Chemistry

Law of Chemical Equilibrium

Chemistry·Explained

Homogeneous and Heterogeneous Equilibria — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

Chemical equilibrium is a cornerstone concept in chemistry, describing a state where the forward and reverse reaction rates are equal, leading to constant macroscopic properties. This dynamic balance is fundamental to understanding reaction extent and product yield. The classification of equilibrium into homogeneous and heterogeneous types is based on the physical states of the reactants and products, profoundly influencing how we express and interpret the equilibrium constant.

Conceptual Foundation: The Dynamic Nature of Equilibrium

Before delving into the types, it's vital to reiterate that chemical equilibrium is not a static state where reactions cease. Instead, it's a dynamic state where both forward and reverse reactions continue to occur, but at identical rates.

This means that while concentrations appear constant, individual molecules are continuously transforming. For example, in the reaction ABA \rightleftharpoons B, A is constantly converting to B, and B is simultaneously converting back to A.

At equilibrium, the rate of ABA \to B equals the rate of BAB \to A.

Key Principles: Law of Mass Action and Equilibrium Constant

The Law of Mass Action, proposed by Guldberg and Waage, states that the rate of a chemical reaction is directly proportional to the product of the molar concentrations (or partial pressures for gases) of the reactants, each raised to the power of its stoichiometric coefficient in the balanced chemical equation.

For a general reversible reaction:

aA+bBcC+dDaA + bB \rightleftharpoons cC + dD
The rate of the forward reaction (RfR_f) is kf[A]a[B]bk_f[A]^a[B]^b, and the rate of the reverse reaction (RrR_r) is kr[C]c[D]dk_r[C]^c[D]^d. At equilibrium, Rf=RrR_f = R_r, so:
kf[A]a[B]b=kr[C]c[D]dk_f[A]^a[B]^b = k_r[C]^c[D]^d
Rearranging this gives the equilibrium constant, KK:
K=kfkr=[C]c[D]d[A]a[B]bK = \frac{k_f}{k_r} = \frac{[C]^c[D]^d}{[A]^a[B]^b}
This constant KK is temperature-dependent and indicates the relative amounts of products and reactants at equilibrium.

Depending on whether concentrations (KcK_c) or partial pressures (KpK_p) are used, the constant is denoted accordingly.

Homogeneous Equilibrium

    1
  1. DefinitionA homogeneous equilibrium is one in which all reactants and products are in the same physical phase. This phase can be gaseous or liquid (solution).
    1
  1. CharacteristicsThe system is uniform throughout. All species contribute to the overall pressure (if gaseous) or concentration (if in solution).
    1
  1. Examples and Equilibrium Constant Expression

* Gas-phase reactions: All species are gases. Consider the Haber process: N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g) The equilibrium constant in terms of concentrations (KcK_c) is:

Kc=[NH3]2[N2][H2]3K_c = \frac{[NH_3]^2}{[N_2][H_2]^3}
The equilibrium constant in terms of partial pressures (KpK_p) is:
Kp=(PNH3)2(PN2)(PH2)3K_p = \frac{(P_{NH_3})^2}{(P_{N_2})(P_{H_2})^3}
Here, PXP_X represents the partial pressure of species X.

* Liquid-phase reactions (in solution): All species are dissolved in a single solvent. Consider the esterification reaction: CH3COOH(aq)+C2H5OH(aq)CH3COOC2H5(aq)+H2O(aq)CH_3COOH(aq) + C_2H_5OH(aq) \rightleftharpoons CH_3COOC_2H_5(aq) + H_2O(aq) The equilibrium constant in terms of concentrations (KcK_c) is:

Kc=[CH3COOC2H5][H2O][CH3COOH][C2H5OH]K_c = \frac{[CH_3COOC_2H_5][H_2O]}{[CH_3COOH][C_2H_5OH]}
Note: For reactions in aqueous solutions, water is often the solvent.

