Primary and Secondary Batteries

Updated 22 Mar 2026

Batteries, fundamentally electrochemical cells, are devices that convert chemical energy into electrical energy through spontaneous redox reactions. They are broadly classified into two main categories: primary batteries and secondary batteries. Primary batteries are non-rechargeable, meaning their chemical reactions proceed in one direction until the reactants are consumed, rendering the battery …

Quick Summary

Batteries are devices converting chemical energy to electrical energy via redox reactions. They are broadly categorized into primary and secondary types. Primary batteries are non-rechargeable, meaning their chemical reactions are irreversible, leading to single use.

Examples include the Dry Cell (Leclanché cell) with a zinc anode and MnO2MnO_2 cathode, providing about 1.5 V, and the Mercury Cell, featuring a zinc-mercury amalgam anode and HgOHgO cathode, known for its stable 1.

35 V output. Secondary batteries are rechargeable, as their chemical reactions are reversible, allowing them to be repeatedly discharged and charged. Key examples include the Lead-Acid Battery, used in automobiles, which involves lead and lead dioxide electrodes in sulfuric acid, producing 2 V per cell.

Nickel-Cadmium (Ni-Cd) batteries, with cadmium and nickel oxyhydroxide electrodes, provide 1.2 V but suffer from a 'memory effect.' Lithium-ion (Li-ion) batteries, utilizing intercalation of lithium ions in graphite and metal oxides, offer high energy density and 3.

7 V, dominating modern portable electronics and electric vehicles. The choice between primary and secondary depends on application, cost, and environmental considerations.

Full explanation

Batteries are electrochemical cells that convert chemical energy directly into electrical energy through spontaneous redox (reduction-oxidation) reactions. This conversion occurs within a self-contained unit, making them portable power sources.

The fundamental components of any battery include an anode (negative electrode, where oxidation occurs), a cathode (positive electrode, where reduction occurs), and an electrolyte (a medium that allows ion flow between electrodes).

The classification into primary and secondary batteries hinges on the reversibility of these electrochemical reactions.

Conceptual Foundation

At the heart of every battery is a redox reaction. Oxidation, the loss of electrons, occurs at the anode, while reduction, the gain of electrons, occurs at the cathode. Electrons flow from the anode to the cathode through an external circuit, providing electrical current. Ions move through the electrolyte to maintain charge neutrality. The potential difference between the anode and cathode, known as the cell potential or electromotive force (EMF), drives this electron flow.

Key Principles/Laws

While detailed derivations are beyond the scope of NEET, understanding the underlying principles is crucial:

    1
  1. Redox Reactions:The core of battery operation. Identifying the species being oxidized and reduced, and their respective half-reactions, is key.
  2. 2
  3. Electrode Potentials:Each half-reaction has a standard electrode potential (EE^\circ). The overall cell potential (EcellE^\circ_{\text{cell}}) is the difference between the standard reduction potential of the cathode and the anode: Ecell=EcathodeEanodeE^\circ_{\text{cell}} = E^\circ_{\text{cathode}} - E^\circ_{\text{anode}}. A positive EcellE^\circ_{\text{cell}} indicates a spontaneous reaction.
  4. 3
  5. Nernst Equation:For non-standard conditions, the cell potential can be calculated using the Nernst equation: Ecell=EcellRTnFlnQE_{\text{cell}} = E^\circ_{\text{cell}} - \frac{RT}{nF} \ln Q, where RR is the gas constant, TT is temperature, nn is the number of electrons transferred, FF is Faraday's constant, and QQ is the reaction quotient. This explains why battery voltage drops as it discharges.
  6. 4
  7. Faraday's Laws of Electrolysis:While primarily for non-spontaneous reactions (electrolysis), Faraday's laws are relevant for understanding the quantitative aspects of charging secondary batteries or the amount of product formed/reactant consumed during discharge. For example, the amount of substance deposited or consumed is directly proportional to the quantity of electricity passed.

