Chemistry

General Characteristics of Compounds

Chemistry·Explained

Oxides, Hydroxides, Halides — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

The study of oxides, hydroxides, and halides forms a cornerstone of inorganic chemistry, providing insights into the periodic trends of elements and their reactivity. These compounds are fundamental to countless industrial processes and biological systems. Let's explore them in detail.

Conceptual Foundation: Bonding and Properties

The nature of bonding—whether ionic or covalent—is the primary determinant of the physical and chemical properties of oxides, hydroxides, and halides. This is governed by the electronegativity difference between the constituent atoms.

A large electronegativity difference favors ionic bonding, while a small difference leads to covalent bonding. The polarizing power of the cation and the polarizability of the anion also play crucial roles, especially in determining the degree of covalent character in an otherwise ionic bond (Fajan's Rules).

  • Ionic Compounds:Typically formed between metals (especially s-block and heavier p-block metals) and highly electronegative non-metals (oxygen, halogens). They are characterized by high melting/boiling points, solubility in polar solvents, and electrical conductivity in molten or aqueous states.
  • Covalent Compounds:Formed between non-metals or metals in high oxidation states. They tend to have lower melting/boiling points, are often gases or liquids at room temperature, are soluble in non-polar solvents, and are poor conductors of electricity.

Oxides: Diversity in Nature and Reactivity

Oxides are binary compounds of oxygen with another element. Oxygen's high electronegativity and ability to form multiple bonds contribute to the vast array of oxides.

Classification of Oxides:

    1
  1. Acidic Oxides (Acid Anhydrides):Formed by non-metals (e.g., CO2CO_2, SO2SO_2, N2O5N_2O_5, P4O10P_4O_{10}) and some metals in high oxidation states (e.g., CrO3CrO_3, Mn2O7Mn_2O_7).

* Properties: React with water to form acids (SO2+H2OH2SO3SO_2 + H_2O \rightarrow H_2SO_3), and with bases to form salt and water (CO2+2NaOHNa2CO3+H2OCO_2 + 2NaOH \rightarrow Na_2CO_3 + H_2O). * Periodic Trend: Acidity increases across a period (e.

g., Na2ONa_2O (basic) MgO\rightarrow MgO (basic) Al2O3\rightarrow Al_2O_3 (amphoteric) SiO2\rightarrow SiO_2 (weakly acidic) P4O10\rightarrow P_4O_{10} (acidic) SO3\rightarrow SO_3 (acidic) Cl2O7\rightarrow Cl_2O_7 (strongly acidic)).

It decreases down a group for non-metals (e.g., CO2CO_2 is more acidic than SiO2SiO_2).

    1
  1. Basic Oxides (Basic Anhydrides):Formed by metals, especially s-block elements (e.g., Na2ONa_2O, CaOCaO) and d-block elements in lower oxidation states (e.g., FeOFeO, CuOCuO).

* Properties: React with water to form bases (CaO+H2OCa(OH)2CaO + H_2O \rightarrow Ca(OH)_2), and with acids to form salt and water (MgO+2HClMgCl2+H2OMgO + 2HCl \rightarrow MgCl_2 + H_2O). * Periodic Trend: Basicity decreases across a period and increases down a group (e.g., Li2OLi_2O is less basic than Cs2OCs_2O).

    1
  1. Amphoteric Oxides:Exhibit both acidic and basic properties. Examples include Al2O3Al_2O_3, ZnOZnO, PbOPbO, SnO2SnO_2, BeOBeO, Ga2O3Ga_2O_3. These elements are typically found near the metalloid region of the periodic table.

* Reactions: React with acids as a base (Al2O3+6HCl2AlCl3+3H2OAl_2O_3 + 6HCl \rightarrow 2AlCl_3 + 3H_2O) and with strong bases as an acid (Al2O3+2NaOH+3H2O2Na[Al(OH)4]Al_2O_3 + 2NaOH + 3H_2O \rightarrow 2Na[Al(OH)_4] (sodium tetrahydroxoaluminate(III))). The ability to act as both acid and base is due to the intermediate electronegativity and polarizing power of the metal ion.

