Chemistry

Law of Chemical Equilibrium

Chemistry·Revision Notes

Homogeneous and Heterogeneous Equilibria — Revision Notes

NEET UG
Version 1Updated 22 Mar 2026

⚡ 30-Second Revision

  • Homogeneous EquilibriumAll species in same phase (g, l, aq).
  • Heterogeneous EquilibriumSpecies in 2\ge 2 phases (s, l, g, aq).
  • $K_c$ ExpressionProducts in numerator, reactants in denominator, coefficients as exponents.
  • $K_p$ ExpressionSame as KcK_c, but with partial pressures for gases.
  • Key Rule for HeterogeneousPure solids (s) and pure liquids (l) are EXCLUDED from KcK_c and KpK_p expressions (activity = 1).
  • $K_p = K_c(RT)^{\Delta n_g}$Δng=nproducts(g)nreactants(g)\Delta n_g = \sum n_{products(g)} - \sum n_{reactants(g)}. Only gaseous species count for Δng\Delta n_g.
  • Effect of adding pure solid/liquidNo effect on equilibrium position (Le Chatelier's principle).

2-Minute Revision

Chemical equilibrium is categorized into homogeneous and heterogeneous types based on the physical states of reactants and products. In homogeneous equilibrium, all species are in the same phase, such as all gases (e.

g., N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g)) or all in a single liquid solution. For these, all species are included in the equilibrium constant (KcK_c or KpK_p) expression, with their stoichiometric coefficients as exponents.

For example, Kc=[NH3]2/([N2][H2]3)K_c = [NH_3]^2 / ([N_2][H_2]^3).

Heterogeneous equilibrium involves species in two or more different phases, like solids and gases (e.g., CaCO3(s)CaO(s)+CO2(g)CaCO_3(s) \rightleftharpoons CaO(s) + CO_2(g)). The critical rule here is that pure solids and pure liquids are *excluded* from the KK expression because their concentrations (activities) are constant.

So, for the CaCO3CaCO_3 example, Kc=[CO2]K_c = [CO_2] and Kp=PCO2K_p = P_{CO_2}. The relationship Kp=Kc(RT)DeltangK_p = K_c(RT)^{Delta n_g} still applies, but DeltangDelta n_g must only consider gaseous species. Adding more pure solid or liquid has no effect on the equilibrium position.

5-Minute Revision

Let's consolidate our understanding of homogeneous and heterogeneous equilibria, crucial for NEET. Chemical equilibrium is a dynamic state where forward and reverse reaction rates are equal, leading to constant concentrations. The classification depends on the phases of the species involved.

1. Homogeneous Equilibrium:

  • Definition:All reactants and products are in the same physical phase. This can be gaseous or a single liquid solution.
  • Example (Gas-phase):2NO(g)+O2(g)2NO2(g)2NO(g) + O_2(g) \rightleftharpoons 2NO_2(g)

* Kc=[NO2]2[NO]2[O2]K_c = \frac{[NO_2]^2}{[NO]^2[O_2]} * Kp=(PNO2)2(PNO)2(PO2)K_p = \frac{(P_{NO_2})^2}{(P_{NO})^2(P_{O_2})}

  • Example (Liquid-phase):CH3COOH(aq)+C2H5OH(aq)CH3COOC2H5(aq)+H2O(aq)CH_3COOH(aq) + C_2H_5OH(aq) \rightleftharpoons CH_3COOC_2H_5(aq) + H_2O(aq)

* Kc=[CH3COOC2H5][H2O][CH3COOH][C2H5OH]K_c = \frac{[CH_3COOC_2H_5][H_2O]}{[CH_3COOH][C_2H_5OH]} (Note: Water is included if its concentration changes significantly).

  • Key Point:All species are included in the KK expression.

2. Heterogeneous Equilibrium:

  • Definition:Reactants and products exist in two or more different physical phases.
  • Example (Solid-Gas):C(s)+H2O(g)CO(g)+H2(g)C(s) + H_2O(g) \rightleftharpoons CO(g) + H_2(g)

* Kc=[CO][H2][H2O]K_c = \frac{[CO][H_2]}{[H_2O]} (Note: C(s)C(s) is excluded) * Kp=PCOPH2PH2OK_p = \frac{P_{CO}P_{H_2}}{P_{H_2O}} (Note: C(s)C(s) is excluded)

  • Example (Solid-Aqueous):AgCl(s)Ag+(aq)+Cl(aq)AgCl(s) \rightleftharpoons Ag^+(aq) + Cl^-(aq)

* Ksp=[Ag+][Cl]K_{sp} = [Ag^+][Cl^-] (Note: AgCl(s)AgCl(s) is excluded)

  • Key Point:Pure solids and pure liquids are *excluded* from the KK expression because their concentrations (activities) are constant and effectively absorbed into the KK value. Their presence is necessary, but their *amount* doesn't shift equilibrium.

