Chemistry·Explained

Nomenclature, Methods of Preparation — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

Phenols, as we've established, are organic compounds where a hydroxyl group is directly bonded to an aromatic ring. This structural feature imparts unique chemical properties, most notably their acidic character, which is stronger than that of alcohols but weaker than that of carboxylic acids. For NEET aspirants, a thorough understanding of their nomenclature and various synthetic routes is paramount.

Conceptual Foundation of Phenols

At the heart of a phenol is the benzene ring, a planar, cyclic, conjugated system of six carbon atoms, each contributing one p-orbital electron to a delocalized π\pi-electron cloud. When an -OH group is attached, the oxygen atom's lone pair electrons can delocalize into this π\pi-system through resonance.

This resonance stabilization of the phenoxide ion (the conjugate base of phenol) is what makes phenols acidic, allowing them to donate a proton (H+H^+) more readily than alcohols. The electron-donating nature of the -OH group also activates the benzene ring towards electrophilic aromatic substitution, primarily at ortho and para positions.

Nomenclature of Phenols

Naming phenols involves both common names, which are deeply entrenched in chemical literature, and systematic IUPAC names, which ensure clarity for more complex structures.

    1
  1. Common Names:

* Phenol: The simplest member, C6H5OHC_6H_5OH. * Cresols: Methylphenols. There are three isomers: *o*-cresol (2-methylphenol), *m*-cresol (3-methylphenol), and *p*-cresol (4-methylphenol). * Catechol: 1,2-dihydroxybenzene. * Resorcinol: 1,3-dihydroxybenzene. * Hydroquinone (or Quinol): 1,4-dihydroxybenzene. * Naphthols: Hydroxyl derivatives of naphthalene, e.g., α\alpha-naphthol (1-naphthol) and β\beta-naphthol (2-naphthol).

    1
  1. IUPAC Names:

* The parent name is 'phenol'. The carbon atom bearing the -OH group is assigned position 1. * Other substituents are then numbered to give them the lowest possible locants. * For dihydroxybenzenes, the suffix '-diol' is used, e.

g., Benzene-1,2-diol (Catechol). * For trihydroxybenzenes, '-triol' is used, e.g., Benzene-1,2,3-triol (Pyrogallol). * If a group with higher priority than -OH is present (e.g., -COOH, -CHO), the compound is named as a derivative of that functional group, and the -OH group is treated as a 'hydroxy' substituent.

However, for NEET, -OH is usually the highest priority group in phenol-related questions.

*Example:* 2-Bromophenol, 4-Nitrophenol, 3,5-Dichlorophenol.

Methods of Preparation of Phenols

Several distinct pathways exist for synthesizing phenols, each with its own set of reagents, conditions, and mechanistic considerations.

    1
  1. From Haloarenes (Dow's Process):

* Reaction: Haloarenes (e.g., chlorobenzene) are heated with aqueous sodium hydroxide (NaOH) at high temperature and pressure. * Conditions: NaOH(aq)NaOH_{(aq)}, 623K623 K, 300atm300 atm. * Mechanism (Simplified): This is an example of nucleophilic aromatic substitution under harsh conditions, often proceeding via an elimination-addition mechanism involving a benzyne intermediate, or through an SNArS_NAr mechanism for activated haloarenes.

Initially, sodium phenoxide is formed, which on acidification yields phenol.

C6H5Cl+2NaOH623K,300atmC6H5ONa+NaCl+H2OC_6H_5Cl + 2NaOH \xrightarrow{623K, 300atm} C_6H_5ONa + NaCl + H_2O
C6H5ONa+H+C6H5OHC_6H_5ONa + H^+ \rightarrow C_6H_5OH
* NEET Relevance: High temperature and pressure are key indicators.

The formation of sodium phenoxide as an intermediate is important.

    1
  1. From Benzenediazonium Salts:

* Reaction: Benzenediazonium chloride (or other salts) is prepared by treating aniline with nitrous acid (NaNO2/HClNaNO_2/HCl) at 05circC0-5^circ C (diazotization). The diazonium salt is then warmed with water.

* Conditions: NaNO2/HClNaNO_2/HCl (05circC0-5^circ C) for diazotization, followed by warming with H2OH_2O. * Mechanism: The diazonium group (N2+-N_2^+) is an excellent leaving group. Upon warming with water, it is replaced by a hydroxyl group, with the evolution of nitrogen gas.

C6H5NH2+NaNO2+2HCl05circCC6H5N2+Cl+NaCl+2H2OC_6H_5NH_2 + NaNO_2 + 2HCl \xrightarrow{0-5^circ C} C_6H_5N_2^+Cl^- + NaCl + 2H_2O
C6H5N2+Cl+H2OwarmC6H5OH+N2+HClC_6H_5N_2^+Cl^- + H_2O \xrightarrow{warm} C_6H_5OH + N_2 \uparrow + HCl
* NEET Relevance: This is a very common laboratory method.

The low temperature for diazotization is critical to prevent decomposition of the diazonium salt. Evolution of N2N_2 gas is a characteristic feature.