    1
  1. Neutral Oxides:Do not react with acids or bases. Examples: COCO, NONO, N2ON_2O. They are generally unreactive.
    1
  1. Peroxides:Contain the O22O_2^{2-} ion (oxidation state of oxygen is -1). Examples: H2O2H_2O_2, Na2O2Na_2O_2, BaO2BaO_2. They are strong oxidizing agents.
    1
  1. Superoxides:Contain the O2O_2^- ion (oxidation state of oxygen is -1/2). Examples: KO2KO_2, RbO2RbO_2, CsO2CsO_2. Formed by larger alkali metals due to stabilization of the large superoxide ion by a large cation. They are paramagnetic and strong oxidizing agents.
    1
  1. Suboxides:Contain a higher proportion of the element than oxygen (e.g., C3O2C_3O_2).
    1
  1. Mixed Oxides:Composed of two different oxides of the same metal (e.g., Pb3O4Pb_3O_4 is 2PbOPbO22PbO \cdot PbO_2; Fe3O4Fe_3O_4 is FeOFe2O3FeO \cdot Fe_2O_3).

Preparation of Oxides:

  • Direct reaction with oxygen:Most elements react directly with oxygen upon heating (e.g., 2Mg+O22MgO2Mg + O_2 \rightarrow 2MgO).
  • Thermal decomposition:Of carbonates, nitrates, or hydroxides (e.g., CaCO3ΔCaO+CO2CaCO_3 \xrightarrow{\Delta} CaO + CO_2).
  • Oxidation of lower oxides:(e.g., 2SO2+O22SO32SO_2 + O_2 \rightarrow 2SO_3).

Hydroxides: Basicity and Acidity

Hydroxides are compounds containing the hydroxyl group (OHOH^-). Their properties are largely determined by the nature of the bond between the element and the oxygen of the hydroxyl group.

Metal Hydroxides:

  • General Formula:M(OH)nM(OH)_n.
  • Basicity:Most metal hydroxides are basic. The basicity arises from the ease with which they can donate OHOH^- ions in aqueous solution. Strong bases (e.g., NaOHNaOH, KOHKOH) dissociate completely, while weak bases (e.g., Mg(OH)2Mg(OH)_2, Fe(OH)3Fe(OH)_3) dissociate partially.
  • Periodic Trends:Basicity of metal hydroxides generally increases down a group (due to decreasing electronegativity and increasing metallic character, leading to weaker M-O bond and easier OHOH^- release) and decreases across a period (due to increasing electronegativity and decreasing metallic character).

* Example: LiOH<NaOH<KOH<RbOH<CsOHLiOH < NaOH < KOH < RbOH < CsOH (increasing basicity). * Example: NaOH>Mg(OH)2>Al(OH)3NaOH > Mg(OH)_2 > Al(OH)_3 (decreasing basicity).

  • Solubility:Alkali metal hydroxides are highly soluble. Alkaline earth metal hydroxides are sparingly soluble, with solubility increasing down the group (Mg(OH)2<Ca(OH)2<Sr(OH)2<Ba(OH)2Mg(OH)_2 < Ca(OH)_2 < Sr(OH)_2 < Ba(OH)_2).
  • Thermal Stability:Generally, thermal stability increases down a group for alkali and alkaline earth metal hydroxides. For example, LiOHLiOH decomposes at a lower temperature than NaOHNaOH. Mg(OH)2Mg(OH)_2 decomposes more readily than Ba(OH)2Ba(OH)_2.

