Chemistry·Explained

Alkanes — Explained

NEET UG
Updated 22 Mar 2026

Detailed Explanation

Conceptual Foundation of Alkanes

Alkanes represent the simplest class of organic compounds, serving as the backbone for understanding more complex organic structures. They are defined as saturated acyclic hydrocarbons, meaning their structures consist solely of carbon and hydrogen atoms, linked exclusively by single covalent bonds, and do not form rings.

The general formula for alkanes is CnH2n+2C_nH_{2n+2}, where 'n' denotes the number of carbon atoms. This formula reflects the saturation, as each carbon atom is bonded to the maximum possible number of hydrogen atoms or other carbon atoms, satisfying its tetravalency.

Each carbon atom in an alkane is sp3sp^3 hybridized. This hybridization leads to a tetrahedral geometry around each carbon, with bond angles of approximately 109.5109.5^\circ. The carbon-carbon single bonds are sigma (σ\sigma) bonds, which allow for free rotation around the bond axis.

This rotational freedom gives rise to different spatial arrangements of atoms, known as conformations, which are interconvertible without breaking any bonds. For instance, in ethane (C2H6C_2H_6), the two methyl groups can rotate relative to each other, leading to staggered and eclipsed conformations, with the staggered conformation being more stable due to reduced torsional strain.

Key Principles: Nomenclature and Isomerism

Nomenclature: The systematic naming of alkanes follows IUPAC (International Union of Pure and Applied Chemistry) rules. The basic principle involves identifying the longest continuous carbon chain, which forms the parent alkane name (e.

g., methane, ethane, propane, butane, pentane, hexane, etc.). Substituents (alkyl groups) attached to this parent chain are then numbered to give them the lowest possible locants. Prefixes like 'di-', 'tri-', 'tetra-' are used for multiple identical substituents, and substituents are listed alphabetically.

For example, CH3CH(CH3)CH2CH3CH_3CH(CH_3)CH_2CH_3 is 2-methylbutane.

Isomerism: Alkanes exhibit structural isomerism, specifically chain isomerism. This occurs when compounds have the same molecular formula but different arrangements of carbon atoms in their chains.

For example, butane (C4H10C_4H_{10}) has two structural isomers: n-butane (a straight chain) and isobutane (2-methylpropane, a branched chain). As the number of carbon atoms increases, the number of possible structural isomers grows significantly.

Conformational isomerism, as mentioned earlier, arises from the free rotation around C-C single bonds.

Preparation Methods of Alkanes

Alkanes can be synthesized through various methods:

    1
  1. Hydrogenation of Unsaturated Hydrocarbons:Alkenes and alkynes can be converted to alkanes by catalytic hydrogenation. This involves adding hydrogen gas (H2H_2) across the double or triple bond in the presence of a catalyst like Nickel (Ni), Palladium (Pd), or Platinum (Pt). This reaction is also known as the Sabatier-Senderens reaction.

RCH=CH2+H2Ni/Pd/PtRCH2CH3R-CH=CH_2 + H_2 \xrightarrow{Ni/Pd/Pt} R-CH_2-CH_3

    1
  1. Wurtz Reaction:This reaction is used for preparing symmetrical alkanes (even number of carbon atoms) by reacting two molecules of an alkyl halide with sodium metal in dry ether. The mechanism involves free radical intermediates.

2RX+2NaDry,EtherRR+2NaX2R-X + 2Na \xrightarrow{Dry,Ether} R-R + 2NaX
Limitations: It is not suitable for preparing unsymmetrical alkanes because it leads to a mixture of products, making separation difficult.

    1
  1. Decarboxylation of Carboxylic Acids:Sodium salts of carboxylic acids, when heated with soda lime (a mixture of NaOH and CaO), undergo decarboxylation to form alkanes with one carbon atom less than the parent carboxylic acid.

