Alkenes

Updated 22 Mar 2026
Sub-topics
3 sub-topics
  1. 1Nomenclature, Structure of Double BondHigh yield
  2. 2Geometrical IsomerismHigh yield
  3. 3Physical and Chemical PropertiesHigh yield

Alkenes are a class of unsaturated hydrocarbons characterized by the presence of at least one carbon-carbon double bond (C=CC=C) in their molecular structure. Their general molecular formula for acyclic alkenes with one double bond is CnH2nC_nH_{2n}, where 'n' represents the number of carbon atoms and must be greater than or equal to 2. The double bond consists of one sigma (σ\sigma) bond and one pi …

Quick Summary

Alkenes are unsaturated hydrocarbons containing at least one carbon-carbon double bond (C=CC=C). Their general formula is CnH2nC_nH_{2n}. Each carbon in the double bond is sp2sp^2 hybridized, resulting in a trigonal planar geometry and restricted rotation, which gives rise to cis-trans isomerism.

The double bond consists of a strong sigma (σ\sigma) bond and a weaker, more exposed pi (π\pi) bond, making alkenes electron-rich and highly reactive towards electrophiles. \n\nNomenclature involves finding the longest chain containing the double bond, numbering to give the double bond the lowest locant, and changing the '-ane' suffix to '-ene'.

\n\nAlkenes are prepared by elimination reactions like dehydration of alcohols and dehydrohalogenation of alkyl halides (often following Saytzeff's rule), or by partial hydrogenation of alkynes. \n\nTheir characteristic reactions are electrophilic additions, including hydrogenation, halogenation (anti-addition), hydrohalogenation (Markovnikov's rule, or anti-Markovnikov with HBr/peroxides), and hydration.

They also undergo oxidation (Baeyer's test, ozonolysis) and polymerization. These reactions are fundamental to their industrial applications, such as the production of plastics like polyethylene and polypropylene, and their role in natural processes like fruit ripening.

Full explanation

Alkenes represent a pivotal class of organic compounds, serving as the cornerstone for understanding unsaturated hydrocarbons and their characteristic reactivity. Their defining feature, the carbon-carbon double bond (C=CC=C), imparts unique structural, physical, and chemical properties that are critical for NEET aspirants to master.

\n\n1. Conceptual Foundation: Structure and Bonding\nAt the heart of alkene chemistry lies the C=CC=C double bond. Each carbon atom involved in the double bond is sp2sp^2 hybridized. This means one s-orbital and two p-orbitals on each carbon atom mix to form three equivalent sp2sp^2 hybrid orbitals.

These sp2sp^2 orbitals lie in a plane, oriented at approximately 120120^\circ to each other, giving the double-bonded carbons a trigonal planar geometry. The remaining unhybridized p-orbital on each carbon atom is perpendicular to this plane.

\n\nThe C=CC=C double bond is formed by two distinct interactions: \n* **Sigma (σ\sigma) bond:** This is formed by the head-on overlap of one sp2sp^2 hybrid orbital from each carbon atom. This bond is strong and lies along the internuclear axis.

\n* **Pi (π\pi) bond:** This is formed by the sideways overlap of the two unhybridized p-orbitals, one from each carbon atom. The electron density of the pi bond lies above and below the plane of the sigma bond.

The pi bond is weaker than the sigma bond and is more exposed, making its electrons readily available for reaction.\n\nThis sp2sp^2 hybridization and the presence of the pi bond have several consequences:\n* Restricted Rotation: Unlike single bonds, where free rotation around the bond axis is possible, the pi bond prevents free rotation around the C=CC=C axis.

This restricted rotation is responsible for geometrical isomerism (cis-trans isomerism) in alkenes.\n* Bond Length and Strength: A C=CC=C double bond is shorter (approx. 1.34A˚1.34\,\text{Å}) and stronger (approx.

611kJ/mol611\,\text{kJ/mol}) than a CCC-C single bond (approx. 1.54A˚1.54\,\text{Å}, 348kJ/mol348\,\text{kJ/mol}). However, the pi bond itself is weaker than the sigma bond, which is why it's the first to break during addition reactions.