Primary Batteries (Non-Rechargeable)

Primary batteries are designed for single use. Their electrochemical reactions are essentially irreversible, meaning once the reactants are consumed, the battery cannot be effectively recharged. They are generally characterized by high energy density (energy per unit mass or volume) for their initial discharge and are suitable for low-drain or intermittent use where convenience outweighs rechargeability.

1. Dry Cell (Leclanché Cell):

  • Construction:A zinc container acts as the anode. A carbon rod, surrounded by a paste of manganese dioxide (MnO2MnO_2), carbon powder, and ammonium chloride (NH4ClNH_4Cl) (which acts as the electrolyte), serves as the cathode. Zinc chloride (ZnCl2ZnCl_2) is often added to the paste to improve conductivity and absorb ammonia gas.
  • Reactions:

* Anode (Oxidation): Zinc metal is oxidized.

Zn(s)Zn2+(aq)+2eZn(s) \rightarrow Zn^{2+}(aq) + 2e^-
* Cathode (Reduction): Manganese dioxide is reduced. The ammonium ions also participate.
2MnO2(s)+2NH4+(aq)+2eMn2O3(s)+2NH3(g)+H2O(l)2MnO_2(s) + 2NH_4^+(aq) + 2e^- \rightarrow Mn_2O_3(s) + 2NH_3(g) + H_2O(l)
The ammonia gas (NH3NH_3) produced can form a complex with Zn2+Zn^{2+} ions ([Zn(NH3)4]2+[Zn(NH_3)_4]^{2+}), preventing its accumulation and maintaining cell efficiency.

  • Overall Reaction:

Zn(s)+2MnO2(s)+2NH4+(aq)Zn2+(aq)+Mn2O3(s)+2NH3(g)+H2O(l)Zn(s) + 2MnO_2(s) + 2NH_4^+(aq) \rightarrow Zn^{2+}(aq) + Mn_2O_3(s) + 2NH_3(g) + H_2O(l)

  • Voltage:Approximately 1.5 V.
  • Uses:Flashlights, radios, wall clocks, remote controls.

2. Mercury Cell:

  • Construction:Consists of a zinc-mercury amalgam anode and a paste of mercury(II) oxide (HgOHgO) and carbon as the cathode. The electrolyte is a concentrated paste of potassium hydroxide (KOHKOH) and zinc oxide (ZnOZnO).
  • Reactions:

* Anode (Oxidation): Zinc is oxidized.

Zn(Hg)(s)+2OH(aq)ZnO(s)+H2O(l)+2eZn(Hg)(s) + 2OH^-(aq) \rightarrow ZnO(s) + H_2O(l) + 2e^-
* Cathode (Reduction): Mercury(II) oxide is reduced.
HgO(s)+H2O(l)+2eHg(l)+2OH(aq)HgO(s) + H_2O(l) + 2e^- \rightarrow Hg(l) + 2OH^-(aq)

  • Overall Reaction:

Zn(Hg)(s)+HgO(s)ZnO(s)+Hg(l)Zn(Hg)(s) + HgO(s) \rightarrow ZnO(s) + Hg(l)

  • Voltage:A constant 1.35 V throughout its life, as the overall reaction does not involve ions whose concentrations change significantly.
  • Uses:Hearing aids, pacemakers, watches, calculators (where constant voltage is critical).

Secondary Batteries (Rechargeable)

Secondary batteries are designed for multiple cycles of discharge and charge. Their electrochemical reactions are reversible, allowing them to be regenerated by passing an external current in the opposite direction. They are crucial for applications requiring long-term power and where replacement is inconvenient or costly.

1. Lead-Acid Battery:

  • Construction:Consists of a series of cells, each containing a lead anode and a grid of lead packed with lead dioxide (PbO2PbO_2) as the cathode. The electrolyte is an aqueous solution of sulfuric acid (H2SO4H_2SO_4).
  • Discharge Reactions (Battery in use):

* Anode (Oxidation): Lead is oxidized to lead sulfate.

