by-side differences the NEET paper likes to test.

Water vs Soft Water
AspectWaterSoft Water
DefinitionContains dissolved mineral salts, primarily $Ca^{2+}$ and $Mg^{2+}$ ions.Relatively free of dissolved $Ca^{2+}$ and $Mg^{2+}$ ions, or contains very low concentrations.
Lather with SoapForms very little or no lather with soap, instead forming insoluble scum.Forms rich lather easily with soap.
TypesTemporary (bicarbonates) and Permanent (chlorides, sulfates).No types, it's a characteristic of water lacking hardness-causing ions.
Boiler ScalingCauses significant scale formation in boilers, pipes, and heating elements.Does not cause scale formation in boilers or pipes.
TasteOften has a distinct mineral taste.Generally has a bland taste.
Suitability for LaundryPoor for laundry due to soap wastage and residue on clothes.Excellent for laundry, requiring less soap and leaving no residue.

Hard water is characterized by the presence of dissolved calcium and magnesium salts, leading to issues like soap wastage and boiler scaling. It can be temporary (removable by boiling) or permanent (requiring chemical treatment).

Soft water, conversely, contains minimal concentrations of these ions, lathers easily with soap, and does not cause scaling. The distinction is crucial for domestic, industrial, and environmental applications, influencing everything from cleaning efficiency to the longevity of plumbing systems and industrial machinery.

Understanding these differences is fundamental for NEET, particularly regarding water treatment methods.

Why it is tested: NEET relevance: Understanding the distinction between hard and soft water is crucial for questions related to water chemistry, environmental chemistry, and industrial applications. Questions often test the causes of hardness, its disadvantages, and the specific methods used to remove temporary and permanent hardness, including the underlying chemical reactions.

Questions students ask

6 answered on this topic.

Why does ice float on water, and what is its significance?

Ice floats on water because, unlike most substances, water reaches its maximum density at 4C4^\circ C and expands as it cools further to 0C0^\circ C and freezes. This expansion is due to the formation of an open, cage-like structure held together by hydrogen bonds in the solid state, which increases the volume and thus decreases the density of ice compared to liquid water.

The significance is profound for aquatic life: ice forms on the surface of lakes and ponds, insulating the water below and preventing it from freezing solid, allowing aquatic organisms to survive through cold winters.

What is the primary reason for water's high boiling point compared to other hydrides like $H_2S$?

The primary reason for water's unusually high boiling point (100C100^\circ C) compared to hydrides of elements below oxygen in Group 16, such as hydrogen sulfide (H2SH_2S, boiling point 60C-60^\circ C), is the extensive network of hydrogen bonding present in liquid water.

Oxygen is highly electronegative, creating strong partial positive charges on hydrogen atoms and partial negative charges on oxygen. These strong dipole-dipole interactions, specifically hydrogen bonds, require significantly more energy to overcome during boiling than the weaker van der Waals forces (dipole-dipole and London dispersion forces) present in H2SH_2S.

How does hard water affect the efficiency of soap and detergents?

Hard water significantly reduces the efficiency of soap. Soap molecules, typically sodium stearate (C17H35COONaC_{17}H_{35}COONa), react with the calcium (Ca2+Ca^{2+}) and magnesium (Mg2+Mg^{2+}) ions present in hard water to form insoluble precipitates, commonly known as scum ((C17H35COO)2Ca(C_{17}H_{35}COO)_2Ca or (C17H35COO)2Mg(C_{17}H_{35}COO)_2Mg).

This scum does not lather and instead forms an undesirable residue, meaning more soap is required to achieve cleaning. Detergents, however, are generally more effective in hard water because their active ingredients are sulfonates, which form soluble salts with Ca2+Ca^{2+} and Mg2+Mg^{2+} ions, thus avoiding scum formation.

Explain the difference between temporary and permanent hardness of water.

Temporary hardness is caused by the presence of dissolved bicarbonates of calcium and magnesium (Ca(HCO3)2Ca(HCO_3)_2 and Mg(HCO3)2Mg(HCO_3)_2). It can be easily removed by simple methods like boiling or adding lime (Clark's method), which precipitate the hardness-causing ions.

