Chemistry·Explained

Alcohols — Explained

NEET UG
Updated 22 Mar 2026

Detailed Explanation

Alcohols represent a pivotal class of organic compounds, serving as versatile intermediates in synthesis and possessing a wide array of applications. Their chemistry is fundamentally governed by the presence of the hydroxyl (-OH) functional group attached to a saturated carbon atom.

Conceptual Foundation:

At the heart of alcohol chemistry is the hydroxyl group. The oxygen atom in the -OH group is sp3sp^3 hybridized, with two lone pairs of electrons and two sigma bonds (one to carbon, one to hydrogen). This makes the oxygen atom slightly negative (due to its high electronegativity) and the hydrogen atom slightly positive, leading to a polar O-H bond.

The C-O bond is also polar, with oxygen being more electronegative than carbon. This polarity allows alcohols to form hydrogen bonds, which significantly impacts their physical properties like boiling points and solubility.

The carbon atom to which the hydroxyl group is attached must be sp3sp^3 hybridized, meaning it forms four single bonds. This distinguishes alcohols from phenols (where -OH is attached to an sp2sp^2 hybridized carbon of an aromatic ring) and enols (where -OH is attached to an sp2sp^2 hybridized carbon of an alkene).

Key Principles and Classification:

    1
  1. Nomenclature:Alcohols are named using IUPAC rules by replacing the '-e' of the corresponding alkane with '-ol'. The position of the hydroxyl group is indicated by a number. For example, CH3CH2OHCH_3CH_2OH is ethanol, and CH3CH(OH)CH3CH_3CH(OH)CH_3 is propan-2-ol. Common names often use the alkyl group followed by 'alcohol' (e.g., ethyl alcohol, isopropyl alcohol).
  2. 2
  3. Classification based on number of -OH groups:

* Monohydric alcohols: Contain one -OH group (e.g., ethanol). * Dihydric alcohols: Contain two -OH groups (e.g., ethane-1,2-diol or ethylene glycol). * Polyhydric alcohols: Contain more than two -OH groups (e.g., propane-1,2,3-triol or glycerol).

    1
  1. Classification based on the carbon atom bearing -OH:This is crucial for predicting reactivity.

* **Primary (11^\circ) alcohols:** The -OH group is attached to a carbon atom that is bonded to only one other carbon atom (e.g., ethanol, CH3CH2OHCH_3CH_2OH). * **Secondary (22^\circ) alcohols:** The -OH group is attached to a carbon atom that is bonded to two other carbon atoms (e.g., propan-2-ol, CH3CH(OH)CH3CH_3CH(OH)CH_3). * **Tertiary (33^\circ) alcohols:** The -OH group is attached to a carbon atom that is bonded to three other carbon atoms (e.g., 2-methylpropan-2-ol, (CH3)3COH(CH_3)_3COH).

Methods of Preparation:

Alcohols can be synthesized through various routes:

    1
  1. From Alkenes:

* Acid-catalyzed hydration: Alkenes react with water in the presence of an acid catalyst (H2SO4H_2SO_4) to form alcohols. This follows Markovnikov's rule, where the -OH adds to the more substituted carbon.

The mechanism involves carbocation formation. For example, propene yields propan-2-ol.

CH3CH=CH2+H2OH2SO4CH3CH(OH)CH3CH_3CH=CH_2 + H_2O \xrightarrow{H_2SO_4} CH_3CH(OH)CH_3
* Hydroboration-oxidation: This method provides anti-Markovnikov addition of water.

Alkenes react with diborane (B2H6B_2H_6) followed by oxidation with hydrogen peroxide (H2O2H_2O_2) in alkaline medium. For example, propene yields propan-1-ol.

    1
  1. From Carbonyl Compounds (Aldehydes, Ketones, Carboxylic Acids, Esters):

* Reduction: Aldehydes reduce to primary alcohols, and ketones reduce to secondary alcohols. Common reducing agents include lithium aluminium hydride (LiAlH4LiAlH_4) or sodium borohydride (NaBH4NaBH_4).

LiAlH4LiAlH_4 is a stronger reducing agent and can reduce carboxylic acids and esters to primary alcohols, while NaBH4NaBH_4 is milder and typically only reduces aldehydes and ketones.

