Chemistry

General Characteristics of Compounds

Chemistry·Revision Notes

Oxides, Hydroxides, Halides — Revision Notes

NEET UG
Version 1Updated 22 Mar 2026

⚡ 30-Second Revision

  • Oxides:Binary compounds with oxygen.

- Acidic: Non-metal oxides (CO2CO_2, SO2SO_2). - Basic: Metal oxides (Na2ONa_2O, CaOCaO). - Amphoteric: Al2O3Al_2O_3, ZnOZnO. - Neutral: COCO, NONO, N2ON_2O. - Peroxides: O22O_2^{2-} (O.S. -1), diamagnetic (Na2O2Na_2O_2). - Superoxides: O2O_2^- (O.S. -1/2), paramagnetic (KO2KO_2).

  • Hydroxides:Contain OHOH^-.

- Basicity: Increases down a group, decreases across a period. - Amphoteric: Al(OH)3Al(OH)_3, Zn(OH)2Zn(OH)_2.

  • Halides:Compounds with halogens.

- Ionic: Large electronegativity difference (e.g., NaClNaCl). High MP/BP, soluble in water, no hydrolysis. - Covalent: Small electronegativity difference (e.g., CCl4CCl_4). Low MP/BP, may hydrolyze. - Hydrolysis: Occurs if central atom has vacant d-orbitals (e.g., SiCl4SiCl_4, PCl5PCl_5). CCl4CCl_4 does not hydrolyze. - Fajan's Rules: Covalent character \propto (cation charge / cation size).

2-Minute Revision

Oxides are compounds of oxygen with another element, categorized by their chemical behavior. Acidic oxides (non-metal oxides like CO2CO_2) react with bases, while basic oxides (metal oxides like Na2ONa_2O) react with acids.

Amphoteric oxides (Al2O3Al_2O_3) exhibit both behaviors, and neutral oxides (COCO, NONO) are unreactive. Remember the specific oxidation states of oxygen in peroxides (O22O_2^{2-}, -1) and superoxides (O2O_2^-, -1/2), noting that superoxides are paramagnetic.

Hydroxides are compounds with the OHOH^- group. Metal hydroxides are generally basic, with basicity increasing down a group and decreasing across a period. Amphoteric hydroxides like Al(OH)3Al(OH)_3 are important exceptions.

Halides are compounds with halogens. Their bonding can be ionic (e.g., NaClNaCl) or covalent (e.g., CCl4CCl_4), determined by electronegativity differences. Ionic halides are typically high-melting solids, while covalent halides are often liquids or gases.

A key concept is the hydrolysis of covalent halides, which occurs if the central atom has vacant d-orbitals (e.g., SiCl4SiCl_4 hydrolyzes, CCl4CCl_4 does not). Fajan's rules explain the degree of covalent character: smaller, more charged cations and larger, more polarizable anions lead to increased covalent character.

5-Minute Revision

Let's consolidate the key aspects of oxides, hydroxides, and halides for NEET. Oxides are binary compounds of oxygen. Their classification is crucial: acidic oxides (e.g., SO2SO_2, N2O5N_2O_5) are non-metal oxides that form acids with water and react with bases.

Basic oxides (e.g., CaOCaO, Na2ONa_2O) are metal oxides that form bases with water and react with acids. Amphoteric oxides (e.g., Al2O3Al_2O_3, ZnOZnO) react with both acids and bases. Neutral oxides (e.g., COCO, NONO, N2ON_2O) are unreactive.

Beyond these, remember peroxides (O22O_2^{2-}, oxygen O.S. -1, diamagnetic) and superoxides (O2O_2^-, oxygen O.S. -1/2, paramagnetic). For example, Na2O2Na_2O_2 is a peroxide, while KO2KO_2 is a superoxide.

Hydroxides contain the OHOH^- group. Metal hydroxides are typically basic. Their basicity follows clear periodic trends: it increases as you go down a group (e.g., LiOH<NaOH<KOHLiOH < NaOH < KOH) because the M-O bond becomes weaker and more ionic, allowing easier release of OHOH^-.

Basicity decreases across a period (e.g., NaOH>Mg(OH)2>Al(OH)3NaOH > Mg(OH)_2 > Al(OH)_3) as metallic character decreases. Amphoteric hydroxides like Al(OH)3Al(OH)_3 can react as both acids and bases, for instance: Al(OH)3+3HClAlCl3+3H2OAl(OH)_3 + 3HCl \rightarrow AlCl_3 + 3H_2O and Al(OH)3+NaOHNa[Al(OH)4]Al(OH)_3 + NaOH \rightarrow Na[Al(OH)_4].

Halides are compounds of elements with halogens. The nature of their bonding is key: ionic halides (e.g., NaClNaCl, CaF2CaF_2) are formed between highly electropositive metals and halogens, characterized by high melting points and solubility in water without hydrolysis.

