Hydrogen Peroxide

Updated 22 Mar 2026
Sub-topics
2 sub-topics
  1. 1Preparation, Properties and Structure
  2. 2Storage and Uses

Hydrogen peroxide, with the chemical formula H2O2H_2O_2, is a compound of hydrogen and oxygen that is a pale blue liquid in its pure form, slightly more viscous than water. It is a powerful oxidizing agent and, under certain conditions, a reducing agent, making it a versatile chemical. Its unique non-planar, 'open book' structure, distinct from water, contributes significantly to its chemical proper…

Quick Summary

Hydrogen peroxide (H2O2H_2O_2) is a pale blue, syrupy liquid, often encountered as a colorless aqueous solution. It's distinct from water (H2OH_2O) by having an extra oxygen atom, leading to an oxygen-oxygen single bond.

This O-O bond makes it thermodynamically unstable, decomposing exothermically into water and oxygen, a process accelerated by light, heat, and catalysts. Its unique non-planar 'open book' structure, with a dihedral angle, gives it a high dipole moment.

Chemically, H2O2H_2O_2 is a powerful oxidizing agent due to oxygen's -1 oxidation state, but it can also act as a reducing agent against stronger oxidants. Industrially, it's primarily produced by the auto-oxidation of 2-ethylanthraquinol.

Key uses include bleaching (paper, textiles), antiseptic applications, and as an oxidizer in rocket fuels. Proper storage in dark, stabilized containers is crucial due to its instability.

Full explanation

Hydrogen peroxide (H2O2H_2O_2) stands as a pivotal compound in inorganic chemistry, distinguished by its unique structure and versatile chemical reactivity. It is the simplest peroxide, meaning it contains an oxygen-oxygen single bond. This O-O bond is relatively weak, making H2O2H_2O_2 thermodynamically unstable and prone to decomposition.

Conceptual Foundation:

At its core, hydrogen peroxide is an inorganic compound of hydrogen and oxygen. Its significance stems from the fact that oxygen exists in an unusual oxidation state of -1 in H2O2H_2O_2, unlike the more common -2 in water (H2OH_2O) or 0 in molecular oxygen (O2O_2).

This intermediate oxidation state allows H2O2H_2O_2 to readily participate in redox reactions, acting as an oxidizing agent (where oxygen goes from -1 to -2) or a reducing agent (where oxygen goes from -1 to 0).

The decomposition of H2O2H_2O_2 is a classic example of a disproportionation reaction, where the same substance is simultaneously oxidized and reduced.

Key Principles/Laws:

    1
  1. Redox Chemistry:The ability of H2O2H_2O_2 to act as both an oxidant and a reductant is central to its chemistry. In acidic medium, its standard reduction potential for oxidation (O2+2H++2eH2O2O_2 + 2H^+ + 2e^- \rightarrow H_2O_2) is +0.68V+0.68\,\text{V} and for reduction (H2O2+2H++2e2H2OH_2O_2 + 2H^+ + 2e^- \rightarrow 2H_2O) is +1.77V+1.77\,\text{V}. This indicates it is a stronger oxidizing agent than a reducing agent.
  2. 2
  3. Thermodynamic Instability:H2O2H_2O_2 is thermodynamically unstable and decomposes exothermically into water and oxygen: 2H2O2(l)2H2O(l)+O2(g)+Heat2H_2O_2(l) \rightarrow 2H_2O(l) + O_2(g) + \text{Heat}. This decomposition is catalyzed by light, heat, rough surfaces, metal ions (e.g., Fe2+Fe^{2+}, Cu2+Cu^{2+}), and certain enzymes (e.g., catalase).
  4. 3
  5. Hydrogen Bonding:Like water, H2O2H_2O_2 can form extensive hydrogen bonds, which accounts for its relatively high boiling point and viscosity compared to its molecular weight.

Preparation Methods:

Hydrogen peroxide can be prepared by various methods, both in the laboratory and industrially.

