Chemistry·Explained

Nitrogen and its Compounds — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

Nitrogen, the cornerstone of Group 15 elements, presents a fascinating study in chemical versatility, despite its elemental form being remarkably inert. Its compounds are central to biological systems, industrial processes, and environmental chemistry. Let's delve into the specifics of nitrogen and its key compounds.

Conceptual Foundation of Nitrogen

Nitrogen (atomic number 7) has an electronic configuration of 1s22s22p31s^2 2s^2 2p^3. This configuration implies five valence electrons, three of which are unpaired in the 2p2p orbitals. In its elemental form, dinitrogen (N2N_2), two nitrogen atoms share three pairs of electrons, forming a very strong triple bond (NequivNN equiv N).

The bond dissociation enthalpy of this triple bond is exceptionally high (941.4,kJ/mol941.4,\text{kJ/mol}), making N2N_2 gas highly stable and unreactive at room temperature. This inertness is crucial for life, as it prevents indiscriminate reactions in the atmosphere.

However, this stability also means that converting atmospheric nitrogen into usable compounds (nitrogen fixation) requires significant energy input.

Nitrogen exhibits a wide range of oxidation states, from -3 (e.g., in NH3NH_3) to +5 (e.g., in HNO3HNO_3 and N2O5N_2O_5). This broad range is due to its ability to gain three electrons to achieve a stable octet (forming N3N^{3-}), or lose electrons to more electronegative elements like oxygen and fluorine.

Dinitrogen ($N_2$)

Preparation:

    1
  1. Laboratory MethodDinitrogen is typically prepared by heating an aqueous solution of ammonium chloride with sodium nitrite.

NH4Cl(aq)+NaNO2(aq)xrightarrowheatN2(g)+2H2O(l)+NaCl(aq)NH_4Cl(aq) + NaNO_2(aq) xrightarrow{\text{heat}} N_2(g) + 2H_2O(l) + NaCl(aq)
Small amounts of NONO and HNO3HNO_3 can be formed as impurities. These can be removed by passing the gas through aqueous sulfuric acid containing potassium dichromate.

    1
  1. Thermal decomposition of ammonium dichromateThis is another laboratory method.

(NH4)2Cr2O7xrightarrowheatN2(g)+Cr2O3(s)+4H2O(l)(NH_4)_2Cr_2O_7 xrightarrow{\text{heat}} N_2(g) + Cr_2O_3(s) + 4H_2O(l)

    1
  1. Industrial MethodOn a large scale, dinitrogen is obtained by the fractional distillation of liquid air. Liquid air, primarily a mixture of liquid nitrogen (boiling point 77.2,K77.2,\text{K}) and liquid oxygen (boiling point 90,K90,\text{K}), is separated based on their different boiling points. Nitrogen, having a lower boiling point, distills off first.

Properties:

  • PhysicalColorless, odorless, tasteless, non-toxic gas. It is slightly lighter than air and sparingly soluble in water.
  • ChemicalDue to the high bond enthalpy of the NequivNN equiv N bond, N2N_2 is quite unreactive at ordinary temperatures. Reactivity increases significantly at higher temperatures.

* Reaction with metals: Forms ionic nitrides with highly electropositive metals (e.g., Li, Mg) at high temperatures.

6Li(s)+N2(g)xrightarrowheat2Li3N(s)6Li(s) + N_2(g) xrightarrow{\text{heat}} 2Li_3N(s)
3Mg(s)+N2(g)xrightarrowheatMg3N2(s)3Mg(s) + N_2(g) xrightarrow{\text{heat}} Mg_3N_2(s)
* Reaction with non-metals: Reacts with hydrogen to form ammonia (Haber process) and with oxygen to form nitric oxide.

Uses:

  • Inert atmosphere for chemical reactions, metallurgy, and food packaging.
  • Cryogenic agent (liquid nitrogen) for preserving biological materials and in surgery.
  • Manufacture of ammonia, nitric acid, and calcium cyanamide.

