Chemistry·Revision Notes

Nomenclature, Methods of Preparation — Revision Notes

NEET UG
Version 1Updated 22 Mar 2026

⚡ 30-Second Revision

  • Ethers:RORR-O-R' functional group.
  • Common Names:Alkyl groups (alphabetical) + 'ether' (e.g., Diethyl ether, Ethyl methyl ether).
  • IUPAC Names:'Alkoxyalkanes' (smaller R-O- as substituent on larger R' chain, e.g., Methoxyethane).
  • Williamson Synthesis:RO+RXSN2RORRO^- + R'X \xrightarrow{S_N2} R-O-R'. RXR'X MUST be primary. Secondary/tertiary RXR'X give alkenes (E2).
  • Dehydration of Alcohols:2ROHConc.H2SO4,140circCROR+H2O2ROH \xrightarrow{Conc. H_2SO_4, 140^circ C} R-O-R + H_2O. Primary alcohols best. 170circC170^circ C gives alkenes.
  • Alkoxymercuration-Demercuration:Alkene + ROH + Hg(OAc)2/NaBH4Hg(OAc)_2/NaBH_4. Markovnikov addition, no rearrangements.

2-Minute Revision

Ethers are compounds with an oxygen atom bridging two hydrocarbon groups (RORR-O-R'). They are named commonly by listing the alkyl groups alphabetically followed by 'ether' (e.g., diethyl ether). Systematically, they are 'alkoxyalkanes', where the smaller alkyl-oxygen unit is an 'alkoxy' substituent on the larger parent alkane (e.

g., methoxyethane). For preparation, the Williamson ether synthesis is key: an alkoxide (RORO^-) reacts with a primary alkyl halide (RXR'X) via an SN2S_N2 mechanism to form RORR-O-R'. Crucially, the alkyl halide must be primary; secondary or tertiary halides lead to undesired alkene formation through E2E2 elimination.

Another method is the acid-catalyzed dehydration of alcohols. Two alcohol molecules react at 140circC140^circ C (with concentrated H2SO4H_2SO_4) to form an ether. Remember, at 170circC170^circ C, alcohols dehydrate intramolecularly to form alkenes.

Alkoxymercuration-demercuration of alkenes provides a regioselective route, adding an alcohol across a double bond following Markovnikov's rule, without carbocation rearrangements. Always pay attention to the specific conditions and limitations of each reaction.

5-Minute Revision

Ethers are organic compounds characterized by an oxygen atom bonded to two alkyl or aryl groups, RORR-O-R'. Their oxygen is sp3sp^3 hybridized, leading to a bent structure. They are less polar than alcohols and cannot form intermolecular hydrogen bonds, resulting in lower boiling points.

Naming ethers involves two systems: common names (e.g., ethyl methyl ether, diethyl ether) where alkyl groups are named alphabetically, and IUPAC names (alkoxyalkanes) where the smaller ROR-O- unit is an 'alkoxy' substituent on the larger parent alkane chain (e.

g., methoxyethane, 2-methoxypropane).

Key Preparation Methods:

    1
  1. Williamson Ether Synthesis:This is an SN2S_N2 reaction between an alkoxide (RORO^-) and a primary alkyl halide (RXR'X).

* Mechanism: Nucleophilic attack by RORO^- on the electrophilic carbon of RXR'X, displacing XX^-. * Example: CH3CH2ONa++CH3BrCH3CH2OCH3+NaBrCH_3CH_2O^-Na^+ + CH_3Br \longrightarrow CH_3CH_2-O-CH_3 + NaBr (Ethyl methyl ether) * Limitation: Secondary or tertiary alkyl halides with strong alkoxide bases lead to E2E2 elimination (alkene formation) as the major product. For instance, CH3ONa++(CH3)3CBrCH2=C(CH3)2CH_3O^-Na^+ + (CH_3)_3C-Br \longrightarrow CH_2=C(CH_3)_2 (isobutylene).

    1
  1. Acid-Catalyzed Dehydration of Alcohols:

* Conditions: Concentrated H2SO4H_2SO_4 at specific temperatures. * Ether Formation: 2ROHConc.H2SO4,140circCROR+H2O2ROH \xrightarrow{Conc. H_2SO_4, 140^circ C} R-O-R + H_2O. Best for symmetrical ethers from primary alcohols. * Alkene Formation: ROHConc.H2SO4,170circCAlkene+H2OROH \xrightarrow{Conc. H_2SO_4, 170^circ C} Alkene + H_2O. This is a competing reaction at higher temperatures. * Example: 2CH3CH2OHConc.H2SO4,140circCCH3CH2OCH2CH3+H2O2CH_3CH_2OH \xrightarrow{Conc. H_2SO_4, 140^circ C} CH_3CH_2-O-CH_2CH_3 + H_2O (Diethyl ether)

    1
  1. Alkoxymercuration-Demercuration of Alkenes:

* Reactants: Alkene, alcohol (ROH), Hg(OAc)2Hg(OAc)_2, followed by NaBH4NaBH_4. * Regioselectivity: Follows Markovnikov's rule (RO- adds to more substituted carbon). * Advantage: No carbocation rearrangements. * Example: CH3CH=CH2+CH3OH1.Hg(OAc)2,CH3OH 2.NaBH4,NaOHCH3CH(OCH3)CH3CH_3-CH=CH_2 + CH_3OH \xrightarrow{1. Hg(OAc)_2, CH_3OH \ 2. NaBH_4, NaOH} CH_3-CH(OCH_3)-CH_3 (2-Methoxypropane)

Remember to differentiate between these methods based on their mechanisms, suitable reactants, and potential side products. This understanding is crucial for solving NEET problems.

