Chemistry·Explained

Some Important Compounds of Transition Elements — Explained

NEET UG
Updated 22 Mar 2026

Detailed Explanation

Transition elements, often referred to as d-block elements, form a fascinating array of compounds characterized by their vibrant colors, paramagnetism, and catalytic activity. This section delves into two of the most significant compounds of transition elements from a NEET perspective: Potassium Permanganate (KMnO4KMnO_4) and Potassium Dichromate (K2Cr2O7K_2Cr_2O_7). Both are powerful oxidizing agents, and their chemistry is central to understanding redox reactions involving transition metals.

I. Potassium Permanganate ($KMnO_4$)

Conceptual Foundation: KMnO4KMnO_4 is a salt of permanganic acid (HMnO4HMnO_4). The manganese atom in the permanganate ion (MnO4MnO_4^-) is in the +7 oxidation state, which is its highest stable oxidation state. This high oxidation state makes MnO4MnO_4^- a very strong oxidizing agent, as it readily accepts electrons to achieve lower, more stable oxidation states.

Key Principles/Laws: The oxidizing power of KMnO4KMnO_4 is highly dependent on the pH of the medium. This is a crucial concept for NEET.

    1
  1. In Acidic Medium:MnO4MnO_4^- is reduced to Mn2+Mn^{2+} ions. The half-reaction is:

MnO4+8H++5eMn2++4H2OMnO_4^- + 8H^+ + 5e^- \rightarrow Mn^{2+} + 4H_2O
Here, manganese gains 5 electrons, and its oxidation state changes from +7 to +2. This is the strongest oxidizing action of KMnO4KMnO_4.

    1
  1. In Neutral or Weakly Alkaline Medium:MnO4MnO_4^- is reduced to manganese dioxide (MnO2MnO_2). The half-reaction is:

MnO4+2H2O+3eMnO2(s)+4OHMnO_4^- + 2H_2O + 3e^- \rightarrow MnO_2(s) + 4OH^-
Manganese gains 3 electrons, changing its oxidation state from +7 to +4. MnO2MnO_2 is a brown precipitate.

    1
  1. In Strongly Alkaline Medium:MnO4MnO_4^- is reduced to manganate ion (MnO42MnO_4^{2-}). The half-reaction is:

MnO4+eMnO42MnO_4^- + e^- \rightarrow MnO_4^{2-}
Manganese gains 1 electron, changing its oxidation state from +7 (purple) to +6 (green). This is a less potent oxidizing action.

Preparation of $KMnO_4$:

KMnO4KMnO_4 is prepared from pyrolusite ore (MnO2MnO_2). The process involves two main steps:

    1
  1. Fusion of $MnO_2$ with KOH and an oxidizing agent (like $KNO_3$ or air):This forms potassium manganate (K2MnO4K_2MnO_4).

2MnO2+4KOH+O2heat2K2MnO4+2H2O2MnO_2 + 4KOH + O_2 \xrightarrow{\text{heat}} 2K_2MnO_4 + 2H_2O
(Alternatively, using KNO3KNO_3 as an oxidizing agent: MnO2+2KOH+KNO3K2MnO4+KNO2+H2OMnO_2 + 2KOH + KNO_3 \rightarrow K_2MnO_4 + KNO_2 + H_2O) In this step, manganese is oxidized from +4 to +6.

    1
  1. Oxidation of Potassium Manganate ($K_2MnO_4$) to Potassium Permanganate ($KMnO_4$):This can be done either chemically or electrolytically.

* Chemical Oxidation: By passing CO2CO_2 or Cl2Cl_2 through the manganate solution.

3K2MnO4+2CO22KMnO4+MnO2+2K2CO33K_2MnO_4 + 2CO_2 \rightarrow 2KMnO_4 + MnO_2 + 2K_2CO_3
2K2MnO4+Cl22KMnO4+2KCl2K_2MnO_4 + Cl_2 \rightarrow 2KMnO_4 + 2KCl
* Electrolytic Oxidation: This is the preferred industrial method. Manganate ions are oxidized at the anode.
MnO42anode oxidationMnO4+eMnO_4^{2-} \xrightarrow{\text{anode oxidation}} MnO_4^- + e^-

Physical Properties: KMnO4KMnO_4 forms dark purple, almost black, crystalline solids. It is moderately soluble in water, giving a deep purple solution. Its intense color is due to charge transfer transitions.

Structure: The permanganate ion (MnO4MnO_4^-) has a tetrahedral geometry, with manganese at the center and four oxygen atoms at the corners. The Mn-O bond length is 163,±163,\pm, indicating significant double bond character.