Ammonia ($NH_3$)

Ammonia is a crucial compound of nitrogen, known for its pungent smell and basic nature.

Preparation:

    1
  1. Laboratory MethodAmmonia can be prepared by heating ammonium salts with a strong base.

2NH4Cl(aq)+Ca(OH)2(s)xrightarrowheatCaCl2(aq)+2NH3(g)+2H2O(l)2NH_4Cl(aq) + Ca(OH)_2(s) xrightarrow{\text{heat}} CaCl_2(aq) + 2NH_3(g) + 2H_2O(l)

    1
  1. Industrial Method (Haber Process)This is the most significant industrial process for ammonia synthesis.

N2(g)+3H2(g)2NH3(g)quadDeltaH=92.4,kJ/molN_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g) quad Delta H = -92.4,\text{kJ/mol}
The reaction is exothermic and reversible. According to Le Chatelier's principle, high pressure and low temperature favor ammonia formation.

However, a very low temperature would make the reaction too slow. Therefore, optimal conditions are: * Temperature: 450500circC450-500^circ C (compromise temperature). * Pressure: 200,atm200,\text{atm} (high pressure).

* Catalyst: Finely divided iron, often with molybdenum or K2O/Al2O3K_2O/Al_2O_3 as promoters to enhance catalytic activity.

Properties:

  • PhysicalColorless gas with a characteristic pungent odor. It is highly soluble in water due to hydrogen bonding. Its high boiling point (33.4circC-33.4^circ C) and melting point (77.7circC-77.7^circ C) compared to other hydrides of similar molecular mass are also due to strong intermolecular hydrogen bonding.
  • Chemical

* Basic Nature: Ammonia is a Lewis base (due to the lone pair on nitrogen) and a Brønsted-Lowry base (accepts protons). It forms ammonium hydroxide in water, which is a weak base.

NH3(g)+H2O(l)NH4+(aq)+OH(aq)NH_3(g) + H_2O(l) \rightleftharpoons NH_4^+(aq) + OH^-(aq)
It reacts with acids to form ammonium salts.

NH3(g)+HCl(g)NH4Cl(s)NH_3(g) + HCl(g) \rightarrow NH_4Cl(s)
* Formation of Complex Compounds: The lone pair on the nitrogen atom allows ammonia to act as a ligand, forming complex compounds with transition metal ions.

Cu2+(aq)+4NH3(aq)[Cu(NH3)4]2+(aq)quad(deep blue)Cu^{2+}(aq) + 4NH_3(aq) \rightarrow [Cu(NH_3)_4]^{2+}(aq) quad (\text{deep blue})
Ag+(aq)+2NH3(aq)[Ag(NH3)2]+(aq)quad(colorless)Ag^+(aq) + 2NH_3(aq) \rightarrow [Ag(NH_3)_2]^+(aq) quad (\text{colorless})
* Reducing Agent: Ammonia can act as a reducing agent, especially at high temperatures.

3CuO(s)+2NH3(g)xrightarrowheat3Cu(s)+N2(g)+3H2O(l)3CuO(s) + 2NH_3(g) xrightarrow{\text{heat}} 3Cu(s) + N_2(g) + 3H_2O(l)
* Combustion: Burns in oxygen with a greenish-yellow flame.
4NH3(g)+3O2(g)2N2(g)+6H2O(l)4NH_3(g) + 3O_2(g) \rightarrow 2N_2(g) + 6H_2O(l)
In the presence of a catalyst (Pt/Rh gauze), it oxidizes to nitric oxide (Ostwald process).

Structure:

Ammonia has a trigonal pyramidal geometry. The nitrogen atom is sp3sp^3 hybridized, with three bond pairs and one lone pair of electrons. The HNHH-N-H bond angle is approximately 107circ107^circ, slightly less than the ideal tetrahedral angle (109.5circ109.5^circ) due to the lone pair-bond pair repulsion.

