Chemistry·Explained

Hydrocarbons — Explained

NEET UG
Updated 22 Mar 2026

Detailed Explanation

Hydrocarbons, as the name suggests, are organic compounds composed exclusively of carbon and hydrogen atoms. Their immense diversity stems from carbon's unique ability to catenate (form stable bonds with other carbon atoms) and its valency of four, allowing it to form single, double, or triple bonds. This foundational class of compounds is critical to both natural processes and industrial applications, serving as primary energy sources and raw materials for countless synthetic products.

I. Classification of Hydrocarbons

Hydrocarbons are broadly classified into two main categories: aliphatic and aromatic.

A. Aliphatic Hydrocarbons: These are open-chain compounds (straight or branched) or cyclic compounds that do not possess aromatic character. 1. Saturated Hydrocarbons (Alkanes): Contain only carbon-carbon single bonds.

Their general formula is CnH2n+2C_nH_{2n+2}. They are relatively unreactive due to the strong C-C and C-H sigma bonds. 2. Unsaturated Hydrocarbons: Contain at least one carbon-carbon double or triple bond.

* Alkenes: Contain at least one carbon-carbon double bond. General formula CnH2nC_nH_{2n}. The presence of the pi bond makes them more reactive than alkanes. * Alkynes: Contain at least one carbon-carbon triple bond.

General formula CnH2n2C_nH_{2n-2}. The triple bond makes them highly reactive. 3. Alicyclic Hydrocarbons: Cyclic compounds containing only carbon-carbon single bonds (cycloalkanes), or double/triple bonds (cycloalkenes/cycloalkynes) but lacking aromaticity.

B. Aromatic Hydrocarbons: These are cyclic, planar compounds that exhibit special stability due to delocalized pi electrons, following Huckel's rule (4n+24n+2 pi electrons). Benzene is the simplest and most important example.

II. Alkanes (Paraffins)

  • Nomenclature:Named using the suffix '-ane'. IUPAC rules apply for branched chains (longest chain, lowest locants for substituents).
  • Isomerism:Primarily chain isomerism (e.g., n-butane and isobutane) and conformational isomerism (e.g., staggered and eclipsed conformations of ethane).
  • Preparation:

* Hydrogenation of Unsaturated Hydrocarbons: Alkenes and alkynes react with hydrogen in the presence of catalysts (Pt, Pd, Ni) to form alkanes. RCH=CHR+H2NiRCH2CH2RR-CH=CH-R' + H_2 \xrightarrow{Ni} R-CH_2-CH_2-R'.

* Wurtz Reaction: Alkyl halides react with sodium metal in dry ether to form higher alkanes. 2RX+2Nadry,etherRR+2NaX2RX + 2Na \xrightarrow{dry,ether} R-R + 2NaX. Best for symmetrical alkanes; mixtures for unsymmetrical ones.

* Decarboxylation of Carboxylic Acids: Sodium salts of carboxylic acids heated with soda lime (NaOH + CaO) yield alkanes with one less carbon atom. RCOONa+NaOHCaO,DeltaRH+Na2CO3R-COONa + NaOH \xrightarrow{CaO, Delta} R-H + Na_2CO_3.

* Kolbe's Electrolytic Method: Electrolysis of aqueous solutions of sodium or potassium salts of carboxylic acids yields symmetrical alkanes at the anode. 2RCOONa+2H2OelectrolysisRR+2CO2+H2+2NaOH2R-COONa + 2H_2O \xrightarrow{electrolysis} R-R + 2CO_2 + H_2 + 2NaOH.

* Reduction of Alkyl Halides: Alkyl halides can be reduced to alkanes using various reducing agents (e.g., Zn/HCl, H2/Pd, LiAlH4).

  • Physical Properties:Nonpolar, insoluble in water, soluble in organic solvents. Boiling points increase with molecular mass (due to increased van der Waals forces) and decrease with branching (due to reduced surface area for interaction).
  • Chemical Reactions:Alkanes are relatively unreactive. Their reactions typically involve breaking strong C-H or C-C sigma bonds.

* Halogenation (Free Radical Substitution): Reaction with halogens (Cl2, Br2) in the presence of UV light or heat. Proceeds via a free radical mechanism (initiation, propagation, termination). Example: CH4+Cl2hνCH3Cl+HClCH_4 + Cl_2 \xrightarrow{h\nu} CH_3Cl + HCl.

