Chemistry

Batteries

Chemistry·Revision Notes

Primary and Secondary Batteries — Revision Notes

NEET UG
Version 1Updated 22 Mar 2026

⚡ 30-Second Revision

  • Primary Batteries:Non-rechargeable, irreversible reactions. Examples: Dry Cell, Mercury Cell.

* Dry Cell: Anode (ZnZn), Cathode (MnO2MnO_2, C rod), Electrolyte (NH4ClNH_4Cl, ZnCl2ZnCl_2 paste). Voltage approx1.5,Vapprox 1.5,\text{V}. * Mercury Cell: Anode (Zn(Hg)Zn(Hg)), Cathode (HgOHgO, C), Electrolyte (KOHKOH, ZnOZnO paste). Voltage approx1.35,Vapprox 1.35,\text{V} (constant).

  • Secondary Batteries:Rechargeable, reversible reactions. Examples: Lead-Acid, Ni-Cd, Li-ion.

* Lead-Acid: Anode (PbPb), Cathode (PbO2PbO_2), Electrolyte (H2SO4H_2SO_4). Voltage approx2,Vapprox 2,\text{V}/cell. * Discharge: Pb+PbO2+2H2SO42PbSO4+2H2OPb + PbO_2 + 2H_2SO_4 \rightarrow 2PbSO_4 + 2H_2O * Charge: 2PbSO4+2H2OPb+PbO2+2H2SO42PbSO_4 + 2H_2O \rightarrow Pb + PbO_2 + 2H_2SO_4 * Ni-Cd: Anode (CdCd), Cathode (NiO(OH)NiO(OH)), Electrolyte (KOHKOH).

Voltage approx1.2,Vapprox 1.2,\text{V}. Suffers from 'memory effect'. * Li-ion: Anode (Graphite), Cathode (LiCoO2LiCoO_2), Electrolyte (non-aqueous Li salt). Voltage approx3.7,Vapprox 3.7,\text{V}. High energy density, no memory effect.

2-Minute Revision

Batteries convert chemical energy to electrical energy via redox reactions. They are categorized into primary (non-rechargeable) and secondary (rechargeable) types. Primary batteries, like the Dry Cell (Leclanché) and Mercury Cell, are single-use.

The Dry Cell uses a zinc anode and a carbon rod with MnO2MnO_2 paste as cathode, yielding 1.5V. The Mercury Cell, with a zinc-mercury amalgam anode and HgOHgO cathode in an alkaline electrolyte, provides a stable 1.

35V, ideal for watches and pacemakers. Secondary batteries, such as the Lead-Acid battery, Nickel-Cadmium (Ni-Cd), and Lithium-ion (Li-ion), can be recharged. The Lead-Acid battery, common in cars, uses lead and lead dioxide electrodes in sulfuric acid, producing 2V per cell, with its charge state indicated by electrolyte density.

Ni-Cd batteries (1.2V) are known for the 'memory effect.' Li-ion batteries (3.7V) are highly favored for modern electronics due to their high energy density and absence of the memory effect. Key aspects for NEET include knowing the anode/cathode materials, electrolytes, specific reactions, voltages, and applications for each type.

5-Minute Revision

A battery is an electrochemical cell that transforms chemical energy into electrical energy through spontaneous redox reactions. The two main types are primary and secondary batteries.

Primary Batteries (Non-Rechargeable): These batteries have irreversible chemical reactions and are designed for single use. Once the reactants are consumed, the battery is 'dead'.

    1
  1. Dry Cell (Leclanché Cell):

* Anode: Zinc container (ZnZn2++2eZn \rightarrow Zn^{2+} + 2e^-) * Cathode: Carbon rod surrounded by MnO2MnO_2 and carbon powder paste (2MnO2+2NH4++2eMn2O3+2NH3+H2O2MnO_2 + 2NH_4^+ + 2e^- \rightarrow Mn_2O_3 + 2NH_3 + H_2O) * Electrolyte: Paste of NH4ClNH_4Cl and ZnCl2ZnCl_2. * Voltage: approx1.5,Vapprox 1.5,\text{V}. * Uses: Flashlights, radios.