3. Relationship between $K_c$ and $K_p$:

  • For gaseous equilibria (both types, if gases are involved): Kp=Kc(RT)DeltangK_p = K_c(RT)^{Delta n_g}
  • Deltang=(sum of stoichiometric coefficients of gaseous products)(sum of stoichiometric coefficients of gaseous reactants)Delta n_g = (\text{sum of stoichiometric coefficients of gaseous products}) - (\text{sum of stoichiometric coefficients of gaseous reactants}).
  • Crucial:Only gaseous species are considered for DeltangDelta n_g. For CaCO3(s)CaO(s)+CO2(g)CaCO_3(s) \rightleftharpoons CaO(s) + CO_2(g), Deltang=10=1Delta n_g = 1 - 0 = 1.

4. NEET Focus: Be able to identify the type of equilibrium, write correct KK expressions (especially for heterogeneous systems), calculate DeltangDelta n_g, and understand that adding/removing pure solids/liquids does not shift equilibrium.

Prelims Revision Notes

    1
  1. Chemical EquilibriumA dynamic state where forward reaction rate (RfR_f) equals reverse reaction rate (RrR_r). Concentrations of reactants and products remain constant. Rf=RrR_f = R_r.
  2. 2
  3. Homogeneous EquilibriumAll reactants and products are in the *same* physical phase.

* Examples: All gases (N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g)), all in aqueous solution (CH3COOH(aq)+C2H5OH(aq)CH3COOC2H5(aq)+H2O(aq)CH_3COOH(aq) + C_2H_5OH(aq) \rightleftharpoons CH_3COOC_2H_5(aq) + H_2O(aq)). * **KcK_c and KpK_p expressions**: All species are included. Stoichiometric coefficients become exponents. * For aA(g)+bB(g)cC(g)+dD(g)aA(g) + bB(g) \rightleftharpoons cC(g) + dD(g): Kc=[C]c[D]d[A]a[B]bK_c = \frac{[C]^c[D]^d}{[A]^a[B]^b} Kp=(PC)c(PD)d(PA)a(PB)bK_p = \frac{(P_C)^c(P_D)^d}{(P_A)^a(P_B)^b}

    1
  1. Heterogeneous EquilibriumReactants and products are in *two or more different* physical phases.

* Examples: Solid-gas (CaCO3(s)CaO(s)+CO2(g)CaCO_3(s) \rightleftharpoons CaO(s) + CO_2(g)), solid-aqueous (AgCl(s)Ag+(aq)+Cl(aq)AgCl(s) \rightleftharpoons Ag^+(aq) + Cl^-(aq)), liquid-gas (H2O(l)H2O(g)H_2O(l) \rightleftharpoons H_2O(g)). * **KcK_c and KpK_p expressions: Pure solids (s) and pure liquids (l) are EXCLUDED.

** Their concentrations/activities are constant (unity) and are absorbed into the KK value. Only gaseous and aqueous species are included.

    1
  1. Relationship between $K_c$ and $K_p$Applicable for equilibria involving gases.

* Kp=Kc(RT)DeltangK_p = K_c(RT)^{Delta n_g} * R=0.0821,Lcdotatm/(molcdotK)R = 0.0821,L cdot atm/(mol cdot K) (or 8.314,J/(molcdotK)8.314,J/(mol cdot K) if using SI units for pressure/volume). * TT must be in Kelvin. * Deltang=(sum of moles of gaseous products)(sum of moles of gaseous reactants)Delta n_g = (\text{sum of moles of gaseous products}) - (\text{sum of moles of gaseous reactants}). * Crucial: Only gaseous species are counted for DeltangDelta n_g, even in heterogeneous equilibria. * Example: For C(s)+H2O(g)CO(g)+H2(g)C(s) + H_2O(g) \rightleftharpoons CO(g) + H_2(g), Deltang=(1+1)1=1Delta n_g = (1+1) - 1 = 1.

    1
  1. Effect of adding/removing pure solids/liquidsAccording to Le Chatelier's principle, adding or removing a pure solid or pure liquid (as long as some is present) has NO EFFECT on the equilibrium position because their concentrations are constant and not part of the KK expression. Only changes in concentration/partial pressure of gaseous or aqueous species, temperature, or total pressure (for gaseous systems) can shift the equilibrium.

Vyyuha Quick Recall

HETERO-K: 'HETERO' means 'EXCLUDE the SOLIDS and LIQUIDS!' (from K expression, only include gases and aqueous species).

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.