Chemistry·Explained

Preparation of Dihydrogen — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

Dihydrogen (H2H_2) is a colorless, odorless, tasteless, and highly flammable gas. Its preparation is a cornerstone of chemical synthesis, driven by its extensive applications in industries ranging from fertilizer production (Haber process) to metallurgy, and as a potential clean fuel source.

The methods for preparing dihydrogen are diverse, reflecting the need for both small-scale laboratory quantities and massive industrial volumes, each with its own set of advantages, disadvantages, and specific reaction conditions.

Conceptual Foundation

The underlying principle for most dihydrogen preparation methods is the reduction of hydrogen from its compounds. In many cases, this involves redox reactions where hydrogen, typically in a +1 oxidation state (as in H2OH_2O, HClHCl, NaOHNaOH), gains electrons to form elemental dihydrogen (H2H_2), where its oxidation state is 0. This reduction is often coupled with the oxidation of another species, such as a metal or a carbon-containing compound.

Key Principles and Laws

    1
  1. Redox Reactions:Many preparations involve electron transfer. For instance, in the reaction of metals with acids, the metal is oxidized (loses electrons) while hydrogen ions are reduced (gain electrons). Example: Zn(s)+2H+(aq)Zn2+(aq)+H2(g)Zn(s) + 2H^+(aq) \rightarrow Zn^{2+}(aq) + H_2(g).
  2. 2
  3. Electrolysis:This process uses electrical energy to drive non-spontaneous redox reactions. In the electrolysis of water, electrical energy breaks down water molecules into hydrogen and oxygen. Example: 2H2O(l)electricity2H2(g)+O2(g)2H_2O(l) \xrightarrow{\text{electricity}} 2H_2(g) + O_2(g).
  4. 3
  5. Displacement Reactions:More reactive metals can displace hydrogen from acids or water. This is a specific type of redox reaction.
  6. 4
  7. Le Chatelier's Principle:Important in industrial processes like the water-gas shift reaction, where optimizing temperature and pressure can maximize hydrogen yield.

Laboratory Methods for Dihydrogen Preparation

These methods are suitable for producing small quantities of dihydrogen for experimental purposes, emphasizing simplicity and readily available reagents.

    1
  1. From Active Metals and Dilute Acids:

* Principle: More electropositive metals (above hydrogen in the electrochemical series) react with dilute non-oxidizing acids to displace hydrogen. * Common Reagents: Zinc granules with dilute hydrochloric acid (HClHCl) or dilute sulfuric acid (H2SO4H_2SO_4).

Iron and magnesium can also be used. * Reaction:

Zn(s)+2HCl(aq)ZnCl2(aq)+H2(g)Zn(s) + 2HCl(aq) \rightarrow ZnCl_2(aq) + H_2(g)
Mg(s)+H2SO4(aq)MgSO4(aq)+H2(g)Mg(s) + H_2SO_4(aq) \rightarrow MgSO_4(aq) + H_2(g)
* Conditions: Room temperature.

Zinc is preferred due to its moderate reactivity and the purity of hydrogen produced. Very reactive metals like Na or K are too vigorous and dangerous, while less reactive metals like Cu or Ag do not react.

* Purity: Hydrogen produced this way may contain impurities like H2SH_2S (if sulfur impurities are present in zinc) or PH3PH_3 (if phosphorus impurities are present). These can be removed by passing the gas through solutions of AgNO3AgNO_3 and KOHKOH respectively.

    1
  1. From Active Metals and Strong Alkalis:

* Principle: Certain amphoteric metals (metals that react with both acids and bases) can react with strong alkali solutions to produce dihydrogen. * Common Reagents: Zinc or Aluminium with concentrated sodium hydroxide (NaOHNaOH) or potassium hydroxide (KOHKOH) solution.

* Reaction:

Zn(s)+2NaOH(aq)Na2ZnO2(aq)+H2(g)Zn(s) + 2NaOH(aq) \rightarrow Na_2ZnO_2(aq) + H_2(g)
(Sodium zincate)
2Al(s)+2NaOH(aq)+2H2O(l)2NaAlO2(aq)+3H2(g)2Al(s) + 2NaOH(aq) + 2H_2O(l) \rightarrow 2NaAlO_2(aq) + 3H_2(g)
(Sodium meta-aluminate) * Conditions: Heating is often required to initiate or speed up the reaction.