Multiple substitutions can occur. * Combustion: Burn in excess oxygen to produce CO2CO_2 and H2OH_2O, releasing significant heat (exothermic). CnH2n+2+(3n+12)O2nCO2+(n+1)H2OC_nH_{2n+2} + (\frac{3n+1}{2})O_2 \rightarrow nCO_2 + (n+1)H_2O.

* Controlled Oxidation: Under specific conditions, alkanes can be oxidized to alcohols, aldehydes, or carboxylic acids. * Isomerization: n-Alkanes can be converted to branched-chain alkanes in the presence of anhydrous AlCl3AlCl_3 and HCl at high temperatures.

* Aromatization: n-Alkanes (6-10 carbons) can be converted to aromatic hydrocarbons (e.g., benzene, toluene) by heating with catalysts (Cr2O3/Al2O3Cr_2O_3/Al_2O_3) at high temperatures and pressures. * Pyrolysis (Cracking): Decomposition of higher alkanes into lower alkanes, alkenes, and hydrogen upon heating to high temperatures in the absence of air.

Important in petroleum refining.

III. Alkenes (Olefins)

  • Nomenclature:Named using the suffix '-ene'. The longest chain containing the double bond is selected, and the double bond is given the lowest possible locant.
  • Isomerism:Chain, position, and geometric (cis-trans) isomerism. Geometric isomerism arises due to restricted rotation around the C=C double bond.
  • Preparation:

* Dehydration of Alcohols: Alcohols lose a molecule of water when heated with concentrated H2SO4H_2SO_4 or Al2O3Al_2O_3 to form alkenes. Follows Zaitsev's rule (more substituted alkene is major product).

* Dehydrohalogenation of Alkyl Halides: Alkyl halides react with alcoholic KOH to eliminate HX, forming alkenes. Also follows Zaitsev's rule. * Vicinal Dihalides Dehalogenation: Vicinal dihalides (halogens on adjacent carbons) react with zinc dust to form alkenes.

RCHBrCHBrR+ZnRCH=CHR+ZnBr2R-CHBr-CHBr-R' + Zn \rightarrow R-CH=CH-R' + ZnBr_2. * Partial Hydrogenation of Alkynes: Alkynes react with H2H_2 in the presence of specific catalysts (e.g., Lindlar's catalyst - Pd/CaCO3/quinoline/sulfur) to yield cis-alkenes.

With Na/liquid NH3NH_3 (Birch reduction), trans-alkenes are formed.

  • Physical Properties:Nonpolar, insoluble in water. Boiling points increase with molecular mass. Cis isomers generally have higher boiling points than trans isomers due to higher polarity.
  • Chemical Reactions:Dominated by electrophilic addition reactions across the C=C double bond.

* Hydrogenation: Addition of H2H_2 in presence of Pt, Pd, or Ni to form alkanes. * Halogenation: Addition of X2X_2 (Cl2, Br2) to form vicinal dihalides. This is a test for unsaturation (decolorizes bromine water).

* Hydrohalogenation: Addition of HX (HCl, HBr, HI). Follows Markovnikov's rule (H adds to the carbon with more hydrogens, X adds to the carbon with fewer hydrogens). Peroxide effect (anti-Markovnikov addition of HBr) occurs only with HBr in the presence of peroxides.

* Hydration: Addition of water in the presence of an acid catalyst (H2SO4H_2SO_4) to form alcohols. Follows Markovnikov's rule. * Ozonolysis: Reaction with ozone (O3O_3) followed by hydrolysis (Zn/H2OH_2O) to cleave the double bond, forming aldehydes and/or ketones.

Useful for determining the position of the double bond. * Oxidation: * Baeyer's Test: Reaction with cold, dilute, alkaline KMnO4KMnO_4 (Baeyer's reagent) to form vicinal diols. Decolorizes the purple KMnO4KMnO_4, indicating unsaturation.

* **Hot, Acidic KMnO4KMnO_4:** Cleaves the double bond, forming carboxylic acids, ketones, or CO2CO_2 depending on the substitution pattern. * Polymerization: Alkenes undergo addition polymerization to form long-chain polymers (e.

g., ethene to polythene).

