Chemistry

Batteries

Chemistry·Explained

Primary and Secondary Batteries — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

Batteries are electrochemical cells that convert chemical energy directly into electrical energy through spontaneous redox (reduction-oxidation) reactions. This conversion occurs within a self-contained unit, making them portable power sources.

The fundamental components of any battery include an anode (negative electrode, where oxidation occurs), a cathode (positive electrode, where reduction occurs), and an electrolyte (a medium that allows ion flow between electrodes).

The classification into primary and secondary batteries hinges on the reversibility of these electrochemical reactions.

Conceptual Foundation

At the heart of every battery is a redox reaction. Oxidation, the loss of electrons, occurs at the anode, while reduction, the gain of electrons, occurs at the cathode. Electrons flow from the anode to the cathode through an external circuit, providing electrical current. Ions move through the electrolyte to maintain charge neutrality. The potential difference between the anode and cathode, known as the cell potential or electromotive force (EMF), drives this electron flow.

Key Principles/Laws

While detailed derivations are beyond the scope of NEET, understanding the underlying principles is crucial:

    1
  1. Redox Reactions:The core of battery operation. Identifying the species being oxidized and reduced, and their respective half-reactions, is key.
  2. 2
  3. Electrode Potentials:Each half-reaction has a standard electrode potential (EcircE^circ). The overall cell potential (EcirccellE^circ_{\text{cell}}) is the difference between the standard reduction potential of the cathode and the anode: Ecirccell=EcirccathodeEcircanodeE^circ_{\text{cell}} = E^circ_{\text{cathode}} - E^circ_{\text{anode}}. A positive EcirccellE^circ_{\text{cell}} indicates a spontaneous reaction.
  4. 3
  5. Nernst Equation:For non-standard conditions, the cell potential can be calculated using the Nernst equation: Ecell=EcirccellRTnFlnQE_{\text{cell}} = E^circ_{\text{cell}} - \frac{RT}{nF} ln Q, where RR is the gas constant, TT is temperature, nn is the number of electrons transferred, FF is Faraday's constant, and QQ is the reaction quotient. This explains why battery voltage drops as it discharges.
  6. 4
  7. Faraday's Laws of Electrolysis:While primarily for non-spontaneous reactions (electrolysis), Faraday's laws are relevant for understanding the quantitative aspects of charging secondary batteries or the amount of product formed/reactant consumed during discharge. For example, the amount of substance deposited or consumed is directly proportional to the quantity of electricity passed.

Primary Batteries (Non-Rechargeable)

Primary batteries are designed for single use. Their electrochemical reactions are essentially irreversible, meaning once the reactants are consumed, the battery cannot be effectively recharged. They are generally characterized by high energy density (energy per unit mass or volume) for their initial discharge and are suitable for low-drain or intermittent use where convenience outweighs rechargeability.

1. Dry Cell (Leclanché Cell):

  • Construction:A zinc container acts as the anode. A carbon rod, surrounded by a paste of manganese dioxide (MnO2MnO_2), carbon powder, and ammonium chloride (NH4ClNH_4Cl) (which acts as the electrolyte), serves as the cathode. Zinc chloride (ZnCl2ZnCl_2) is often added to the paste to improve conductivity and absorb ammonia gas.
  • Reactions:

* Anode (Oxidation): Zinc metal is oxidized.

Zn(s)Zn2+(aq)+2eZn(s) \rightarrow Zn^{2+}(aq) + 2e^-
* Cathode (Reduction): Manganese dioxide is reduced. The ammonium ions also participate.
2MnO2(s)+2NH4+(aq)+2eMn2O3(s)+2NH3(g)+H2O(l)2MnO_2(s) + 2NH_4^+(aq) + 2e^- \rightarrow Mn_2O_3(s) + 2NH_3(g) + H_2O(l)
The ammonia gas (NH3NH_3) produced can form a complex with Zn2+Zn^{2+} ions ([Zn(NH3)4]2+[Zn(NH_3)_4]^{2+}), preventing its accumulation and maintaining cell efficiency.

  • Overall Reaction:

Zn(s)+2MnO2(s)+2NH4+(aq)Zn2+(aq)+Mn2O3(s)+2NH3(g)+H2O(l)Zn(s) + 2MnO_2(s) + 2NH_4^+(aq) \rightarrow Zn^{2+}(aq) + Mn_2O_3(s) + 2NH_3(g) + H_2O(l)

  • Voltage:Approximately 1.5 V.
  • Uses:Flashlights, radios, wall clocks, remote controls.

2. Mercury Cell:

  • Construction:Consists of a zinc-mercury amalgam anode and a paste of mercury(II) oxide (HgOHgO) and carbon as the cathode. The electrolyte is a concentrated paste of potassium hydroxide (KOHKOH) and zinc oxide (ZnOZnO).
  • Reactions:

* Anode (Oxidation): Zinc is oxidized.

