Chemistry·Explained

Properties of Dihydrogen — Explained

NEET UG
Updated 22 Mar 2026

Detailed Explanation

Dihydrogen (H2H_2) is the most abundant chemical substance in the universe, though less so on Earth. Its properties are a direct consequence of its atomic structure and the nature of the covalent bond formed between two hydrogen atoms. Understanding these properties is crucial for comprehending its role in various chemical reactions and industrial applications.

I. Physical Properties of Dihydrogen

    1
  1. State, Color, Odor, and TasteDihydrogen is a colorless, odorless, and tasteless gas under standard temperature and pressure (STP). This makes it difficult to detect without specialized equipment, which can be a safety concern due to its flammability.
  2. 2
  3. Molecular Mass and DensityWith a molecular mass of approximately 2.016g/mol2.016\,\text{g/mol}, dihydrogen is the lightest gas known. Its density is significantly lower than that of air (0.08988g/L0.08988\,\text{g/L} at STP compared to air's 1.29g/L1.29\,\text{g/L}), which explains why hydrogen-filled balloons float.
  4. 3
  5. Melting and Boiling PointsDihydrogen has extremely low melting (13.99K13.99\,\text{K} or 259.16,C-259.16,^\circ\text{C}) and boiling points (20.28K20.28\,\text{K} or 252.87,C-252.87,^\circ\text{C}). This is due to the very weak London dispersion forces (van der Waals forces) between its nonpolar molecules, which require very little energy to overcome.
  6. 4
  7. SolubilityDihydrogen is sparingly soluble in water and other common solvents. Its nonpolar nature means it does not form strong interactions with polar solvent molecules like water, limiting its solubility.
  8. 5
  9. Thermal ConductivityDihydrogen possesses exceptionally high thermal conductivity, about seven times that of air. This property is utilized in cooling systems for large electrical generators.
  10. 6
  11. Ortho and Para HydrogenDihydrogen exists in two isomeric forms based on the spin orientation of its two nuclei: ortho-hydrogen (nuclear spins are parallel) and para-hydrogen (nuclear spins are antiparallel). At room temperature, normal hydrogen is a mixture of approximately 75% ortho-hydrogen and 25% para-hydrogen. At very low temperatures (e.g., liquid hydrogen), the equilibrium shifts towards para-hydrogen, which is the more stable form. These isomers differ slightly in physical properties like specific heat, thermal conductivity, and magnetic susceptibility, but their chemical properties are identical.

II. Chemical Properties of Dihydrogen

The chemical reactivity of dihydrogen is primarily governed by the strength of the H-H bond. The bond dissociation enthalpy of the H-H bond is very high (435.88kJ/mol435.88\,\text{kJ/mol} at 298K298\,\text{K}). This high energy requirement to break the bond makes dihydrogen relatively inert at room temperature.

However, at higher temperatures, in the presence of catalysts, or upon irradiation with light, the bond can be broken, leading to highly reactive hydrogen atoms, which then participate in various reactions.

    1
  1. Reactions with Halogens (X$_2$)Dihydrogen reacts with halogens to form hydrogen halides (HX). The reactivity varies significantly down the group:

* **Fluorine (F2F_2)**: Reacts explosively even in the dark at low temperatures.

H2(g)+F2(g)2HF(g)H_2(g) + F_2(g) \rightarrow 2HF(g)
(Explosive, even at 250,C-250,^\circ\text{C}) * **Chlorine (Cl2Cl_2)**: Reacts in the presence of light (photochemical reaction) or heat.

H2(g)+Cl2(g)light/heat2HCl(g)H_2(g) + Cl_2(g) \xrightarrow{\text{light/heat}} 2HCl(g)
* **Bromine (Br2Br_2)**: Reacts only on heating with a catalyst.
H2(g)+Br2(g)heat, catalyst2HBr(g)H_2(g) + Br_2(g) \xrightarrow{\text{heat, catalyst}} 2HBr(g)
* **Iodine (I2I_2)**: Reacts very slowly and reversibly only at high temperatures and with a catalyst.

H2(g)+I2(g)heat, catalyst2HI(g)H_2(g) + I_2(g) \xrightarrow{\text{heat, catalyst}} 2HI(g)
The decreasing reactivity from fluorine to iodine is due to the decreasing electronegativity and increasing bond dissociation enthalpy of the halogen molecules.

    1
  1. Reactions with Oxygen ($O_2$)Dihydrogen reacts with oxygen to form water. This reaction is highly exothermic and explosive, especially when ignited.