\n* Electron Richness: The exposed pi electrons make alkenes electron-rich, acting as nucleophiles and readily reacting with electrophiles.\n\n2. Key Principles and Laws: Nomenclature and Isomerism\n\na) IUPAC Nomenclature:\nNaming alkenes follows a systematic approach:\n1.

Longest Chain: Identify the longest continuous carbon chain that includes the double bond.\n2. Parent Name: Replace the '-ane' suffix of the corresponding alkane with '-ene'.\n3. Numbering: Number the carbon chain from the end that gives the carbon atoms of the double bond the lowest possible numbers.

The position of the double bond is indicated by the lower number of the two carbons involved.\n4. Substituents: Name and number any substituents, listing them alphabetically before the parent name.

\n5. Multiple Double Bonds: If there are two double bonds, use '-adiene'; for three, use '-atriene', and so on. The positions of all double bonds must be indicated.\n\n*Example:* CH3CH=CHCH3CH_3-CH=CH-CH_3 is But-2-ene.

CH2=CHCH2CH3CH_2=CH-CH_2-CH_3 is But-1-ene.\n\nb) Isomerism:\nAlkenes exhibit various types of isomerism:\n* Structural Isomerism:\n * Chain Isomerism: Different carbon skeletons (e.g., but-1-ene and 2-methylpropene).

\n * Position Isomerism: Different positions of the double bond (e.g., but-1-ene and but-2-ene).\n * Functional Isomerism: Alkenes are functional isomers with cycloalkanes (e.g., propene and cyclopropane, both C3H6C_3H_6).

\n* Geometrical (cis-trans) Isomerism: This arises due to the restricted rotation around the C=CC=C double bond. For geometrical isomerism to exist, each carbon atom of the double bond must be attached to two different groups.

\n * cis-isomer: Identical groups are on the same side of the double bond.\n * trans-isomer: Identical groups are on opposite sides of the double bond.\n * Example: But-2-ene exists as cis-but-2-ene and trans-but-2-ene.

Trans isomers are generally more stable due to reduced steric hindrance.\n\n3. Preparation of Alkenes\nAlkenes can be synthesized through various elimination reactions:\n* Dehydration of Alcohols: Alcohols lose a molecule of water when heated with strong acids (e.

g., conc. H2SO4H_2SO_4, H3PO4H_3PO_4, Al2O3Al_2O_3) at high temperatures. This is typically an E1 or E2 mechanism, often following Saytzeff's rule (more substituted alkene is the major product). \n $$R-CH_2-CH_2-OH \xrightarrow{Conc.

\,H_2SO_4, \Delta} R-CH=CH_2 + H_2O$$ \n* Dehydrohalogenation of Alkyl Halides: Alkyl halides lose a molecule of hydrogen halide (HX) when heated with a strong base (e.g., alcoholic KOH). This is an E2 reaction and also follows Saytzeff's rule.

\n

RCH2CH2XAlc.KOH,ΔRCH=CH2+HXR-CH_2-CH_2-X \xrightarrow{Alc.\,KOH, \Delta} R-CH=CH_2 + HX
\n* Dehalogenation of Vicinal Dihalides: Vicinal dihalides (halogens on adjacent carbons) react with zinc dust in alcohol to remove two halogen atoms, forming an alkene.

\n

RCHBrCHBrRZn,AlcoholRCH=CHR+ZnBr2R-CHBr-CHBr-R' \xrightarrow{Zn, \,Alcohol} R-CH=CH-R' + ZnBr_2
\n* Partial Hydrogenation of Alkynes: Alkynes can be partially hydrogenated to alkenes using specific catalysts.\n * **Lindlar's Catalyst (Pd/CaCO3Pd/CaCO_3 poisoned with quinoline/sulfur):** Gives cis-alkenes (syn addition).

\n

RCCRH2,LindlarsCatalystRCH=CHR(cis)R-C\equiv C-R' \xrightarrow{H_2, \,Lindlar's \,Catalyst} R-CH=CH-R' \, (cis)
\n * **Sodium in Liquid Ammonia (Na/liq.NH3Na/liq.\,NH_3, Birch Reduction):** Gives trans-alkenes (anti addition). \n $$R-C\equiv C-R' \xrightarrow{Na, \,liq.