RCHONaBH4 or LiAlH4RCH2OH(Primary alcohol)RCHO \xrightarrow{NaBH_4 \text{ or } LiAlH_4} RCH_2OH \quad (\text{Primary alcohol})
RCORNaBH4 or LiAlH4RCH(OH)R(Secondary alcohol)RCOR' \xrightarrow{NaBH_4 \text{ or } LiAlH_4} RCH(OH)R' \quad (\text{Secondary alcohol})
RCOOHLiAlH4RCH2OH(Primary alcohol)RCOOH \xrightarrow{LiAlH_4} RCH_2OH \quad (\text{Primary alcohol})
RCOORLiAlH4RCH2OH+ROH(Primary alcohol)RCOOR' \xrightarrow{LiAlH_4} RCH_2OH + R'OH \quad (\text{Primary alcohol})
* Grignard Reagents: Alkyl magnesium halides (RMgXRMgX) react with carbonyl compounds.

Formaldehyde (HCHOHCHO) gives primary alcohols, other aldehydes (RCHOR'CHO) give secondary alcohols, and ketones (RCORR'COR'') give tertiary alcohols. This is a powerful C-C bond forming reaction.

    1
  1. From Alkyl Halides:Primary alkyl halides can be converted to primary alcohols by nucleophilic substitution (SN2S_N2) with aqueous KOH or NaOH.

RX+KOH(aq)ROH+KXR-X + KOH(aq) \rightarrow R-OH + KX

Chemical Reactions of Alcohols:

Alcohols exhibit reactions involving both the O-H bond (acidity, esterification) and the C-O bond (dehydration, oxidation, substitution).

    1
  1. Acidity of Alcohols:Alcohols are weakly acidic, less acidic than water and significantly less acidic than phenols. Their acidity arises from the polarization of the O-H bond, allowing the proton to be donated. Electron-withdrawing groups increase acidity, while electron-donating groups decrease it. They react with active metals like sodium to form alkoxides.

2ROH+2Na2RONa+H22ROH + 2Na \rightarrow 2RONa + H_2

    1
  1. Esterification:Alcohols react with carboxylic acids or their derivatives (acid chlorides, anhydrides) in the presence of an acid catalyst to form esters. This involves the cleavage of the O-H bond of the alcohol.

RCOOH+ROHH+RCOOR+H2ORCOOH + R'OH \xrightarrow{H^+} RCOOR' + H_2O

    1
  1. Reaction with Hydrogen Halides:Alcohols react with HX (HCl, HBr, HI) to form alkyl halides. The reactivity order of HX is HI>HBr>HClHI > HBr > HCl. The reactivity order of alcohols is 3>2>13^\circ > 2^\circ > 1^\circ (following SN1S_N1 mechanism for 33^\circ and 22^\circ, and SN2S_N2 for 11^\circ). Lucas reagent (conc. HCl + anhydrous ZnCl2ZnCl_2) is used to distinguish 1circ,2circ,31^circ, 2^circ, 3^\circ alcohols.

ROH+HXZnCl2 (for 1circ,2 with HCl)RX+H2OROH + HX \xrightarrow{ZnCl_2 \text{ (for } 1^circ, 2^\circ \text{ with HCl)}} RX + H_2O

    1
  1. Dehydration:Alcohols undergo elimination of a water molecule to form alkenes in the presence of protic acids (H2SO4H_2SO_4, H3PO4H_3PO_4) or anhydrous Al2O3Al_2O_3 at high temperatures. The ease of dehydration follows the order 3>2>13^\circ > 2^\circ > 1^\circ. The reaction follows Zaitsev's rule, forming the more substituted alkene as the major product.

CH3CH2OHConc.H2SO4,443KCH2=CH2+H2OCH_3CH_2OH \xrightarrow{Conc. H_2SO_4, 443K} CH_2=CH_2 + H_2O

    1
  1. Oxidation:This is a key reaction for distinguishing alcohols.

* Primary alcohols oxidize to aldehydes, which can be further oxidized to carboxylic acids. Mild oxidizing agents like PCC (Pyridinium Chlorochromate) stop at the aldehyde stage. Stronger agents like acidified K2Cr2O7K_2Cr_2O_7 or KMnO4KMnO_4 oxidize directly to carboxylic acids.

RCH2OHPCCRCHOK2Cr2O7/H+RCOOHRCH_2OH \xrightarrow{PCC} RCHO \xrightarrow{K_2Cr_2O_7/H^+} RCOOH
* Secondary alcohols oxidize to ketones. Both mild and strong oxidizing agents yield ketones, as ketones are resistant to further oxidation under normal conditions.