IV. Alkynes (Acetylenes)

  • Nomenclature:Named using the suffix '-yne'. The longest chain containing the triple bond is selected, and the triple bond is given the lowest possible locant.
  • Isomerism:Chain and position isomerism.
  • Preparation:

* From Calcium Carbide: CaC2+2H2OCa(OH)2+C2H2CaC_2 + 2H_2O \rightarrow Ca(OH)_2 + C_2H_2 (ethyne). * Dehydrohalogenation of Vicinal or Geminal Dihalides: Elimination of two molecules of HX from dihaloalkanes using strong bases like alcoholic KOH followed by NaNH2NaNH_2 (sodamide).

  • Physical Properties:Nonpolar, insoluble in water. Boiling points increase with molecular mass.
  • Chemical Reactions:Similar to alkenes, they undergo electrophilic addition reactions, but often in two steps due to the presence of two pi bonds.

* Hydrogenation: Addition of H2H_2 in presence of Pt, Pd, or Ni to form alkanes (two moles of H2H_2 are added). Partial hydrogenation to alkenes can be achieved using Lindlar's catalyst (cis-alkene) or Na/liquid NH3NH_3 (trans-alkene).

* Halogenation: Addition of X2X_2 (Cl2, Br2) to form tetrahaloalkanes (two moles of X2X_2 are added). * Hydrohalogenation: Addition of HX. Follows Markovnikov's rule. Two moles of HX can add to form geminal dihalides.

* Hydration: Addition of water in the presence of HgSO4HgSO_4 and dilute H2SO4H_2SO_4. Forms enols, which tautomerize to aldehydes (from ethyne) or ketones (from higher alkynes). Follows Markovnikov's rule.

* Acidity of Terminal Alkynes: Terminal alkynes (with a hydrogen atom directly attached to a triply bonded carbon) are weakly acidic due to the s-character of the sp hybridized carbon, which makes the C-H bond more polar.

They react with strong bases (e.g., NaNH2NaNH_2) to form metal acetylides, and with ammoniacal silver nitrate (Tollens' reagent) or ammoniacal cuprous chloride (Fehling's solution) to form insoluble silver or copper acetylides, respectively.

This is a distinguishing test for terminal alkynes. * Polymerization: Linear polymerization of ethyne yields polyacetylene. Cyclic polymerization (red hot iron tube) yields benzene.

V. Aromatic Hydrocarbons (Arenes)

  • Benzene:The simplest aromatic hydrocarbon (C6H6C_6H_6).

* Structure: Planar, hexagonal ring with all C-C bond lengths identical (intermediate between single and double bonds) due to resonance. Each carbon is sp2sp^2 hybridized. Delocalized pi electron cloud above and below the ring. * Aromaticity (Huckel's Rule): A compound is aromatic if it is cyclic, planar, has complete conjugation (p-orbitals on every atom in the ring), and contains (4n+2)(4n+2) pi electrons (where n = 0, 1, 2...). For benzene, n=1, so 4(1)+2=64(1)+2 = 6 pi electrons.

  • Preparation of Benzene:

* Cyclic Polymerization of Ethyne: Passing ethyne through a red hot iron tube at 873 K. * Decarboxylation of Aromatic Carboxylic Acids: Heating sodium benzoate with soda lime. * Reduction of Phenol: Heating phenol with zinc dust.

  • Physical Properties:Nonpolar, immiscible with water, soluble in organic solvents. Characteristic odor. Toxic and carcinogenic.
  • Chemical Reactions:Primarily electrophilic substitution reactions, where an electrophile replaces a hydrogen atom on the ring, preserving the aromaticity.

* Nitration: Reaction with nitrating mixture (conc. HNO3HNO_3 + conc. H2SO4H_2SO_4) to form nitrobenzene. The electrophile is NO2+NO_2^+. * Halogenation: Reaction with X2X_2 (Cl2, Br2) in the presence of a Lewis acid catalyst (FeCl3FeCl_3, FeBr3FeBr_3) to form halobenzenes.

The electrophile is X+X^+. * Sulfonation: Reaction with fuming H2SO4H_2SO_4 or conc. H2SO4H_2SO_4 to form benzenesulfonic acid. The electrophile is SO3SO_3. * Friedel-Crafts Alkylation: Reaction with an alkyl halide in the presence of anhydrous AlCl3AlCl_3 to form alkylbenzenes.