Uses:

  • Production of fertilizers (urea, ammonium nitrate, ammonium sulfate).
  • Manufacture of nitric acid (Ostwald process).
  • Refrigerant (liquid ammonia).
  • In cleaning agents and as a laboratory reagent.

Oxides of Nitrogen

Nitrogen forms a variety of oxides, exhibiting different oxidation states and structures. These are often referred to as 'nitrogen oxides' or 'NOx' collectively, especially in environmental contexts.

    1
  1. Nitrous Oxide ($N_2O$) - Dinitrogen Monoxide

* Oxidation State: +1 * Preparation: By heating ammonium nitrate.

NH4NO3(s)xrightarrowheatN2O(g)+2H2O(l)NH_4NO_3(s) xrightarrow{\text{heat}} N_2O(g) + 2H_2O(l)
* Properties: Colorless gas, neutral, sweetish taste, known as 'laughing gas'. Used as an anesthetic. * Structure: Linear, resonance structures exist (NequivN+OleftrightarrowN=N+=ON equiv N^+ - O^- leftrightarrow N^- = N^+ = O).

    1
  1. Nitric Oxide ($NO$) - Nitrogen Monoxide

* Oxidation State: +2 * Preparation: * Laboratory: Reaction of copper with dilute nitric acid.

3Cu(s)+8HNO3(dilute)3Cu(NO3)2(aq)+2NO(g)+4H2O(l)3Cu(s) + 8HNO_3(\text{dilute}) \rightarrow 3Cu(NO_3)_2(aq) + 2NO(g) + 4H_2O(l)
* Industrial: Catalytic oxidation of ammonia (Ostwald process, first step).

4NH3(g)+5O2(g)xrightarrowPt/Rh gauze4NO(g)+6H2O(l)4NH_3(g) + 5O_2(g) xrightarrow{\text{Pt/Rh gauze}} 4NO(g) + 6H_2O(l)
* Properties: Colorless gas, neutral, paramagnetic (due to an odd number of electrons). Readily oxidizes in air to NO2NO_2.

2NO(g)+O2(g)2NO2(g)2NO(g) + O_2(g) \rightarrow 2NO_2(g)
* Structure: Linear, odd electron molecule.

    1
  1. Dinitrogen Trioxide ($N_2O_3$)

* Oxidation State: +3 * Preparation: By mixing equal volumes of NONO and NO2NO_2 at 250,K250,\text{K}.

NO(g)+NO2(g)xrightarrow250,KN2O3(l)NO(g) + NO_2(g) xrightarrow{250,\text{K}} N_2O_3(l)
* Properties: Blue solid, acidic (anhydride of nitrous acid, HNO2HNO_2). Unstable above 250,K250,\text{K}. * Structure: Planar, with an NNN-N bond.

    1
  1. Nitrogen Dioxide ($NO_2$)

* Oxidation State: +4 * Preparation: * Laboratory: Reaction of copper with concentrated nitric acid.

Cu(s)+4HNO3(conc.)Cu(NO3)2(aq)+2NO2(g)+2H2O(l)Cu(s) + 4HNO_3(\text{conc.}) \rightarrow Cu(NO_3)_2(aq) + 2NO_2(g) + 2H_2O(l)
* Thermal decomposition of lead nitrate.

2Pb(NO3)2(s)xrightarrowheat2PbO(s)+4NO2(g)+O2(g)2Pb(NO_3)_2(s) xrightarrow{\text{heat}} 2PbO(s) + 4NO_2(g) + O_2(g)
* Properties: Reddish-brown gas, pungent odor, acidic (dissolves in water to form nitric and nitrous acids). Paramagnetic. Readily dimerizes to N2O4N_2O_4 at lower temperatures.

2NO2(g)N2O4(g)quad(brown)quad(colorless)2NO_2(g) \rightleftharpoons N_2O_4(g) quad (\text{brown}) quad (\text{colorless})
* Structure: Bent, with an odd electron. The dimerization is an important equilibrium.

