Nitrogen and its Compounds

Updated 22 Mar 2026

Nitrogen, a non-metallic element with atomic number 7, is the first member of Group 15 (Pnictogens) in the periodic table. It is a vital constituent of the Earth's atmosphere, comprising approximately 78% by volume as dinitrogen (N2N_2) gas. Its unique electronic configuration (1s22s22p31s^2 2s^2 2p^3) and the presence of a stable triple bond in its diatomic form contribute to its relative inertness at r…

Quick Summary

Nitrogen, the most abundant gas in the atmosphere, is characterized by its inert diatomic form (N2N_2) due to a strong triple bond. Despite this, it forms a wide array of crucial compounds, exhibiting oxidation states from -3 to +5.

Key compounds include ammonia (NH3NH_3), various oxides of nitrogen (N2O,NO,N2O3,NO2,N2O4,N2O5N_2O, NO, N_2O_3, NO_2, N_2O_4, N_2O_5), and nitric acid (HNO3HNO_3). Ammonia is industrially produced via the Haber process, a high-pressure, moderate-temperature catalytic reaction, and is vital for fertilizers.

It's a pyramidal molecule, a Lewis base, and forms complexes. Oxides of nitrogen vary in color, acidity, and oxidation state; for instance, NONO is colorless and paramagnetic, while NO2NO_2 is reddish-brown and also paramagnetic, readily dimerizing to colorless N2O4N_2O_4.

Nitric acid is a strong oxidizing acid, industrially made by the Ostwald process. Its reactions with metals depend on concentration, producing different nitrogen oxides. Understanding these compounds' preparation, properties, structures, and uses is fundamental for NEET, with special attention to industrial processes and reaction conditions.

Full explanation

Nitrogen, the cornerstone of Group 15 elements, presents a fascinating study in chemical versatility, despite its elemental form being remarkably inert. Its compounds are central to biological systems, industrial processes, and environmental chemistry. Let's delve into the specifics of nitrogen and its key compounds.

Conceptual Foundation of Nitrogen

Nitrogen (atomic number 7) has an electronic configuration of 1s22s22p31s^2 2s^2 2p^3. This configuration implies five valence electrons, three of which are unpaired in the 2p2p orbitals. In its elemental form, dinitrogen (N2N_2), two nitrogen atoms share three pairs of electrons, forming a very strong triple bond (NNN \equiv N).

The bond dissociation enthalpy of this triple bond is exceptionally high (941.4kJ/mol941.4\,\text{kJ/mol}), making N2N_2 gas highly stable and unreactive at room temperature. This inertness is crucial for life, as it prevents indiscriminate reactions in the atmosphere.

However, this stability also means that converting atmospheric nitrogen into usable compounds (nitrogen fixation) requires significant energy input.

Nitrogen exhibits a wide range of oxidation states, from -3 (e.g., in NH3NH_3) to +5 (e.g., in HNO3HNO_3 and N2O5N_2O_5). This broad range is due to its ability to gain three electrons to achieve a stable octet (forming N3N^{3-}), or lose electrons to more electronegative elements like oxygen and fluorine.

Dinitrogen ($N_2$)

Preparation:

    1
  1. Laboratory MethodDinitrogen is typically prepared by heating an aqueous solution of ammonium chloride with sodium nitrite.

NH4Cl(aq)+NaNO2(aq)heatN2(g)+2H2O(l)+NaCl(aq)NH_4Cl(aq) + NaNO_2(aq) \xrightarrow{\text{heat}} N_2(g) + 2H_2O(l) + NaCl(aq)
Small amounts of NONO and HNO3HNO_3 can be formed as impurities. These can be removed by passing the gas through aqueous sulfuric acid containing potassium dichromate.

    1
  1. Thermal decomposition of ammonium dichromateThis is another laboratory method.

(NH4)2Cr2O7heatN2(g)+Cr2O3(s)+4H2O(l)(NH_4)_2Cr_2O_7 \xrightarrow{\text{heat}} N_2(g) + Cr_2O_3(s) + 4H_2O(l)

    1
  1. Industrial MethodOn a large scale, dinitrogen is obtained by the fractional distillation of liquid air. Liquid air, primarily a mixture of liquid nitrogen (boiling point 77.2K77.2\,\text{K}) and liquid oxygen (boiling point 90K90\,\text{K}), is separated based on their different boiling points. Nitrogen, having a lower boiling point, distills off first.