    1
  1. Mercury Cell:

* Anode: Zinc-mercury amalgam (Zn(Hg)+2OHZnO+H2O+2eZn(Hg) + 2OH^- \rightarrow ZnO + H_2O + 2e^-) * Cathode: Paste of HgOHgO and carbon (HgO+H2O+2eHg+2OHHgO + H_2O + 2e^- \rightarrow Hg + 2OH^-) * Electrolyte: Concentrated paste of KOHKOH and ZnOZnO. * Voltage: Constant 1.35,V1.35,\text{V} (due to stable reactant/product concentrations). * Uses: Hearing aids, pacemakers, watches.

Secondary Batteries (Rechargeable): These batteries have reversible chemical reactions and can be recharged by applying an external current, allowing for multiple cycles.

    1
  1. Lead-Acid Battery:

* Anode (Discharge): Lead (Pb+SO42PbSO4+2ePb + SO_4^{2-} \rightarrow PbSO_4 + 2e^-) * Cathode (Discharge): Lead dioxide (PbO2+SO42+4H++2ePbSO4+2H2OPbO_2 + SO_4^{2-} + 4H^+ + 2e^- \rightarrow PbSO_4 + 2H_2O) * Overall Discharge: Pb+PbO2+2H2SO42PbSO4+2H2OPb + PbO_2 + 2H_2SO_4 \rightarrow 2PbSO_4 + 2H_2O * Overall Charge: 2PbSO4+2H2OPb+PbO2+2H2SO42PbSO_4 + 2H_2O \rightarrow Pb + PbO_2 + 2H_2SO_4 * Electrolyte: Aqueous H2SO4H_2SO_4.

Density changes with charge state. * Voltage: approx2,Vapprox 2,\text{V} per cell (e.g., 12V car battery has 6 cells). * Uses: Automobile starter, UPS, inverters.

    1
  1. Nickel-Cadmium (Ni-Cd) Battery:

* Anode: Cadmium (Cd+2OHCd(OH)2+2eCd + 2OH^- \rightarrow Cd(OH)_2 + 2e^-) * Cathode: Nickel(III) oxyhydroxide (2NiO(OH)+2H2O+2e2Ni(OH)2+2OH2NiO(OH) + 2H_2O + 2e^- \rightarrow 2Ni(OH)_2 + 2OH^-) * Electrolyte: Alkaline KOHKOH solution. * Voltage: approx1.2,Vapprox 1.2,\text{V}. * Characteristic: Suffers from 'memory effect'. * Uses: Older portable electronics, power tools.

    1
  1. Lithium-ion (Li-ion) Battery:

* Principle: Intercalation of Li+Li^+ ions between electrode layers. * Anode: Graphite (LixC6xLi++xe+C6Li_x C_6 \rightleftharpoons xLi^+ + xe^- + C_6) * Cathode: Lithium metal oxide (e.g., LiCoO2LiCoO_2) (Li1xCoO2+xLi++xeLiCoO2Li_{1-x}CoO_2 + xLi^+ + xe^- \rightleftharpoons LiCoO_2) * Electrolyte: Non-aqueous lithium salt solution. * Voltage: approx3.7,Vapprox 3.7,\text{V}. * Characteristics: High energy density, no memory effect, low self-discharge. * Uses: Smartphones, laptops, electric vehicles.

For NEET, focus on the specific reactions, electrode materials, electrolytes, voltages, and key applications/characteristics of each battery type. Pay attention to oxidation states in redox reactions.

Prelims Revision Notes

  • Batteries:Electrochemical cells converting chemical energy to electrical energy via spontaneous redox reactions.
  • Primary Batteries:Non-rechargeable, single-use. Reactions are irreversible.

* Dry Cell (Leclanché Cell): * Anode: Zinc (ZnZn). Oxidation: Zn(s)Zn2+(aq)+2eZn(s) \rightarrow Zn^{2+}(aq) + 2e^-. * Cathode: Carbon rod surrounded by MnO2MnO_2 and carbon powder. Reduction: 2MnO2(s)+2NH4+(aq)+2eMn2O3(s)+2NH3(g)+H2O(l)2MnO_2(s) + 2NH_4^+(aq) + 2e^- \rightarrow Mn_2O_3(s) + 2NH_3(g) + H_2O(l).