  • Laboratory Methods:

* From Barium Peroxide: This is a traditional method. Barium peroxide (BaO2BaO_2) is treated with dilute sulfuric acid (H2SO4H_2SO_4) or phosphoric acid (H3PO4H_3PO_4). BaO2(s)+H2SO4(aq)BaSO4(s)+H2O2(aq)BaO_2(s) + H_2SO_4(aq) \rightarrow BaSO_4(s) + H_2O_2(aq) Barium sulfate (BaSO4BaSO_4) is insoluble and precipitates out, which can be filtered off, leaving a dilute solution of H2O2H_2O_2.

Carbon dioxide can also be used: BaO2(s)+H2O(l)+CO2(g)BaCO3(s)+H2O2(aq)BaO_2(s) + H_2O(l) + CO_2(g) \rightarrow BaCO_3(s) + H_2O_2(aq) * From Sodium Peroxide: Sodium peroxide (Na2O2Na_2O_2) reacts with ice-cold dilute sulfuric acid.

Na2O2(s)+H2SO4(aq)Na2SO4(aq)+H2O2(aq)Na_2O_2(s) + H_2SO_4(aq) \rightarrow Na_2SO_4(aq) + H_2O_2(aq) This reaction needs to be carefully controlled due to its exothermic nature.

  • Industrial Methods:

* Auto-oxidation of 2-ethylanthraquinol (Anthraquinone Process): This is the most common modern industrial method. 2-ethylanthraquinol is dissolved in an organic solvent and oxidized by air (oxygen) to 2-ethylanthraquinone, producing H2O2H_2O_2.

The 2-ethylanthraquinone is then catalytically reduced back to 2-ethylanthraquinol using PdPd catalyst, making the process cyclic. 2-ethylanthraquinol+O22-ethylanthraquinone+H2O22\text{-ethylanthraquinol} + O_2 \rightarrow 2\text{-ethylanthraquinone} + H_2O_2 2-ethylanthraquinone+H2Pd2-ethylanthraquinol2\text{-ethylanthraquinone} + H_2 \xrightarrow{Pd} 2\text{-ethylanthraquinol} * Electrolytic Process (Old Method): Electrolysis of a cold 50% sulfuric acid solution or an ammonium hydrogen sulfate solution (NH4HSO4NH_4HSO_4) yields peroxodisulfuric acid (H2S2O8H_2S_2O_8), which on hydrolysis gives H2O2H_2O_2.

Physical Properties:

  • Appearance:Pure H2O2H_2O_2 is a very pale blue, almost colorless, syrupy liquid. Dilute solutions appear colorless.
  • Density:Denser than water (1.44g/cm31.44\,\text{g/cm}^3 at 20C20^\circ C for pure H2O2H_2O_2).
  • Melting Point:0.43C-0.43^\circ C.
  • Boiling Point:150.2C150.2^\circ C (extrapolated, as it decomposes before reaching this point at atmospheric pressure).
  • Solubility:Miscible with water in all proportions due to extensive hydrogen bonding.
  • Dielectric Constant:High (7878 at 0C0^\circ C), indicating its polar nature and ability to dissolve many ionic compounds.
  • Viscosity:Higher than water.
  • Odor:Faint, characteristic odor.

Chemical Properties:

    1
  1. Decomposition:As mentioned, it's thermodynamically unstable. The decomposition is catalyzed by light, heat, metal ions, and rough surfaces. It's stored in dark, wax-lined plastic bottles to prevent decomposition.

2H2O2(l)2H2O(l)+O2(g)2H_2O_2(l) \rightarrow 2H_2O(l) + O_2(g)

    1
  1. Acidic Nature:H2O2H_2O_2 is a very weak acid, weaker than water. It dissociates slightly to form HO2HO_2^- ions.

H2O2H++HO2H_2O_2 \rightleftharpoons H^+ + HO_2^- (Ka=1.5×1012K_a = 1.5 \times 10^{-12})

    1
  1. Oxidizing Agent:This is its most common role. It oxidizes many substances in both acidic and basic media.

