Chemistry·Explained

Batteries — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

Batteries are ubiquitous in modern society, powering everything from wristwatches to electric vehicles. Fundamentally, they are electrochemical cells that convert chemical energy directly into electrical energy. This conversion occurs via spontaneous oxidation-reduction (redox) reactions, where electrons are transferred from one chemical species to another, creating an electrical potential difference that drives current through an external circuit.

Conceptual Foundation: The Electrochemical Cell

At the heart of every battery is an electrochemical cell, also known as a galvanic or voltaic cell. Such a cell consists of two half-cells, each containing an electrode immersed in an electrolyte. The two half-cells are connected externally by a wire (allowing electron flow) and internally by a salt bridge or porous membrane (allowing ion flow to maintain charge neutrality). In a battery, these components are typically integrated into a compact unit.

  • Anode (Negative Electrode):This is where oxidation occurs. The material at the anode loses electrons, which then flow through the external circuit. It's the source of electrons.
  • Cathode (Positive Electrode):This is where reduction occurs. The material at the cathode gains electrons from the external circuit. It's the sink for electrons.
  • Electrolyte:An ionically conductive medium that allows the movement of ions between the anode and cathode, completing the internal circuit and maintaining charge balance. It does not conduct electrons directly.
  • External Circuit:Wires and the device being powered, through which electrons flow from anode to cathode.

The potential difference generated across the electrodes is called the electromotive force (EMF) or cell voltage, measured in volts. This voltage is determined by the difference in the standard electrode potentials of the two half-reactions involved.

Key Principles and Laws:

    1
  1. Redox Reactions:The driving force. Oxidation at the anode (MMn++neM \rightarrow M^{n+} + ne^-) and reduction at the cathode (Xm++meXX^{m+} + me^- \rightarrow X). The overall cell reaction is the sum of these two half-reactions.
  2. 2
  3. Electron Flow:From anode (negative) to cathode (positive) through the external circuit.
  4. 3
  5. Ion Flow:Through the electrolyte to maintain charge neutrality. Cations move towards the cathode, anions towards the anode.
  6. 4
  7. Cell Potential ($E_{cell}$):Ecell=EcathodeEanodeE_{cell} = E_{cathode} - E_{anode}, where EcathodeE_{cathode} and EanodeE_{anode} are the reduction potentials of the respective electrodes. For spontaneous reactions, EcellE_{cell} must be positive.
  8. 5
  9. Gibbs Free Energy ($Delta G$):The spontaneity of the cell reaction is related to DeltaGDelta G by the equation DeltaG=nFEcellDelta G = -nFE_{cell}, where nn is the number of moles of electrons transferred, and FF is Faraday's constant (96485,C/mol96485,\text{C/mol}). For a spontaneous reaction, DeltaGDelta G is negative, implying a positive EcellE_{cell}.

Types of Batteries:

A. Primary Batteries (Non-rechargeable):

These batteries are designed for single use. Once the reactants are consumed or the equilibrium is reached, the battery cannot be effectively recharged because the electrode reactions are irreversible or difficult to reverse.

    1
  1. Dry Cell (Leclanché Cell):

* Anode: Zinc container (ZnZn2++2eZn \rightarrow Zn^{2+} + 2e^-) * Cathode: Carbon rod surrounded by a paste of MnO2MnO_2 and carbon powder (MnO2+NH4++eMnO(OH)+NH3MnO_2 + NH_4^+ + e^- \rightarrow MnO(OH) + NH_3) * Electrolyte: Paste of NH4ClNH_4Cl and ZnCl2ZnCl_2 in water.

* Overall Reaction: Zn(s)+2NH4Cl(aq)+2MnO2(s)Zn(NH3)2Cl2(s)+Mn2O3(s)+H2O(l)Zn(s) + 2NH_4Cl(aq) + 2MnO_2(s) \rightarrow Zn(NH_3)_2Cl_2(s) + Mn_2O_3(s) + H_2O(l) * Voltage: Approximately 1.5,V1.5,\text{V}. * Applications: Flashlights, transistor radios, wall clocks.

* Limitations: Voltage drops as it's used, short shelf life due to acidic NH4ClNH_4Cl corroding zinc.

    1
  1. Mercury Cell:

* Anode: Zinc-mercury amalgam (Zn(Hg)+2OHZnO(s)+H2O(l)+2eZn(Hg) + 2OH^- \rightarrow ZnO(s) + H_2O(l) + 2e^-) * Cathode: Paste of mercury(II) oxide and carbon (HgO(s)+H2O(l)+2eHg(l)+2OHHgO(s) + H_2O(l) + 2e^- \rightarrow Hg(l) + 2OH^-) * Electrolyte: Paste of KOHKOH and ZnOZnO.

* Overall Reaction: Zn(Hg)+HgO(s)ZnO(s)+Hg(l)Zn(Hg) + HgO(s) \rightarrow ZnO(s) + Hg(l) * Voltage: Constant 1.35,V1.35,\text{V} throughout its life because the overall reaction does not involve ions whose concentrations change significantly.

* Applications: Hearing aids, watches, pacemakers, cameras. * Advantages: Constant voltage, long shelf life. Less prone to leakage. * Disadvantages: Contains mercury, which is toxic.

B. Secondary Batteries (Rechargeable):

These batteries can be recharged by passing an external current through them, which reverses the electrode reactions, regenerating the original reactants. They act as galvanic cells during discharge and electrolytic cells during charging.