If water is a reactant or product and its concentration changes significantly, it must be included in the KcK_c expression. However, if it's the solvent and its concentration is essentially constant (very large excess), it's sometimes omitted, particularly in dilute solutions, leading to a modified constant KcK_c'.

For NEET, assume all species are included unless specified as solvent in large excess.

Heterogeneous Equilibrium

    1
  1. DefinitionA heterogeneous equilibrium is one in which reactants and products are present in two or more different physical phases.
    1
  1. CharacteristicsThe system is non-uniform. Crucially, the concentrations of pure solids and pure liquids are considered constant and are therefore *not* included in the equilibrium constant expression.
    1
  1. Explanation for Exclusion of Pure Solids/LiquidsThe concentration of a pure solid or a pure liquid is essentially constant at a given temperature. This is because the amount of substance per unit volume (density) for a pure solid or liquid is fixed. For example, if you have a block of solid calcium carbonate, its 'concentration' (moles per liter of the solid itself) doesn't change, regardless of how much solid is present, as long as some solid is there. Its activity is defined as 1. Since these 'concentrations' are constant, they can be absorbed into the equilibrium constant KK. If we were to write the full expression including them, say for CaCO3(s)CaO(s)+CO2(g)CaCO_3(s) \rightleftharpoons CaO(s) + CO_2(g):

Kfull=[CaO(s)][CO2(g)][CaCO3(s)]K_{full} = \frac{[CaO(s)][CO_2(g)]}{[CaCO_3(s)]}
Since [CaO(s)][CaO(s)] and [CaCO3(s)][CaCO_3(s)] are constant, we can define a new constant, KcK_c, as:
Kc=Kfull[CaCO3(s)][CaO(s)]=[CO2(g)]K_c = K_{full} \frac{[CaCO_3(s)]}{[CaO(s)]} = [CO_2(g)]
Similarly for KpK_p, pure solids and liquids are omitted. This simplification is a key aspect of heterogeneous equilibria.

    1
  1. Examples and Equilibrium Constant Expression

* Solid-Gas Equilibrium: Decomposition of calcium carbonate. CaCO3(s)CaO(s)+CO2(g)CaCO_3(s) \rightleftharpoons CaO(s) + CO_2(g) Here, CaCO3(s)CaCO_3(s) and CaO(s)CaO(s) are pure solids. Only the gaseous species is included.

Kc=[CO2]K_c = [CO_2]
Kp=PCO2K_p = P_{CO_2}
* Solid-Liquid Equilibrium: Dissolution of a sparingly soluble salt. AgCl(s)Ag+(aq)+Cl(aq)AgCl(s) \rightleftharpoons Ag^+(aq) + Cl^-(aq) Here, AgCl(s)AgCl(s) is a pure solid. The equilibrium constant is the solubility product constant, KspK_{sp}.

Ksp=[Ag+][Cl]K_{sp} = [Ag^+][Cl^-]
* Liquid-Gas Equilibrium: Evaporation of water. H2O(l)H2O(g)H_2O(l) \rightleftharpoons H_2O(g) Here, H2O(l)H_2O(l) is a pure liquid.
Kc=[H2O(g)]K_c = [H_2O(g)]
Kp=PH2OK_p = P_{H_2O}
* Solid-Gas with liquid product: Reaction of carbon with steam.

C(s)+H2O(g)CO(g)+H2(g)C(s) + H_2O(g) \rightleftharpoons CO(g) + H_2(g) Here, C(s)C(s) is a pure solid.