RCH(OH)RK2Cr2O7/H+RCORRCH(OH)R' \xrightarrow{K_2Cr_2O_7/H^+} RCOR'
* Tertiary alcohols are resistant to oxidation under mild conditions. Strong oxidizing agents at high temperatures cause C-C bond cleavage, leading to a mixture of carboxylic acids with fewer carbon atoms.

Real-World Applications:

  • Solvents:Ethanol, methanol, and isopropyl alcohol are widely used as solvents in industries, laboratories, and households due to their ability to dissolve both polar and non-polar substances to some extent.
  • Fuels:Ethanol is blended with gasoline (gasohol) as a biofuel. Methanol is also explored as an alternative fuel.
  • Beverages:Ethanol is the active ingredient in alcoholic drinks.
  • Antiseptics/Disinfectants:Isopropyl alcohol and ethanol are effective against bacteria and viruses.
  • Chemical Feedstocks:Alcohols are crucial starting materials for synthesizing a vast array of other organic compounds, including esters, ethers, aldehydes, ketones, and alkenes.
  • Antifreeze:Ethylene glycol (ethane-1,2-diol) is a common antifreeze agent in car radiators.

Common Misconceptions:

  • Acidity:Students often confuse the acidity of alcohols with that of phenols. Phenols are significantly more acidic than alcohols due to the resonance stabilization of the phenoxide ion, which is not possible for alkoxide ions. Alcohols are even less acidic than water.
  • Oxidation of Tertiary Alcohols:A common mistake is to assume tertiary alcohols oxidize easily. They are generally resistant to oxidation under mild conditions because the carbon bearing the -OH group has no hydrogen atoms directly attached to it, which are required for the initial oxidation step.
  • Reactivity Order in Dehydration/Substitution:While 3>2>13^\circ > 2^\circ > 1^\circ holds for dehydration and reaction with HX (via SN1S_N1), it's important to remember the specific conditions and mechanisms. For primary alcohols, SN2S_N2 is more common with HX, and dehydration requires higher temperatures.
  • Markovnikov vs. Anti-Markovnikov:Confusing the products of acid-catalyzed hydration (Markovnikov) with hydroboration-oxidation (anti-Markovnikov) is a frequent error.

NEET-Specific Angle:

For NEET, a deep understanding of reaction mechanisms, especially for preparation and characteristic reactions (oxidation, dehydration, reaction with HX, Grignard), is paramount. Distinguishing tests (Lucas test for 1circ,2circ,31^circ, 2^circ, 3^\circ alcohols, iodoform test for alcohols with CH3CH(OH)CH_3CH(OH) group) are frequently tested.

Comparative properties like acidity, boiling points (due to hydrogen bonding), and solubility are also important. Name reactions involving alcohols (e.g., Williamson ether synthesis, esterification) should be thoroughly known, including reagents and conditions.

Predicting products of reactions, especially those involving rearrangements (e.g., carbocation rearrangements during dehydration or acid-catalyzed hydration), is a high-level skill often assessed.

Often confused with

Side-by-side differences the NEET paper likes to test.

Alcohols vs Phenols
AspectAlcoholsPhenols
Functional Group AttachmentHydroxyl group attached to a saturated $sp^3$ hybridized carbon atom.Hydroxyl group attached directly to an aromatic (benzene) ring, an $sp^2$ hybridized carbon.
AcidityWeakly acidic, generally less acidic than water ($pK_a \approx 16-18$). Acidity order: $1^\circ > 2^\circ > 3^\circ$.Significantly more acidic than alcohols and water ($pK_a \approx 10$). Acidity due to resonance stabilization of phenoxide ion.
Reaction with NaOHDo not react with NaOH (too weak an acid).React with NaOH to form sodium phenoxide (soluble in water).
Reaction with $FeCl_3$ (Neutral)Do not give a characteristic color with neutral ferric chloride solution.Give a characteristic violet, green, or blue coloration with neutral ferric chloride solution.
Electrophilic Substitution on RingNo direct electrophilic substitution on the alkyl chain.Undergo electrophilic substitution on the aromatic ring (e.g., nitration, bromination) due to the activating -OH group.

The fundamental difference between alcohols and phenols lies in the nature of the carbon atom to which the hydroxyl group is attached. In alcohols, it's a saturated sp3sp^3 carbon, while in phenols, it's an sp2sp^2 carbon of an aromatic ring.