Applications:

  • Volumetric analysis (titrations) for estimating reducing agents like Fe2+Fe^{2+}, oxalates, H2SH_2S, SO2SO_2, etc.
  • As a disinfectant and antiseptic (e.g., in dilute solutions for washing wounds).
  • In organic chemistry as an oxidizing agent for alcohols, alkenes, and alkynes.

Common Misconceptions (NEET-specific):

  • Confusing the number of electrons gained in different media. Remember: 5 in acidic, 3 in neutral/weakly alkaline, 1 in strongly alkaline.
  • Incorrectly balancing redox reactions involving KMnO4KMnO_4 in different media. Always balance oxygen with H2OH_2O and hydrogen with H+H^+ (acidic) or OHOH^- (basic).
  • Forgetting that KMnO4KMnO_4 is a self-indicator in titrations, so no external indicator is usually needed.

II. Potassium Dichromate ($K_2Cr_2O_7$)

Conceptual Foundation: K2Cr2O7K_2Cr_2O_7 is a salt of dichromic acid (H2Cr2O7H_2Cr_2O_7). The chromium atoms in the dichromate ion (Cr2O72Cr_2O_7^{2-}) are in the +6 oxidation state. Like MnO4MnO_4^-, Cr2O72Cr_2O_7^{2-} is a powerful oxidizing agent, especially in acidic solutions, where it is reduced to the more stable Cr3+Cr^{3+} ions.

Key Principles/Laws: The interconversion between chromate (CrO42CrO_4^{2-}, yellow) and dichromate (Cr2O72Cr_2O_7^{2-}, orange) ions is pH-dependent. This equilibrium is crucial:

2CrO42(yellow)+2H+Cr2O72()+H2O2CrO_4^{2-} (yellow) + 2H^+ \rightleftharpoons Cr_2O_7^{2-} (\orange) + H_2O
Cr2O72()+2OH2CrO42(yellow)+H2OCr_2O_7^{2-} (\orange) + 2OH^- \rightleftharpoons 2CrO_4^{2-} (yellow) + H_2O
In acidic medium, dichromate is favored. In alkaline medium, chromate is favored.

Oxidizing Action of $K_2Cr_2O_7$:

K2Cr2O7K_2Cr_2O_7 is a strong oxidizing agent, primarily used in acidic solutions. The half-reaction for its reduction is:

Cr2O72+14H++6e2Cr3++7H2OCr_2O_7^{2-} + 14H^+ + 6e^- \rightarrow 2Cr^{3+} + 7H_2O
Here, each chromium atom gains 3 electrons (total 6 electrons for two Cr atoms), changing its oxidation state from +6 to +3. The color change from orange (Cr2O72Cr_2O_7^{2-}) to green (Cr3+Cr^{3+}) is a characteristic observation.

Preparation of $K_2Cr_2O_7$:

K2Cr2O7K_2Cr_2O_7 is prepared from chromite ore (FeCr2O4FeCr_2O_4). The process involves three main steps:

    1
  1. Conversion of Chromite Ore to Sodium Chromate:The finely powdered chromite ore is fused with sodium carbonate (Na2CO3Na_2CO_3) and lime in the presence of air.

4FeCr2O4+8Na2CO3+7O2heat8Na2CrO4+2Fe2O3+8CO24FeCr_2O_4 + 8Na_2CO_3 + 7O_2 \xrightarrow{\text{heat}} 8Na_2CrO_4 + 2Fe_2O_3 + 8CO_2
The yellow solution of sodium chromate is then extracted with water.

    1
  1. Conversion of Sodium Chromate to Sodium Dichromate:The yellow sodium chromate solution is acidified with sulfuric acid (H2SO4H_2SO_4).

2Na2CrO4+H2SO4Na2Cr2O7+Na2SO4+H2O2Na_2CrO_4 + H_2SO_4 \rightarrow Na_2Cr_2O_7 + Na_2SO_4 + H_2O
Sodium dichromate is more soluble than potassium dichromate, so it's usually converted to the potassium salt.

    1
  1. Conversion of Sodium Dichromate to Potassium Dichromate:Sodium dichromate solution is treated with potassium chloride (KClKCl). Potassium dichromate, being less soluble, crystallizes out.

Na2Cr2O7+2KClK2Cr2O7(s)+2NaClNa_2Cr_2O_7 + 2KCl \rightarrow K_2Cr_2O_7(s) + 2NaCl

Physical Properties: K2Cr2O7K_2Cr_2O_7 forms orange-red crystalline solids. It is soluble in water, giving an orange solution. It is toxic and carcinogenic.