Properties:

  • PhysicalColorless, odorless, tasteless, non-toxic gas. It is slightly lighter than air and sparingly soluble in water.
  • ChemicalDue to the high bond enthalpy of the NNN \equiv N bond, N2N_2 is quite unreactive at ordinary temperatures. Reactivity increases significantly at higher temperatures.

* Reaction with metals: Forms ionic nitrides with highly electropositive metals (e.g., Li, Mg) at high temperatures.

6Li(s)+N2(g)heat2Li3N(s)6Li(s) + N_2(g) \xrightarrow{\text{heat}} 2Li_3N(s)
3Mg(s)+N2(g)heatMg3N2(s)3Mg(s) + N_2(g) \xrightarrow{\text{heat}} Mg_3N_2(s)
* Reaction with non-metals: Reacts with hydrogen to form ammonia (Haber process) and with oxygen to form nitric oxide.

Uses:

  • Inert atmosphere for chemical reactions, metallurgy, and food packaging.
  • Cryogenic agent (liquid nitrogen) for preserving biological materials and in surgery.
  • Manufacture of ammonia, nitric acid, and calcium cyanamide.

Ammonia ($NH_3$)

Ammonia is a crucial compound of nitrogen, known for its pungent smell and basic nature.

Preparation:

    1
  1. Laboratory MethodAmmonia can be prepared by heating ammonium salts with a strong base.

2NH4Cl(aq)+Ca(OH)2(s)heatCaCl2(aq)+2NH3(g)+2H2O(l)2NH_4Cl(aq) + Ca(OH)_2(s) \xrightarrow{\text{heat}} CaCl_2(aq) + 2NH_3(g) + 2H_2O(l)

    1
  1. Industrial Method (Haber Process)This is the most significant industrial process for ammonia synthesis.

N2(g)+3H2(g)2NH3(g)ΔH=92.4kJ/molN_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g) \quad \Delta H = -92.4\,\text{kJ/mol}
The reaction is exothermic and reversible. According to Le Chatelier's principle, high pressure and low temperature favor ammonia formation.

However, a very low temperature would make the reaction too slow. Therefore, optimal conditions are: * Temperature: 450500C450-500^\circ C (compromise temperature). * Pressure: 200atm200\,\text{atm} (high pressure).

* Catalyst: Finely divided iron, often with molybdenum or K2O/Al2O3K_2O/Al_2O_3 as promoters to enhance catalytic activity.

Properties:

  • PhysicalColorless gas with a characteristic pungent odor. It is highly soluble in water due to hydrogen bonding. Its high boiling point (33.4C-33.4^\circ C) and melting point (77.7C-77.7^\circ C) compared to other hydrides of similar molecular mass are also due to strong intermolecular hydrogen bonding.
  • Chemical

* Basic Nature: Ammonia is a Lewis base (due to the lone pair on nitrogen) and a Brønsted-Lowry base (accepts protons). It forms ammonium hydroxide in water, which is a weak base.

NH3(g)+H2O(l)NH4+(aq)+OH(aq)NH_3(g) + H_2O(l) \rightleftharpoons NH_4^+(aq) + OH^-(aq)
It reacts with acids to form ammonium salts.

NH3(g)+HCl(g)NH4Cl(s)NH_3(g) + HCl(g) \rightarrow NH_4Cl(s)
* Formation of Complex Compounds: The lone pair on the nitrogen atom allows ammonia to act as a ligand, forming complex compounds with transition metal ions.

Cu2+(aq)+4NH3(aq)[Cu(NH3)4]2+(aq)(deep blue)Cu^{2+}(aq) + 4NH_3(aq) \rightarrow [Cu(NH_3)_4]^{2+}(aq) \quad (\text{deep blue})
Ag+(aq)+2NH3(aq)[Ag(NH3)2]+(aq)(colorless)Ag^+(aq) + 2NH_3(aq) \rightarrow [Ag(NH_3)_2]^+(aq) \quad (\text{colorless})
* Reducing Agent: Ammonia can act as a reducing agent, especially at high temperatures.

