Chemistry·MCQ Practice

Homogeneous and Heterogeneous Equilibria — MCQ Practice

NEET UG
Updated 22 Mar 2026

Interactive MCQ Practice

Test your knowledge. Click “Solve” to reveal options, select your answer, then check the result. 6 questions available.

Q1easy

Which of the following reactions represents a heterogeneous equilibrium?

Q2easy

For the reaction 2SO2(g)+O2(g)2SO3(g)2SO_2(g) + O_2(g) \rightleftharpoons 2SO_3(g), which is a homogeneous equilibrium, what is the correct expression for KcK_c?

Q3medium

Consider the heterogeneous equilibrium: C(s)+H2O(g)CO(g)+H2(g)C(s) + H_2O(g) \rightleftharpoons CO(g) + H_2(g). What is the correct expression for KpK_p?

Q4medium

For the reaction N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g), if Kc=0.5,(mol/L)2K_c = 0.5,(mol/L)^{-2} at 700,K700,K, what is the value of KpK_p at the same temperature? (Given R=0.0821,Latm/(molK)R = 0.0821,L \cdot atm/(mol \cdot K))

Q5hard

At a certain temperature, the equilibrium constant KpK_p for the reaction PCl5(s)PCl3(g)+Cl2(g)PCl_5(s) \rightleftharpoons PCl_3(g) + Cl_2(g) is 0.50,atm20.50,atm^2. If the total pressure at equilibrium is 1.0,atm1.0,atm, what are the partial pressures of PCl3(g)PCl_3(g) and Cl2(g)Cl_2(g)?

Q6medium

Which of the following statements is TRUE regarding the effect of adding more solid reactant to a heterogeneous equilibrium system?