Chemistry·Explained

Alkenes — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

Alkenes represent a pivotal class of organic compounds, serving as the cornerstone for understanding unsaturated hydrocarbons and their characteristic reactivity. Their defining feature, the carbon-carbon double bond (C=CC=C), imparts unique structural, physical, and chemical properties that are critical for NEET aspirants to master.

\n\n1. Conceptual Foundation: Structure and Bonding\nAt the heart of alkene chemistry lies the C=CC=C double bond. Each carbon atom involved in the double bond is sp2sp^2 hybridized. This means one s-orbital and two p-orbitals on each carbon atom mix to form three equivalent sp2sp^2 hybrid orbitals.

These sp2sp^2 orbitals lie in a plane, oriented at approximately 120120^\circ to each other, giving the double-bonded carbons a trigonal planar geometry. The remaining unhybridized p-orbital on each carbon atom is perpendicular to this plane.

\n\nThe C=CC=C double bond is formed by two distinct interactions: \n* **Sigma (σ\sigma) bond:** This is formed by the head-on overlap of one sp2sp^2 hybrid orbital from each carbon atom. This bond is strong and lies along the internuclear axis.

\n* **Pi (π\pi) bond:** This is formed by the sideways overlap of the two unhybridized p-orbitals, one from each carbon atom. The electron density of the pi bond lies above and below the plane of the sigma bond.

The pi bond is weaker than the sigma bond and is more exposed, making its electrons readily available for reaction.\n\nThis sp2sp^2 hybridization and the presence of the pi bond have several consequences:\n* Restricted Rotation: Unlike single bonds, where free rotation around the bond axis is possible, the pi bond prevents free rotation around the C=CC=C axis.

This restricted rotation is responsible for geometrical isomerism (cis-trans isomerism) in alkenes.\n* Bond Length and Strength: A C=CC=C double bond is shorter (approx. 1.34A˚1.34\,\text{Å}) and stronger (approx.

611kJ/mol611\,\text{kJ/mol}) than a CCC-C single bond (approx. 1.54A˚1.54\,\text{Å}, 348kJ/mol348\,\text{kJ/mol}). However, the pi bond itself is weaker than the sigma bond, which is why it's the first to break during addition reactions.

\n* Electron Richness: The exposed pi electrons make alkenes electron-rich, acting as nucleophiles and readily reacting with electrophiles.\n\n2. Key Principles and Laws: Nomenclature and Isomerism\n\na) IUPAC Nomenclature:\nNaming alkenes follows a systematic approach:\n1.

Longest Chain: Identify the longest continuous carbon chain that *includes* the double bond.\n2. Parent Name: Replace the '-ane' suffix of the corresponding alkane with '-ene'.\n3. Numbering: Number the carbon chain from the end that gives the carbon atoms of the double bond the lowest possible numbers.

The position of the double bond is indicated by the lower number of the two carbons involved.\n4. Substituents: Name and number any substituents, listing them alphabetically before the parent name.

\n5. Multiple Double Bonds: If there are two double bonds, use '-adiene'; for three, use '-atriene', and so on. The positions of all double bonds must be indicated.\n\n*Example:* CH3CH=CHCH3CH_3-CH=CH-CH_3 is But-2-ene.

CH2=CHCH2CH3CH_2=CH-CH_2-CH_3 is But-1-ene.\n\nb) Isomerism:\nAlkenes exhibit various types of isomerism:\n* Structural Isomerism:\n * Chain Isomerism: Different carbon skeletons (e.g., but-1-ene and 2-methylpropene).

\n * Position Isomerism: Different positions of the double bond (e.g., but-1-ene and but-2-ene).\n * Functional Isomerism: Alkenes are functional isomers with cycloalkanes (e.g., propene and cyclopropane, both C3H6C_3H_6).

\n* Geometrical (cis-trans) Isomerism: This arises due to the restricted rotation around the C=CC=C double bond. For geometrical isomerism to exist, each carbon atom of the double bond must be attached to two *different* groups.

\n * cis-isomer: Identical groups are on the same side of the double bond.\n * trans-isomer: Identical groups are on opposite sides of the double bond.\n * *Example:* But-2-ene exists as cis-but-2-ene and trans-but-2-ene.

Trans isomers are generally more stable due to reduced steric hindrance.\n\n3. Preparation of Alkenes\nAlkenes can be synthesized through various elimination reactions:\n* Dehydration of Alcohols: Alcohols lose a molecule of water when heated with strong acids (e.

g., conc. H2SO4H_2SO_4, H3PO4H_3PO_4, Al2O3Al_2O_3) at high temperatures. This is typically an E1 or E2 mechanism, often following Saytzeff's rule (more substituted alkene is the major product). \n $$R-CH_2-CH_2-OH \xrightarrow{Conc.