3CuO(s)+2NH3(g)heat3Cu(s)+N2(g)+3H2O(l)3CuO(s) + 2NH_3(g) \xrightarrow{\text{heat}} 3Cu(s) + N_2(g) + 3H_2O(l)
* Combustion: Burns in oxygen with a greenish-yellow flame.
4NH3(g)+3O2(g)2N2(g)+6H2O(l)4NH_3(g) + 3O_2(g) \rightarrow 2N_2(g) + 6H_2O(l)
In the presence of a catalyst (Pt/Rh gauze), it oxidizes to nitric oxide (Ostwald process).

Structure:

Ammonia has a trigonal pyramidal geometry. The nitrogen atom is sp3sp^3 hybridized, with three bond pairs and one lone pair of electrons. The HNHH-N-H bond angle is approximately 107107^\circ, slightly less than the ideal tetrahedral angle (109.5109.5^\circ) due to the lone pair-bond pair repulsion.

Uses:

  • Production of fertilizers (urea, ammonium nitrate, ammonium sulfate).
  • Manufacture of nitric acid (Ostwald process).
  • Refrigerant (liquid ammonia).
  • In cleaning agents and as a laboratory reagent.

Oxides of Nitrogen

Nitrogen forms a variety of oxides, exhibiting different oxidation states and structures. These are often referred to as 'nitrogen oxides' or 'NOx' collectively, especially in environmental contexts.

    1
  1. Nitrous Oxide ($N_2O$) - Dinitrogen Monoxide

* Oxidation State: +1 * Preparation: By heating ammonium nitrate.

NH4NO3(s)heatN2O(g)+2H2O(l)NH_4NO_3(s) \xrightarrow{\text{heat}} N_2O(g) + 2H_2O(l)
* Properties: Colorless gas, neutral, sweetish taste, known as 'laughing gas'. Used as an anesthetic. * Structure: Linear, resonance structures exist (NN+ON=N+=ON \equiv N^+ - O^- \leftrightarrow N^- = N^+ = O).

    1
  1. Nitric Oxide ($NO$) - Nitrogen Monoxide

* Oxidation State: +2 * Preparation: * Laboratory: Reaction of copper with dilute nitric acid.

3Cu(s)+8HNO3(dilute)3Cu(NO3)2(aq)+2NO(g)+4H2O(l)3Cu(s) + 8HNO_3(\text{dilute}) \rightarrow 3Cu(NO_3)_2(aq) + 2NO(g) + 4H_2O(l)
* Industrial: Catalytic oxidation of ammonia (Ostwald process, first step).

4NH3(g)+5O2(g)Pt/Rh gauze4NO(g)+6H2O(l)4NH_3(g) + 5O_2(g) \xrightarrow{\text{Pt/Rh gauze}} 4NO(g) + 6H_2O(l)
* Properties: Colorless gas, neutral, paramagnetic (due to an odd number of electrons). Readily oxidizes in air to NO2NO_2.

2NO(g)+O2(g)2NO2(g)2NO(g) + O_2(g) \rightarrow 2NO_2(g)
* Structure: Linear, odd electron molecule.

    1
  1. Dinitrogen Trioxide ($N_2O_3$)

* Oxidation State: +3 * Preparation: By mixing equal volumes of NONO and NO2NO_2 at 250K250\,\text{K}.

NO(g)+NO2(g)250KN2O3(l)NO(g) + NO_2(g) \xrightarrow{250\,\text{K}} N_2O_3(l)
* Properties: Blue solid, acidic (anhydride of nitrous acid, HNO2HNO_2). Unstable above 250K250\,\text{K}. * Structure: Planar, with an NNN-N bond.

    1
  1. Nitrogen Dioxide ($NO_2$)

* Oxidation State: +4 * Preparation: * Laboratory: Reaction of copper with concentrated nitric acid.

Cu(s)+4HNO3(conc.)Cu(NO3)2(aq)+2NO2(g)+2H2O(l)Cu(s) + 4HNO_3(\text{conc.}) \rightarrow Cu(NO_3)_2(aq) + 2NO_2(g) + 2H_2O(l)
* Thermal decomposition of lead nitrate.

2Pb(NO3)2(s)heat2PbO(s)+4NO2(g)+O2(g)2Pb(NO_3)_2(s) \xrightarrow{\text{heat}} 2PbO(s) + 4NO_2(g) + O_2(g)
* Properties: Reddish-brown gas, pungent odor, acidic (dissolves in water to form nitric and nitrous acids). Paramagnetic.

Readily dimerizes to N2O4N_2O_4 at lower temperatures.