Amphoteric Hydroxides:

  • Examples: Al(OH)3Al(OH)_3, Zn(OH)2Zn(OH)_2, Pb(OH)2Pb(OH)_2, Sn(OH)2Sn(OH)_2, Be(OH)2Be(OH)_2.
  • Reactions:

* With acid: Al(OH)3+3HClAlCl3+3H2OAl(OH)_3 + 3HCl \rightarrow AlCl_3 + 3H_2O * With base: Al(OH)3+NaOHNa[Al(OH)4]Al(OH)_3 + NaOH \rightarrow Na[Al(OH)_4] (sodium tetrahydroxoaluminate(III))

Non-metal Hydroxides:

  • Often referred to as oxyacids (e.g., H2SO4H_2SO_4 is SO2(OH)2SO_2(OH)_2, HNO3HNO_3 is NO2(OH)NO_2(OH)). These are acidic because the non-metal atom is highly electronegative, pulling electron density away from the O-H bond, making the hydrogen more acidic.

Halides: Ionic vs. Covalent Character

Halides are compounds of an element with one or more halogens. The nature of the bond is a key aspect.

Ionic Halides:

  • Formation:Typically formed by s-block metals and heavier p-block metals (e.g., NaClNaCl, CaF2CaF_2, AlF3AlF_3). Fluorides are generally the most ionic due to fluorine's high electronegativity.
  • Properties:High melting/boiling points, solid at room temperature, soluble in polar solvents (like water), conduct electricity in molten or aqueous states.
  • Hydrolysis:Generally do not hydrolyze in water (e.g., NaClNaCl simply dissolves).

Covalent Halides:

  • Formation:Formed by non-metals (e.g., CCl4CCl_4, PCl3PCl_3, SF6SF_6) and metals in high oxidation states or with high charge density (e.g., TiCl4TiCl_4, SnCl4SnCl_4, AlCl3AlCl_3 (in vapor phase)).
  • Properties:Low melting/boiling points, often gases or liquids at room temperature, insoluble in water (or react with water), non-conductors of electricity.
  • Hydrolysis:Many covalent halides hydrolyze in water, especially if the central atom has vacant d-orbitals to accept lone pairs from water molecules. This reaction often produces the corresponding oxyacid and hydrogen halide.

* Example: SiCl4+4H2OSi(OH)4+4HClSiCl_4 + 4H_2O \rightarrow Si(OH)_4 + 4HCl (or SiO2cdotxH2OSiO_2 cdot xH_2O) * Example: PCl5+4H2OH3PO4+5HClPCl_5 + 4H_2O \rightarrow H_3PO_4 + 5HCl

  • Fajan's Rules:Explain the deviation from ideal ionic character. Smaller cation, larger anion, and higher charge on either ion increase covalent character. For example, AlF3AlF_3 is ionic, but AlCl3AlCl_3 has significant covalent character (dimerizes to Al2Cl6Al_2Cl_6).

Trends in Halides:

  • Across a Period:Halides generally become more covalent across a period as electronegativity increases (e.g., NaClNaCl (ionic) MgCl2\rightarrow MgCl_2 (more covalent) AlCl3\rightarrow AlCl_3 (covalent) SiCl4\rightarrow SiCl_4 (covalent) PCl5\rightarrow PCl_5 (covalent)).
  • Down a Group:For a given element, the covalent character of its halides generally increases from fluoride to iodide (e.g., CCl4CCl_4 is more covalent than CF4CF_4). This is because the polarizability of the halide ion increases from FF^- to II^-.
  • Oxidizing/Reducing Nature:Halides can exhibit oxidizing or reducing properties. For instance, SnCl2SnCl_2 is a reducing agent, while FeCl3FeCl_3 is an oxidizing agent.

NEET-Specific Angle:

NEET questions often focus on comparative properties, periodic trends, and exceptions. Be prepared for:

  • Identifying types of oxides:Given a formula, classify it as acidic, basic, amphoteric, or neutral.
  • Comparing basicity/acidity:Rank hydroxides or oxides based on their strength.
  • Hydrolysis of halides:Predict which halides will hydrolyze and what products are formed.
  • Fajan's rules application:Explain why certain halides are more covalent than others.
  • Reactions:Understand the reactions of amphoteric oxides/hydroxides with acids and bases.
  • Oxidation states of oxygen:Distinguish between normal oxides, peroxides, and superoxides based on oxygen's oxidation state.

Mastering these concepts requires a strong grasp of periodic trends, electronegativity, and bonding principles.

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.