Zn(Hg)(s)+2OH(aq)ZnO(s)+H2O(l)+2eZn(Hg)(s) + 2OH^-(aq) \rightarrow ZnO(s) + H_2O(l) + 2e^-
* Cathode (Reduction): Mercury(II) oxide is reduced.
HgO(s)+H2O(l)+2eHg(l)+2OH(aq)HgO(s) + H_2O(l) + 2e^- \rightarrow Hg(l) + 2OH^-(aq)

  • Overall Reaction:

Zn(Hg)(s)+HgO(s)ZnO(s)+Hg(l)Zn(Hg)(s) + HgO(s) \rightarrow ZnO(s) + Hg(l)

  • Voltage:A constant 1.35 V throughout its life, as the overall reaction does not involve ions whose concentrations change significantly.
  • Uses:Hearing aids, pacemakers, watches, calculators (where constant voltage is critical).

Secondary Batteries (Rechargeable)

Secondary batteries are designed for multiple cycles of discharge and charge. Their electrochemical reactions are reversible, allowing them to be regenerated by passing an external current in the opposite direction. They are crucial for applications requiring long-term power and where replacement is inconvenient or costly.

1. Lead-Acid Battery:

  • Construction:Consists of a series of cells, each containing a lead anode and a grid of lead packed with lead dioxide (PbO2PbO_2) as the cathode. The electrolyte is an aqueous solution of sulfuric acid (H2SO4H_2SO_4).
  • Discharge Reactions (Battery in use):

* Anode (Oxidation): Lead is oxidized to lead sulfate.

Pb(s)+SO42(aq)PbSO4(s)+2ePb(s) + SO_4^{2-}(aq) \rightarrow PbSO_4(s) + 2e^-
* Cathode (Reduction): Lead dioxide is reduced to lead sulfate.
PbO2(s)+SO42(aq)+4H+(aq)+2ePbSO4(s)+2H2O(l)PbO_2(s) + SO_4^{2-}(aq) + 4H^+(aq) + 2e^- \rightarrow PbSO_4(s) + 2H_2O(l)

  • Overall Discharge Reaction:

Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO4(s)+2H2O(l)Pb(s) + PbO_2(s) + 2H_2SO_4(aq) \rightarrow 2PbSO_4(s) + 2H_2O(l)
During discharge, sulfuric acid is consumed, and water is produced, leading to a decrease in the density of the electrolyte. This density change can be used to gauge the battery's state of charge.

  • Charging Reactions (External current applied):The discharge reactions are reversed.

* Anode (now acting as cathode for charging): Lead sulfate is reduced back to lead.

PbSO4(s)+2ePb(s)+SO42(aq)PbSO_4(s) + 2e^- \rightarrow Pb(s) + SO_4^{2-}(aq)
* Cathode (now acting as anode for charging): Lead sulfate is oxidized back to lead dioxide.
PbSO4(s)+2H2O(l)PbO2(s)+SO42(aq)+4H+(aq)+2ePbSO_4(s) + 2H_2O(l) \rightarrow PbO_2(s) + SO_4^{2-}(aq) + 4H^+(aq) + 2e^-

  • Overall Charging Reaction:

2PbSO4(s)+2H2O(l)Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO_4(s) + 2H_2O(l) \rightarrow Pb(s) + PbO_2(s) + 2H_2SO_4(aq)
During charging, sulfuric acid is regenerated, and water is consumed, increasing the density of the electrolyte.

  • Voltage:Each cell provides approximately 2 V. A typical car battery has six cells in series, providing 12 V.
  • Uses:Automobile batteries, inverters, UPS systems.

2. Nickel-Cadmium (Ni-Cd) Battery:

  • Construction:Uses a cadmium anode and a nickel(III) oxyhydroxide (NiO(OH)NiO(OH)) cathode. The electrolyte is an alkaline solution, typically potassium hydroxide (KOHKOH).
  • Discharge Reactions:

* Anode (Oxidation): Cadmium is oxidized.

Cd(s)+2OH(aq)Cd(OH)2(s)+2eCd(s) + 2OH^-(aq) \rightarrow Cd(OH)_2(s) + 2e^-
* Cathode (Reduction): Nickel(III) oxyhydroxide is reduced.
2NiO(OH)(s)+2H2O(l)+2e2Ni(OH)2(s)+2OH(aq)2NiO(OH)(s) + 2H_2O(l) + 2e^- \rightarrow 2Ni(OH)_2(s) + 2OH^-(aq)

  • Overall Discharge Reaction:

Cd(s)+2NiO(OH)(s)+2H2O(l)Cd(OH)2(s)+2Ni(OH)2(s)Cd(s) + 2NiO(OH)(s) + 2H_2O(l) \rightarrow Cd(OH)_2(s) + 2Ni(OH)_2(s)

  • Charging Reactions:The discharge reactions are reversed.