2NO2(g)N2O4(g)(brown)(colorless)2NO_2(g) \rightleftharpoons N_2O_4(g) \quad (\text{brown}) \quad (\text{colorless})
* Structure: Bent, with an odd electron. The dimerization is an important equilibrium.

    1
  1. Dinitrogen Tetroxide ($N_2O_4$)

* Oxidation State: +4 * Preparation: Dimerization of NO2NO_2 at low temperatures. * Properties: Colorless solid or liquid, diamagnetic. Exists in equilibrium with NO2NO_2. * Structure: Planar, with an NNN-N bond.

    1
  1. Dinitrogen Pentoxide ($N_2O_5$)

* Oxidation State: +5 * Preparation: By dehydrating nitric acid with P4O10P_4O_{10}.

2HNO3(l)+P4O10(s)N2O5(s)+2HPO3(s)2HNO_3(l) + P_4O_{10}(s) \rightarrow N_2O_5(s) + 2HPO_3(s)
* Properties: Colorless solid, very strong oxidizing agent, acidic (anhydride of nitric acid). * Structure: In gaseous state, it's planar with an NONN-O-N bridge. In solid state, it exists as nitronium nitrate, [NO2+][NO3][NO_2^+][NO_3^-].

Nitric Acid ($HNO_3$)

Nitric acid is a strong mineral acid and a powerful oxidizing agent.

Preparation:

    1
  1. Laboratory MethodBy heating potassium nitrate with concentrated sulfuric acid.

KNO3(s)+H2SO4(conc.)heatKHSO4(s)+HNO3(l)KNO_3(s) + H_2SO_4(\text{conc.}) \xrightarrow{\text{heat}} KHSO_4(s) + HNO_3(l)

    1
  1. Industrial Method (Ostwald Process)This process involves three main steps:

* Step 1: Catalytic oxidation of ammonia: Ammonia is oxidized by atmospheric oxygen in the presence of a platinum-rhodium gauze catalyst at 800C800^\circ C to form nitric oxide.

4NH3(g)+5O2(g)Pt/Rh gauze, 800C4NO(g)+6H2O(g)4NH_3(g) + 5O_2(g) \xrightarrow{\text{Pt/Rh gauze, 800}^\circ C} 4NO(g) + 6H_2O(g)
* Step 2: Oxidation of nitric oxide: Nitric oxide is cooled and then oxidized by air to nitrogen dioxide.

2NO(g)+O2(g)2NO2(g)2NO(g) + O_2(g) \rightarrow 2NO_2(g)
* Step 3: Absorption of nitrogen dioxide in water: Nitrogen dioxide is absorbed in water in the presence of oxygen to form nitric acid.
3NO2(g)+H2O(l)2HNO3(aq)+NO(g)3NO_2(g) + H_2O(l) \rightarrow 2HNO_3(aq) + NO(g)
The NONO produced can be recycled.

In the presence of excess oxygen, the reaction is:

4NO2(g)+O2(g)+2H2O(l)4HNO3(aq)4NO_2(g) + O_2(g) + 2H_2O(l) \rightarrow 4HNO_3(aq)
The acid obtained is about 68%68\% by mass. It can be concentrated to 98%98\% by distillation with concentrated H2SO4H_2SO_4.

Properties:

  • PhysicalPure nitric acid is a colorless, fuming liquid. It has a pungent odor. It is highly corrosive. Commercial nitric acid is often yellowish due to dissolved NO2NO_2 (formed by decomposition).

4HNO34NO2+2H2O+O24HNO_3 \rightarrow 4NO_2 + 2H_2O + O_2

  • Chemical

* Acidic Nature: It is a strong acid, ionizing completely in water.

HNO3(aq)+H2O(l)H3O+(aq)+NO3(aq)HNO_3(aq) + H_2O(l) \rightarrow H_3O^+(aq) + NO_3^-(aq)
* Oxidizing Agent: Nitric acid is a powerful oxidizing agent, reacting with most metals and many non-metals.

The reduction products of nitric acid depend on the concentration of the acid, the temperature, and the nature of the substance being oxidized. * Reaction with Metals: * Copper: * With dilute HNO3HNO_3: 3Cu+8HNO3(dilute)3Cu(NO3)2+2NO+4H2O3Cu + 8HNO_3(\text{dilute}) \rightarrow 3Cu(NO_3)_2 + 2NO + 4H_2O * With concentrated HNO3HNO_3: $Cu + 4HNO_3(\text{conc.