Derivations (General)

The derivation of KcK_c and KpK_p stems directly from the Law of Mass Action and the condition of equilibrium where forward and reverse reaction rates are equal. For a generic reaction aA+bBcC+dDaA + bB \rightleftharpoons cC + dD, the rate laws are: Rate (forward) =kf[A]a[B]b= k_f [A]^a [B]^b Rate (reverse) =kr[C]c[D]d= k_r [C]^c [D]^d At equilibrium, Rate (forward) = Rate (reverse): kf[A]a[B]b=kr[C]c[D]dk_f [A]^a [B]^b = k_r [C]^c [D]^d Rearranging gives: kfkr=[C]c[D]d[A]a[B]b\frac{k_f}{k_r} = \frac{[C]^c [D]^d}{[A]^a [B]^b} Defining Kc=kfkrK_c = \frac{k_f}{k_r}, we get:

Kc=[C]c[D]d[A]a[B]bK_c = \frac{[C]^c [D]^d}{[A]^a [B]^b}
For gaseous reactions, concentrations can be related to partial pressures using the ideal gas law, PV=nRTPV=nRT, so P=(n/V)RT=CRTP = (n/V)RT = CRT.

Thus, [X]=PX/RT[X] = P_X/RT. Substituting this into the KcK_c expression allows derivation of KpK_p and the relationship Kp=Kc(RT)DeltangK_p = K_c(RT)^{Delta n_g}, where DeltangDelta n_g is the change in the number of moles of gaseous products minus gaseous reactants.

Real-World Applications

Understanding homogeneous and heterogeneous equilibria is crucial in various industrial processes. For instance, the Haber-Bosch process for ammonia synthesis (N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g)) is a homogeneous gas-phase equilibrium, optimized for yield by manipulating pressure and temperature.

The production of sulfuric acid via the Contact Process involves the oxidation of SO2(g)SO_2(g) to SO3(g)SO_3(g) (2SO2(g)+O2(g)2SO3(g)2SO_2(g) + O_2(g) \rightleftharpoons 2SO_3(g)), another homogeneous gas-phase equilibrium. Heterogeneous equilibria are vital in metallurgy (e.

g., reduction of metal oxides by carbon), environmental chemistry (e.g., dissolution of minerals, acid rain effects on limestone), and even in biological systems (e.g., dissolution of bone minerals, gas exchange in lungs, though these are often more complex multi-phase systems).

Common Misconceptions

    1
  1. Including Pure Solids/Liquids in K ExpressionThe most frequent error is to include the concentrations or partial pressures of pure solids and liquids in the equilibrium constant expression. Remember, their activities are unity, and their effective concentrations are constant, thus they are absorbed into the value of KK.
  2. 2
  3. Confusing PhasesIncorrectly identifying the phase of a reactant or product (e.g., treating a solid precipitate as an aqueous species) can lead to errors in writing the K expression.
  4. 3
  5. Static EquilibriumBelieving that reactions stop at equilibrium rather than continuing dynamically in both directions.
  6. 4
  7. Units of KWhile KK is often treated as unitless in advanced chemistry, for NEET, it's important to understand that KcK_c has units of (mol/L)Deltan(mol/L)^{Delta n} and KpK_p has units of (atm)Deltang(atm)^{Delta n_g} or (bar)Deltang(bar)^{Delta n_g}, where DeltanDelta n is the change in moles of products minus reactants (for KcK_c) or gaseous products minus gaseous reactants (for KpK_p).

NEET-Specific Angle

For NEET, the focus will primarily be on:

  • Identifying the type of equilibriumGiven a reaction, classify it as homogeneous or heterogeneous.
  • Correctly writing equilibrium constant expressions ($K_c$ and $K_p$)This is a very common question type, especially for heterogeneous systems where pure solids/liquids must be omitted.
  • Calculating $K_c$ or $K_p$Given equilibrium concentrations or partial pressures.
  • Relating $K_c$ and $K_p$Using the formula Kp=Kc(RT)DeltangK_p = K_c(RT)^{Delta n_g}. Ensure DeltangDelta n_g is calculated correctly, considering only gaseous species.
  • Understanding the implications for Le Chatelier's PrincipleWhile Le Chatelier's principle is a separate topic, its application often depends on correctly identifying the phases and the species that influence the equilibrium (e.g., adding a solid reactant to a heterogeneous equilibrium typically has no effect on the equilibrium position, as its concentration is constant).
Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.