2H2(g)+O2(g)ignition/electric spark2H2O(l)(ΔH=285.8kJ/mol)2H_2(g) + O_2(g) \xrightarrow{\text{ignition/electric spark}} 2H_2O(l) \quad (\Delta H = -285.8\,\text{kJ/mol})
This reaction is the basis for the 'pop' sound test for hydrogen gas.

    1
  1. Reactions with Nitrogen ($N_2$)Dihydrogen reacts with nitrogen under specific conditions (high pressure, moderate temperature, and a catalyst, typically iron) to form ammonia. This is the industrially vital Haber-Bosch process.

N2(g)+3H2(g)xrightleftharpoons[Fe catalyst]450500,C,200atm2NH3(g)N_2(g) + 3H_2(g) xrightleftharpoons[Fe \text{ catalyst}]{450-500,^\circ\text{C}, 200\,\text{atm}} 2NH_3(g)

    1
  1. Reactions with MetalsDihydrogen reacts with highly electropositive metals (primarily s-block elements and some d-block elements) to form metal hydrides. These hydrides can be ionic (salt-like), covalent, or interstitial.

* Ionic Hydrides: Formed with alkali and alkaline earth metals (except Be and Mg). Hydrogen acts as a hydride ion (HH^-).

2Na(s)+H2(g)heat2NaH(s)2Na(s) + H_2(g) \xrightarrow{\text{heat}} 2NaH(s)
Ca(s)+H2(g)heatCaH2(s)Ca(s) + H_2(g) \xrightarrow{\text{heat}} CaH_2(s)
* Covalent Hydrides: Formed with p-block elements (e.g., CH4,NH3,H2O,HFCH_4, NH_3, H_2O, HF). * Interstitial Hydrides: Formed with many d- and f-block metals, where hydrogen atoms occupy interstitial sites in the metal lattice.

    1
  1. Reducing NatureDihydrogen is a powerful reducing agent, especially at elevated temperatures. It can reduce metal oxides, non-metal oxides, and unsaturated organic compounds.

* Reduction of Metal Oxides: It reduces oxides of less electropositive metals (e.g., Cu, Fe, Pb) to their respective metals.

CuO(s)+H2(g)heatCu(s)+H2O(g)CuO(s) + H_2(g) \xrightarrow{\text{heat}} Cu(s) + H_2O(g)
Fe3O4(s)+4H2(g)heat3Fe(s)+4H2O(g)Fe_3O_4(s) + 4H_2(g) \xrightarrow{\text{heat}} 3Fe(s) + 4H_2O(g)
* Hydrogenation of Unsaturated Hydrocarbons: This is a crucial industrial process (hydrogenation).

Dihydrogen adds across double or triple bonds in organic compounds in the presence of catalysts like Ni, Pd, or Pt, converting unsaturated compounds into saturated ones.

RCH=CHR+H2Ni/Pd/PtRCH2CH2RR-CH=CH-R' + H_2 \xrightarrow{Ni/Pd/Pt} R-CH_2-CH_2-R'
(e.

g., vegetable oil to vanaspati ghee)

CH2=CH2(g)+H2(g)NiCH3CH3(g)CH_2=CH_2(g) + H_2(g) \xrightarrow{Ni} CH_3-CH_3(g)
* Reduction of Aldehydes and Ketones: Dihydrogen can reduce aldehydes to primary alcohols and ketones to secondary alcohols.

III. Common Misconceptions and NEET-Specific Angle

  • Inertness vs. ReactivityStudents often confuse dihydrogen's inertness at room temperature with overall unreactivity. It's crucial to emphasize the role of bond dissociation enthalpy and activation energy. While inert at room temperature, it's highly reactive when activated.
  • Reducing AgentDihydrogen's role as a reducing agent is central. Remember that it itself gets oxidized (hydrogen goes from 0 to +1 oxidation state) while reducing other species.
  • Catalyst RoleCatalysts (Ni, Pd, Pt, Fe) are vital in many dihydrogen reactions, lowering the activation energy and increasing reaction rates. Knowing specific catalysts for specific reactions (e.g., Ni for hydrogenation, Fe for Haber process) is important for NEET.
  • Ortho/Para HydrogenWhile their chemical properties are identical, the existence and interconversion of ortho and para forms, and their differing physical properties, are conceptual points that can be tested.
  • FlammabilityDihydrogen is highly flammable and forms an explosive mixture with air (5-75% by volume). This is a key safety aspect and a characteristic property.

In summary, dihydrogen is a versatile element whose properties range from extreme lightness and inertness at low temperatures to powerful reducing capabilities and explosive reactivity under specific conditions. Its industrial importance is immense, making its properties a frequently tested topic in NEET.

Often confused with

Side-by-side differences the NEET paper likes to test.