}) \rightarrow Cu(NO_3)_2 + 2NO_2 + 2H_2OZinc:Withverydilute* **Zinc**: * With very diluteHNO_3::4Zn + 10HNO_3(\text{very dilute}) \rightarrow 4Zn(NO_3)_2 + N_2O + 5H_2OWithdilute* With diluteHNO_3::3Zn + 8HNO_3(\text{dilute}) \rightarrow 3Zn(NO_3)_2 + 2NO + 4H_2OWithconcentrated* With concentratedHNO_3::Zn + 4HNO_3(\text{conc.

}) \rightarrow Zn(NO_3)_2 + 2NO_2 + 2H_2ONoblemetals(Au,Pt):Generallyunreactivewith* **Noble metals (Au, Pt)**: Generally unreactive withHNO_3alone.Theyreactwithaquaregia(aalone. They react with aqua regia (a3:1mixtureofconcentratedmixture of concentratedHClandconcentratedand concentratedHNO_3$).

* Passivity: Iron, chromium, and aluminum become passive when treated with concentrated nitric acid. This is due to the formation of a thin, protective oxide layer on their surface, which prevents further reaction.

* Reaction with Non-metals: Oxidizes non-metals like carbon, sulfur, and phosphorus. * Carbon: C+4HNO3(conc.)CO2+4NO2+2H2OC + 4HNO_3(\text{conc.}) \rightarrow CO_2 + 4NO_2 + 2H_2O * Sulfur: S8+48HNO3(conc.)8H2SO4+48NO2+16H2OS_8 + 48HNO_3(\text{conc.}) \rightarrow 8H_2SO_4 + 48NO_2 + 16H_2O * Phosphorus: $P_4 + 20HNO_3(\text{conc.

Structure:

Nitric acid is a planar molecule. The nitrogen atom is sp2sp^2 hybridized. It has one N=ON=O double bond, one NON-O single bond, and one NOHN-OH single bond. Resonance structures contribute to the stability of the nitrate ion (NO3NO_3^-).

Uses:

  • Manufacture of ammonium nitrate (fertilizer) and other nitrates.
  • Production of explosives (e.g., TNT, nitroglycerin).
  • In the purification of silver and gold.
  • As an oxidizing agent in laboratories and industries.
  • Manufacture of dyes, drugs, and perfumes.

Common Misconceptions and NEET-Specific Angle

  • Inertness vs. ReactivityStudents often confuse the inertness of N2N_2 gas with the reactivity of nitrogen in its compounds. Emphasize that the triple bond in N2N_2 is responsible for its inertness, but once fixed, nitrogen can be highly reactive.
  • Oxidation StatesA common error is miscalculating or confusing the oxidation states of nitrogen in its various oxides. Practice assigning oxidation states.
  • Nitric Acid ReactionsThe varying products of nitric acid's reactions with metals based on concentration are a frequent source of confusion. Memorize the key reactions and the products (NO,NO2,N2ONO, NO_2, N_2O, etc.) for different conditions.
  • Industrial ProcessesHaber and Ostwald processes are high-yield topics. Understand the principles (Le Chatelier's principle), catalysts, and optimal conditions.
  • Structures and HybridizationBe able to draw structures and identify hybridization for NH3NH_3, HNO3HNO_3, and common oxides. Paramagnetic nature of NONO and NO2NO_2 is also important.

For NEET, focus on balanced chemical equations, reaction conditions, distinguishing properties (e.g., color of gases like NO2NO_2), and the applications of these compounds.

Key Concepts

Haber Process Conditions and Le Chatelier's Principle

The Haber process, N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g), is an exothermic reaction ($\Delta H =…

Oxidizing Nature of Nitric Acid with Metals

Nitric acid (HNO3HNO_3) is a powerful oxidizing agent, and its reduction products vary significantly based on…

Ammonia as a Ligand and Complex Formation

Ammonia (NH3NH_3) acts as a ligand due to the presence of a lone pair of electrons on the nitrogen atom. This…

Often confused with

Side-by-side differences the NEET paper likes to test.