\,NH_3} R-CH=CH-R' \, (trans)$\n\n4.ReactionsofAlkenes\nAlkenesarecharacterizedbyelectrophilicadditionreactions,wherethepibondbreaks,andnewgroupsaddacrossthedoublebond.\n\na)ElectrophilicAdditionReactions:\nHydrogenation(Additionof\n\n**4. Reactions of Alkenes**\nAlkenes are characterized by electrophilic addition reactions, where the pi bond breaks, and new groups add across the double bond.\n\n**a) Electrophilic Addition Reactions:**\n* **Hydrogenation (Addition ofH_2$):** Alkenes react with hydrogen in the presence of a catalyst (Ni, Pt, Pd) to form alkanes.

This is a syn addition. \n

RCH=CHR+H2Ni/Pt/PdRCH2CH2RR-CH=CH-R' + H_2 \xrightarrow{Ni/Pt/Pd} R-CH_2-CH_2-R'
\n* **Halogenation (Addition of X2X_2, where X=Cl,BrX=Cl, Br):** Alkenes react with halogens (e.g., Br2Br_2 in CCl4CCl_4) to form vicinal dihalides.

This is an anti addition, proceeding via a cyclic halonium ion intermediate. The decolorization of bromine water is a characteristic test for unsaturation. \n

RCH=CHR+Br2CCl4RCHBrCHBrRR-CH=CH-R' + Br_2 \xrightarrow{CCl_4} R-CHBr-CHBr-R'
\n* **Hydrohalogenation (Addition of HXHX, where X=Cl,Br,IX=Cl, Br, I):** Alkenes react with hydrogen halides to form alkyl halides.

This reaction follows Markovnikov's Rule: The hydrogen atom of HX adds to the carbon atom of the double bond that already has more hydrogen atoms, and the halogen adds to the carbon with fewer hydrogen atoms.

This is due to the formation of a more stable carbocation intermediate. \n

CH3CH=CH2+HBrCH3CHBrCH3(2bromopropane)CH_3-CH=CH_2 + HBr \longrightarrow CH_3-CHBr-CH_3 \, (2-bromopropane)
\n * Anti-Markovnikov's Rule (Peroxide Effect): In the presence of peroxides (e.

g., benzoyl peroxide), the addition of HBr to unsymmetrical alkenes occurs in an anti-Markovnikov fashion. This is a free radical mechanism, where the bromine radical adds first to form a more stable carbon radical.

This effect is observed only with HBr, not HCl or HI. \n

CH3CH=CH2+HBrPeroxideCH3CH2CH2Br(1bromopropane)CH_3-CH=CH_2 + HBr \xrightarrow{Peroxide} CH_3-CH_2-CH_2Br \, (1-bromopropane)
\n* **Hydration (Addition of H2OH_2O):** Alkenes react with water in the presence of an acid catalyst (e.

g., dilute H2SO4H_2SO_4) to form alcohols. This also follows Markovnikov's rule, proceeding via a carbocation intermediate. \n

RCH=CH2+H2OH+RCH(OH)CH3R-CH=CH_2 + H_2O \xrightarrow{H^+} R-CH(OH)-CH_3
\n\nb) Oxidation Reactions:\n* Baeyer's Test (Hydroxylation): Cold, dilute, alkaline potassium permanganate (KMnO4KMnO_4) oxidizes alkenes to vicinal diols (glycols).

The purple color of KMnO4KMnO_4 disappears, and a brown precipitate of MnO2MnO_2 forms. This is a syn addition and a characteristic test for unsaturation. \n

RCH=CHRCold,dilute,alkalineKMnO4RCH(OH)CH(OH)RR-CH=CH-R' \xrightarrow{Cold, \,dilute, \,alkaline \,KMnO_4} R-CH(OH)-CH(OH)-R'
\n* Ozonolysis: Alkenes react with ozone (O3O_3) to form ozonides, which are then cleaved by reduction (with Zn/H2OZn/H_2O) or oxidation (with H2O2H_2O_2) to yield carbonyl compounds (aldehydes and ketones).

This reaction is highly useful for locating the position of the double bond. \n * **Reductive Ozonolysis (Zn/H2OZn/H_2O):** Produces aldehydes and ketones. \n

R2C=CR21.O3;2.Zn/H2OR2C=O+O=CR2R_2C=CR_2 \xrightarrow{1.\,O_3; \,2.\,Zn/H_2O} R_2C=O + O=CR_2
\n * **Oxidative Ozonolysis (H2O2H_2O_2):** Produces carboxylic acids (from aldehydes) and ketones.