Permanent hardness, on the other hand, is due to the dissolved chlorides and sulfates of calcium and magnesium (CaCl2CaCl_2, MgCl2MgCl_2, CaSO4CaSO_4, MgSO4MgSO_4). This type of hardness cannot be removed by boiling and requires more advanced chemical or physical methods such as the washing soda method, Calgon method, or ion-exchange processes.

What are the main uses of heavy water ($D_2O$)?

Heavy water (D2OD_2O) has several important applications, primarily stemming from its distinct nuclear properties and slightly different chemical reactivity compared to normal water. Its most significant use is as a moderator in nuclear reactors, where it slows down fast neutrons produced during fission, enabling a sustained nuclear chain reaction.

It is also employed as a tracer compound in chemical and biological research to study reaction mechanisms and metabolic pathways. Additionally, D2OD_2O serves as a solvent in Nuclear Magnetic Resonance (NMR) spectroscopy, as deuterium nuclei do not produce signals in the proton NMR spectrum, allowing for clear observation of proton signals in dissolved samples.

How does the ion-exchange method work for softening water?

The ion-exchange method, particularly using synthetic resins, is highly effective for softening water. It involves passing hard water through two types of resin columns. The first column contains a cation-exchange resin (e.

g., RSO3HRSO_3H), which exchanges its H+H^+ ions for the Ca2+Ca^{2+} and Mg2+Mg^{2+} ions present in the hard water. The water then flows through an anion-exchange resin (e.g., RNH3OHRNH_3OH), which exchanges its OHOH^- ions for other anions like ClCl^-, SO42SO_4^{2-}, and HCO3HCO_3^-.

The H+H^+ and OHOH^- ions released from the resins then combine to form pure water (H2OH_2O), effectively removing all dissolved mineral salts and producing demineralized or deionized water.

Revise in 30 seconds

  • Structure:Bent, sp3sp^3 hybridized oxygen, 104.5104.5^\circ bond angle.
  • Polarity:Highly polar due to electronegativity difference and bent shape.
  • Hydrogen Bonding:Extensive H-bonding, responsible for unique properties.
  • Anomalous Properties:High BP (100C100^\circ C), MP (0C0^\circ C), specific heat (4.184J/gC4.184\,\text{J/g}^\circ C), latent heats. Max density at 4C4^\circ C (ice floats).
  • Hardness:Due to Ca2+Ca^{2+}, Mg2+Mg^{2+} salts.

- Temporary: Bicarbonates (Ca(HCO3)2Ca(HCO_3)_2, Mg(HCO3)2Mg(HCO_3)_2). Removed by boiling (Ca(HCO3)2heatCaCO3+H2O+CO2Ca(HCO_3)_2 \xrightarrow{\text{heat}} CaCO_3 \downarrow + H_2O + CO_2) or Clark's method (Ca(HCO3)2+Ca(OH)22CaCO3+2H2OCa(HCO_3)_2 + Ca(OH)_2 \rightarrow 2CaCO_3 \downarrow + 2H_2O).

- Permanent: Chlorides, sulfates (CaCl2CaCl_2, MgCl2MgCl_2, CaSO4CaSO_4, MgSO4MgSO_4). - Removal (Permanent): - Washing Soda: CaCl2+Na2CO3CaCO3+2NaClCaCl_2 + Na_2CO_3 \rightarrow CaCO_3 \downarrow + 2NaCl. - Calgon: Na6P6O18Na_6P_6O_{18} forms soluble complexes with Ca2+Ca^{2+}, Mg2+Mg^{2+}.

- Ion-exchange (Zeolite/Resins): 2NaZ+Ca2+CaZ2+2Na+2NaZ + Ca^{2+} \rightarrow CaZ_2 + 2Na^+; 2RSO3H+Ca2+(RSO3)2Ca+2H+2RSO_3H + Ca^{2+} \rightarrow (RSO_3)_2Ca + 2H^+; RNH3OH+ClRNH3Cl+OHRNH_3OH + Cl^- \rightarrow RNH_3Cl + OH^-.

  • Heavy Water ($D_2O$):Deuterium oxide. Higher density, MP, BP. Used as nuclear moderator (slows neutrons, low absorption).

To remember the methods for removing Permanent Hardness: We Can Initiate Removal.

  • Washing soda method
  • Calgon method
  • Ion-exchange method
  • Reverse Osmosis