Pb(s)+SO42(aq)PbSO4(s)+2ePb(s) + SO_4^{2-}(aq) \rightarrow PbSO_4(s) + 2e^-
* Cathode (Reduction): Lead dioxide is reduced to lead sulfate.
PbO2(s)+SO42(aq)+4H+(aq)+2ePbSO4(s)+2H2O(l)PbO_2(s) + SO_4^{2-}(aq) + 4H^+(aq) + 2e^- \rightarrow PbSO_4(s) + 2H_2O(l)

  • Overall Discharge Reaction:

Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO4(s)+2H2O(l)Pb(s) + PbO_2(s) + 2H_2SO_4(aq) \rightarrow 2PbSO_4(s) + 2H_2O(l)
During discharge, sulfuric acid is consumed, and water is produced, leading to a decrease in the density of the electrolyte. This density change can be used to gauge the battery's state of charge.

  • Charging Reactions (External current applied):The discharge reactions are reversed.

* Anode (now acting as cathode for charging): Lead sulfate is reduced back to lead.

PbSO4(s)+2ePb(s)+SO42(aq)PbSO_4(s) + 2e^- \rightarrow Pb(s) + SO_4^{2-}(aq)
* Cathode (now acting as anode for charging): Lead sulfate is oxidized back to lead dioxide.
PbSO4(s)+2H2O(l)PbO2(s)+SO42(aq)+4H+(aq)+2ePbSO_4(s) + 2H_2O(l) \rightarrow PbO_2(s) + SO_4^{2-}(aq) + 4H^+(aq) + 2e^-

  • Overall Charging Reaction:

2PbSO4(s)+2H2O(l)Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO_4(s) + 2H_2O(l) \rightarrow Pb(s) + PbO_2(s) + 2H_2SO_4(aq)
During charging, sulfuric acid is regenerated, and water is consumed, increasing the density of the electrolyte.

  • Voltage:Each cell provides approximately 2 V. A typical car battery has six cells in series, providing 12 V.
  • Uses:Automobile batteries, inverters, UPS systems.

2. Nickel-Cadmium (Ni-Cd) Battery:

  • Construction:Uses a cadmium anode and a nickel(III) oxyhydroxide (NiO(OH)NiO(OH)) cathode. The electrolyte is an alkaline solution, typically potassium hydroxide (KOHKOH).
  • Discharge Reactions:

* Anode (Oxidation): Cadmium is oxidized.

Cd(s)+2OH(aq)Cd(OH)2(s)+2eCd(s) + 2OH^-(aq) \rightarrow Cd(OH)_2(s) + 2e^-
* Cathode (Reduction): Nickel(III) oxyhydroxide is reduced.
2NiO(OH)(s)+2H2O(l)+2e2Ni(OH)2(s)+2OH(aq)2NiO(OH)(s) + 2H_2O(l) + 2e^- \rightarrow 2Ni(OH)_2(s) + 2OH^-(aq)

  • Overall Discharge Reaction:

Cd(s)+2NiO(OH)(s)+2H2O(l)Cd(OH)2(s)+2Ni(OH)2(s)Cd(s) + 2NiO(OH)(s) + 2H_2O(l) \rightarrow Cd(OH)_2(s) + 2Ni(OH)_2(s)

  • Charging Reactions:The discharge reactions are reversed.

Cd(OH)2(s)+2Ni(OH)2(s)Cd(s)+2NiO(OH)(s)+2H2O(l)Cd(OH)_2(s) + 2Ni(OH)_2(s) \rightarrow Cd(s) + 2NiO(OH)(s) + 2H_2O(l)

  • Voltage:Approximately 1.2 V.
  • Uses:Portable electronic devices (older models), power tools. Known for the 'memory effect' where repeated partial discharge/charge cycles can reduce capacity.