\,H_2SO_4, \Delta} R-CH=CH_2 + H_2O$$ \n* Dehydrohalogenation of Alkyl Halides: Alkyl halides lose a molecule of hydrogen halide (HX) when heated with a strong base (e.g., alcoholic KOH). This is an E2 reaction and also follows Saytzeff's rule.

\n

RCH2CH2XAlc.KOH,ΔRCH=CH2+HXR-CH_2-CH_2-X \xrightarrow{Alc.\,KOH, \Delta} R-CH=CH_2 + HX
\n* Dehalogenation of Vicinal Dihalides: Vicinal dihalides (halogens on adjacent carbons) react with zinc dust in alcohol to remove two halogen atoms, forming an alkene.

\n

RCHBrCHBrRZn,AlcoholRCH=CHR+ZnBr2R-CHBr-CHBr-R' \xrightarrow{Zn, \,Alcohol} R-CH=CH-R' + ZnBr_2
\n* Partial Hydrogenation of Alkynes: Alkynes can be partially hydrogenated to alkenes using specific catalysts.\n * **Lindlar's Catalyst (Pd/CaCO3Pd/CaCO_3 poisoned with quinoline/sulfur):** Gives cis-alkenes (syn addition).

\n

RCCRH2,LindlarsCatalystRCH=CHR(cis)R-C\equiv C-R' \xrightarrow{H_2, \,Lindlar's \,Catalyst} R-CH=CH-R' \, (cis)
\n * **Sodium in Liquid Ammonia (Na/liq.NH3Na/liq.\,NH_3, Birch Reduction):** Gives trans-alkenes (anti addition). \n $$R-C\equiv C-R' \xrightarrow{Na, \,liq.

\,NH_3} R-CH=CH-R' \, (trans)$\n\n4.ReactionsofAlkenes\nAlkenesarecharacterizedbyelectrophilicadditionreactions,wherethepibondbreaks,andnewgroupsaddacrossthedoublebond.\n\na)ElectrophilicAdditionReactions:\nHydrogenation(Additionof\n\n**4. Reactions of Alkenes**\nAlkenes are characterized by electrophilic addition reactions, where the pi bond breaks, and new groups add across the double bond.\n\n**a) Electrophilic Addition Reactions:**\n* **Hydrogenation (Addition ofH_2$):** Alkenes react with hydrogen in the presence of a catalyst (Ni, Pt, Pd) to form alkanes.

This is a syn addition. \n

RCH=CHR+H2Ni/Pt/PdRCH2CH2RR-CH=CH-R' + H_2 \xrightarrow{Ni/Pt/Pd} R-CH_2-CH_2-R'
\n* **Halogenation (Addition of X2X_2, where X=Cl,BrX=Cl, Br):** Alkenes react with halogens (e.g., Br2Br_2 in CCl4CCl_4) to form vicinal dihalides.

This is an anti addition, proceeding via a cyclic halonium ion intermediate. The decolorization of bromine water is a characteristic test for unsaturation. \n

RCH=CHR+Br2CCl4RCHBrCHBrRR-CH=CH-R' + Br_2 \xrightarrow{CCl_4} R-CHBr-CHBr-R'
\n* **Hydrohalogenation (Addition of HXHX, where X=Cl,Br,IX=Cl, Br, I):** Alkenes react with hydrogen halides to form alkyl halides.

This reaction follows Markovnikov's Rule: The hydrogen atom of HX adds to the carbon atom of the double bond that already has more hydrogen atoms, and the halogen adds to the carbon with fewer hydrogen atoms.

This is due to the formation of a more stable carbocation intermediate. \n

CH3CH=CH2+HBrCH3CHBrCH3(2bromopropane)CH_3-CH=CH_2 + HBr \longrightarrow CH_3-CHBr-CH_3 \, (2-bromopropane)
\n * Anti-Markovnikov's Rule (Peroxide Effect): In the presence of peroxides (e.

g., benzoyl peroxide), the addition of HBr to unsymmetrical alkenes occurs in an anti-Markovnikov fashion. This is a free radical mechanism, where the bromine radical adds first to form a more stable carbon radical.

This effect is observed only with HBr, not HCl or HI. \n

CH3CH=CH2+HBrPeroxideCH3CH2CH2Br(1bromopropane)CH_3-CH=CH_2 + HBr \xrightarrow{Peroxide} CH_3-CH_2-CH_2Br \, (1-bromopropane)
\n* **Hydration (Addition of H2OH_2O):** Alkenes react with water in the presence of an acid catalyst (e.

g., dilute H2SO4H_2SO_4) to form alcohols. This also follows Markovnikov's rule, proceeding via a carbocation intermediate. \n

RCH=CH2+H2OH+RCH(OH)CH3R-CH=CH_2 + H_2O \xrightarrow{H^+} R-CH(OH)-CH_3
\n\nb) Oxidation Reactions:\n* Baeyer's Test (Hydroxylation): Cold, dilute, alkaline potassium permanganate (KMnO4KMnO_4) oxidizes alkenes to vicinal diols (glycols).