\n

R2C=CHR1.O3;2.H2O2R2C=O+RCOOHR_2C=CHR' \xrightarrow{1.\,O_3; \,2.\,H_2O_2} R_2C=O + R'COOH
\n* Combustion: Alkenes burn in the presence of oxygen to produce carbon dioxide and water, releasing a large amount of heat. \n
CnH2n+3n2O2nCO2+nH2OC_nH_{2n} + \frac{3n}{2}O_2 \longrightarrow nCO_2 + nH_2O
\n\nc) Polymerization:\nAlkenes undergo addition polymerization, where many alkene molecules (monomers) add to each other to form a long chain polymer.

Ethene polymerizes to polyethylene, and propene to polypropylene, both widely used plastics. \n

n(CH2=CH2)HighT,P,Catalyst(CH2CH2)nn(CH_2=CH_2) \xrightarrow{High \,T, \,P, \,Catalyst} -(CH_2-CH_2)_n-
\n\n5. Real-World Applications\n* Ethene (Ethylene): The simplest alkene, it is a crucial industrial chemical.

It acts as a plant hormone promoting fruit ripening. It's the primary monomer for polyethylene, a widely used plastic. It's also used to synthesize ethanol, ethylene glycol (antifreeze), and vinyl chloride (for PVC).

\n* Propene (Propylene): Used to produce polypropylene, another important plastic. Also a precursor for isopropanol and cumene (for phenol synthesis). \n* Butadiene: Used in the production of synthetic rubber.

\n\n6. Common Misconceptions and NEET-Specific Angle\n* Markovnikov's Rule vs. Anti-Markovnikov's Rule: Students often confuse when to apply which rule. Remember, the peroxide effect is only for HBr addition and proceeds via a free radical mechanism, leading to anti-Markovnikov product.

Other HX additions follow Markovnikov's rule (carbocation mechanism).\n* Stereochemistry: Understanding syn vs. anti addition is crucial. Hydrogenation (catalytic) and Baeyer's test are syn additions.

Halogenation is anti addition. This impacts the stereoisomers formed.\n* Carbocation Stability: The stability of carbocations (3>2>1>methyl3^\circ > 2^\circ > 1^\circ > methyl) dictates the regioselectivity of many electrophilic addition reactions (Markovnikov's rule) and also explains rearrangements in E1/addition reactions.

\n* Saytzeff's Rule: This rule, applicable to elimination reactions (dehydration, dehydrohalogenation), states that the major product is the more substituted (more stable) alkene. Students often forget to apply it when multiple alkene products are possible.

\n* Distinguishing Tests: Knowing the specific reagents and observations for Baeyer's test (cold, dilute, alkaline KMnO4KMnO_4) and bromine water test is vital for identifying unsaturation.\n* Ozonolysis Products: Accurately predicting the products of ozonolysis (aldehydes, ketones, or carboxylic acids depending on workup) is a frequently tested concept.

Remember that reductive workup (Zn/H2OZn/H_2O) preserves aldehydes, while oxidative workup (H2O2H_2O_2) oxidizes them to carboxylic acids.

Key Concepts

Geometrical (cis-trans) Isomerism

Geometrical isomerism, also known as cis-trans isomerism, arises in alkenes due to the restricted rotation…

Markovnikov's Rule and Carbocation Stability

Markovnikov's rule governs the regioselectivity of electrophilic addition to unsymmetrical alkenes. It states…

Saytzeff's Rule in Elimination Reactions

Saytzeff's rule (also spelled Zaitsev's rule) is an empirical rule used to predict the major product in…

Often confused with

Side-by-side differences the NEET paper likes to test.