* Acidic Medium: H2O2+2H++2e2H2OH_2O_2 + 2H^+ + 2e^- \rightarrow 2H_2O Example: Oxidation of Fe2+Fe^{2+} to Fe3+Fe^{3+} 2Fe2++H2O2+2H+2Fe3++2H2O2Fe^{2+} + H_2O_2 + 2H^+ \rightarrow 2Fe^{3+} + 2H_2O Example: Oxidation of PbSPbS to PbSO4PbSO_4 (black to white) PbS(s)+4H2O2(aq)PbSO4(s)+4H2O(l)PbS(s) + 4H_2O_2(aq) \rightarrow PbSO_4(s) + 4H_2O(l) * Basic Medium: H2O2+2e2OHH_2O_2 + 2e^- \rightarrow 2OH^- Example: Oxidation of Mn2+Mn^{2+} to Mn4+Mn^{4+} Mn2++H2O2+2OHMnO2(s)+2H2OMn^{2+} + H_2O_2 + 2OH^- \rightarrow MnO_2(s) + 2H_2O

    1
  1. Reducing Agent:H2O2H_2O_2 acts as a reducing agent towards strong oxidizing agents, especially in alkaline medium.

* Acidic Medium: H2O2O2+2H++2eH_2O_2 \rightarrow O_2 + 2H^+ + 2e^- Example: Reduction of KMnO4KMnO_4 (purple) to Mn2+Mn^{2+} (colorless) 2KMnO4+5H2O2+3H2SO4K2SO4+2MnSO4+8H2O+5O22KMnO_4 + 5H_2O_2 + 3H_2SO_4 \rightarrow K_2SO_4 + 2MnSO_4 + 8H_2O + 5O_2 * Basic Medium: H2O2+2OHO2+2H2O+2eH_2O_2 + 2OH^- \rightarrow O_2 + 2H_2O + 2e^- Example: Reduction of Ag2OAg_2O to AgAg Ag2O(s)+H2O2(aq)2Ag(s)+H2O(l)+O2(g)Ag_2O(s) + H_2O_2(aq) \rightarrow 2Ag(s) + H_2O(l) + O_2(g)

    1
  1. Bleaching Action:Its bleaching action is due to the nascent oxygen released during its decomposition, which oxidizes colored substances to colorless ones. It is a milder and more environmentally friendly bleaching agent than chlorine.

Colored substance+[O]Colorless substance\text{Colored substance} + [O] \rightarrow \text{Colorless substance}

Structure:

Hydrogen peroxide has a non-planar, 'open book' structure. The two oxygen atoms are linked by a single bond, and each oxygen atom is bonded to one hydrogen atom. The two O-H bonds are not in the same plane.

The dihedral angle (the angle between the two H-O-O planes) is approximately 111.5111.5^\circ in the gas phase and 90.290.2^\circ in the solid phase. The O-O bond length is 147.5pm147.5\,\text{pm}, O-H bond length is $95.

0\,\text{pm},andtheHOObondangleis, and the H-O-O bond angle is94.8^\circ$. This non-planar structure is crucial for its properties, including its high dipole moment.

Storage:

Due to its instability, H2O2H_2O_2 must be stored carefully. It is typically stored in dark-colored bottles (to prevent light-catalyzed decomposition) made of plastic or wax-lined glass (to avoid rough surfaces and metal ion catalysis). Small amounts of stabilizers like urea, acetanilide, or sodium stannate are often added to slow down decomposition.

Real-World Applications:

  • Antiseptic and Disinfectant:Dilute solutions (3-6%) are used to clean wounds and sterilize medical equipment.
  • Bleaching Agent:Used extensively in the textile, paper, and pulp industries for bleaching cotton, wood pulp, and other materials. It's an eco-friendly alternative to chlorine.
  • Environmental Chemistry:Used in wastewater treatment to remove organic pollutants and reduce odors.
  • Rocket Fuel:High-concentration H2O2H_2O_2 (90% or more, known as High Test Peroxide, HTP) is used as an oxidizer in rocket propulsion systems.
  • Synthesis:Used in the synthesis of various organic and inorganic peroxides.