3. Lithium-ion (Li-ion) Battery:

  • Principle:Unlike other batteries where electrode materials change phase, Li-ion batteries operate on the principle of 'intercalation,' where lithium ions move between layers of electrode materials (typically graphite for anode, lithium metal oxides for cathode) without forming new compounds.
  • Construction:Typically, a graphite anode and a lithium cobalt oxide (LiCoO2LiCoO_2) or lithium manganese oxide (LiMn2O4LiMn_2O_4) cathode. The electrolyte is a non-aqueous lithium salt solution (e.g., LiPF6LiPF_6 in organic solvents).
  • Discharge Reactions (Simplified):

* Anode (Oxidation): Lithium ions de-intercalate from graphite.

LixC6xLi++xe+C6Li_x C_6 \rightarrow xLi^+ + xe^- + C_6
* Cathode (Reduction): Lithium ions intercalate into the metal oxide.
Li1xCoO2+xLi++xeLiCoO2Li_{1-x}CoO_2 + xLi^+ + xe^- \rightarrow LiCoO_2

  • Overall Reaction:LixC6+Li1xCoO2C6+LiCoO2Li_x C_6 + Li_{1-x}CoO_2 \rightleftharpoons C_6 + LiCoO_2
  • Voltage:Typically 3.7 V per cell.
  • Uses:Smartphones, laptops, electric vehicles, medical devices. High energy density, no memory effect, low self-discharge.

Comparison of Primary and Secondary Batteries

AspectPrimary BatteriesSecondary Batteries
RechargeabilityNon-rechargeable (irreversible reactions)Rechargeable (reversible reactions)
CostLower initial costHigher initial cost
Life CycleSingle useMultiple charge/discharge cycles
Energy DensityGenerally higher for single useCan be lower initially, but high overall energy output over life cycle
Environmental ImpactHigher waste generation (disposable)Lower waste generation (reusable), but disposal of specific types (e.g., Ni-Cd) requires care
ApplicationsLow-drain, intermittent use (remotes, watches)High-drain, continuous use (phones, cars, laptops)

Real-World Applications

  • Primary:Dry cells (AA, AAA, C, D) power everyday items like flashlights, toys, and remote controls. Mercury cells are vital for medical implants like pacemakers due to their stable voltage output and compact size. Lithium primary cells (different from Li-ion) are used in cameras and smoke detectors for long shelf life.
  • Secondary:Lead-acid batteries are the workhorses for starting internal combustion engines in vehicles and for backup power systems (UPS, inverters). Ni-Cd batteries, though less common now, were prevalent in portable electronics. NiMH batteries (Nickel-Metal Hydride) replaced Ni-Cd due to environmental concerns (cadmium toxicity) and better capacity. Lithium-ion batteries are ubiquitous in modern portable electronics (smartphones, laptops, tablets), electric vehicles (EVs), and grid-scale energy storage due to their high energy density, long cycle life, and lack of memory effect.

Common Misconceptions

    1
  1. All batteries are rechargeable:This is incorrect. Primary batteries are specifically designed for single use and attempting to recharge them can be dangerous (overheating, leakage, explosion).
  2. 2
  3. Higher voltage means a 'better' battery:While higher voltage can mean more power for certain applications, it doesn't solely define 'better.' Factors like capacity (Ah), energy density (Wh/kg), cycle life, self-discharge rate, and cost are equally important depending on the application.
  4. 3
  5. Memory effect applies to all rechargeable batteries:The 'memory effect' (a temporary loss of capacity if a battery is repeatedly recharged after only partial discharge) is primarily associated with Ni-Cd batteries. NiMH batteries exhibit a milder form, while Li-ion batteries are virtually free from this effect.

NEET-Specific Angle

For NEET, the focus is typically on:

  • Identifying primary vs. secondary batteriesbased on their characteristics.
  • Knowing the specific examplesof each type (Dry cell, Mercury cell, Lead-acid, Ni-Cd, Li-ion).
  • Understanding the anode, cathode, and overall reactionsfor the key examples, especially Lead-acid, Dry cell, and Mercury cell. Pay attention to the oxidation states and products formed.
  • Recalling the approximate voltageof each cell type.
  • Recognizing the main applicationsof each battery type.
  • Understanding the environmental concernsassociated with certain battery components (e.g., mercury, cadmium, lead).

