Batteries

Updated 22 Mar 2026
Sub-topics
1 sub-topics
  1. 1Primary and Secondary Batteries

Batteries are fundamentally electrochemical cells, or combinations thereof, that convert stored chemical energy into electrical energy through spontaneous redox reactions. They are self-contained power sources, distinct from electrolytic cells which require an external power input to drive non-spontaneous reactions. The efficiency and utility of a battery are determined by factors such as its volt…

Quick Summary

Batteries are electrochemical devices that convert chemical energy into electrical energy through spontaneous redox reactions. They consist of an anode (where oxidation occurs), a cathode (where reduction occurs), and an electrolyte (which allows ion flow).

Batteries are broadly classified into primary (non-rechargeable, like Leclanché and mercury cells) and secondary (rechargeable, like lead-acid, nickel-cadmium, and lithium-ion cells). Primary cells are 'use and throw' as their reactions are irreversible.

Secondary cells can be recharged by reversing the chemical reactions using an external electrical current. Key characteristics include voltage, capacity, energy density, and cycle life. Understanding the specific chemical reactions at each electrode and the role of the electrolyte is crucial for comprehending their operation and applications.

Full explanation

Batteries are ubiquitous in modern society, powering everything from wristwatches to electric vehicles. Fundamentally, they are electrochemical cells that convert chemical energy directly into electrical energy. This conversion occurs via spontaneous oxidation-reduction (redox) reactions, where electrons are transferred from one chemical species to another, creating an electrical potential difference that drives current through an external circuit.

Conceptual Foundation: The Electrochemical Cell

At the heart of every battery is an electrochemical cell, also known as a galvanic or voltaic cell. Such a cell consists of two half-cells, each containing an electrode immersed in an electrolyte. The two half-cells are connected externally by a wire (allowing electron flow) and internally by a salt bridge or porous membrane (allowing ion flow to maintain charge neutrality). In a battery, these components are typically integrated into a compact unit.

  • Anode (Negative Electrode):This is where oxidation occurs. The material at the anode loses electrons, which then flow through the external circuit. It's the source of electrons.
  • Cathode (Positive Electrode):This is where reduction occurs. The material at the cathode gains electrons from the external circuit. It's the sink for electrons.
  • Electrolyte:An ionically conductive medium that allows the movement of ions between the anode and cathode, completing the internal circuit and maintaining charge balance. It does not conduct electrons directly.
  • External Circuit:Wires and the device being powered, through which electrons flow from anode to cathode.

The potential difference generated across the electrodes is called the electromotive force (EMF) or cell voltage, measured in volts. This voltage is determined by the difference in the standard electrode potentials of the two half-reactions involved.

Key Principles and Laws:

    1
  1. Redox Reactions:The driving force. Oxidation at the anode (MMn++M \rightarrow M^{n+} + \ne^-) and reduction at the cathode (Xm++meXX^{m+} + me^- \rightarrow X). The overall cell reaction is the sum of these two half-reactions.
  2. 2
  3. Electron Flow:From anode (negative) to cathode (positive) through the external circuit.
  4. 3
  5. Ion Flow:Through the electrolyte to maintain charge neutrality. Cations move towards the cathode, anions towards the anode.
  6. 4
  7. Cell Potential ($E_{cell}$):Ecell=EcathodeEanodeE_{cell} = E_{cathode} - E_{anode}, where EcathodeE_{cathode} and EanodeE_{anode} are the reduction potentials of the respective electrodes. For spontaneous reactions, EcellE_{cell} must be positive.
  8. 5
  9. Gibbs Free Energy ($\Delta G$):The spontaneity of the cell reaction is related to ΔG\Delta G by the equation ΔG=nFEcell\Delta G = -nFE_{cell}, where nn is the number of moles of electrons transferred, and FF is Faraday's constant (96485C/mol96485\,\text{C/mol}). For a spontaneous reaction, ΔG\Delta G is negative, implying a positive EcellE_{cell}.

Types of Batteries:

A. Primary Batteries (Non-rechargeable):

These batteries are designed for single use. Once the reactants are consumed or the equilibrium is reached, the battery cannot be effectively recharged because the electrode reactions are irreversible or difficult to reverse.