Structure: The dichromate ion (Cr2O72Cr_2O_7^{2-}) consists of two tetrahedral CrO4CrO_4 units sharing one oxygen atom. The two CrOCrCr-O-Cr bonds are bent, with a bond angle of approximately 126126^\circ. The Cr-O (terminal) bond length is about 161,±161,\pm, and the Cr-O (bridge) bond length is about 179,±179,\pm.

Applications:

  • Volumetric analysis for estimating reducing agents like Fe2+Fe^{2+}, II^-, SO32SO_3^{2-}, etc.
  • In organic chemistry as an oxidizing agent (e.g., for converting primary alcohols to carboxylic acids, and secondary alcohols to ketones).
  • In leather tanning.
  • As a primary standard in volumetric analysis (though KMnO4KMnO_4 is not).

Common Misconceptions (NEET-specific):

  • Confusing the colors of chromate (yellow) and dichromate (orange) ions and their interconversion with pH.
  • Incorrectly balancing redox reactions, especially the number of electrons gained (6 electrons for Cr2O72Cr_2O_7^{2-} to 2Cr3+2Cr^{3+}).
  • Assuming K2Cr2O7K_2Cr_2O_7 is a self-indicator; it requires an external indicator (like diphenylamine) for precise endpoint detection in titrations, unlike KMnO4KMnO_4.

NEET-Specific Angle:

NEET questions often focus on:

    1
  1. Oxidation states:Identifying the oxidation state of Mn in KMnO4KMnO_4 (+7) and Cr in K2Cr2O7K_2Cr_2O_7 (+6).
  2. 2
  3. Redox reactions:Balancing half-reactions and full redox reactions in different media, particularly the number of electrons transferred.
  4. 3
  5. Color changes:Associating specific colors with different oxidation states or ions (e.g., purple MnO4MnO_4^-, green Mn2+Mn^{2+}, brown MnO2MnO_2; orange Cr2O72Cr_2O_7^{2-}, yellow CrO42CrO_4^{2-}, green Cr3+Cr^{3+}).
  6. 4
  7. Preparation methods:Knowing the key steps and reagents involved in the industrial preparation of both compounds.
  8. 5
  9. Structural aspects:Basic geometry of MnO4MnO_4^- (tetrahedral) and Cr2O72Cr_2O_7^{2-} (two tetrahedra sharing an oxygen).
  10. 6
  11. Distinguishing features:KMnO4KMnO_4 as a self-indicator vs. K2Cr2O7K_2Cr_2O_7 requiring an external indicator; difference in oxidizing power in various media.
  12. 7
  13. Stoichiometry:Calculating quantities in titration problems using molar mass and balanced equations.

Mastering these aspects, along with practicing balancing redox equations, will be crucial for success in NEET.

Often confused with

Side-by-side differences the NEET paper likes to test.

Some Important Compounds of Transition Elements vs Potassium Permanganate ($KMnO_4$) vs. Potassium Dichromate ($K_2Cr_2O_7$)
AspectSome Important Compounds of Transition ElementsPotassium Permanganate ($KMnO_4$) vs. Potassium Dichromate ($K_2Cr_2O_7$)
Chemical Formula$KMnO_4$$K_2Cr_2O_7$
ColorDark purple (solution is purple)Orange-red (solution is orange)
Oxidation State of MetalMn is +7Cr is +6
Primary OrePyrolusite ($MnO_2$)Chromite ($FeCr_2O_4$)
Reduction Product (Acidic Medium)$Mn^{2+}$ (colorless)$Cr^{3+}$ (green)
Electrons Gained (Acidic Medium)5 electrons per $MnO_4^-$6 electrons per $Cr_2O_7^{2-}$
Self-IndicatorYesNo (requires external indicator)
StabilityDecomposes on heatingRelatively stable to heat
pH Dependence of Oxidizing PowerStrongly dependent (acidic > neutral > alkaline)Mainly used in acidic medium; less variation with pH for its primary redox action

Potassium permanganate and potassium dichromate are both powerful oxidizing agents but differ significantly in their properties and applications. KMnO4KMnO_4 is purple with Mn in +7 state, reducing to colorless Mn2+Mn^{2+} in acidic media by gaining 5 electrons, and acts as a self-indicator.

K2Cr2O7K_2Cr_2O_7 is orange with Cr in +6 state, reducing to green Cr3+Cr^{3+} in acidic media by gaining 6 electrons, and requires an external indicator. Their preparation methods also differ, starting from pyrolusite and chromite ores, respectively.

