Chemistry·Revision Notes

Dioxygen and Ozone — Revision Notes

NEET UG
Version 1Updated 22 Mar 2026

⚡ 30-Second Revision

  • Dioxygen ($O_2$)Colorless, odorless, tasteless. Paramagnetic. Linear structure. Essential for respiration/combustion. Lab prep: 2KClO3MnO22KCl+3O22KClO_3 \xrightarrow{MnO_2} 2KCl + 3O_2; 2H2O2MnO22H2O+O22H_2O_2 \xrightarrow{MnO_2} 2H_2O + O_2. Industrial prep: Fractional distillation of liquid air.
  • Ozone ($O_3$)Pale blue gas, pungent smell. Diamagnetic. Bent structure (116.8circ116.8^circ), resonance, identical OOO-O bond lengths (128,pm128,\text{pm}). Strong oxidizing agent (O3O2+OO_3 \rightarrow O_2 + O). Lab prep: 3O2silent electric discharge2O33O_2 \xrightarrow{\text{silent electric discharge}} 2O_3. Thermodynamically unstable.
  • Key Reactions of $O_3$2KI+H2O+O32KOH+I2+O22KI + H_2O + O_3 \rightarrow 2KOH + I_2 + O_2; PbS+4O3PbSO4+4O2PbS + 4O_3 \rightarrow PbSO_4 + 4O_2; 2Hg+O3Hg2O+O22Hg + O_3 \rightarrow Hg_2O + O_2.
  • EnvironmentalStratospheric O3O_3 (UV shield), Tropospheric O3O_3 (pollutant).

2-Minute Revision

Dioxygen (O2O_2) and ozone (O3O_3) are the two main allotropes of oxygen. Dioxygen is a stable, colorless, odorless, and tasteless gas, crucial for life. Its most notable property is paramagnetism, explained by two unpaired electrons in its molecular orbitals. It's prepared in labs by decomposing compounds like KClO3KClO_3 or H2O2H_2O_2 and industrially by fractional distillation of liquid air.

Ozone (O3O_3) is a less stable, pale blue gas with a pungent smell. It's diamagnetic, meaning all its electrons are paired. Its structure is bent, with a bond angle of about 116.8circ116.8^circ, and it exhibits resonance, leading to two identical OOO-O bond lengths.

Ozone is a very powerful oxidizing agent because it readily decomposes to release nascent oxygen. It's prepared by passing a silent electric discharge through dry oxygen to prevent decomposition. Key reactions include oxidizing KIKI to I2I_2, PbSPbS to PbSO4PbSO_4, and NONO to NO2NO_2.

Environmentally, stratospheric ozone protects from UV radiation, while tropospheric ozone is a pollutant.

5-Minute Revision

Let's quickly review the essential aspects of Dioxygen (O2O_2) and Ozone (O3O_3) for NEET. These are the two primary allotropes of oxygen, differing significantly in their properties and roles.

**Dioxygen (O2O_2): This is the common form of oxygen, a colorless, odorless, tasteless gas. It's vital for respiration and combustion. A critical point for NEET is its paramagnetic** nature, arising from two unpaired electrons in its antibonding pipi^* molecular orbitals, as explained by Molecular Orbital Theory.

Its structure is linear. Laboratory preparation involves heating potassium chlorate with manganese dioxide (2KClO3MnO2,Delta2KCl+3O22KClO_3 \xrightarrow{MnO_2, Delta} 2KCl + 3O_2) or decomposing hydrogen peroxide (2H2O2MnO22H2O+O22H_2O_2 \xrightarrow{MnO_2} 2H_2O + O_2).

Industrially, it's obtained by fractional distillation of liquid air.

**Ozone (O3O_3)**: This is a pale blue gas with a characteristic pungent smell. Unlike O2O_2, it is diamagnetic (all electrons paired). Its molecular structure is bent, not linear, with a bond angle of approximately $116.

8^circ.Thecentraloxygenatomis. The central oxygen atom issp^2hybridized,anditexhibitsresonance,resultingintwoidenticalhybridized, and it exhibits resonance, resulting in two identicalO-Obondlengths(bond lengths (128, ext{pm}),intermediatebetweensingleanddoublebonds.Ozoneisthermodynamicallyunstableandreadilydecomposesto), intermediate between single and double bonds. Ozone is thermodynamically unstable and readily decomposes toO_2,makingitaverypowerfuloxidizingagentduetothereleaseofnascentoxygen(, making it a **very powerful oxidizing agent** due to the release of nascent oxygen (O_3 \rightarrow O_2 + O$).

Preparation of Ozone: It's prepared by passing a silent electric discharge through dry oxygen in an ozonizer (3O2(g)silent electric discharge2O3(g)3O_2(g) \xrightarrow{\text{silent electric discharge}} 2O_3(g)). The 'silent' discharge is crucial to prevent the decomposition of the unstable ozone due to excessive heat.