    1
  1. Dry Cell (Leclanché Cell):

* Anode: Zinc container (ZnZn2++2eZn \rightarrow Zn^{2+} + 2e^-) * Cathode: Carbon rod surrounded by a paste of MnO2MnO_2 and carbon powder (MnO2+NH4++eMnO(OH)+NH3MnO_2 + NH_4^+ + e^- \rightarrow MnO(OH) + NH_3) * Electrolyte: Paste of NH4ClNH_4Cl and ZnCl2ZnCl_2 in water.

* Overall Reaction: Zn(s)+2NH4Cl(aq)+2MnO2(s)Zn(NH3)2Cl2(s)+Mn2O3(s)+H2O(l)Zn(s) + 2NH_4Cl(aq) + 2MnO_2(s) \rightarrow Zn(NH_3)_2Cl_2(s) + Mn_2O_3(s) + H_2O(l) * Voltage: Approximately 1.5V1.5\,\text{V}. * Applications: Flashlights, transistor radios, wall clocks.

* Limitations: Voltage drops as it's used, short shelf life due to acidic NH4ClNH_4Cl corroding zinc.

    1
  1. Mercury Cell:

* Anode: Zinc-mercury amalgam (Zn(Hg)+2OHZnO(s)+H2O(l)+2eZn(Hg) + 2OH^- \rightarrow ZnO(s) + H_2O(l) + 2e^-) * Cathode: Paste of mercury(II) oxide and carbon (HgO(s)+H2O(l)+2eHg(l)+2OHHgO(s) + H_2O(l) + 2e^- \rightarrow Hg(l) + 2OH^-) * Electrolyte: Paste of KOHKOH and ZnOZnO.

* Overall Reaction: Zn(Hg)+HgO(s)ZnO(s)+Hg(l)Zn(Hg) + HgO(s) \rightarrow ZnO(s) + Hg(l) * Voltage: Constant 1.35V1.35\,\text{V} throughout its life because the overall reaction does not involve ions whose concentrations change significantly.

* Applications: Hearing aids, watches, pacemakers, cameras. * Advantages: Constant voltage, long shelf life. Less prone to leakage. * Disadvantages: Contains mercury, which is toxic.

B. Secondary Batteries (Rechargeable):

These batteries can be recharged by passing an external current through them, which reverses the electrode reactions, regenerating the original reactants. They act as galvanic cells during discharge and electrolytic cells during charging.

    1
  1. Lead-Acid Battery:

* Anode (Discharge): Lead grid packed with spongy lead (Pb(s)+SO42(aq)PbSO4(s)+2ePb(s) + SO_4^{2-}(aq) \rightarrow PbSO_4(s) + 2e^-) * Cathode (Discharge): Lead grid packed with lead dioxide (PbO2(s)+SO42(aq)+4H+(aq)+2ePbSO4(s)+2H2O(l)PbO_2(s) + SO_4^{2-}(aq) + 4H^+(aq) + 2e^- \rightarrow PbSO_4(s) + 2H_2O(l)) * Electrolyte: 38%38\% solution of sulfuric acid (H2SO4H_2SO_4).

* Overall Discharge Reaction: Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO4(s)+2H2O(l)Pb(s) + PbO_2(s) + 2H_2SO_4(aq) \rightarrow 2PbSO_4(s) + 2H_2O(l) * Charging: The external current reverses these reactions. PbSO4PbSO_4 on both electrodes is converted back to PbPb and PbO2PbO_2, and H2SO4H_2SO_4 is regenerated.

* Voltage: Each cell produces approximately 2V2\,\text{V}. A typical car battery has six such cells in series, yielding 12V12\,\text{V}. * Applications: Automobile ignition, inverters, UPS systems.

* Advantages: High current output, relatively inexpensive, robust. * Disadvantages: Heavy, contains corrosive acid, lead is toxic.