RCOONa+NaOHCaO,DeltaRH+Na2CO3R-COONa + NaOH \xrightarrow{CaO, Delta} R-H + Na_2CO_3

    1
  1. Kolbe's Electrolytic Method:This method involves the electrolysis of an aqueous solution of sodium or potassium salt of a carboxylic acid. Alkanes are formed at the anode, typically symmetrical alkanes with an even number of carbon atoms.

2RCOONa+2H2OElectrolysisRR+2CO2+H2+2NaOH2R-COONa + 2H_2O \xrightarrow{Electrolysis} R-R + 2CO_2 + H_2 + 2NaOH

    1
  1. Reduction of Alkyl Halides:Alkyl halides can be reduced to alkanes using various reducing agents such as Zn/HCl, H2H_2/Pd, or LiAlH4_4.

RX+[H]RH+HXR-X + [H] \rightarrow R-H + HX

Physical Properties

  • State of Matter:At room temperature, alkanes with 1 to 4 carbon atoms (C1C4C_1-C_4) are gases (e.g., methane, ethane, propane, butane). Alkanes with 5 to 17 carbon atoms (C5C17C_5-C_{17}) are liquids (e.g., pentane, hexane, octane). Alkanes with 18 or more carbon atoms (C18+C_{18+}) are solids (e.g., paraffin wax).
  • Boiling and Melting Points:These generally increase with increasing molecular mass (number of carbon atoms) due to stronger London dispersion forces. For isomeric alkanes, branching decreases the surface area, leading to weaker intermolecular forces and thus lower boiling points. For example, n-pentane has a higher boiling point than isopentane (2-methylbutane), which in turn has a higher boiling point than neopentane (2,2-dimethylpropane).
  • Density:Alkanes are less dense than water, with densities typically ranging from 0.60.6 to 0.8g/mL0.8\,\text{g/mL}. Density increases with increasing molecular mass.
  • Solubility:Alkanes are nonpolar molecules and are therefore insoluble in water (a polar solvent) but soluble in nonpolar organic solvents like benzene, ether, and carbon tetrachloride. They are also good solvents for other nonpolar substances.

Chemical Properties

Alkanes are generally unreactive due to their saturated nature and the strong, nonpolar C-C and C-H sigma bonds. However, they undergo a few important reactions:

    1
  1. Halogenation (Free Radical Substitution):This is the most characteristic reaction of alkanes, occurring in the presence of UV light or high temperatures. It involves the substitution of one or more hydrogen atoms by halogen atoms (Cl or Br) via a free radical mechanism.

* Mechanism (e.g., Chlorination of Methane): * Initiation: Homolytic cleavage of the halogen molecule by UV light to form free radicals.

ClClhνClcdot+ClcdotCl-Cl \xrightarrow{h\nu} Clcdot + Clcdot
* Propagation: A chain reaction where radicals react with stable molecules to form new radicals.

CH4+ClcdotCH3+HClCH_4 + Clcdot \rightarrow \cdot CH_3 + HCl
CH3+ClClCH3Cl+Clcdot\cdot CH_3 + Cl-Cl \rightarrow CH_3Cl + Clcdot
* Termination: Two radicals combine to form a stable molecule, ending the chain.
Clcdot+ClcdotCl2Clcdot + Clcdot \rightarrow Cl_2
CH3+CH3CH3CH3\cdot CH_3 + \cdot CH_3 \rightarrow CH_3-CH_3
CH3+ClcdotCH3Cl\cdot CH_3 + Clcdot \rightarrow CH_3Cl
* Reactivity Order: For hydrogen atoms: 3>2>13^\circ > 2^\circ > 1^\circ.

For halogens: F2>Cl2>Br2>I2F_2 > Cl_2 > Br_2 > I_2. Fluorination is too violent, iodination is reversible and slow.

    1
  1. Combustion:Alkanes burn in the presence of sufficient oxygen to produce carbon dioxide, water, and a large amount of heat. This makes them excellent fuels.

CnH2n+2+(3n+12)O2nCO2+(n+1)H2O+HeatC_nH_{2n+2} + \left(\frac{3n+1}{2}\right)O_2 \rightarrow nCO_2 + (n+1)H_2O + Heat
In insufficient oxygen, incomplete combustion occurs, producing carbon monoxide (CO) or carbon (soot).

