Chemistry·Revision Notes

Activity and Selectivity of Solid Catalysts — Revision Notes

NEET UG
Updated 22 Mar 2026

⚡ 30-Second Revision

  • Activity:Catalyst's ability to increase reaction rate.

- Factors: Surface area, active sites, optimal adsorption strength (Sabatier principle). - Example: Fe in Haber process.

  • Selectivity:Catalyst's ability to direct reaction to specific product.

- Factors: Pore structure (shape selectivity), active site geometry. - Example: ZSM-5 zeolite (alcohol to gasoline), CO+H2CO + H_2 to CH3OHCH_3OH (Cu/ZnO-Cr2O3Cr_2O_3).

  • Sabatier Principle:Optimal adsorption strength (not too weak, not too strong) for maximum activity.
  • Shape Selectivity:Molecular sieving effect by catalysts with specific pore sizes (e.g., zeolites).
  • Catalystslower EaE_a, do NOT change ΔH\Delta H or KeqK_{eq}.

2-Minute Revision

Solid catalysts are crucial for speeding up reactions (activity) and guiding them to specific products (selectivity). Activity is how fast a catalyst makes a reaction go, primarily by lowering the activation energy.

Key factors for activity include a large surface area, the presence of specific active sites, and critically, the optimal strength of reactant adsorption – known as the Sabatier principle. If reactants bind too weakly, they don't react; if too strongly, products get stuck, blocking sites.

Examples include iron in the Haber process and nickel in hydrogenation. Selectivity is the catalyst's ability to choose a particular product when multiple are possible. This is vital for industrial efficiency.

Factors influencing selectivity include the catalyst's pore structure, leading to 'shape selectivity' (e.g., zeolites like ZSM-5, which act as molecular sieves), and the precise geometry of active sites.

The conversion of synthesis gas (CO+H2CO + H_2) into different products (methanol, methane, hydrocarbons) using different catalysts is a prime example of selectivity. Remember, catalysts affect reaction rates but not equilibrium positions.

5-Minute Revision

Solid catalysts are materials that accelerate chemical reactions without being consumed, exhibiting two primary characteristics: activity and selectivity. Activity refers to the catalyst's efficiency in increasing the reaction rate.

This is achieved by providing an alternative reaction pathway with a lower activation energy (EaE_a). Factors governing activity include: 1) Surface Area: More surface area means more active sites.

2) Nature of Active Sites: Specific atomic arrangements or electronic properties (e.g., partially filled d-orbitals in transition metals) facilitate bond breaking and formation. 3) Adsorption Strength (Sabatier Principle): Reactants must adsorb with an optimal strength – strong enough to react, but weak enough for products to desorb.

Too weak, no reaction; too strong, active sites are blocked. For example, iron in the Haber process for ammonia synthesis is highly active.

Selectivity is the catalyst's ability to favor the formation of a specific product out of several possible ones. This is crucial for minimizing by-products and maximizing desired product yield. Key factors for selectivity include: 1) Geometric Factors (Shape Selectivity): Catalysts with specific pore structures, like zeolites (e.

g., ZSM-5), act as molecular sieves, allowing only molecules of a certain size and shape to react. This is widely used in the petrochemical industry to convert alcohols to gasoline. 2) Active Site Geometry and Electronic Properties: The precise arrangement of atoms on the surface can dictate which bonds are activated and which intermediates are stabilized, thereby directing the reaction pathway.

A classic example is the conversion of synthesis gas (CO+H2CO + H_2) into methanol (using Cu/ZnOCr2O3Cu/ZnO-Cr_2O_3), methane (using Ni), or higher hydrocarbons (using Fe/Co), where the catalyst dictates the product.

Remember, catalysts only affect the kinetics (rate) of a reaction, not its thermodynamics (equilibrium constant or ΔH\Delta H).

Prelims Revision Notes

    1
  1. Catalyst Definition:Substance that alters reaction rate without being consumed. Lowers activation energy (EaE_a). Does NOT change ΔH\Delta H or equilibrium constant (KeqK_{eq}).
  2. 2
  3. Activity:Measure of catalyst's ability to increase reaction rate.

* Factors affecting Activity: * Surface Area: Larger surface area \rightarrow more active sites \rightarrow higher activity. (e.g., finely divided metals). * Active Sites: Specific locations on catalyst surface where reaction occurs.

* Sabatier Principle: Optimal adsorption strength is crucial. Too weak adsorption: Reactants don't bind. Too strong adsorption: Products don't desorb, block sites (poisoning). * 'Just right' adsorption: Efficient reaction and desorption.

* Electronic Configuration: Transition metals (partially filled d-orbitals) are highly active due to ability to form temporary bonds and variable oxidation states. * Promoters: Substances enhancing catalyst activity (e.

g., Mo with Fe in Haber process). * Poisons: Substances reducing/destroying activity (e.g., CO poisoning of Pt). * Examples: Fe in Haber process (N2+3H2Fe2NH3N_2 + 3H_2 \xrightarrow{Fe} 2NH_3), Ni/Pt/Pd in hydrogenation of oils.

    1
  1. Selectivity:Catalyst's ability to direct a reaction towards a specific product.

* Factors affecting Selectivity: * Shape Selectivity: Unique to catalysts with specific pore structures (e.g., Zeolites like ZSM-5). Act as molecular sieves, allowing only specific size/shape molecules to react.

* Active Site Geometry: Specific arrangement of atoms on surface favors certain reaction pathways. * Electronic Properties: Influence orientation and stability of intermediates. * Examples: * Synthesis gas (CO+H2CO + H_2) conversion: * CO+2H2Cu/ZnOCr2O3CH3OHCO + 2H_2 \xrightarrow{Cu/ZnO-Cr_2O_3} CH_3OH (Methanol) * CO+3H2NiCH4+H2OCO + 3H_2 \xrightarrow{Ni} CH_4 + H_2O (Methane) * nCO+(2n+1)H2Fe/CoCnH2n+2+nH2OnCO + (2n+1)H_2 \xrightarrow{Fe/Co} C_nH_{2n+2} + nH_2O (Hydrocarbons) * ZSM-5 converting alcohols to gasoline.

    1
  1. Key Distinction:Activity = how fast; Selectivity = which product. Both are vital for industrial processes.

Vyyuha Quick Recall

To remember factors for Activity and Selectivity:

Active Sites Often Promote Transition Metals (for Activity)

  • Active Sites
  • Optimal Adsorption (Sabatier Principle)
  • Promoters
  • Transition Metals

Selectivity Shapes Products Geometrically (for Selectivity)

  • Shape Selectivity (Zeolites)
  • Pore structure
  • Geometry of active sites