* Electrolyte: Paste of NH4ClNH_4Cl and ZnCl2ZnCl_2. * Voltage: approx1.5,Vapprox 1.5,\text{V}. * Uses: Flashlights, radios, remote controls. * Mercury Cell: * Anode: Zinc-mercury amalgam (Zn(Hg)Zn(Hg)). Oxidation: Zn(Hg)(s)+2OH(aq)ZnO(s)+H2O(l)+2eZn(Hg)(s) + 2OH^-(aq) \rightarrow ZnO(s) + H_2O(l) + 2e^-.

* Cathode: Paste of HgOHgO and carbon. Reduction: HgO(s)+H2O(l)+2eHg(l)+2OH(aq)HgO(s) + H_2O(l) + 2e^- \rightarrow Hg(l) + 2OH^-(aq). * Overall Reaction: Zn(Hg)(s)+HgO(s)ZnO(s)+Hg(l)Zn(Hg)(s) + HgO(s) \rightarrow ZnO(s) + Hg(l). * Electrolyte: Concentrated alkaline paste of KOHKOH and ZnOZnO.

* Voltage: Constant 1.35,V1.35,\text{V}. * Uses: Hearing aids, pacemakers, watches (constant voltage critical).

  • Secondary Batteries:Rechargeable, multiple-use. Reactions are reversible.

* Lead-Acid Battery: * Anode (Discharge): Lead (PbPb). Pb(s)+SO42(aq)PbSO4(s)+2ePb(s) + SO_4^{2-}(aq) \rightarrow PbSO_4(s) + 2e^-. * Cathode (Discharge): Lead dioxide (PbO2PbO_2). PbO2(s)+SO42(aq)+4H+(aq)+2ePbSO4(s)+2H2O(l)PbO_2(s) + SO_4^{2-}(aq) + 4H^+(aq) + 2e^- \rightarrow PbSO_4(s) + 2H_2O(l).

* Overall Discharge: Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO4(s)+2H2O(l)Pb(s) + PbO_2(s) + 2H_2SO_4(aq) \rightarrow 2PbSO_4(s) + 2H_2O(l). * Overall Charge: 2PbSO4(s)+2H2O(l)Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO_4(s) + 2H_2O(l) \rightarrow Pb(s) + PbO_2(s) + 2H_2SO_4(aq). * Electrolyte: Aqueous H2SO4H_2SO_4.

Density decreases on discharge, increases on charge. * Voltage: approx2,Vapprox 2,\text{V} per cell. * Uses: Automobile batteries, inverters, UPS. * Nickel-Cadmium (Ni-Cd) Battery: * Anode: Cadmium (CdCd).

Cd(s)+2OH(aq)Cd(OH)2(s)+2eCd(s) + 2OH^-(aq) \rightarrow Cd(OH)_2(s) + 2e^-. * Cathode: Nickel(III) oxyhydroxide (NiO(OH)NiO(OH)). 2NiO(OH)(s)+2H2O(l)+2e2Ni(OH)2(s)+2OH(aq)2NiO(OH)(s) + 2H_2O(l) + 2e^- \rightarrow 2Ni(OH)_2(s) + 2OH^-(aq). * Electrolyte: Alkaline KOHKOH solution.

* Voltage: approx1.2,Vapprox 1.2,\text{V}. * Characteristic: Exhibits 'memory effect'. Contains toxic cadmium. * Lithium-ion (Li-ion) Battery: * Principle: Intercalation of Li+Li^+ ions. * Anode: Graphite (LixC6Li_x C_6).

* Cathode: Lithium metal oxide (e.g., LiCoO2LiCoO_2). * Electrolyte: Non-aqueous lithium salt solution. * Voltage: approx3.7,Vapprox 3.7,\text{V}. * Characteristics: High energy density, no memory effect, low self-discharge.

* Uses: Smartphones, laptops, electric vehicles, medical devices.

  • Key Differences:Primary (irreversible, single-use, lower initial cost) vs. Secondary (reversible, multi-use, higher initial cost).

Vyyuha Quick Recall

Primary Never Recharges, Secondary Reverses Reactions.

Primary: Dry Mercury (Dry cell, Mercury cell) Secondary: Lead Ni-Cd Li-ion (Lead-acid, Nickel-Cadmium, Lithium-ion)

Lead-Acid: Lead Lead Dioxide Sulfuric Acid (Anode, Cathode, Electrolyte) Mercury: Maintains Constant Voltage (1.35V)

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.