Key Reactions of Ozone: Focus on its oxidizing reactions:

  • Oxidation of potassium iodide: 2KI(aq)+H2O(l)+O3(g)2KOH(aq)+I2(s)+O2(g)2KI(aq) + H_2O(l) + O_3(g) \rightarrow 2KOH(aq) + I_2(s) + O_2(g) (used for quantitative estimation).
  • Oxidation of lead sulfide: PbS(s)+4O3(g)PbSO4(s)+4O2(g)PbS(s) + 4O_3(g) \rightarrow PbSO_4(s) + 4O_2(g) (black PbSPbS to white PbSO4PbSO_4).
  • Oxidation of mercury ('tailing of mercury'): 2Hg(l)+O3(g)Hg2O(s)+O2(g)2Hg(l) + O_3(g) \rightarrow Hg_2O(s) + O_2(g).
  • Oxidation of nitrogen monoxide: NO(g)+O3(g)NO2(g)+O2(g)NO(g) + O_3(g) \rightarrow NO_2(g) + O_2(g).

Environmental Role: Stratospheric ozone forms a protective layer, absorbing harmful UV radiation. Tropospheric ozone, however, is a harmful pollutant contributing to smog.

Common Traps: Don't confuse the magnetic properties or stability. Remember O3O_3 is less stable but a stronger oxidizer. Be clear on the specific products of ozone's reactions.

Prelims Revision Notes

  • Oxygen AllotropesDioxygen (O2O_2) and Ozone (O3O_3).
  • Dioxygen ($O_2$) Properties

* Colorless, odorless, tasteless gas. * Paramagnetic (due to 2 unpaired electrons in pipi^* MOs). * Linear molecule. * Essential for respiration and combustion. * Oxidation state typically 2-2, but 1-1 in peroxides (H2O2H_2O_2) and 1/2-1/2 in superoxides (KO2KO_2). With fluorine, +1+1 (O2F2O_2F_2) and +2+2 (OF2OF_2).

  • Dioxygen Preparation

* Lab: Thermal decomposition of KClO3KClO_3 (with MnO2MnO_2 catalyst), H2O2H_2O_2 (with MnO2MnO_2 catalyst), HgOHgO, Ag2OAg_2O. * 2KClO3(s)MnO2,Delta2KCl(s)+3O2(g)2KClO_3(s) \xrightarrow{MnO_2, Delta} 2KCl(s) + 3O_2(g) * 2H2O2(aq)MnO22H2O(l)+O2(g)2H_2O_2(aq) \xrightarrow{MnO_2} 2H_2O(l) + O_2(g) * Industrial: Fractional distillation of liquid air.

  • Ozone ($O_3$) Properties

* Pale blue gas, pungent 'electrical' smell. * Diamagnetic (all electrons paired). * Bent structure, sp2sp^2 hybridized central O, resonance stabilized. * Bond angle approx116.8circapprox 116.8^circ, identical OOO-O bond lengths (128,pm128,\text{pm}). * Thermodynamically unstable (decomposes to O2O_2), endothermic formation (DeltaH=+142,kJ/molDelta H = +142,\text{kJ/mol}). * Very strong oxidizing agent (releases nascent oxygen: O3O2+OO_3 \rightarrow O_2 + O).

  • Ozone Preparation

* Lab/Industrial: Passing dry oxygen through a silent electric discharge in an ozonizer. * 3O2(g)silent electric discharge2O3(g)3O_2(g) \xrightarrow{\text{silent electric discharge}} 2O_3(g) * Silent discharge prevents decomposition due to heat.

  • Key Reactions of Ozone (Oxidizing Action)

* Oxidizes KIKI to I2I_2: 2KI+H2O+O32KOH+I2+O22KI + H_2O + O_3 \rightarrow 2KOH + I_2 + O_2 * Oxidizes PbSPbS to PbSO4PbSO_4: PbS+4O3PbSO4+4O2PbS + 4O_3 \rightarrow PbSO_4 + 4O_2 * Oxidizes HgHg ('tailing of mercury'): 2Hg+O3Hg2O+O22Hg + O_3 \rightarrow Hg_2O + O_2 * Oxidizes NONO to NO2NO_2: NO+O3NO2+O2NO + O_3 \rightarrow NO_2 + O_2

  • UsesGermicide, disinfectant, bleaching agent, air purifier.
  • Environmental RoleStratospheric ozone (protective UV shield), Tropospheric ozone (harmful pollutant, smog component).

Vyyuha Quick Recall

OZONE's Properties: Pungent smell, Pale blue, Powerful oxidizer, Prepped by silent discharge. Bent structure, Bond lengths equal, But Bad at ground level. Diamagnetic, Decomposes easily.

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.