Nitrogen and its Compounds vs Dilute Nitric Acid vs. Concentrated Nitric Acid (Reactions with Copper)
AspectNitrogen and its CompoundsDilute Nitric Acid vs. Concentrated Nitric Acid (Reactions with Copper)
ConcentrationDilute $HNO_3$Concentrated $HNO_3$
Oxidizing PowerModerateStrong
Reduction Product (with Cu)Nitric Oxide ($NO$)Nitrogen Dioxide ($NO_2$)
Color of Gas EvolvedColorlessReddish-brown
Balanced Equation (with Cu)$3Cu + 8HNO_3(\text{dilute}) \rightarrow 3Cu(NO_3)_2 + 2NO + 4H_2O$$Cu + 4HNO_3(\text{conc.}) \rightarrow Cu(NO_3)_2 + 2NO_2 + 2H_2O$

The reactivity and products formed when metals like copper react with nitric acid are highly dependent on the acid's concentration. Dilute nitric acid acts as a moderate oxidizing agent, typically reducing to colorless nitric oxide (NONO) gas.

In contrast, concentrated nitric acid is a much stronger oxidizing agent, leading to its reduction to reddish-brown nitrogen dioxide (NO2NO_2) gas. This difference arises from the varying availability of water molecules to stabilize intermediate species and the overall oxidizing potential of the acid, which is higher in concentrated solutions.

Understanding these distinct reaction pathways is crucial for predicting products in NEET questions.

Why it is tested: For NEET, understanding the differential reactivity of dilute versus concentrated nitric acid with metals is a frequently tested concept. Questions often involve predicting products, balancing redox reactions, or identifying the gas evolved under specific conditions. It assesses a student's grasp of redox chemistry and the influence of concentration on reaction pathways.

Questions students ask

6 answered on this topic.

Why is dinitrogen ($N_2$) gas so unreactive at room temperature, despite being abundant in the atmosphere?

Dinitrogen (N2N_2) gas is remarkably unreactive at room temperature primarily due to the presence of a very strong triple bond (NNN \equiv N) between the two nitrogen atoms. This triple bond has an exceptionally high bond dissociation enthalpy of $941.

4\,\text{kJ/mol}.Breakingthisbondrequiresasignificantamountofenergy,whichisnotreadilyavailableundernormalambientconditions.Consequently,. Breaking this bond requires a significant amount of energy, which is not readily available under normal ambient conditions. Consequently,N_2$ does not easily participate in chemical reactions, making it an inert gas that dilutes oxygen in the atmosphere and prevents rapid oxidation processes.

Explain the significance of the Haber process in modern society.

The Haber process is one of the most significant chemical processes ever developed, as it enables the industrial synthesis of ammonia (NH3NH_3) directly from atmospheric nitrogen (N2N_2) and hydrogen (H2H_2).

Ammonia is the primary precursor for almost all nitrogen-containing fertilizers. Without the Haber process, it would be impossible to produce enough food to sustain the global population, as natural nitrogen fixation processes are insufficient.

It is estimated that the Haber process is responsible for feeding billions of people by providing the necessary nitrogen for agricultural productivity.

How does ammonia act as both a Lewis base and a Brønsted-Lowry base?

Ammonia (NH3NH_3) acts as a Lewis base because its nitrogen atom possesses a lone pair of electrons, which it can donate to an electron-deficient species (a Lewis acid) to form a coordinate covalent bond.

For example, it forms complex ions with transition metal cations. Simultaneously, ammonia acts as a Brønsted-Lowry base because it can accept a proton (H+H^+) from an acid. When dissolved in water, it accepts a proton from water to form ammonium ions (NH4+NH_4^+) and hydroxide ions (OHOH^-), demonstrating its basic character.

What are the different products formed when copper reacts with dilute versus concentrated nitric acid?

The reaction of copper with nitric acid yields different nitrogen-containing products depending on the acid's concentration. With dilute nitric acid, copper reacts to produce nitric oxide (NONO) gas, which is colorless.

The balanced equation is: 3Cu+8HNO3(dilute)3Cu(NO3)2+2NO+4H2O3Cu + 8HNO_3(\text{dilute}) \rightarrow 3Cu(NO_3)_2 + 2NO + 4H_2O. In contrast, with concentrated nitric acid, copper reacts to produce nitrogen dioxide (NO2NO_2) gas, which is a reddish-brown gas.

The balanced equation is: Cu+4HNO3(conc.)Cu(NO3)2+2NO2+2H2OCu + 4HNO_3(\text{conc.}) \rightarrow Cu(NO_3)_2 + 2NO_2 + 2H_2O. This difference highlights nitric acid's varying oxidizing power.