Key Concepts

Redox in a Leclanché (Dry) Cell

In a Leclanché cell, the zinc casing acts as the anode. Here, zinc metal (ZnZn) undergoes oxidation, losing…

Charging a Lead-Acid Battery

The charging process in a lead-acid battery is an example of electrolysis, where an external electrical…

Memory Effect in Ni-Cd Batteries

The 'memory effect' is a historical issue primarily associated with Nickel-Cadmium (Ni-Cd) batteries. It…

Often confused with

Side-by-side differences the NEET paper likes to test.

Primary and Secondary Batteries vs Secondary Batteries
AspectPrimary and Secondary BatteriesSecondary Batteries
RechargeabilityPrimary Batteries: Non-rechargeable; chemical reactions are irreversible.Secondary Batteries: Rechargeable; chemical reactions are reversible.
Chemical ReactionsPrimary Batteries: Proceed in one direction until reactants are consumed.Secondary Batteries: Can be reversed by applying an external electrical current.
CostPrimary Batteries: Generally lower initial purchase cost.Secondary Batteries: Higher initial purchase cost due to complex chemistry and components.
Life CyclePrimary Batteries: Single-use; discarded after one discharge cycle.Secondary Batteries: Multiple-use; can undergo hundreds to thousands of charge-discharge cycles.
Energy Density (Initial)Primary Batteries: Often have a higher energy density for their initial discharge.Secondary Batteries: May have slightly lower initial energy density compared to some primary types, but higher overall energy delivered over lifetime.
Environmental ImpactPrimary Batteries: Contribute more to landfill waste due to disposability; some contain toxic materials (e.g., mercury).Secondary Batteries: Less waste generation due to reusability; however, proper recycling is crucial for toxic components (e.g., lead, cadmium).
Typical ApplicationsPrimary Batteries: Low-drain devices, intermittent use, long shelf-life (e.g., remote controls, watches, smoke detectors).Secondary Batteries: High-drain devices, continuous use, portable electronics, electric vehicles, backup power (e.g., smartphones, laptops, cars, UPS).
ExamplesPrimary Batteries: Dry cell (Leclanché), Mercury cell, Alkaline cell.Secondary Batteries: Lead-acid battery, Nickel-Cadmium (Ni-Cd), Nickel-Metal Hydride (NiMH), Lithium-ion (Li-ion).

Primary and secondary batteries represent two distinct approaches to portable power. Primary batteries are designed for single use, relying on irreversible chemical reactions, making them convenient for low-drain applications but contributing to waste.

Their initial cost is low. Secondary batteries, conversely, are rechargeable, leveraging reversible chemical reactions to allow for multiple charge-discharge cycles. While their initial cost is higher, their reusability makes them more economical and environmentally friendly in the long run, essential for high-drain devices and modern electronics.

The choice depends on the specific application's power demands, cost considerations, and environmental impact.

Why it is tested: For NEET, understanding the fundamental differences, specific examples, and the underlying chemical reactions (especially anode/cathode processes) for primary and secondary batteries is crucial. Questions often test the reversibility concept, specific battery components, their characteristic voltages, and primary applications. Environmental aspects like the presence of toxic metals (mercury, cadmium, lead) are also relevant.

Questions students ask

5 answered on this topic.

What is the fundamental difference between a primary and a secondary battery?

The fundamental difference lies in the reversibility of their electrochemical reactions. Primary batteries undergo irreversible chemical reactions, meaning once the reactants are consumed during discharge, they cannot be regenerated by applying an external current.

They are single-use. Secondary batteries, on the other hand, have reversible chemical reactions. They can be recharged by passing an external current, which reverses the discharge reactions and restores the original reactants, allowing for multiple cycles of use.

Why do mercury cells provide a constant voltage throughout their operational life?