Alkenes vs Alkanes and Alkynes
AspectAlkenesAlkanes and Alkynes
General Formula (acyclic, one bond)Alkanes: $C_nH_{2n+2}$Alkenes: $C_nH_{2n}$
Type of C-C BondsOnly single bondsAt least one double bond
Hybridization of C-C bond carbons$sp^3$$sp^2$
Geometry around C-C bond carbonsTetrahedralTrigonal planar
Characteristic ReactionsFree radical substitutionElectrophilic addition
Degree of UnsaturationSaturated (0)Unsaturated (1)
Test for UnsaturationNo reaction with $Br_2/CCl_4$ or Baeyer's reagentDecolorizes $Br_2/CCl_4$ and Baeyer's reagent

Alkanes are saturated hydrocarbons with only single bonds, exhibiting sp3sp^3 hybridization and tetrahedral geometry, primarily undergoing free radical substitution. Alkenes, with at least one double bond, are unsaturated, feature sp2sp^2 hybridization and trigonal planar geometry, and are characterized by electrophilic addition reactions.

Alkynes, containing at least one triple bond, are even more unsaturated, possess spsp hybridization and linear geometry, and also undergo electrophilic addition, often twice across the triple bond. The degree of unsaturation dictates their reactivity and the types of reactions they readily undergo, with alkenes and alkynes being much more reactive than alkanes towards electrophiles.

Why it is tested: For NEET, understanding these fundamental differences is crucial for predicting reaction products, identifying unknown compounds through chemical tests, and grasping the underlying principles of organic reactivity. Questions often involve distinguishing between these hydrocarbon types based on their reactions or structural features.

Questions students ask

6 answered on this topic.

What is the primary difference in bonding between alkanes and alkenes?

The fundamental difference lies in the carbon-carbon bonds. Alkanes contain only carbon-carbon single bonds, which allow free rotation around the bond axis. Alkenes, on the other hand, possess at least one carbon-carbon double bond.

This double bond consists of a strong sigma (σ\sigma) bond and a weaker pi (π\pi) bond. The presence of the pi bond restricts rotation around the C=CC=C axis and makes alkenes electron-rich, leading to their characteristic electrophilic addition reactions, which are not typical for alkanes.

Why do alkenes undergo addition reactions, while alkanes undergo substitution reactions?

Alkenes are unsaturated due to the presence of a pi (π\pi) bond, whose electrons are relatively exposed and loosely held. This makes the pi bond a site of high electron density, readily attacked by electron-deficient species (electrophiles).

The pi bond breaks, and new atoms or groups add across the double bond, converting the alkene into a saturated product. Alkanes, being saturated, have only strong C-C and C-H sigma bonds. Breaking these bonds requires significant energy, and they are not easily attacked by electrophiles.

Instead, alkanes typically undergo substitution reactions, where a hydrogen atom is replaced by another atom or group, usually via a free radical mechanism under harsh conditions (e.g., halogenation in UV light).

Explain Markovnikov's rule with an example.

Markovnikov's rule is a regioselectivity rule in organic chemistry, particularly for the addition of unsymmetrical reagents (like HX or H2OH_2O) to unsymmetrical alkenes. It states that the hydrogen atom of the reagent adds to the carbon atom of the double bond that already has a greater number of hydrogen atoms, while the electronegative part adds to the carbon atom with fewer hydrogen atoms.

For example, in the addition of HBr to propene (CH3CH=CH2CH_3-CH=CH_2), the hydrogen of HBr adds to the CH2CH_2 carbon, and bromine adds to the CHCH carbon, yielding 2-bromopropane (CH3CHBrCH3CH_3-CHBr-CH_3) as the major product.

This is because the reaction proceeds via the formation of the more stable secondary carbocation intermediate.

What is the significance of the peroxide effect in alkene reactions?

The peroxide effect, also known as the Kharasch effect, is a specific phenomenon observed during the addition of HBr (and only HBr, not HCl or HI) to unsymmetrical alkenes in the presence of organic peroxides.

It leads to an 'anti-Markovnikov' addition, meaning the hydrogen adds to the carbon with fewer hydrogens, and the bromine adds to the carbon with more hydrogens. This occurs via a free radical mechanism, where the peroxide initiates the formation of bromine radicals, which then add to the alkene to form the more stable carbon radical, ultimately leading to the anti-Markovnikov product.

This effect is crucial for synthesizing 1-bromoalkanes from terminal alkenes.

How can you distinguish between an alkene and an alkane using simple chemical tests?