    1
  1. Nickel-Cadmium (Ni-Cd) Cell:

* Anode (Discharge): Cadmium (Cd(s)+2OH(aq)Cd(OH)2(s)+2eCd(s) + 2OH^-(aq) \rightarrow Cd(OH)_2(s) + 2e^-) * Cathode (Discharge): Nickel(III) oxide hydroxide (NiO(OH)(s)+H2O(l)+eNi(OH)2(s)+OH(aq)NiO(OH)(s) + H_2O(l) + e^- \rightarrow Ni(OH)_2(s) + OH^-(aq)) * Electrolyte: Potassium hydroxide (KOHKOH) solution.

* Overall Discharge Reaction: Cd(s)+2NiO(OH)(s)+2H2O(l)Cd(OH)2(s)+2Ni(OH)2(s)Cd(s) + 2NiO(OH)(s) + 2H_2O(l) \rightarrow Cd(OH)_2(s) + 2Ni(OH)_2(s) * Voltage: Approximately 1.2V1.2\,\text{V}. * Applications: Cordless phones, power tools, portable electronic devices.

* Advantages: Long cycle life, good performance at low temperatures, sealed unit. * Disadvantages: Cadmium is toxic, 'memory effect' (reduced capacity if recharged before fully discharged), relatively expensive.

    1
  1. Lithium-ion (Li-ion) Cell:

* These are 'rocking chair' batteries where lithium ions move between two intercalation compounds (materials that can reversibly host ions within their layered structure) during charge and discharge.

* Anode (Discharge): Graphite (LixC6xLi++xe+C6Li_x C_6 \rightarrow xLi^+ + xe^- + C_6) * Cathode (Discharge): Lithium metal oxide (e.g., LiCoO2LiCoO_2) (Li1xCoO2+xLi++xeLiCoO2Li_{1-x}CoO_2 + xLi^+ + xe^- \rightarrow LiCoO_2) * Electrolyte: Non-aqueous organic solvent containing lithium salts (e.

g., LiPF6LiPF_6). * Overall Discharge Reaction: LixC6+Li1xCoO2C6+LiCoO2Li_x C_6 + Li_{1-x}CoO_2 \rightarrow C_6 + LiCoO_2 * Voltage: Typically 3.7V3.7\,\text{V} per cell. * Applications: Mobile phones, laptops, electric vehicles, medical devices.

* Advantages: High energy density (more power per unit weight), no memory effect, low self-discharge, high voltage. * Disadvantages: More expensive, safety concerns (overheating, fire risk if damaged), complex charging circuitry required.

Real-World Applications:

  • Primary Batteries:Remote controls (Leclanché/Alkaline), watches (Mercury), smoke detectors.
  • Secondary Batteries:Car batteries (Lead-acid), mobile phones/laptops (Li-ion), power tools (Ni-Cd, Li-ion), electric vehicles (Li-ion).

Common Misconceptions:

  • Voltage vs. Capacity:Students often confuse these. Voltage is the electrical potential difference, while capacity (measured in Ampere-hours, Ah) indicates how much charge the battery can deliver over time. A battery can have high voltage but low capacity, or vice-versa.
  • Battery 'Memory Effect':While true for older Ni-Cd batteries, it's largely absent in modern NiMH and Li-ion batteries. Misapplying this concept can lead to inefficient charging practices.
  • Electrolyte as Electron Conductor:The electrolyte conducts ions, not electrons. Electrons flow through the external circuit.
  • Battery Life:Often confused with shelf life. Battery life refers to the number of charge/discharge cycles (for secondary batteries) or total energy delivered, while shelf life is how long it can retain charge when not in use.

NEET-Specific Angle:

For NEET, the focus is heavily on the chemical reactions involved in different battery types, particularly the anode and cathode reactions during both discharge and charge (for secondary batteries). Students should be able to:

    1
  1. Identify primary vs. secondary batteries and their key distinguishing features.
  2. 2
  3. Recall the main components (anode, cathode, electrolyte) and their chemical nature for each battery type.
  4. 3
  5. Write balanced half-reactions and overall cell reactions for Leclanché, Mercury, Lead-acid, and Ni-Cd cells.
  6. 4
  7. Understand the role of the electrolyte and how its concentration changes (e.g., H2SO4H_2SO_4 in lead-acid battery).
  8. 5
  9. Compare and contrast different battery types based on voltage, applications, advantages, and disadvantages (e.g., toxicity of mercury/cadmium, energy density of Li-ion).
  10. 6
  11. Relate battery performance to electrochemical principles like standard electrode potentials and Gibbs free energy.
  12. 7
  13. Understand the concept of 'charging' as an electrolytic process that reverses the spontaneous galvanic reactions.