Why does nitric oxide ($NO$) readily turn reddish-brown when exposed to air?

Nitric oxide (NONO) is a colorless gas, but it contains an odd number of electrons (11 valence electrons), making it a paramagnetic and relatively reactive molecule. When exposed to air, NONO readily reacts with oxygen (O2O_2) present in the atmosphere to form nitrogen dioxide (NO2NO_2).

Nitrogen dioxide is a reddish-brown gas, which is why colorless NONO appears reddish-brown upon contact with air. The reaction is: 2NO(g)+O2(g)2NO2(g)2NO(g) + O_2(g) \rightarrow 2NO_2(g). This rapid oxidation is a characteristic property of nitric oxide.

What is the phenomenon of 'passivity' observed with certain metals in concentrated nitric acid?

Passivity is a phenomenon where certain metals, such as iron (Fe), chromium (Cr), and aluminum (Al), become unreactive or 'passive' when treated with concentrated nitric acid. Instead of dissolving, these metals form a very thin, dense, and non-porous protective oxide layer on their surface.

This oxide layer acts as a barrier, preventing further contact between the metal and the acid, thereby inhibiting any further chemical reaction. This protective layer makes these metals resistant to corrosion under specific conditions.

Revise in 30 seconds

  • Dinitrogen ($N_2$)Inert due to NNN \equiv N bond. Lab prep: NH4Cl+NaNO2heatN2NH_4Cl + NaNO_2 \xrightarrow{\text{heat}} N_2. Industrial: Fractional distillation of liquid air.
  • Ammonia ($NH_3$)Pyramidal, sp3sp^3 N. Lewis base. Haber process: N2+3H22NH3N_2 + 3H_2 \rightleftharpoons 2NH_3 (Fe catalyst, 450500C450-500^\circ C, 200atm200\,\text{atm}). Forms complexes (e.g., [Cu(NH3)4]2+[Cu(NH_3)_4]^{2+}).
  • Oxides of Nitrogen

- N2ON_2O: +1, colorless, neutral, diamagnetic. - NONO: +2, colorless, neutral, paramagnetic, oxidizes to NO2NO_2 in air. - N2O3N_2O_3: +3, blue solid, acidic, unstable. - NO2NO_2: +4, reddish-brown, acidic, paramagnetic, dimerizes to N2O4N_2O_4. - N2O4N_2O_4: +4, colorless, diamagnetic, dimer of NO2NO_2. - N2O5N_2O_5: +5, colorless solid, acidic, strong oxidizing agent.

  • Nitric Acid ($HNO_3$)Strong acid, powerful oxidizing agent. Ostwald process: NH3O2,Pt/RhNOO2NO2H2O,O2HNO3NH_3 \xrightarrow{O_2, Pt/Rh} NO \xrightarrow{O_2} NO_2 \xrightarrow{H_2O, O_2} HNO_3.

- Reactions with metals: Dilute HNO3NOHNO_3 \rightarrow NO; Conc. HNO3NO2HNO_3 \rightarrow NO_2. Passivity with Fe, Cr, Al.

For the Oxides of Nitrogen and their oxidation states, remember: Never Never Never Never Never Never Outside Outside Outside Outside Outside

This represents the number of Nitrogen and Oxygen atoms in the common oxides, and helps recall their oxidation states in increasing order:

N2ON_2O (N=+1) - Never Outside (1 N, 1 O for oxidation state calc) NONO (N=+2) - Never Outside (1 N, 1 O for oxidation state calc) N2O3N_2O_3 (N=+3) - Never Outside (2 N, 3 O for oxidation state calc) NO2NO_2 (N=+4) - Never Outside (1 N, 2 O for oxidation state calc) N2O4N_2O_4 (N=+4) - Never Outside (2 N, 4 O for oxidation state calc) N2O5N_2O_5 (N=+5) - Never Outside (2 N, 5 O for oxidation state calc)

While the mnemonic itself is simple, the key is to associate the increasing number of 'O's (and 'N's for N2OxN_2O_x) with the increasing oxidation state of nitrogen. For example, N2ON_2O is +1, NONO is +2, N2O3N_2O_3 is +3, NO2NO_2 is +4, N2O4N_2O_4 is +4, N2O5N_2O_5 is +5. It's a quick way to mentally check the order and corresponding oxidation states.