    1
  1. From Water with Active Metals:

* Principle: Highly electropositive metals react vigorously with water, displacing hydrogen. * Common Reagents: Sodium (NaNa), Potassium (KK), Calcium (CaCa) with cold water. Magnesium (MgMg) with hot water or steam.

* Reaction:

2Na(s)+2H2O(l)2NaOH(aq)+H2(g)2Na(s) + 2H_2O(l) \rightarrow 2NaOH(aq) + H_2(g)
Ca(s)+2H2O(l)Ca(OH)2(aq)+H2(g)Ca(s) + 2H_2O(l) \rightarrow Ca(OH)_2(aq) + H_2(g)
Mg(s)+H2O(steam)MgO(s)+H2(g)Mg(s) + H_2O(steam) \rightarrow MgO(s) + H_2(g)
* Conditions: Sodium and potassium react explosively with cold water, making this method unsafe for laboratory preparation.

Calcium reacts less violently. Magnesium reacts slowly with cold water but vigorously with steam.

    1
  1. From Steam over Red-Hot Coke (Water Gas Shift Reaction - Lab Scale):

* While primarily an industrial process, the principle can be demonstrated in a lab setting. * Reaction: C(s)+H2O(g)1000circCCO(g)+H2(g)C(s) + H_2O(g) \xrightarrow{1000^circ C} CO(g) + H_2(g) (Water gas) * This produces a mixture of CO and H2H_2, not pure dihydrogen directly.

Industrial Methods for Dihydrogen Preparation

These methods focus on large-scale, cost-effective production, often involving high temperatures, pressures, and catalysts.

    1
  1. Electrolysis of Acidified Water:

* Principle: Passing an electric current through water containing a small amount of acid (e.g., H2SO4H_2SO_4) or base (e.g., NaOHNaOH) to increase conductivity. Water decomposes into hydrogen and oxygen.

* Reactions: At cathode (reduction): 2H2O(l)+2eH2(g)+2OH(aq)2H_2O(l) + 2e^- \rightarrow H_2(g) + 2OH^-(aq) At anode (oxidation): 2H2O(l)O2(g)+4H+(aq)+4e2H_2O(l) \rightarrow O_2(g) + 4H^+(aq) + 4e^- Overall: 2H2O(l)electricity2H2(g)+O2(g)2H_2O(l) \xrightarrow{\text{electricity}} 2H_2(g) + O_2(g) * Advantages: Produces very pure hydrogen.

Oxygen is a valuable by-product. * Disadvantages: Energy-intensive, making it expensive unless cheap electricity is available.

    1
  1. Electrolysis of Brine (Chlor-Alkali Process):

* Principle: Dihydrogen is produced as a by-product during the industrial manufacture of sodium hydroxide (NaOHNaOH) and chlorine (Cl2Cl_2) by the electrolysis of an aqueous solution of sodium chloride (brine).

* Reaction: At cathode: 2H2O(l)+2eH2(g)+2OH(aq)2H_2O(l) + 2e^- \rightarrow H_2(g) + 2OH^-(aq) At anode: 2Cl(aq)Cl2(g)+2e2Cl^-(aq) \rightarrow Cl_2(g) + 2e^- Overall: 2NaCl(aq)+2H2O(l)electricity2NaOH(aq)+Cl2(g)+H2(g)2NaCl(aq) + 2H_2O(l) \xrightarrow{\text{electricity}} 2NaOH(aq) + Cl_2(g) + H_2(g) * Advantages: Cost-effective as hydrogen is a co-product of other valuable chemicals.

    1
  1. Steam Reforming of Hydrocarbons (e.g., Methane):

* Principle: This is the most common industrial method for producing hydrogen. Methane (natural gas) reacts with steam at high temperatures over a nickel catalyst. * Reaction:

CH4(g)+H2O(g)1000circC,NiCO(g)+3H2(g)CH_4(g) + H_2O(g) \xrightarrow{1000^circ C, Ni} CO(g) + 3H_2(g)
* Product: This reaction produces 'synthesis gas' or 'syngas' (a mixture of CO and H2H_2).