    1
  1. Controlled Oxidation:Under specific conditions (e.g., high pressure, catalyst), alkanes can undergo controlled oxidation to form alcohols, aldehydes, or carboxylic acids.

CH4+O2Cu/523K/100atmCH3OHCH_4 + O_2 \xrightarrow{Cu/523K/100atm} CH_3OH

    1
  1. Isomerization:Straight-chain alkanes can be converted into branched-chain alkanes in the presence of anhydrous aluminum chloride (AlCl3AlCl_3) and HCl at elevated temperatures. This reaction is important in petroleum refining to improve fuel quality (increase octane number).

CH3CH2CH2CH3AlCl3/HClCH3CH(CH3)CH3CH_3CH_2CH_2CH_3 \xrightarrow{AlCl_3/HCl} CH_3CH(CH_3)CH_3

    1
  1. Pyrolysis (Cracking):When alkanes are heated to high temperatures (e.g., 700800K700-800\,\text{K}) in the absence of air, they decompose into smaller alkanes, alkenes, and hydrogen. This process is crucial in the petroleum industry to produce gasoline and other valuable chemicals from heavier crude oil fractions.

C6H14DeltaC4H8+C2H6orC3H6+C2H4+CH4C_6H_{14} \xrightarrow{Delta} C_4H_8 + C_2H_6 \quad \text{or} \quad C_3H_6 + C_2H_4 + CH_4

Real-World Applications

Alkanes are indispensable in daily life and industry:

  • Fuels:Methane (natural gas), propane, butane (LPG), gasoline (petrol, a mixture of C5C12C_5-C_{12} alkanes), diesel (C15C18C_{15}-C_{18} alkanes), kerosene are all primarily alkanes and are vital energy sources.
  • Solvents:Hexane and heptane are common nonpolar solvents used in laboratories and industrial processes for extracting oils and fats.
  • Lubricants:Heavier liquid alkanes and solid alkanes (paraffin wax) are used as lubricants, greases, and protective coatings.
  • Raw Materials:Cracking of alkanes provides alkenes, which are crucial monomers for plastics (polyethylene, polypropylene) and other organic chemicals.

Common Misconceptions and NEET-Specific Angle

  • Reactivity:Students often mistakenly assume alkanes are completely unreactive. While less reactive than unsaturated hydrocarbons, they do undergo specific reactions like free radical halogenation and combustion, which are important for NEET.
  • Free Radical Mechanism:A common error is confusing the steps of the free radical substitution mechanism (initiation, propagation, termination) or misidentifying the reactive species (radicals, not ions).
  • Wurtz Reaction Limitations:Forgetting that Wurtz reaction is best for symmetrical alkanes and leads to a mixture for unsymmetrical ones is a frequent trap.
  • Isomerism:Distinguishing between structural and conformational isomers, and understanding how branching affects physical properties (boiling point, melting point) is key.
  • NEET Focus:For NEET, emphasis is placed on understanding reaction mechanisms (especially free radical halogenation), specific reagents and conditions for preparation methods (e.g., soda lime for decarboxylation, catalysts for hydrogenation), the relative reactivity of different types of hydrogen atoms in halogenation, and the effects of branching on physical properties. Questions often involve identifying products of reactions, choosing appropriate reagents, or comparing properties of isomers. Pay close attention to exceptions and specific conditions mentioned for each reaction.

Often confused with

Side-by-side differences the NEET paper likes to test.