    1
  1. Dinitrogen Tetroxide ($N_2O_4$)

* Oxidation State: +4 * Preparation: Dimerization of NO2NO_2 at low temperatures. * Properties: Colorless solid or liquid, diamagnetic. Exists in equilibrium with NO2NO_2. * Structure: Planar, with an NNN-N bond.

    1
  1. Dinitrogen Pentoxide ($N_2O_5$)

* Oxidation State: +5 * Preparation: By dehydrating nitric acid with P4O10P_4O_{10}.

2HNO3(l)+P4O10(s)N2O5(s)+2HPO3(s)2HNO_3(l) + P_4O_{10}(s) \rightarrow N_2O_5(s) + 2HPO_3(s)
* Properties: Colorless solid, very strong oxidizing agent, acidic (anhydride of nitric acid). * Structure: In gaseous state, it's planar with an NONN-O-N bridge. In solid state, it exists as nitronium nitrate, [NO2+][NO3][NO_2^+][NO_3^-].

Nitric Acid ($HNO_3$)

Nitric acid is a strong mineral acid and a powerful oxidizing agent.

Preparation:

    1
  1. Laboratory MethodBy heating potassium nitrate with concentrated sulfuric acid.

KNO3(s)+H2SO4(conc.)xrightarrowheatKHSO4(s)+HNO3(l)KNO_3(s) + H_2SO_4(\text{conc.}) xrightarrow{\text{heat}} KHSO_4(s) + HNO_3(l)

    1
  1. Industrial Method (Ostwald Process)This process involves three main steps:

* Step 1: Catalytic oxidation of ammonia: Ammonia is oxidized by atmospheric oxygen in the presence of a platinum-rhodium gauze catalyst at 800circC800^circ C to form nitric oxide.

4NH3(g)+5O2(g)xrightarrowPt/Rh gauze, 800circC4NO(g)+6H2O(g)4NH_3(g) + 5O_2(g) xrightarrow{\text{Pt/Rh gauze, 800}^circ C} 4NO(g) + 6H_2O(g)
* Step 2: Oxidation of nitric oxide: Nitric oxide is cooled and then oxidized by air to nitrogen dioxide.

2NO(g)+O2(g)2NO2(g)2NO(g) + O_2(g) \rightarrow 2NO_2(g)
* Step 3: Absorption of nitrogen dioxide in water: Nitrogen dioxide is absorbed in water in the presence of oxygen to form nitric acid.
3NO2(g)+H2O(l)2HNO3(aq)+NO(g)3NO_2(g) + H_2O(l) \rightarrow 2HNO_3(aq) + NO(g)
The NONO produced can be recycled.

In the presence of excess oxygen, the reaction is:

4NO2(g)+O2(g)+2H2O(l)4HNO3(aq)4NO_2(g) + O_2(g) + 2H_2O(l) \rightarrow 4HNO_3(aq)
The acid obtained is about 6868% by mass. It can be concentrated to 9898% by distillation with concentrated H2SO4H_2SO_4.

Properties:

  • PhysicalPure nitric acid is a colorless, fuming liquid. It has a pungent odor. It is highly corrosive. Commercial nitric acid is often yellowish due to dissolved NO2NO_2 (formed by decomposition).

4HNO34NO2+2H2O+O24HNO_3 \rightarrow 4NO_2 + 2H_2O + O_2

  • Chemical

* Acidic Nature: It is a strong acid, ionizing completely in water.

HNO3(aq)+H2O(l)H3O+(aq)+NO3(aq)HNO_3(aq) + H_2O(l) \rightarrow H_3O^+(aq) + NO_3^-(aq)
* Oxidizing Agent: Nitric acid is a powerful oxidizing agent, reacting with most metals and many non-metals.

