Chemistry·Revision Notes

Physical and Chemical Properties — Revision Notes

NEET UG
Version 1Updated 22 Mar 2026

⚡ 30-Second Revision

  • Boiling Points:High due to cyclic dimerization via two H-bonds. RCOOHcdotsO=C(R)OHcdotsO=C(R)OHR-COOH cdots O=C(R)-OH cdots O=C(R)-OH
  • Solubility:Lower members soluble (H-bonding with H2OH_2O), higher members insoluble.
  • Acidity:RCOOHRCOO+H+R-COOH \rightleftharpoons R-COO^- + H^+. Carboxylate anion resonance stabilized.
  • Acidity Order:Mineral acids > Carboxylic acids > Carbonic acid > Phenols > Alcohols.
  • Effect of Substituents:EWG increase acidity (stabilize RCOOR-COO^-), EDG decrease acidity (destabilize RCOOR-COO^-).
  • $NaHCO_3$ Test:RCOOH+NaHCO3RCOONa+H2O+CO2R-COOH + NaHCO_3 \rightarrow R-COONa + H_2O + CO_2 \uparrow (effervescence).
  • Esterification:RCOOH+ROHH+RCOOR+H2OR-COOH + R'-OH \xrightarrow{H^+} R-COO-R' + H_2O
  • Acyl Chloride:RCOOH+SOCl2RCOCl+SO2+HClR-COOH + SOCl_2 \rightarrow R-COCl + SO_2 + HCl
  • Reduction:RCOOH1.LiAlH4,2.H3O+RCH2OHR-COOH \xrightarrow{1. LiAlH_4, 2. H_3O^+} R-CH_2OH (not NaBH4NaBH_4)
  • Decarboxylation (Soda-lime):RCOONa+NaOHCaO,ΔRH+Na2CO3R-COONa + NaOH \xrightarrow{CaO, \Delta} R-H + Na_2CO_3 (loss of 1 carbon)
  • HVZ Reaction:RCH2COOHX2/RedPRCH(X)COOHR-CH_2-COOH \xrightarrow{X_2/Red P} R-CH(X)-COOH (alphaalpha-halogenation, requires alphaalpha-H)
  • Aromatic Substitution:COOH is meta-directing, deactivating.

2-Minute Revision

Carboxylic acids possess a unique carboxyl group (COOH-COOH) that dictates their properties. Physically, they exhibit unusually high boiling points due to strong intermolecular hydrogen bonding, forming stable cyclic dimers.

Lower members are water-soluble because the carboxyl group can hydrogen bond with water, but solubility decreases as the non-polar alkyl chain lengthens. Chemically, their most important property is their acidity.

They are stronger acids than alcohols and phenols because the resulting carboxylate anion (RCOOR-COO^-) is highly stabilized by resonance, delocalizing the negative charge over two oxygen atoms. This acidity allows them to react with active metals, bases, and crucially, with sodium bicarbonate to produce CO2CO_2 gas, a key distinguishing test.

They undergo nucleophilic acyl substitution reactions, forming derivatives like esters (with alcohols), acyl chlorides (with SOCl2SOCl_2), and amides (with NH3NH_3). The entire carboxyl group can be reduced to a primary alcohol using LiAlH4LiAlH_4 or removed via decarboxylation (e.

g., soda-lime, losing one carbon). Aliphatic carboxylic acids with an alphaalpha-hydrogen undergo the Hell-Volhard-Zelinsky (HVZ) reaction to form alphaalpha-halo carboxylic acids. Aromatic carboxylic acids undergo meta-directed electrophilic substitution.

5-Minute Revision

Carboxylic acids are defined by the COOH-COOH functional group, a hybrid of carbonyl and hydroxyl. Their physical properties are dominated by strong intermolecular hydrogen bonding, leading to the formation of stable cyclic dimers.

This dimerization explains their exceptionally high boiling points compared to alcohols or aldehydes of similar molecular mass. For example, ethanoic acid (118circC118^circ\text{C}) boils higher than propan-1-ol (97circC97^circ\text{C}).