This structural distinction profoundly impacts their chemical properties, most notably their acidity. Phenols are significantly more acidic than alcohols due to the resonance stabilization of the phenoxide ion, which allows them to react with weak bases like NaOH and give characteristic color reactions with FeCl3FeCl_3.

Alcohols, being weaker acids, do not exhibit these reactions. Understanding these differences is crucial for distinguishing between these two important classes of organic compounds in NEET.

Why it is tested: NEET relevance: Distinguishing between alcohols and phenols is a frequently tested concept. Questions often involve identifying the correct reagent or test to differentiate them, comparing their relative acidities, or predicting the products of their characteristic reactions. Knowledge of their structural differences and how they influence reactivity is essential for solving such problems.

Questions students ask

5 answered on this topic.

Why do alcohols have higher boiling points than corresponding alkanes or ethers?

Alcohols exhibit significantly higher boiling points compared to hydrocarbons or ethers of comparable molecular mass primarily due to their ability to form intermolecular hydrogen bonds. The highly electronegative oxygen atom in the hydroxyl (-OH) group pulls electron density away from the hydrogen, making the hydrogen partially positive.

This partially positive hydrogen can then form an attractive interaction with the lone pair of electrons on the oxygen atom of an adjacent alcohol molecule. These strong intermolecular forces require more energy to overcome during boiling, leading to elevated boiling points.

Alkanes lack this polar O-H bond, and while ethers have polar C-O bonds, they lack the hydrogen directly bonded to oxygen, preventing hydrogen bond formation.

Are alcohols acidic or basic?

Alcohols are amphoteric, meaning they can act as both weak acids and weak bases. As weak acids, they can donate a proton from the hydroxyl group, forming an alkoxide ion (RORO^-). This acidity is weaker than water and significantly weaker than phenols.

They react with active metals like sodium to release hydrogen gas. As weak bases, the oxygen atom's lone pairs can accept a proton from a strong acid, forming an oxonium ion (ROH2+ROH_2^+). This basicity allows them to participate in reactions like dehydration or reaction with hydrogen halides, where the protonated alcohol acts as a good leaving group (water).

How can primary, secondary, and tertiary alcohols be distinguished using the Lucas test?

The Lucas test uses a mixture of concentrated HCl and anhydrous ZnCl2ZnCl_2 (Lucas reagent). This reagent converts alcohols to alkyl chlorides. Tertiary alcohols react immediately with Lucas reagent at room temperature, forming a cloudy precipitate (alkyl chloride) due to the SN1S_N1 mechanism.

Secondary alcohols react within 5-10 minutes, showing turbidity. Primary alcohols do not react at room temperature, or react very slowly upon heating, as they prefer an SN2S_N2 mechanism which is not favored under these conditions.

The difference in reactivity is due to the stability of the carbocation intermediate formed, which is highest for tertiary, then secondary, and least for primary.

What is the role of $LiAlH_4$ and $NaBH_4$ in alcohol synthesis?

LiAlH4LiAlH_4 (Lithium Aluminium Hydride) and NaBH4NaBH_4 (Sodium Borohydride) are both powerful reducing agents used to convert carbonyl compounds into alcohols. NaBH4NaBH_4 is a milder reducing agent, primarily used to reduce aldehydes to primary alcohols and ketones to secondary alcohols.

It is selective and does not reduce carboxylic acids, esters, or amides. LiAlH4LiAlH_4, on the other hand, is a much stronger reducing agent. It can reduce aldehydes, ketones, carboxylic acids, esters, and even amides to alcohols.

Due to its high reactivity, LiAlH4LiAlH_4 reacts violently with water and protic solvents, so reactions are typically carried out in anhydrous ether or THF, followed by aqueous workup.

Why is anti-Markovnikov addition of water to an alkene achieved via hydroboration-oxidation?

Hydroboration-oxidation is a two-step process that results in the anti-Markovnikov addition of water across a double bond, meaning the hydroxyl group adds to the less substituted carbon atom. In the first step, hydroboration, the boron atom (being less electronegative) adds to the less substituted carbon, and the hydrogen adds to the more substituted carbon.

This occurs in a syn-addition manner. In the second step, oxidation with hydrogen peroxide in alkaline medium replaces the boron group with a hydroxyl group, retaining the stereochemistry. The overall effect is the addition of -H and -OH in an anti-Markovnikov fashion, which is regioselective and stereoselective (syn-addition of H and OH).