Key Concepts

Primary vs. Secondary Batteries

The distinction between primary and secondary batteries is fundamental to understanding their utility.…

Cell Potential and Gibbs Free Energy

The cell potential (EcellE_{cell}) is a measure of the electromotive force (EMF) generated by a battery,…

Energy Density and its Importance

Energy density quantifies how much electrical energy a battery can store per unit of its mass (gravimetric…

Often confused with

Side-by-side differences the NEET paper likes to test.

Batteries vs Secondary Batteries
AspectBatteriesSecondary Batteries
Reversibility of ReactionsIrreversible or practically irreversibleReversible
RechargeabilityNon-rechargeable (single use)Rechargeable (multiple uses)
Cost-effectivenessLower initial cost, higher long-term cost if frequently replacedHigher initial cost, lower long-term cost due to reusability
Typical ApplicationsLow-drain devices, remote controls, flashlights, watchesHigh-drain devices, automobiles, mobile phones, laptops, electric vehicles
ExamplesLeclanché cell (dry cell), Mercury cell, Alkaline batteryLead-acid battery, Nickel-Cadmium (Ni-Cd) battery, Lithium-ion (Li-ion) battery
Environmental ImpactContributes more to waste if not properly disposed of due to single useLess waste per unit of energy delivered, but disposal of toxic components still a concern

Primary batteries are designed for single use, featuring irreversible chemical reactions that prevent recharging. They are typically cheaper initially and suited for low-drain, disposable applications like remote controls.

Secondary batteries, conversely, are rechargeable, as their chemical reactions can be reversed by an external current. This makes them suitable for repeated use in high-drain applications such as electric vehicles and smartphones, offering better long-term value despite a higher initial cost.

The choice between them depends on the application's power demands, cost considerations, and environmental impact.

Why it is tested: NEET relevance: Understanding this distinction is crucial for identifying battery types, predicting their behavior, and recalling their specific chemical reactions and applications, which are frequently tested in the exam. Questions often involve identifying examples or comparing characteristics.

Questions students ask

5 answered on this topic.

What is the fundamental difference between a primary and a secondary battery?

The core difference lies in their reversibility. Primary batteries are designed for single use; their electrochemical reactions are irreversible or practically irreversible. Once the reactants are consumed, the battery cannot be recharged and must be discarded.

Examples include the common Leclanché (dry cell) and mercury cells. Secondary batteries, conversely, are rechargeable. Their chemical reactions can be reversed by applying an external electrical current, allowing them to be used and recharged multiple times.

Lead-acid, nickel-cadmium, and lithium-ion batteries are prominent examples of secondary batteries.

Why does the voltage of a Leclanché cell drop during continuous use, unlike a mercury cell?

In a Leclanché cell, the electrolyte (NH4ClNH_4Cl) is consumed, and ammonia (NH3NH_3) gas is produced at the cathode. The accumulation of NH3NH_3 can form a layer around the carbon rod, increasing internal resistance and decreasing the effective surface area for reaction, leading to a voltage drop.

Additionally, the concentration of reactants changes significantly. In contrast, the overall reaction in a mercury cell (Zn(Hg)+HgO(s)ZnO(s)+Hg(l)Zn(Hg) + HgO(s) \rightarrow ZnO(s) + Hg(l)) does not involve species whose concentrations change significantly in the electrolyte, leading to a more constant voltage output throughout its operational life.

Explain the role of sulfuric acid in a lead-acid battery during discharge and charge.

During discharge, sulfuric acid (H2SO4H_2SO_4) acts as the electrolyte and is consumed in the overall reaction: Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO4(s)+2H2O(l)Pb(s) + PbO_2(s) + 2H_2SO_4(aq) \rightarrow 2PbSO_4(s) + 2H_2O(l). This leads to a decrease in the concentration of H2SO4H_2SO_4 and an increase in water content, which lowers the density of the electrolyte.