Properties of Dihydrogen vs Atomic Hydrogen vs. Molecular Dihydrogen
AspectProperties of DihydrogenAtomic Hydrogen vs. Molecular Dihydrogen
NatureAtomic Hydrogen (H)Molecular Dihydrogen ($H_2$)
StabilityHighly unstable, very short-livedStable under normal conditions
ReactivityExtremely reactive, nascent hydrogenRelatively inert at room temperature, reactive at high temperatures/with catalysts
BondingSingle, unpaired electronCovalent bond between two H atoms
FormationFormed by dissociation of $H_2$ at high temperatures or by electrical dischargeNaturally occurring form of hydrogen

Atomic hydrogen (H) is a highly unstable and extremely reactive species, possessing a single unpaired electron, making it much more reactive than its molecular counterpart, dihydrogen (H2H_2). While dihydrogen is stable and relatively inert at room temperature due to its strong H-H covalent bond, atomic hydrogen readily combines with almost any element to form compounds.

Atomic hydrogen is typically generated under extreme conditions like very high temperatures or electrical discharge, whereas dihydrogen is the common, stable form of hydrogen gas.

Why it is tested: For NEET, understanding the difference in reactivity between atomic and molecular hydrogen is crucial. Questions might test why nascent hydrogen (atomic hydrogen) is a more powerful reducing agent than molecular hydrogen, or the conditions required to generate atomic hydrogen. This distinction helps clarify the concept of activation energy and bond dissociation enthalpy in dihydrogen's reactions.

Questions students ask

5 answered on this topic.

Why is dihydrogen considered inert at room temperature despite being highly reactive?

Dihydrogen is considered inert at room temperature primarily due to its very high bond dissociation enthalpy (435.88kJ/mol435.88\,\text{kJ/mol}). This means a significant amount of energy is required to break the strong covalent bond between the two hydrogen atoms.

At room temperature, there isn't enough thermal energy available to overcome this activation energy barrier. However, once this bond is broken (e.g., by heating, light, or catalysts), the resulting hydrogen atoms are extremely reactive, leading to vigorous reactions.

So, it's not inherently unreactive, but rather requires activation.

What is the 'pop' sound test for hydrogen gas?

The 'pop' sound test is a common laboratory method to confirm the presence of hydrogen gas. When a burning splint (a small piece of wood lit on fire) is introduced into a test tube containing hydrogen gas, the hydrogen reacts explosively with the oxygen in the air, producing a characteristic 'pop' sound. This reaction is highly exothermic: 2H2(g)+O2(g)2H2O(l)2H_2(g) + O_2(g) \rightarrow 2H_2O(l). The rapid expansion of gases due to the heat generated causes the audible 'pop'.

Explain the role of catalysts in reactions involving dihydrogen.

Catalysts play a crucial role in many dihydrogen reactions by providing an alternative reaction pathway with a lower activation energy. For instance, in the hydrogenation of vegetable oils, nickel, palladium, or platinum catalysts adsorb dihydrogen molecules onto their surfaces, weakening the H-H bond and facilitating its addition across unsaturated carbon-carbon bonds.

Similarly, in the Haber process for ammonia synthesis, an iron catalyst enables the reaction between nitrogen and dihydrogen to proceed at a practical rate and temperature, which would otherwise be too slow due to the strong triple bond in nitrogen.

What are ortho and para hydrogen, and how do they differ?

Ortho and para hydrogen are two nuclear spin isomers of dihydrogen. They differ in the relative orientation of the spins of their two nuclei (protons). In ortho-hydrogen, the nuclear spins are parallel, while in para-hydrogen, the nuclear spins are antiparallel.

These isomers have identical chemical properties because their electronic structures are the same. However, they exhibit slight differences in physical properties such as specific heat, thermal conductivity, and magnetic susceptibility.

At room temperature, normal hydrogen is a mixture of approximately 75% ortho and 25% para forms, but at very low temperatures, the more stable para-hydrogen predominates.

Why is dihydrogen considered a good reducing agent?

Dihydrogen is an excellent reducing agent because it readily donates electrons (or effectively, adds hydrogen atoms) to other substances, causing them to be reduced. In these reactions, hydrogen itself gets oxidized from an oxidation state of 0 to +1 (e.

g., in water or hydrides). This tendency is particularly evident at higher temperatures where the H-H bond can be broken. It can reduce metal oxides to their respective metals (e.g., CuO+H2Cu+H2OCuO + H_2 \rightarrow Cu + H_2O) and hydrogenate unsaturated organic compounds (e.

g., alkenes to alkanes), making it invaluable in industrial chemistry.