Lower carboxylic acids (up to C4C5C_4-C_5) are water-soluble due to hydrogen bonding with water molecules, but solubility rapidly decreases as the hydrophobic alkyl chain length increases. Odour varies from pungent for lower members to odourless waxy solids for higher ones.

Chemically, carboxylic acids are weak acids, significantly stronger than phenols and alcohols. Their acidity stems from the resonance stabilization of the carboxylate anion (RCOOR-COO^-) formed upon deprotonation, where the negative charge is delocalized over two equivalent oxygen atoms.

Electron-withdrawing groups (e.g., halogens, nitro) increase acidity by stabilizing the anion, while electron-donating groups (e.g., alkyl) decrease it. They react with active metals (e.g., Na, Mg) to liberate H2H_2, with strong bases (e.

g., NaOH) to form salts, and famously with sodium bicarbonate (NaHCO3NaHCO_3) to produce CO2CO_2 effervescence, a diagnostic test.

Reactions involving the C-OH bond cleavage lead to derivatives:

    1
  1. Esterification:With alcohols (ROHR'-OH) in presence of acid catalyst (H2SO4H_2SO_4) to form esters (RCOORR-COO-R').

CH3COOH+CH3OHH+CH3COOCH3+H2OCH_3COOH + CH_3OH \xrightarrow{H^+} CH_3COOCH_3 + H_2O

    1
  1. Acyl Chloride formation:With SOCl2SOCl_2, PCl5PCl_5, or PCl3PCl_3 to form acyl chlorides (RCOClR-COCl). SOCl2SOCl_2 is preferred due to gaseous byproducts.

CH3COOH+SOCl2CH3COCl+SO2+HClCH_3COOH + SOCl_2 \rightarrow CH_3COCl + SO_2 + HCl

    1
  1. Anhydride formation:With dehydrating agents like P2O5P_2O_5 or strong heating.

2CH3COOHP2O5,Δ(CH3CO)2O+H2O2CH_3COOH \xrightarrow{P_2O_5, \Delta} (CH_3CO)_2O + H_2O

Reactions involving the entire -COOH group:

    1
  1. Reduction:To primary alcohols (RCH2OHR-CH_2OH) using strong reducing agents like LiAlH4LiAlH_4 (not NaBH4NaBH_4).

CH3COOH1.LiAlH4,2.H3O+CH3CH2OHCH_3COOH \xrightarrow{1. LiAlH_4, 2. H_3O^+} CH_3CH_2OH

    1
  1. Decarboxylation:Removal of CO2CO_2. Heating sodium salts with soda-lime (NaOH+CaONaOH + CaO) yields an alkane with one less carbon.

CH3COONa+NaOHCaO,ΔCH4+Na2CO3CH_3COONa + NaOH \xrightarrow{CaO, \Delta} CH_4 + Na_2CO_3

Reactions involving the alkyl/aryl part:

    1
  1. Hell-Volhard-Zelinsky (HVZ) Reaction:alphaalpha-halogenation of aliphatic carboxylic acids with alphaalpha-hydrogens using X2X_2/Red P.

CH3CH2COOHBr2/RedPCH3CH(Br)COOHCH_3CH_2COOH \xrightarrow{Br_2/Red P} CH_3CH(Br)COOH

    1
  1. Aromatic Substitution:The -COOH group is meta-directing and deactivating for electrophilic substitution.

Prelims Revision Notes

    1
  1. Physical Properties:

* Boiling Points: Carboxylic acids have higher boiling points than alcohols, aldehydes, and ketones of comparable molecular mass. Reason: Strong intermolecular hydrogen bonding forming stable cyclic dimers (two H-bonds per dimer).

* Melting Points: Generally increase with molecular mass. Alternation effect: Even-numbered carbon chains pack better, leading to higher melting points than odd-numbered ones. * Solubility: Lower members (C1C5C_1-C_5) are water-soluble due to H-bonding with water.