During charging, an external current reverses this process. Water is consumed, and H2SO4H_2SO_4 is regenerated, increasing the electrolyte's concentration and density. Monitoring the specific gravity of the electrolyte is a common way to check the battery's state of charge.

What is the 'memory effect' in batteries, and which battery type is most associated with it?

The 'memory effect' primarily affects older Nickel-Cadmium (Ni-Cd) batteries. It describes a phenomenon where a battery, if repeatedly recharged after only being partially discharged, 'remembers' the shallower discharge point and subsequently delivers only that reduced capacity, even if it was originally capable of a full discharge.

This is believed to be due to the formation of larger, harder-to-reduce cadmium hydroxide crystals. Modern Ni-Cd batteries and other chemistries like NiMH and Li-ion are largely immune to this effect, making full discharge cycles less critical for their longevity.

Why are lithium-ion batteries preferred for modern portable electronic devices despite their higher cost and potential safety concerns?

Lithium-ion batteries offer several significant advantages that outweigh their drawbacks for portable electronics. Foremost is their exceptionally high energy density, meaning they can store a large amount of energy in a small, lightweight package, crucial for devices like smartphones and laptops.

They also provide a high cell voltage (typically 3.7V3.7\,\text{V}), have a low self-discharge rate, and do not suffer from the 'memory effect'. While safety concerns (overheating, fire risk) exist, continuous advancements in battery management systems and cell chemistry have significantly mitigated these risks, making them the preferred choice for high-performance applications.

Revise in 30 seconds

  • Primary Batteries:Non-rechargeable. Irreversible reactions.

- Leclanché Cell: Anode: ZnZn. Cathode: CC rod in MnO2,CMnO_2, C. Electrolyte: NH4Cl,ZnCl2NH_4Cl, ZnCl_2. Voltage: 1.5V1.5\,\text{V} (drops). Zn(s)+2NH4Cl(aq)+2MnO2(s)Zn(NH3)2Cl2(s)+Mn2O3(s)+H2O(l)Zn(s) + 2NH_4Cl(aq) + 2MnO_2(s) \rightarrow Zn(NH_3)_2Cl_2(s) + Mn_2O_3(s) + H_2O(l). - Mercury Cell: Anode: Zn(Hg)Zn(Hg). Cathode: HgO,CHgO, C. Electrolyte: KOH,ZnOKOH, ZnO. Voltage: 1.35V1.35\,\text{V} (constant). Zn(Hg)+HgO(s)ZnO(s)+Hg(l)Zn(Hg) + HgO(s) \rightarrow ZnO(s) + Hg(l).

  • Secondary Batteries:Rechargeable. Reversible reactions.

- Lead-Acid Battery: Anode: PbPb. Cathode: PbO2PbO_2. Electrolyte: 38%H2SO438\% H_2SO_4. Voltage: 2V2\,\text{V}/cell. Discharge: Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO4(s)+2H2O(l)Pb(s) + PbO_2(s) + 2H_2SO_4(aq) \rightarrow 2PbSO_4(s) + 2H_2O(l). Charging reverses this.

- Ni-Cd Cell: Anode: CdCd. Cathode: NiO(OH)NiO(OH). Electrolyte: KOHKOH. Voltage: 1.2V1.2\,\text{V}. Discharge: Cd(s)+2NiO(OH)(s)+2H2O(l)Cd(OH)2(s)+2Ni(OH)2(s)Cd(s) + 2NiO(OH)(s) + 2H_2O(l) \rightarrow Cd(OH)_2(s) + 2Ni(OH)_2(s). Charging reverses this.

- Li-ion Cell: Anode: Graphite. Cathode: LiLi metal oxide. Electrolyte: Non-aqueous LiLi salt. Voltage: 3.7V3.7\,\text{V}. High energy density. No memory effect.

Lead Me Now, Please Sir! (Types of Batteries)**

  • Leclanché (Primary)
  • Mercury (Primary)
  • Nickel-Cadmium (Secondary)
  • Pb-Acid (Lead-Acid) (Secondary)
  • Secondary (General category for rechargeable)

(For Li-ion, remember it's the 'new kid on the block' for high-tech secondary batteries!)