The electrophile is R+R^+. Can suffer from polyalkylation and rearrangement. * Friedel-Crafts Acylation: Reaction with an acyl halide or acid anhydride in the presence of anhydrous AlCl3AlCl_3 to form acylbenzenes (ketones).

The electrophile is RCO+RCO^+. Does not suffer from polyacylation or rearrangement. * Directive Influence of Substituents: When a substituted benzene undergoes further electrophilic substitution, the existing substituent directs the incoming electrophile to specific positions (ortho, meta, or para) and also affects the reactivity of the ring.

* Ortho-para directing and activating groups: Electron-donating groups (e.g., OH,NH2,OCH3,R,X-OH, -NH_2, -OCH_3, -R, -X (halogens are deactivating but o,p-directing)). * Meta-directing and deactivating groups: Electron-withdrawing groups (e.

g., NO2,COOH,CHO,CN,SO3H-NO_2, -COOH, -CHO, -CN, -SO_3H). * Combustion: Burn with a sooty flame due to high carbon content. * Addition Reactions: Under harsh conditions (e.g., hydrogenation at high pressure, halogenation in UV light), benzene can undergo addition reactions, losing its aromaticity.

Common Misconceptions & NEET-Specific Angles:

  • Markovnikov's Rule vs. Anti-Markovnikov's Rule:Students often confuse when to apply which. Remember, peroxide effect is only for HBr addition to alkenes.
  • Acidity of Terminal Alkynes:Understand why they are acidic (sp hybridization, increased s-character, more electronegative carbon).
  • Aromaticity:Don't just memorize Huckel's rule; understand the criteria (cyclic, planar, conjugated, 4n+24n+2 pi electrons).
  • Named Reactions:Wurtz, Kolbe, Friedel-Crafts (alkylation and acylation), Birch reduction, Lindlar's catalyst, Baeyer's test, Ozonolysis are frequently tested. Know reactants, products, and conditions.
  • Distinguishing Tests:Be able to differentiate between alkanes, alkenes, alkynes, and aromatic compounds using chemical tests (e.g., bromine water, Baeyer's reagent, Tollens' reagent).
  • Reaction Mechanisms:While not always explicitly asked for full mechanisms, understanding the intermediates (carbocations, free radicals, electrophiles) helps predict products and understand regioselectivity (Markovnikov's rule) and stereoselectivity (cis/trans products).
  • Directive Influence:Crucial for predicting products of disubstituted benzenes. Memorize common activating/deactivating and ortho/meta/para directing groups.

Often confused with

Side-by-side differences the NEET paper likes to test.

Hydrocarbons vs Alkanes, Alkenes, and Alkynes
AspectHydrocarbonsAlkanes, Alkenes, and Alkynes
BondingAlkanes: Only C-C single bondsAlkenes: At least one C=C double bond
General Formula$C_nH_{2n+2}$$C_nH_{2n}$
Hybridization of C-C multiple bond carbons$sp^3$$sp^2$
ReactivityLeast reactive (saturated)More reactive (unsaturated, due to pi bond)
Characteristic ReactionsFree radical substitution, combustionElectrophilic addition, oxidation, polymerization
Test for UnsaturationNo reaction with bromine water or Baeyer's reagentDecolorizes bromine water and Baeyer's reagent
AcidityNon-acidicNon-acidic

Alkanes are saturated hydrocarbons with only single bonds, making them relatively inert and undergoing substitution reactions. Alkenes and alkynes are unsaturated, possessing double and triple bonds respectively, which are sites of high electron density.

This makes them significantly more reactive, primarily undergoing addition reactions. Alkynes, particularly terminal ones, also exhibit weak acidic character due to the high s-character of their sp-hybridized carbons, a property not found in alkanes or alkenes.

These differences in bonding and reactivity are crucial for distinguishing between these fundamental classes of hydrocarbons.

Why it is tested: For NEET, understanding the fundamental differences in structure, bonding, and reactivity between alkanes, alkenes, and alkynes is absolutely critical. Questions frequently test the ability to identify the class of hydrocarbon, predict reaction products based on their characteristic reactions (e.g., addition vs. substitution), and apply distinguishing chemical tests. Knowledge of general formulas, hybridization, and specific named reactions associated with each class is essential for scoring well in organic chemistry.