Prelims Revision Notes

Ethers: Nomenclature & Preparation (NEET Quick Recall)

1. Ether Structure & Functional Group:

  • General formula: RORR-O-R' (R, R' = alkyl or aryl groups).
  • Oxygen is sp3sp^3 hybridized, bent geometry (bond angle approx110circapprox 110^circ).
  • Polar COC-O bonds, but low net dipole moment in symmetrical ethers.
  • Cannot form intermolecular H-bonds (no OHO-H bond).

2. Nomenclature:

  • Common Names:Name alkyl/aryl groups alphabetically, then 'ether'.

* Symmetrical: Diethyl ether (CH3CH2OCH2CH3CH_3CH_2-O-CH_2CH_3) * Unsymmetrical: Ethyl methyl ether (CH3CH2OCH3CH_3CH_2-O-CH_3) * Aromatic: Anisole (methoxybenzene), Phenetole (ethoxybenzene)

  • IUPAC Names (Alkoxyalkanes):

* Identify longer R group as parent alkane. * Shorter R-O- group is 'alkoxy' substituent. * Number parent chain for lowest locant of alkoxy group. * Example: CH3OCH2CH3CH_3-O-CH_2CH_3 is Methoxyethane. CH3CH2OCH2CH2CH3CH_3CH_2-O-CH_2CH_2CH_3 is 1-Ethoxypropane.

3. Methods of Preparation:

A. Williamson Ether Synthesis:

* Reaction: Alkoxide (RORO^-) + Primary Alkyl Halide (RXR'X) SN2\xrightarrow{S_N2} Ether (RORR-O-R'). * Mechanism: SN2S_N2 (nucleophilic attack, concerted displacement). * Key: Alkyl halide (RXR'X) MUST be primary (e.

g., CH3BrCH_3Br, CH3CH2ClCH_3CH_2Cl). * Limitations/Side Reactions: * Secondary or tertiary alkyl halides (RXR'X) with strong alkoxide bases (RORO^-) lead to E2E2 elimination (alkene formation) as the major product.

* Aryl halides (ArXArX) are unreactive in SN2S_N2 (cannot be RXR'X). * Versatility: Good for both symmetrical and unsymmetrical ethers. * Example: CH3ONa++CH3CH2BrCH3OCH2CH3+NaBrCH_3O^-Na^+ + CH_3CH_2Br \longrightarrow CH_3-O-CH_2CH_3 + NaBr.

B. Dehydration of Alcohols (Acid-Catalyzed):

* Catalyst: Concentrated H2SO4H_2SO_4 or H3PO4H_3PO_4. * Temperature Control is CRITICAL: * **140circC140^circ C (lower temp):** Intermolecular dehydration \rightarrow ETHER formation. * $2R-OH \xrightarrow{Conc.

H_2SO_4, 140^circ C} R-O-R + H_2O.Bestforsymmetricalethersfromprimaryalcohols.. * Best for symmetrical ethers from primary alcohols. * **170^circ C(highertemp):Intramoleculardehydration(higher temp):** Intramolecular dehydration\rightarrowALKENEformation.ALKENE formation. *R-OH \xrightarrow{Conc.

H_2SO_4, 170^circ C} Alkene + H_2O.Limitations:Secondaryandtertiaryalcoholsreadilyformalkenesevenatlowertemperaturesduetocarbocationstabilityandsterichindrance.Example:. * **Limitations:** Secondary and tertiary alcohols readily form alkenes even at lower temperatures due to carbocation stability and steric hindrance. * **Example:**2CH_3CH_2OH \xrightarrow{Conc.

H_2SO_4, 140^circ C} CH_3CH_2-O-CH_2CH_3 + H_2O$.

C. Alkoxymercuration-Demercuration of Alkenes:

* Reactants: Alkene + Alcohol (ROH) + Hg(OAc)2Hg(OAc)_2 (followed by NaBH4NaBH_4). * Regioselectivity: Follows Markovnikov's rule (RO- adds to more substituted carbon). * Advantage: No carbocation rearrangements. * Example: CH3CH=CH2+CH3OH1.Hg(OAc)2,CH3OH 2.NaBH4,NaOHCH3CH(OCH3)CH3CH_3-CH=CH_2 + CH_3OH \xrightarrow{1. Hg(OAc)_2, CH_3OH \ 2. NaBH_4, NaOH} CH_3-CH(OCH_3)-CH_3.

D. Reaction of Alkyl Halides with Dry Silver Oxide:

* 2RX+Ag2ODryROR+2AgX2R-X + Ag_2O \xrightarrow{Dry} R-O-R + 2AgX. * Primarily for symmetrical ethers.

E. Reaction of Diazomethane with Alcohols/Phenols:

* ROH+CH2N2HBF4ROCH3+N2R-OH + CH_2N_2 \xrightarrow{HBF_4} R-O-CH_3 + N_2. * Specific for methyl ethers.

Vyyuha Quick Recall

Williamson Prefers Primary Halides, Alcohol Dehydration Temperature Controls Product. (WPP-HADC-P)

  • Williamson Prefers Primary Halides: Reminds that in Williamson synthesis, the alkyl halide must be primary to avoid elimination.
  • Alcohol Dehydration Temperature Controls Product: Highlights the critical role of temperature in alcohol dehydration (ether at 140circC140^circ C, alkene at 170circC170^circ C).

This mnemonic helps recall the two most important preparation methods and their crucial conditions/limitations for NEET.

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.