    1
  1. From Cumene (Isopropylbenzene) - Industrial Method:

* Reaction: Cumene is oxidized by air in the presence of a catalyst to form cumene hydroperoxide, which is then decomposed by dilute acid to yield phenol and acetone. * Conditions: Air oxidation (catalytic), then dilute H2SO4H_2SO_4.

* Mechanism: Cumene reacts with oxygen to form cumene hydroperoxide (an unstable intermediate). This hydroperoxide then undergoes acid-catalyzed rearrangement and cleavage to produce phenol and acetone.

This is a radical mechanism for the initial oxidation.

C6H5CH(CH3)2+O2Air,CatalystC6H5C(CH3)2OOH (Cumene hydroperoxide)C_6H_5-CH(CH_3)_2 + O_2 \xrightarrow{Air, Catalyst} C_6H_5-C(CH_3)_2-OOH \text{ (Cumene hydroperoxide)}
C6H5C(CH3)2OOH+H2OH+C6H5OH+CH3COCH3 (Acetone)C_6H_5-C(CH_3)_2-OOH + H_2O \xrightarrow{H^+} C_6H_5OH + CH_3COCH_3 \text{ (Acetone)}
* NEET Relevance: This is the most important industrial method.

The co-product, acetone, is also valuable. Identifying cumene hydroperoxide as the intermediate is crucial.

    1
  1. From Benzenesulphonic Acid:

* Reaction: Benzenesulphonic acid (prepared by sulphonation of benzene) is fused with solid sodium hydroxide at high temperatures, followed by acidification. * Conditions: NaOH(s)NaOH_{(s)}, 573K573K, then H+H^+.

* Mechanism: The sulphonic acid group (SO3H-SO_3H) is replaced by a hydroxyl group. Initially, sodium phenoxide is formed.

C6H5SO3H+2NaOH573KC6H5ONa+Na2SO3+H2OC_6H_5SO_3H + 2NaOH \xrightarrow{573K} C_6H_5ONa + Na_2SO_3 + H_2O
C6H5ONa+H+C6H5OHC_6H_5ONa + H^+ \rightarrow C_6H_5OH
* NEET Relevance: This method highlights the utility of sulphonic acids as intermediates.

The high temperature fusion is characteristic.

    1
  1. From Grignard Reagents (Indirect Method):

* Reaction: An aryl Grignard reagent (e.g., phenylmagnesium bromide) reacts with oxygen, followed by hydrolysis with dilute acid. * Conditions: O2O_2, then H3O+H_3O^+. * Mechanism: The Grignard reagent reacts with oxygen to form an intermediate arylperoxymagnesium halide, which upon hydrolysis yields phenol.

C6H5MgBr+O2C6H5OOMgBrC_6H_5MgBr + O_2 \rightarrow C_6H_5OOMgBr
C6H5OOMgBr+H2OH+C6H5OH+Mg(OH)BrC_6H_5OOMgBr + H_2O \xrightarrow{H^+} C_6H_5OH + Mg(OH)Br
* NEET Relevance: Less common for direct phenol synthesis in NEET context, but demonstrates the versatility of Grignard reagents.

Real-World Applications

The industrial preparation methods, particularly the Cumene process, are critical because phenol is a high-volume chemical used in the production of polymers (like Bakelite, nylon), pharmaceuticals (aspirin), dyes, and disinfectants. The efficiency and cost-effectiveness of these syntheses directly impact various industries.

Common Misconceptions

  • Confusing Phenols with Alcohols:Students often forget that the -OH group must be *directly* attached to an aromatic ring for a compound to be a phenol. Benzyl alcohol (C6H5CH2OHC_6H_5CH_2OH) is an alcohol, not a phenol.
  • Incorrect Numbering in Nomenclature:Failing to assign the -OH group's carbon as '1' or not giving other substituents the lowest possible numbers.
  • Conditions for Dow's Process:Forgetting the extreme temperature and pressure required due to the inertness of haloarenes towards nucleophilic substitution.
  • Diazotization Temperature:Overlooking the 05circC0-5^circ C temperature requirement, which is crucial for the stability of diazonium salts.
  • Cumene Process Intermediates:Not recognizing cumene hydroperoxide as the key intermediate or forgetting acetone as a co-product.

NEET-Specific Angle

NEET questions often focus on:

  • Reagents and Conditions:Identifying the correct reagents and specific conditions (temperature, pressure, catalysts) for each preparation method.
  • Named Reactions/Processes:Dow's process, Diazotization, Cumene process are frequently tested.
  • Intermediate Products:Knowing the structure of intermediates like sodium phenoxide, benzenediazonium salt, or cumene hydroperoxide.
  • Product Identification:Predicting the products of a given reaction, especially when multiple products are formed (e.g., phenol and acetone from cumene).
  • Nomenclature:Drawing structures from IUPAC or common names, or vice-versa, especially for substituted phenols and dihydroxybenzenes.
  • Distinguishing Phenols from Alcohols:Understanding the structural difference and its implications for reactivity and acidity.
Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.