    1
  1. Lead-Acid Battery:

* Anode (Discharge): Lead grid packed with spongy lead (Pb(s)+SO42(aq)PbSO4(s)+2ePb(s) + SO_4^{2-}(aq) \rightarrow PbSO_4(s) + 2e^-) * Cathode (Discharge): Lead grid packed with lead dioxide (PbO2(s)+SO42(aq)+4H+(aq)+2ePbSO4(s)+2H2O(l)PbO_2(s) + SO_4^{2-}(aq) + 4H^+(aq) + 2e^- \rightarrow PbSO_4(s) + 2H_2O(l)) * Electrolyte: 3838% solution of sulfuric acid (H2SO4H_2SO_4).

* Overall Discharge Reaction: Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO4(s)+2H2O(l)Pb(s) + PbO_2(s) + 2H_2SO_4(aq) \rightarrow 2PbSO_4(s) + 2H_2O(l) * Charging: The external current reverses these reactions. PbSO4PbSO_4 on both electrodes is converted back to PbPb and PbO2PbO_2, and H2SO4H_2SO_4 is regenerated.

* Voltage: Each cell produces approximately 2,V2,\text{V}. A typical car battery has six such cells in series, yielding 12,V12,\text{V}. * Applications: Automobile ignition, inverters, UPS systems.

* Advantages: High current output, relatively inexpensive, robust. * Disadvantages: Heavy, contains corrosive acid, lead is toxic.

    1
  1. Nickel-Cadmium (Ni-Cd) Cell:

* Anode (Discharge): Cadmium (Cd(s)+2OH(aq)Cd(OH)2(s)+2eCd(s) + 2OH^-(aq) \rightarrow Cd(OH)_2(s) + 2e^-) * Cathode (Discharge): Nickel(III) oxide hydroxide (NiO(OH)(s)+H2O(l)+eNi(OH)2(s)+OH(aq)NiO(OH)(s) + H_2O(l) + e^- \rightarrow Ni(OH)_2(s) + OH^-(aq)) * Electrolyte: Potassium hydroxide (KOHKOH) solution.

* Overall Discharge Reaction: Cd(s)+2NiO(OH)(s)+2H2O(l)Cd(OH)2(s)+2Ni(OH)2(s)Cd(s) + 2NiO(OH)(s) + 2H_2O(l) \rightarrow Cd(OH)_2(s) + 2Ni(OH)_2(s) * Voltage: Approximately 1.2,V1.2,\text{V}. * Applications: Cordless phones, power tools, portable electronic devices.

* Advantages: Long cycle life, good performance at low temperatures, sealed unit. * Disadvantages: Cadmium is toxic, 'memory effect' (reduced capacity if recharged before fully discharged), relatively expensive.

    1
  1. Lithium-ion (Li-ion) Cell:

* These are 'rocking chair' batteries where lithium ions move between two intercalation compounds (materials that can reversibly host ions within their layered structure) during charge and discharge.

* Anode (Discharge): Graphite (LixC6xLi++xe+C6Li_x C_6 \rightarrow xLi^+ + xe^- + C_6) * Cathode (Discharge): Lithium metal oxide (e.g., LiCoO2LiCoO_2) (Li1xCoO2+xLi++xeLiCoO2Li_{1-x}CoO_2 + xLi^+ + xe^- \rightarrow LiCoO_2) * Electrolyte: Non-aqueous organic solvent containing lithium salts (e.

g., LiPF6LiPF_6). * Overall Discharge Reaction: LixC6+Li1xCoO2C6+LiCoO2Li_x C_6 + Li_{1-x}CoO_2 \rightarrow C_6 + LiCoO_2 * Voltage: Typically 3.7,V3.7,\text{V} per cell. * Applications: Mobile phones, laptops, electric vehicles, medical devices.

* Advantages: High energy density (more power per unit weight), no memory effect, low self-discharge, high voltage. * Disadvantages: More expensive, safety concerns (overheating, fire risk if damaged), complex charging circuitry required.

Real-World Applications:

  • Primary Batteries:Remote controls (Leclanché/Alkaline), watches (Mercury), smoke detectors.
  • Secondary Batteries:Car batteries (Lead-acid), mobile phones/laptops (Li-ion), power tools (Ni-Cd, Li-ion), electric vehicles (Li-ion).

Common Misconceptions:

  • Voltage vs. Capacity:Students often confuse these. Voltage is the electrical potential difference, while capacity (measured in Ampere-hours, Ah) indicates how much charge the battery can deliver over time. A battery can have high voltage but low capacity, or vice-versa.
  • Battery 'Memory Effect':While true for older Ni-Cd batteries, it's largely absent in modern NiMH and Li-ion batteries. Misapplying this concept can lead to inefficient charging practices.
  • Electrolyte as Electron Conductor:The electrolyte conducts ions, not electrons. Electrons flow through the external circuit.
  • Battery Life:Often confused with shelf life. Battery life refers to the number of charge/discharge cycles (for secondary batteries) or total energy delivered, while shelf life is how long it can retain charge when not in use.

NEET-Specific Angle:

For NEET, the focus is heavily on the chemical reactions involved in different battery types, particularly the anode and cathode reactions during both discharge and charge (for secondary batteries). Students should be able to:

    1
  1. Identify primary vs. secondary batteries and their key distinguishing features.
  2. 2
  3. Recall the main components (anode, cathode, electrolyte) and their chemical nature for each battery type.
  4. 3
  5. Write balanced half-reactions and overall cell reactions for Leclanché, Mercury, Lead-acid, and Ni-Cd cells.
  6. 4
  7. Understand the role of the electrolyte and how its concentration changes (e.g., H2SO4H_2SO_4 in lead-acid battery).
  8. 5
  9. Compare and contrast different battery types based on voltage, applications, advantages, and disadvantages (e.g., toxicity of mercury/cadmium, energy density of Li-ion).
  10. 6
  11. Relate battery performance to electrochemical principles like standard electrode potentials and Gibbs free energy.
  12. 7
  13. Understand the concept of 'charging' as an electrolytic process that reverses the spontaneous galvanic reactions.
Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.