Cd(OH)2(s)+2Ni(OH)2(s)Cd(s)+2NiO(OH)(s)+2H2O(l)Cd(OH)_2(s) + 2Ni(OH)_2(s) \rightarrow Cd(s) + 2NiO(OH)(s) + 2H_2O(l)

  • Voltage:Approximately 1.2 V.
  • Uses:Portable electronic devices (older models), power tools. Known for the 'memory effect' where repeated partial discharge/charge cycles can reduce capacity.

3. Lithium-ion (Li-ion) Battery:

  • Principle:Unlike other batteries where electrode materials change phase, Li-ion batteries operate on the principle of 'intercalation,' where lithium ions move between layers of electrode materials (typically graphite for anode, lithium metal oxides for cathode) without forming new compounds.
  • Construction:Typically, a graphite anode and a lithium cobalt oxide (LiCoO2LiCoO_2) or lithium manganese oxide (LiMn2O4LiMn_2O_4) cathode. The electrolyte is a non-aqueous lithium salt solution (e.g., LiPF6LiPF_6 in organic solvents).
  • Discharge Reactions (Simplified):

* Anode (Oxidation): Lithium ions de-intercalate from graphite.

LixC6xLi++xe+C6Li_x C_6 \rightarrow xLi^+ + xe^- + C_6
* Cathode (Reduction): Lithium ions intercalate into the metal oxide.
Li1xCoO2+xLi++xeLiCoO2Li_{1-x}CoO_2 + xLi^+ + xe^- \rightarrow LiCoO_2

  • Overall Reaction:LixC6+Li1xCoO2C6+LiCoO2Li_x C_6 + Li_{1-x}CoO_2 \rightleftharpoons C_6 + LiCoO_2
  • Voltage:Typically 3.7 V per cell.
  • Uses:Smartphones, laptops, electric vehicles, medical devices. High energy density, no memory effect, low self-discharge.

Comparison of Primary and Secondary Batteries

AspectPrimary BatteriesSecondary Batteries
RechargeabilityNon-rechargeable (irreversible reactions)Rechargeable (reversible reactions)
CostLower initial costHigher initial cost
Life CycleSingle useMultiple charge/discharge cycles
Energy DensityGenerally higher for single useCan be lower initially, but high overall energy output over life cycle
Environmental ImpactHigher waste generation (disposable)Lower waste generation (reusable), but disposal of specific types (e.g., Ni-Cd) requires care
ApplicationsLow-drain, intermittent use (remotes, watches)High-drain, continuous use (phones, cars, laptops)

Real-World Applications

  • Primary:Dry cells (AA, AAA, C, D) power everyday items like flashlights, toys, and remote controls. Mercury cells are vital for medical implants like pacemakers due to their stable voltage output and compact size. Lithium primary cells (different from Li-ion) are used in cameras and smoke detectors for long shelf life.
  • Secondary:Lead-acid batteries are the workhorses for starting internal combustion engines in vehicles and for backup power systems (UPS, inverters). Ni-Cd batteries, though less common now, were prevalent in portable electronics. NiMH batteries (Nickel-Metal Hydride) replaced Ni-Cd due to environmental concerns (cadmium toxicity) and better capacity. Lithium-ion batteries are ubiquitous in modern portable electronics (smartphones, laptops, tablets), electric vehicles (EVs), and grid-scale energy storage due to their high energy density, long cycle life, and lack of memory effect.

Common Misconceptions

    1
  1. All batteries are rechargeable:This is incorrect. Primary batteries are specifically designed for single use and attempting to recharge them can be dangerous (overheating, leakage, explosion).
  2. 2
  3. Higher voltage means a 'better' battery:While higher voltage can mean more power for certain applications, it doesn't solely define 'better.' Factors like capacity (Ah), energy density (Wh/kg), cycle life, self-discharge rate, and cost are equally important depending on the application.
  4. 3
  5. Memory effect applies to all rechargeable batteries:The 'memory effect' (a temporary loss of capacity if a battery is repeatedly recharged after only partial discharge) is primarily associated with Ni-Cd batteries. NiMH batteries exhibit a milder form, while Li-ion batteries are virtually free from this effect.

NEET-Specific Angle

For NEET, the focus is typically on:

  • Identifying primary vs. secondary batteriesbased on their characteristics.
  • Knowing the specific examplesof each type (Dry cell, Mercury cell, Lead-acid, Ni-Cd, Li-ion).
  • Understanding the anode, cathode, and overall reactionsfor the key examples, especially Lead-acid, Dry cell, and Mercury cell. Pay attention to the oxidation states and products formed.
  • Recalling the approximate voltageof each cell type.
  • Recognizing the main applicationsof each battery type.
  • Understanding the environmental concernsassociated with certain battery components (e.g., mercury, cadmium, lead).
Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.