Common Misconceptions:

  • Stability:Many students assume H2O2H_2O_2 is stable like water. It's crucial to remember its inherent thermodynamic instability and propensity to decompose.
  • Oxidation State of Oxygen:Often confused with -2, but it's -1 in H2O2H_2O_2.
  • Structure:Sometimes incorrectly assumed to be linear or planar like some other simple molecules. Its 'open book' structure is unique and important.

NEET-Specific Angle:

For NEET, focus on the following:

  • Preparation Methods:Especially the industrial anthraquinone process and laboratory methods from barium peroxide.
  • Redox Properties:Understand when it acts as an oxidizing agent and when as a reducing agent, and be able to write balanced redox reactions in both acidic and basic media. This is a very common question type.
  • Structure:The non-planar 'open book' structure, dihedral angle, and bond parameters are important.
  • Decomposition:Factors affecting decomposition (light, heat, catalysts) and methods of storage.
  • Uses:Key applications like bleaching, antiseptic, and rocket fuel.
  • Comparison with Water:Differences in structure, stability, and reactivity.

Key Concepts

Redox Nature of Hydrogen Peroxide

Hydrogen peroxide is unique because the oxygen atoms are in an oxidation state of -1. This intermediate state…

Decomposition and Stability

Hydrogen peroxide is thermodynamically unstable, meaning its decomposition into water and oxygen is an…

Industrial Production: Anthraquinone Process

The anthraquinone process (or auto-oxidation of 2-ethylanthraquinol) is the dominant industrial method for…

Often confused with

Side-by-side differences the NEET paper likes to test.

Hydrogen Peroxide vs Water ($H_2O$)
AspectHydrogen PeroxideWater ($H_2O$)
Chemical Formula$H_2O_2$$H_2O$
Oxidation State of Oxygen-1-2
StructureNon-planar, 'open book' structure (dihedral angle)Bent, planar structure (bond angle $104.5^\circ$)
StabilityThermodynamically unstable, decomposes to $H_2O$ and $O_2$Highly stable
Redox PropertiesBoth oxidizing and reducing agentGenerally neither (stable oxidation state)
Bleaching ActionActs as a bleaching agentNo bleaching action
ViscosityMore viscous than waterLess viscous

While both hydrogen peroxide and water are compounds of hydrogen and oxygen, their chemical and physical properties differ significantly due to the presence of an additional oxygen atom in H2O2H_2O_2. This extra oxygen leads to an O-O single bond and an oxygen oxidation state of -1, making H2O2H_2O_2 thermodynamically unstable and a versatile redox agent.

Water, with oxygen in a stable -2 oxidation state, is a highly stable compound and generally unreactive in redox processes. The non-planar 'open book' structure of H2O2H_2O_2 also contrasts with the bent planar structure of H2OH_2O, influencing their physical characteristics.

Why it is tested: For NEET, understanding the differences between $H_2O_2$ and $H_2O$ is crucial for distinguishing their chemical behavior, particularly their stability, redox properties, and structural aspects. Questions often test the unique properties of $H_2O_2$ in contrast to the more common water molecule.

Questions students ask

5 answered on this topic.

Why is hydrogen peroxide stored in dark bottles?

Hydrogen peroxide is thermodynamically unstable and readily decomposes into water and oxygen. This decomposition reaction is significantly accelerated by light, especially ultraviolet light. Storing it in dark-colored bottles, typically brown or opaque plastic, minimizes the exposure to light, thereby slowing down the decomposition process and extending the shelf life of the hydrogen peroxide solution. This helps maintain its concentration and effectiveness for its intended uses.

What is the 'open book' structure of hydrogen peroxide?