Two common tests can distinguish alkenes from alkanes, both relying on the alkene's unsaturation. The Bromine Water Test involves adding bromine water (reddish-brown) to the sample. Alkenes will rapidly decolorize the bromine water as bromine adds across the double bond, forming a colorless vicinal dibromide.

Alkanes, being saturated, do not react with bromine water in the absence of UV light, so the color persists. The Baeyer's Test uses cold, dilute, alkaline potassium permanganate solution (purple).

Alkenes will decolorize the purple solution and form a brown precipitate of manganese dioxide (MnO2MnO_2) as they are oxidized to diols. Alkanes do not react under these mild conditions, and the purple color remains.

What is ozonolysis and why is it important?

Ozonolysis is a powerful reaction used to cleave carbon-carbon double bonds in alkenes (and triple bonds in alkynes) using ozone (O3O_3), followed by a reductive or oxidative workup. The alkene first reacts with ozone to form an unstable ozonide intermediate, which is then cleaved.

Reductive workup (e.g., with Zn/H2OZn/H_2O or Me2SMe_2S) yields aldehydes and ketones. Oxidative workup (e.g., with H2O2H_2O_2) converts any aldehydes formed into carboxylic acids, while ketones remain unchanged.

Ozonolysis is incredibly important for determining the position of the double bond in an unknown alkene, as the products formed directly reveal the structure of the original alkene.

Revise in 30 seconds

  • General Formula: Acyclic alkenes CnH2nC_nH_{2n}.\n- Double Bond: One σ\sigma and one π\pi bond. Restricted rotation.\n- Hybridization: sp2sp^2 for double-bonded carbons, trigonal planar geometry (120120^\circ).\n- Nomenclature: '-ene' suffix, lowest locant for double bond.\n- Isomerism: Structural (chain, position, functional with cycloalkanes), Geometrical (cis-trans, requires two different groups on each C of C=CC=C).\n- Preparation:\n - Dehydration of alcohols (H2SO4/ΔH_2SO_4/\Delta): Saytzeff's rule.\n - Dehydrohalogenation of alkyl halides (Alc. KOH/Δ\Delta): Saytzeff's rule.\n - Dehalogenation of vicinal dihalides (Zn/AlcoholZn/Alcohol).\n - Partial hydrogenation of alkynes:\n - Lindlar's catalyst (H2/Pd/CaCO3H_2/Pd/CaCO_3, quinoline/sulfur): cis-alkene (syn).\n - Na/liq.NH3Na/liq.\,NH_3: trans-alkene (anti).\n- Reactions (Electrophilic Addition):\n - Hydrogenation (H2/Ni,Pt,PdH_2/Ni, Pt, Pd): Syn addition, forms alkane.\n - Halogenation (X2/CCl4X_2/CCl_4): Anti addition, forms vicinal dihalide. Decolorizes Br2Br_2 water.\n - Hydrohalogenation (HXHX): Markovnikov's rule (H to C with more H, X to C with fewer H). Carbocation intermediate.\n - Anti-Markovnikov (HBr/PeroxideHBr/Peroxide): Free radical mechanism, H to C with fewer H, Br to C with more H.\n - Hydration (H2O/H+H_2O/H^+): Markovnikov's rule, forms alcohol.\n- Oxidation:\n - Baeyer's test (Cold, dil., alk. KMnO4KMnO_4): Syn addition, forms vicinal diol (glycol). Decolorizes KMnO4KMnO_4, brown MnO2MnO_2 ppt.\n - Ozonolysis (O3O_3 then Zn/H2OZn/H_2O or H2O2H_2O_2): Cleaves C=CC=C bond, forms aldehydes/ketones (reductive) or carboxylic acids/ketones (oxidative).\n- Polymerization: Addition polymerization (e.g., polyethylene).

Markovnikov Has More Hydrogens, Anti-Markovnikov Has Less Hydrogens (for HBr/peroxide). \n\nThis mnemonic helps remember the regioselectivity of HBr addition to unsymmetrical alkenes.

'Markovnikov Has More Hydrogens' means the hydrogen of HBr adds to the carbon of the double bond that already has more hydrogen atoms. 'Anti-Markovnikov Has Less Hydrogens' means, in the presence of peroxide, the hydrogen of HBr adds to the carbon of the double bond that has fewer hydrogen atoms.