The reduction products of nitric acid depend on the concentration of the acid, the temperature, and the nature of the substance being oxidized. * Reaction with Metals: * Copper: * With dilute HNO3HNO_3: 3Cu+8HNO3(dilute)3Cu(NO3)2+2NO+4H2O3Cu + 8HNO_3(\text{dilute}) \rightarrow 3Cu(NO_3)_2 + 2NO + 4H_2O * With concentrated HNO3HNO_3: $Cu + 4HNO_3( ext{conc.

}) ightarrow Cu(NO_3)_2 + 2NO_2 + 2H_2OZinc:Withverydilute* **Zinc**: * With very diluteHNO_3::4Zn + 10HNO_3( ext{very dilute}) ightarrow 4Zn(NO_3)_2 + N_2O + 5H_2OWithdilute* With diluteHNO_3::3Zn + 8HNO_3( ext{dilute}) ightarrow 3Zn(NO_3)_2 + 2NO + 4H_2OWithconcentrated* With concentratedHNO_3::Zn + 4HNO_3( ext{conc.

}) ightarrow Zn(NO_3)_2 + 2NO_2 + 2H_2ONoblemetals(Au,Pt):Generallyunreactivewith* **Noble metals (Au, Pt)**: Generally unreactive withHNO_3alone.Theyreactwithaquaregia(aalone. They react with aqua regia (a3:1mixtureofconcentratedmixture of concentratedHClandconcentratedand concentratedHNO_3$).

* Passivity: Iron, chromium, and aluminum become passive when treated with concentrated nitric acid. This is due to the formation of a thin, protective oxide layer on their surface, which prevents further reaction.

* Reaction with Non-metals: Oxidizes non-metals like carbon, sulfur, and phosphorus. * Carbon: C+4HNO3(conc.)CO2+4NO2+2H2OC + 4HNO_3(\text{conc.}) \rightarrow CO_2 + 4NO_2 + 2H_2O * Sulfur: S8+48HNO3(conc.)8H2SO4+48NO2+16H2OS_8 + 48HNO_3(\text{conc.}) \rightarrow 8H_2SO_4 + 48NO_2 + 16H_2O * Phosphorus: $P_4 + 20HNO_3( ext{conc.

Structure:

Nitric acid is a planar molecule. The nitrogen atom is sp2sp^2 hybridized. It has one N=ON=O double bond, one NON-O single bond, and one NOHN-OH single bond. Resonance structures contribute to the stability of the nitrate ion (NO3NO_3^-).

Uses:

  • Manufacture of ammonium nitrate (fertilizer) and other nitrates.
  • Production of explosives (e.g., TNT, nitroglycerin).
  • In the purification of silver and gold.
  • As an oxidizing agent in laboratories and industries.
  • Manufacture of dyes, drugs, and perfumes.

Common Misconceptions and NEET-Specific Angle

  • Inertness vs. ReactivityStudents often confuse the inertness of N2N_2 gas with the reactivity of nitrogen in its compounds. Emphasize that the triple bond in N2N_2 is responsible for its inertness, but once fixed, nitrogen can be highly reactive.
  • Oxidation StatesA common error is miscalculating or confusing the oxidation states of nitrogen in its various oxides. Practice assigning oxidation states.
  • Nitric Acid ReactionsThe varying products of nitric acid's reactions with metals based on concentration are a frequent source of confusion. Memorize the key reactions and the products (NO,NO2,N2ONO, NO_2, N_2O, etc.) for different conditions.
  • Industrial ProcessesHaber and Ostwald processes are high-yield topics. Understand the principles (Le Chatelier's principle), catalysts, and optimal conditions.
  • Structures and HybridizationBe able to draw structures and identify hybridization for NH3NH_3, HNO3HNO_3, and common oxides. Paramagnetic nature of NONO and NO2NO_2 is also important.

For NEET, focus on balanced chemical equations, reaction conditions, distinguishing properties (e.g., color of gases like NO2NO_2), and the applications of these compounds.

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.