Mercury cells maintain a constant voltage (1.35 V) because the overall cell reaction does not involve any ions in the electrolyte whose concentrations would change significantly during discharge. The reactants (Zn(Hg) and HgO) and products (ZnO and Hg) are all solids or liquids, and the electrolyte (KOH) concentration remains relatively constant. According to the Nernst equation, if reactant/product concentrations remain stable, the cell potential remains constant.

What is the 'memory effect' in batteries, and which type is most affected?

The 'memory effect' is a phenomenon where a rechargeable battery, if repeatedly recharged after only being partially discharged, 'remembers' the shallower discharge point and subsequently delivers only that reduced capacity. This leads to a temporary reduction in the battery's effective capacity. This effect is most prominently associated with Nickel-Cadmium (Ni-Cd) batteries. Modern Lithium-ion batteries are virtually free from the memory effect.

Explain the role of sulfuric acid in a lead-acid battery during discharge and charge.

During discharge, sulfuric acid (H2SO4H_2SO_4) acts as the electrolyte and is consumed in the reactions at both the anode and cathode, forming lead sulfate (PbSO4PbSO_4) and water (H2OH_2O). This leads to a decrease in the concentration and density of the sulfuric acid.

During charging, an external current reverses these reactions, regenerating sulfuric acid and consuming water. Consequently, the concentration and density of sulfuric acid increase, which is why a hydrometer can be used to check the state of charge of a lead-acid battery.

Why are Lithium-ion batteries preferred for modern portable electronics and electric vehicles?

Lithium-ion batteries are preferred due to several key advantages: they offer a very high energy density (more energy stored per unit mass/volume), a high cell voltage (typically 3.7V), a long cycle life (can be recharged thousands of times), and they do not suffer from the 'memory effect.' These characteristics make them ideal for devices requiring compact, lightweight, and long-lasting power sources.

Revise in 30 seconds

  • Primary Batteries:Non-rechargeable, irreversible reactions. Examples: Dry Cell, Mercury Cell.

* Dry Cell: Anode (ZnZn), Cathode (MnO2MnO_2, C rod), Electrolyte (NH4ClNH_4Cl, ZnCl2ZnCl_2 paste). Voltage 1.5V\approx 1.5\,\text{V}. * Mercury Cell: Anode (Zn(Hg)Zn(Hg)), Cathode (HgOHgO, C), Electrolyte (KOHKOH, ZnOZnO paste). Voltage 1.35V\approx 1.35\,\text{V} (constant).

  • Secondary Batteries:Rechargeable, reversible reactions. Examples: Lead-Acid, Ni-Cd, Li-ion.

* Lead-Acid: Anode (PbPb), Cathode (PbO2PbO_2), Electrolyte (H2SO4H_2SO_4). Voltage 2V\approx 2\,\text{V}/cell. * Discharge: Pb+PbO2+2H2SO42PbSO4+2H2OPb + PbO_2 + 2H_2SO_4 \rightarrow 2PbSO_4 + 2H_2O * Charge: 2PbSO4+2H2OPb+PbO2+2H2SO42PbSO_4 + 2H_2O \rightarrow Pb + PbO_2 + 2H_2SO_4 * Ni-Cd: Anode (CdCd), Cathode (NiO(OH)NiO(OH)), Electrolyte (KOHKOH).

Voltage 1.2V\approx 1.2\,\text{V}. Suffers from 'memory effect'. * Li-ion: Anode (Graphite), Cathode (LiCoO2LiCoO_2), Electrolyte (non-aqueous Li salt). Voltage 3.7V\approx 3.7\,\text{V}. High energy density, no memory effect.

Primary Never Recharges, Secondary Reverses Reactions.

Primary: Dry Mercury (Dry cell, Mercury cell) Secondary: Lead Ni-Cd Li-ion (Lead-acid, Nickel-Cadmium, Lithium-ion)

Lead-Acid: Lead Lead Dioxide Sulfuric Acid (Anode, Cathode, Electrolyte) Mercury: Maintains Constant Voltage (1.35V)