Solubility decreases rapidly with increasing alkyl chain length (hydrophobic part dominates). * Odour: Lower members (e.g., formic, acetic) are pungent. Butyric acid has rancid butter smell. Higher members are odourless, waxy solids.

    1
  1. Chemical Properties (Reactivity):

* Acidic Nature: * Proton donation from -OH group: RCOOHRCOO+H+R-COOH \rightleftharpoons R-COO^- + H^+. * Reason for acidity: Resonance stabilization of carboxylate anion (RCOOR-COO^-). * Acidity Order: Mineral acids > Carboxylic acids > Carbonic acid (H2CO3H_2CO_3) > Phenols > Alcohols.

* Effect of Substituents: Electron-Withdrawing Groups (EWGs) like NO2,CN,X-NO_2, -CN, -X (halogens) increase acidity. Electron-Donating Groups (EDGs) like alkyl groups decrease acidity. Effect decreases with distance.

* Reactions: With active metals (H2H_2 gas), bases (salts), carbonates/bicarbonates (CO2CO_2 effervescence – diagnostic test). * Reactions involving C-OH bond cleavage (Nucleophilic Acyl Substitution): * Esterification: RCOOH+ROHH+RCOOR+H2OR-COOH + R'-OH \xrightarrow{H^+} R-COO-R' + H_2O.

* Acyl Chloride formation: RCOOH+SOCl2RCOCl+SO2+HClR-COOH + SOCl_2 \rightarrow R-COCl + SO_2 + HCl (preferred). Also PCl5,PCl3PCl_5, PCl_3. * Anhydride formation: 2RCOOHP2O5,Δ(RCO)2O+H2O2R-COOH \xrightarrow{P_2O_5, \Delta} (R-CO)_2O + H_2O.

* Amide formation: RCOOH+NH3RCOONH4ΔRCONH2+H2OR-COOH + NH_3 \rightarrow R-COONH_4 \xrightarrow{\Delta} R-CONH_2 + H_2O. * Reactions involving -COOH group as a whole: * Reduction: $R-COOH \xrightarrow{1. LiAlH_4, 2.

H_3O^+} R-CH_2OH(primaryalcohol).Note:(primary alcohol). Note:NaBH_4isineffective.Decarboxylation:Removalofis ineffective. * **Decarboxylation:** Removal ofCO_2.Sodalime:. * **Soda-lime:**R-COONa + NaOH \xrightarrow{CaO, \Delta} R-H + Na_2CO_3$ (alkane with one less carbon).

* Kolbe's Electrolysis: 2RCOONaElectrolysisRR+2CO2+2NaOH+H22R-COONa \xrightarrow{Electrolysis} R-R + 2CO_2 + 2NaOH + H_2. * Reactions involving alkyl/aryl part: * Hell-Volhard-Zelinsky (HVZ) Reaction: alphaalpha-halogenation of aliphatic carboxylic acids with alphaalpha-hydrogens.

RCH2COOHX2/RedPRCH(X)COOHR-CH_2-COOH \xrightarrow{X_2/Red P} R-CH(X)-COOH. * Ring Substitution (Aromatic): -COOH is a meta-directing, deactivating group for electrophilic substitution.

Vyyuha Quick Recall

Carboxylic Acids Properties: Hydrogen Bonds Double Acidity Reactions Everywhere!

  • Hydrogen Bonds: High Boiling Points (due to Dimerization), Solubility (lower members).
  • Acidity: Stronger than phenols/alcohols (due to Resonance stabilization of carboxylate anion).
  • Reactions Everywhere:

* Esterification (alcohol + acid \rightarrow ester) * Very Zealous (HVZ) reaction (alphaalpha-halogenation) * Elimination of CO2CO_2 (Decarboxylation, soda-lime) * Reduction (LiAlH4LiAlH_4 to alcohol) * With Carbonates (NaHCO3NaHCO_3 test, CO2CO_2 effervescence)

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.