Covalent halides (e.g., CCl4CCl_4, PCl5PCl_5) are formed between non-metals or metals in high oxidation states, typically having lower melting points and often hydrolyzing in water. The ability to hydrolyze depends on the presence of vacant d-orbitals on the central atom; for example, SiCl4SiCl_4 hydrolyzes readily (SiCl4+4H2OSi(OH)4+4HClSiCl_4 + 4H_2O \rightarrow Si(OH)_4 + 4HCl), but CCl4CCl_4 does not due to the absence of d-orbitals on carbon.

Fajan's rules are crucial for understanding the degree of covalent character: a smaller, more highly charged cation and a larger, more polarizable anion lead to increased covalent character. For example, AlCl3AlCl_3 is more covalent than AlF3AlF_3 due to the larger ClCl^- ion.

Prelims Revision Notes

    1
  1. Oxides Classification:

* Acidic Oxides: Non-metal oxides (CO2CO_2, SO2SO_2, N2O5N_2O_5, P4O10P_4O_{10}) and high O.S. metal oxides (CrO3CrO_3, Mn2O7Mn_2O_7). React with water to form acids, react with bases to form salts. Acidity \uparrow across period, \downarrow down group (for non-metals).

* Basic Oxides: Metal oxides (Na2ONa_2O, CaOCaO, BaOBaO, FeOFeO). React with water to form bases, react with acids to form salts. Basicity \downarrow across period, \uparrow down group. * Amphoteric Oxides: Al2O3Al_2O_3, ZnOZnO, PbOPbO, SnO2SnO_2, BeOBeO, Ga2O3Ga_2O_3.

React with both acids and bases. * Neutral Oxides: COCO, NONO, N2ON_2O. Do not react with acids or bases. * Peroxides: Contain O22O_2^{2-} ion (O.S. of O = -1). E.g., H2O2H_2O_2, Na2O2Na_2O_2, BaO2BaO_2.

Diamagnetic. * Superoxides: Contain O2O_2^- ion (O.S. of O = -1/2). E.g., KO2KO_2, RbO2RbO_2, CsO2CsO_2. Paramagnetic (one unpaired electron). * Mixed Oxides: E.g., Pb3O4(2PbOcdotPbO2)Pb_3O_4 (2PbO cdot PbO_2), Fe3O4(FeOcdotFe2O3)Fe_3O_4 (FeO cdot Fe_2O_3).

    1
  1. Hydroxides:

* Metal Hydroxides: Generally basic. Basicity \uparrow down group (LiOH<CsOHLiOH < CsOH), \downarrow across period (NaOH>Mg(OH)2>Al(OH)3NaOH > Mg(OH)_2 > Al(OH)_3). * Amphoteric Hydroxides: Al(OH)3Al(OH)_3, Zn(OH)2Zn(OH)_2, Pb(OH)2Pb(OH)_2, Be(OH)2Be(OH)_2. React with acids and strong bases. * Non-metal Hydroxides: Often oxyacids (e.g., H2SO4H_2SO_4, HNO3HNO_3), acidic in nature.

    1
  1. Halides:Binary compounds of elements with halogens.

* Ionic Halides: Formed by highly electropositive metals (s-block, some p-block) with halogens. High MP/BP, solid, soluble in polar solvents, conduct electricity in molten/aqueous state. Generally do not hydrolyze (e.

g., NaClNaCl). * Covalent Halides: Formed by non-metals or metals in high oxidation states. Low MP/BP, often liquid/gas, soluble in non-polar solvents, non-conductors. Many hydrolyze. * Hydrolysis: Covalent halides hydrolyze if the central atom has vacant d-orbitals to accept lone pairs from water.

E.g., SiCl4+4H2OSi(OH)4+4HClSiCl_4 + 4H_2O \rightarrow Si(OH)_4 + 4HCl. PCl5+4H2OH3PO4+5HClPCl_5 + 4H_2O \rightarrow H_3PO_4 + 5HCl. CCl4CCl_4 does NOT hydrolyze due to absence of vacant d-orbitals on carbon. * Fajan's Rules: Predict covalent character in ionic compounds.

* Covalent character \uparrow with: smaller cation size, higher cation charge, larger anion size, higher anion charge. * Example: AlF3AlF_3 (ionic) vs. AlCl3AlCl_3 (more covalent, dimerizes to Al2Cl6Al_2Cl_6).

LiClLiCl is more covalent than NaClNaCl. * Trends: Covalent character \uparrow across a period, \uparrow from fluoride to iodide for a given element.

Vyyuha Quick Recall

For Amphoteric oxides, remember Aluminum, Zinc, Lead, Sn (tin), Beryllium, Gallium: 'Always Zebras Look So Beautifully Gray'.

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.