The 'open book' structure refers to the non-planar geometry of the hydrogen peroxide molecule (H2O2H_2O_2). Unlike water (H2OH_2O) which is bent and planar, H2O2H_2O_2 has two H-O-O planes that are twisted relative to each other, resembling an open book. The two hydrogen atoms lie in different planes, with a dihedral angle between these planes. This unique arrangement, with an O-O single bond, is responsible for its distinct physical and chemical properties, including its high dipole moment.

How does hydrogen peroxide act as both an oxidizing and reducing agent?

Hydrogen peroxide contains oxygen in an intermediate oxidation state of -1. This allows it to either gain electrons (get reduced) to form compounds where oxygen has an oxidation state of -2 (like in H2OH_2O), thus acting as an oxidizing agent.

Or, it can lose electrons (get oxidized) to form molecular oxygen (O2O_2) where oxygen has an oxidation state of 0, thus acting as a reducing agent. Its specific role depends on the redox potential of the other reactant and the reaction conditions (acidic or basic medium).

What is the role of stabilizers in hydrogen peroxide solutions?

Stabilizers are added to hydrogen peroxide solutions to slow down its natural decomposition into water and oxygen. Common stabilizers include urea, acetanilide, phosphates, and sodium stannate. These substances work by deactivating catalytic impurities (like metal ions from container surfaces) or by forming complexes that inhibit the decomposition pathway. This ensures that the hydrogen peroxide maintains its desired concentration and efficacy over time, especially during storage and transport.

Why is the anthraquinone process preferred for industrial production of $H_2O_2$?

The anthraquinone (or auto-oxidation) process is the most widely used industrial method because it is highly efficient, economical, and environmentally friendly. It's a cyclic process where 2-ethylanthraquinol is oxidized by air to produce H2O2H_2O_2 and 2-ethylanthraquinone, which is then reduced back to 2-ethylanthraquinol. This regeneration of the organic reactant makes the process continuous and minimizes waste, offering a sustainable way to produce large quantities of hydrogen peroxide.

Revise in 30 seconds

  • Formula:H2O2H_2O_2
  • Oxidation State of O:1
  • Structure:Non-planar, 'open book' structure. Dihedral angle (gas) 111.5\approx 111.5^\circ, (solid) 90.2\approx 90.2^\circ.
  • Stability:Thermodynamically unstable, decomposes to H2O+O2H_2O + O_2.
  • Decomposition:2H2O2(l)2H2O(l)+O2(g)2H_2O_2(l) \rightarrow 2H_2O(l) + O_2(g). Accelerated by light, heat, metal ions (Fe2+Fe^{2+}), rough surfaces.
  • Storage:Dark, wax-lined bottles with stabilizers (urea, acetanilide).
  • Redox Nature:Both oxidizing and reducing agent.

- Oxidizing Agent (acidic): H2O2+2H++2e2H2OH_2O_2 + 2H^+ + 2e^- \rightarrow 2H_2O - Oxidizing Agent (basic): H2O2+2e2OHH_2O_2 + 2e^- \rightarrow 2OH^- - Reducing Agent (acidic): H2O2O2+2H++2eH_2O_2 \rightarrow O_2 + 2H^+ + 2e^- - Reducing Agent (basic): H2O2+2OHO2+2H2O+2eH_2O_2 + 2OH^- \rightarrow O_2 + 2H_2O + 2e^-

  • Preparation (Industrial):Auto-oxidation of 2-ethylanthraquinol.
  • Preparation (Lab):BaO2+H2SO4BaSO4+H2O2BaO_2 + H_2SO_4 \rightarrow BaSO_4 + H_2O_2
  • Uses:Bleaching, antiseptic, rocket fuel oxidizer.

To remember H2O2H_2O_2 properties: Hydrogen Peroxide Often Decomposes Rapidly.

  • Hydrogen peroxide
  • Preparation (Anthraquinone, Barium Peroxide)
  • Open book structure
  • Decomposition (light, heat, catalysts)
  • Redox agent (Oxidizing AND Reducing)