The purple color of KMnO4KMnO_4 disappears, and a brown precipitate of MnO2MnO_2 forms. This is a syn addition and a characteristic test for unsaturation. \n

RCH=CHRCold,dilute,alkalineKMnO4RCH(OH)CH(OH)RR-CH=CH-R' \xrightarrow{Cold, \,dilute, \,alkaline \,KMnO_4} R-CH(OH)-CH(OH)-R'
\n* Ozonolysis: Alkenes react with ozone (O3O_3) to form ozonides, which are then cleaved by reduction (with Zn/H2OZn/H_2O) or oxidation (with H2O2H_2O_2) to yield carbonyl compounds (aldehydes and ketones).

This reaction is highly useful for locating the position of the double bond. \n * **Reductive Ozonolysis (Zn/H2OZn/H_2O):** Produces aldehydes and ketones. \n

R2C=CR21.O3;2.Zn/H2OR2C=O+O=CR2R_2C=CR_2 \xrightarrow{1.\,O_3; \,2.\,Zn/H_2O} R_2C=O + O=CR_2
\n * **Oxidative Ozonolysis (H2O2H_2O_2):** Produces carboxylic acids (from aldehydes) and ketones.

\n

R2C=CHR1.O3;2.H2O2R2C=O+RCOOHR_2C=CHR' \xrightarrow{1.\,O_3; \,2.\,H_2O_2} R_2C=O + R'COOH
\n* Combustion: Alkenes burn in the presence of oxygen to produce carbon dioxide and water, releasing a large amount of heat. \n
CnH2n+3n2O2nCO2+nH2OC_nH_{2n} + \frac{3n}{2}O_2 \longrightarrow nCO_2 + nH_2O
\n\nc) Polymerization:\nAlkenes undergo addition polymerization, where many alkene molecules (monomers) add to each other to form a long chain polymer.

Ethene polymerizes to polyethylene, and propene to polypropylene, both widely used plastics. \n

n(CH2=CH2)HighT,P,Catalyst(CH2CH2)nn(CH_2=CH_2) \xrightarrow{High \,T, \,P, \,Catalyst} -(CH_2-CH_2)_n-
\n\n5. Real-World Applications\n* Ethene (Ethylene): The simplest alkene, it is a crucial industrial chemical.

It acts as a plant hormone promoting fruit ripening. It's the primary monomer for polyethylene, a widely used plastic. It's also used to synthesize ethanol, ethylene glycol (antifreeze), and vinyl chloride (for PVC).

\n* Propene (Propylene): Used to produce polypropylene, another important plastic. Also a precursor for isopropanol and cumene (for phenol synthesis). \n* Butadiene: Used in the production of synthetic rubber.

\n\n6. Common Misconceptions and NEET-Specific Angle\n* Markovnikov's Rule vs. Anti-Markovnikov's Rule: Students often confuse when to apply which rule. Remember, the peroxide effect is *only* for HBr addition and proceeds via a free radical mechanism, leading to anti-Markovnikov product.

Other HX additions follow Markovnikov's rule (carbocation mechanism).\n* Stereochemistry: Understanding syn vs. anti addition is crucial. Hydrogenation (catalytic) and Baeyer's test are syn additions.

Halogenation is anti addition. This impacts the stereoisomers formed.\n* Carbocation Stability: The stability of carbocations (3>2>1>methyl3^\circ > 2^\circ > 1^\circ > methyl) dictates the regioselectivity of many electrophilic addition reactions (Markovnikov's rule) and also explains rearrangements in E1/addition reactions.

\n* Saytzeff's Rule: This rule, applicable to elimination reactions (dehydration, dehydrohalogenation), states that the major product is the more substituted (more stable) alkene. Students often forget to apply it when multiple alkene products are possible.

\n* Distinguishing Tests: Knowing the specific reagents and observations for Baeyer's test (cold, dilute, alkaline KMnO4KMnO_4) and bromine water test is vital for identifying unsaturation.\n* Ozonolysis Products: Accurately predicting the products of ozonolysis (aldehydes, ketones, or carboxylic acids depending on workup) is a frequently tested concept.

Remember that reductive workup (Zn/H2OZn/H_2O) preserves aldehydes, while oxidative workup (H2O2H_2O_2) oxidizes them to carboxylic acids.

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.