Understanding these distinctions is vital for solving NEET problems.

Why it is tested: NEET relevance: This comparison is highly relevant for NEET as it highlights key distinguishing features, redox behavior, and analytical applications of these two important compounds. Questions often test these differences directly or indirectly in titration problems and conceptual queries.

Questions students ask

6 answered on this topic.

Why are $KMnO_4$ and $K_2Cr_2O_7$ strong oxidizing agents?

Both KMnO4KMnO_4 and K2Cr2O7K_2Cr_2O_7 are strong oxidizing agents because the central metal atoms, manganese and chromium respectively, are in their highest possible oxidation states (+7 for Mn and +6 for Cr).

In these high oxidation states, the metal atoms have a strong tendency to accept electrons and get reduced to more stable, lower oxidation states. This electron-accepting ability is the defining characteristic of an oxidizing agent.

For example, in acidic medium, MnO4MnO_4^- reduces to Mn2+Mn^{2+} (gaining 5 electrons), and Cr2O72Cr_2O_7^{2-} reduces to Cr3+Cr^{3+} (gaining 6 electrons).

How does the oxidizing power of $KMnO_4$ vary with pH?

The oxidizing power of KMnO4KMnO_4 is highly dependent on the pH of the solution. In a strongly acidic medium, MnO4MnO_4^- is reduced to Mn2+Mn^{2+} ions, gaining 5 electrons, which represents its strongest oxidizing action.

In a neutral or weakly alkaline medium, it is reduced to MnO2MnO_2 (manganese dioxide), gaining 3 electrons. In a strongly alkaline medium, it is reduced to the manganate ion (MnO42MnO_4^{2-}), gaining only 1 electron, making it a much weaker oxidizing agent.

This variation is crucial for selecting appropriate conditions for redox reactions.

What is the color change observed during the reduction of $K_2Cr_2O_7$ in acidic medium?

When potassium dichromate (K2Cr2O7K_2Cr_2O_7) acts as an oxidizing agent in an acidic medium, the orange dichromate ion (Cr2O72Cr_2O_7^{2-}) is reduced to the green chromic ion (Cr3+Cr^{3+}). The characteristic color change from orange to green is a visual indicator of the redox reaction taking place. This distinct color change is often used in titrations to detect the endpoint, although an external indicator like diphenylamine is usually employed for sharper detection.

Why is $KMnO_4$ considered a self-indicator in titrations, but $K_2Cr_2O_7$ is not?

KMnO4KMnO_4 is a self-indicator because the permanganate ion (MnO4MnO_4^-) is intensely purple. When it reacts with a reducing agent, it gets reduced to colorless Mn2+Mn^{2+} ions (in acidic medium). As long as the reducing agent is present, any added KMnO4KMnO_4 is consumed and decolorized.

Once all the reducing agent is consumed, the very next drop of KMnO4KMnO_4 solution, having no reducing agent to react with, imparts a persistent light pink color to the solution, signaling the endpoint.

In contrast, K2Cr2O7K_2Cr_2O_7 is orange and its reduced product, Cr3+Cr^{3+}, is green. While there is a color change, it's not as sharp or easily detectable as the appearance of a distinct color from a colorless solution, hence an external indicator is preferred for K2Cr2O7K_2Cr_2O_7 titrations.

Describe the structural difference between chromate and dichromate ions.

The chromate ion (CrO42CrO_4^{2-}) has a tetrahedral structure, with a central chromium atom bonded to four oxygen atoms. All Cr-O bonds are equivalent. The dichromate ion (Cr2O72Cr_2O_7^{2-}), on the other hand, consists of two CrO4CrO_4 tetrahedra joined together by sharing one oxygen atom.

This creates a bent CrOCrCr-O-Cr bridge. The terminal Cr-O bonds are shorter than the bridging Cr-O bonds. The interconversion between these two forms is pH-dependent, with chromate favored in alkaline conditions and dichromate in acidic conditions.

What is the primary ore used for the preparation of $KMnO_4$ and $K_2Cr_2O_7$?

The primary ore used for the preparation of potassium permanganate (KMnO4KMnO_4) is pyrolusite, which is chemically manganese dioxide (MnO2MnO_2). For potassium dichromate (K2Cr2O7K_2Cr_2O_7), the primary ore is chromite, which has the chemical formula FeCr2O4FeCr_2O_4. These ores are subjected to specific chemical processes, including fusion with alkaline substances and oxidation steps, to yield the desired compounds.