Questions students ask

6 answered on this topic.

What is the primary difference between saturated and unsaturated hydrocarbons?

The fundamental distinction lies in the type of carbon-carbon bonds present. Saturated hydrocarbons, primarily alkanes, contain only single bonds between carbon atoms. This means each carbon atom is bonded to the maximum possible number of hydrogen atoms, making them 'saturated'.

Unsaturated hydrocarbons, which include alkenes and alkynes, possess at least one carbon-carbon double or triple bond, respectively. These multiple bonds mean they have fewer hydrogen atoms than their saturated counterparts with the same carbon skeleton, hence 'unsaturated'.

The presence of pi bonds in unsaturated hydrocarbons makes them significantly more reactive, especially towards addition reactions, compared to the relatively inert saturated hydrocarbons.

Why are aromatic hydrocarbons exceptionally stable, and what is Huckel's rule?

Aromatic hydrocarbons, like benzene, exhibit extraordinary stability due to a phenomenon called aromaticity. This special stability arises from the cyclic delocalization of pi electrons within a planar ring system.

Huckel's rule provides a criterion for aromaticity, stating that a cyclic, planar, fully conjugated system is aromatic if it contains (4n+2)(4n+2) pi electrons, where 'n' is a non-negative integer (0, 1, 2, ...

). For benzene, n=1, leading to 6 pi electrons, which satisfies the rule. This delocalization lowers the overall energy of the molecule, making it more stable than its non-aromatic or anti-aromatic counterparts.

Explain Markovnikov's rule and its significance in alkene reactions.

Markovnikov's rule is an empirical rule used to predict the regioselectivity of electrophilic addition reactions to unsymmetrical alkenes. It states that when a protic acid (like HX or H2O) adds to an unsymmetrical alkene, the hydrogen atom (or the positive part of the reagent) adds to the carbon atom of the double bond that already has a greater number of hydrogen atoms.

Conversely, the halogen (or the negative part) adds to the carbon atom with fewer hydrogen atoms. This rule is significant because it helps predict the major product in such reactions, which is often the more stable carbocation intermediate formed during the reaction mechanism.

What is the peroxide effect, and when is it observed?

The peroxide effect, also known as the Kharasch effect or anti-Markovnikov addition, is an exception to Markovnikov's rule observed specifically during the addition of hydrogen bromide (HBr) to unsymmetrical alkenes in the presence of organic peroxides.

Under these conditions, the addition proceeds via a free radical mechanism, leading to the hydrogen atom adding to the carbon with fewer hydrogens, and the bromine atom adding to the carbon with more hydrogens.

This results in the formation of an anti-Markovnikov product. It is crucial to remember that the peroxide effect is only observed with HBr and not with HCl or HI, nor with other reagents like H2O.

How can you distinguish between a terminal alkyne and an internal alkyne?

Terminal alkynes possess a hydrogen atom directly attached to a triply bonded carbon (RCCHR-C \equiv C-H), making this hydrogen weakly acidic. Internal alkynes (RCCRR-C \equiv C-R') do not have such an acidic hydrogen.

This difference in acidity allows for distinguishing tests. Terminal alkynes will react with ammoniacal silver nitrate (Tollens' reagent) to form a white precipitate of silver acetylide, and with ammoniacal cuprous chloride (Fehling's solution) to form a red precipitate of copper acetylide.

Internal alkynes, lacking the acidic hydrogen, will not react with these reagents, thus providing a clear chemical distinction.

What is the purpose of ozonolysis in organic chemistry?

Ozonolysis is a powerful analytical tool used to determine the position of double or triple bonds in unsaturated hydrocarbons. The reaction involves treating the alkene or alkyne with ozone (O3O_3), which cleaves the multiple bond to form an intermediate ozonide.

Subsequent reductive workup (typically with zinc dust and water) breaks down the ozonide, yielding carbonyl compounds (aldehydes and/or ketones) from alkenes, or carboxylic acids/ketones/CO2 from alkynes.

By identifying the carbonyl products, one can deduce the original structure of the unsaturated hydrocarbon, specifically the location of the multiple bond.