* Further Processing (Water-Gas Shift Reaction): To increase the yield of hydrogen and remove carbon monoxide, the syngas is mixed with more steam and passed over an iron-chromium catalyst at lower temperatures (400circC400^circ C).

CO(g)+H2O(g)400circC,Fe2O3/Cr2O3CO2(g)+H2(g)CO(g) + H_2O(g) \xrightarrow{400^circ C, Fe_2O_3/Cr_2O_3} CO_2(g) + H_2(g)
* Carbon Dioxide Removal: The CO2CO_2 produced is then removed by scrubbing with water under pressure or by absorption in a solution of potassium carbonate.

* Advantages: Economical, uses abundant natural gas, high yield of hydrogen. * Disadvantages: Produces carbon dioxide, a greenhouse gas.

    1
  1. From Coke (Bosch Process):

* Principle: Similar to steam reforming, but uses coke (carbon) as the primary reactant. * Steps: a. Water Gas Production: Steam is passed over red-hot coke (1000circC1000^circ C).

C(s)+H2O(g)1000circCCO(g)+H2(g)C(s) + H_2O(g) \xrightarrow{1000^circ C} CO(g) + H_2(g)
b.

Water-Gas Shift Reaction: The water gas is mixed with excess steam and passed over a catalyst (Fe2O3/Cr2O3Fe_2O_3/Cr_2O_3) at 400500circC400-500^circ C.

CO(g)+H2O(g)400500circC,Fe2O3/Cr2O3CO2(g)+H2(g)CO(g) + H_2O(g) \xrightarrow{400-500^circ C, Fe_2O_3/Cr_2O_3} CO_2(g) + H_2(g)
c.

Carbon Dioxide Removal: CO2CO_2 is removed by dissolving it in water under pressure or by absorption in potassium carbonate solution. Any remaining CO can be removed by absorption in ammoniacal cuprous chloride solution.

* Advantages: Uses readily available coke. * Disadvantages: Produces CO2CO_2, similar to steam reforming.

Common Misconceptions

  • Hydrogen vs. Dihydrogen:Students often use 'hydrogen' interchangeably with 'dihydrogen'. While context often clarifies, it's important to remember that 'hydrogen' refers to the element, while 'dihydrogen' refers specifically to the H2H_2 molecule.
  • Reactivity of Metals:Not all metals react with acids or water to produce hydrogen. Reactivity depends on their position in the electrochemical series. Highly reactive metals (like Na, K) react too violently, while less reactive metals (like Cu, Ag) do not react with dilute non-oxidizing acids.
  • Purity of Hydrogen:Laboratory methods often yield hydrogen with impurities. Industrial processes include purification steps (e.g., CO2CO_2 removal) to obtain high-purity hydrogen.
  • Oxidizing Acids:Concentrated oxidizing acids like nitric acid (HNO3HNO_3) or concentrated sulfuric acid (H2SO4H_2SO_4) do not typically produce hydrogen when reacting with metals because the hydrogen produced is immediately oxidized by the acid itself to form water. Instead, oxides of nitrogen or sulfur dioxide are formed.

NEET-Specific Angle

For NEET, focus on:

  • Specific Reagents and Conditions:Memorize the exact reactants, catalysts, temperatures, and pressures for each method (e.g., Zn + dil. HCl, Al + NaOH, CH4+H2OCH_4 + H_2O with Ni catalyst at 1000circC1000^circ C).
  • By-products:Identify the by-products formed in each reaction (e.g., ZnCl2ZnCl_2, Na2ZnO2Na_2ZnO_2, COCO, CO2CO_2, Cl2Cl_2, NaOHNaOH).
  • Purification Steps:Understand how impurities are removed, especially in industrial processes (e.g., CO2CO_2 removal in Bosch process).
  • Distinguishing Lab vs. Industrial Methods:Be able to differentiate based on scale, cost, and purity requirements.
  • Redox Chemistry:Recognize the oxidation and reduction half-reactions in electrolysis and metal-acid reactions.
  • Amphoteric Metals:Remember that metals like Zn and Al can react with both acids and strong bases to produce hydrogen.
Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.