Alkanes vs Alkenes and Alkynes
AspectAlkanesAlkenes and Alkynes
DefinitionAlkanes: Saturated hydrocarbons with only C-C single bonds.Alkenes: Unsaturated hydrocarbons with at least one C=C double bond. Alkynes: Unsaturated hydrocarbons with at least one C≡C triple bond.
General FormulaAlkanes: $C_nH_{2n+2}$Alkenes: $C_nH_{2n}$ (for one double bond). Alkynes: $C_nH_{2n-2}$ (for one triple bond).
HybridizationAlkanes: All carbons are $sp^3$ hybridized.Alkenes: Carbons involved in the double bond are $sp^2$ hybridized. Alkynes: Carbons involved in the triple bond are $sp$ hybridized.
ReactivityAlkanes: Relatively unreactive (paraffins), undergo substitution reactions (e.g., free radical halogenation).Alkenes/Alkynes: Highly reactive due to $\pi$ bonds, undergo addition reactions (e.g., hydrogenation, halogenation, hydration, hydrohalogenation).
Bond AnglesAlkanes: Approximately $109.5^\circ$ (tetrahedral).Alkenes: Approximately $120^\circ$ (trigonal planar). Alkynes: $180^\circ$ (linear).
Test for UnsaturationAlkanes: Do not decolorize bromine water or Baeyer's reagent.Alkenes/Alkynes: Decolorize bromine water and Baeyer's reagent (cold, dilute, alkaline $KMnO_4$). This is a key distinguishing test.

The fundamental difference between alkanes, alkenes, and alkynes lies in their degree of saturation, which dictates their general formula, hybridization, geometry, and most importantly, their chemical reactivity.

Alkanes are saturated with only single bonds, making them relatively inert and primarily undergoing substitution reactions. In contrast, alkenes and alkynes are unsaturated, possessing double and triple bonds, respectively.

These π\pi bonds are electron-rich and readily undergo addition reactions, where atoms are added across the multiple bond without the loss of other atoms. This difference in reactivity is crucial for distinguishing them in laboratory tests and understanding their synthetic utility.

Why it is tested: NEET relevance: Understanding these differences is critical for predicting reaction products, choosing appropriate reagents for synthesis or identification, and solving conceptual questions related to hydrocarbon classification and reactivity. Questions often involve distinguishing between these classes based on their reactions with specific reagents like bromine water or Baeyer's reagent, or identifying the type of hybridization in a given molecule.

Questions students ask

6 answered on this topic.

Why are alkanes called paraffins?

Alkanes are often referred to as paraffins, a term derived from the Latin words 'parum' (meaning little) and 'affinis' (meaning affinity). This nomenclature accurately reflects their chemical inertness and low reactivity under normal conditions.

The reason for this low reactivity lies in their molecular structure: alkanes consist solely of strong carbon-carbon and carbon-hydrogen single bonds, which are nonpolar and difficult to break. Furthermore, they lack any functional groups, such as double bonds, triple bonds, or heteroatoms with lone pairs, that would typically provide sites for chemical attack by common reagents like acids, bases, or oxidizing agents.

How does branching affect the boiling point of alkanes?

Branching in alkanes significantly affects their boiling points. As the degree of branching increases for a given molecular formula, the boiling point decreases. This is because branching leads to a more compact, spherical shape for the molecule, which reduces the surface area available for intermolecular contact.

Consequently, the strength of the London dispersion forces (van der Waals forces) between molecules decreases. Weaker intermolecular forces require less energy to overcome, resulting in lower boiling points.

For example, n-pentane has a higher boiling point than isopentane (2-methylbutane), which in turn has a higher boiling point than neopentane (2,2-dimethylpropane).

What is the significance of the Wurtz reaction in alkane synthesis, and what are its limitations?

The Wurtz reaction is a classic method for synthesizing alkanes by coupling two alkyl halide molecules using sodium metal in dry ether. Its significance lies in its ability to form carbon-carbon bonds, effectively increasing the chain length.

It is particularly useful for preparing symmetrical alkanes with an even number of carbon atoms. However, it has a major limitation: if two different alkyl halides are used to prepare an unsymmetrical alkane, a mixture of three different alkanes will be produced (R-R, R'-R', and R-R').

Separating these products, which often have similar boiling points, is challenging and makes the reaction impractical for synthesizing unsymmetrical alkanes efficiently.

Explain the role of UV light in the halogenation of alkanes.

UV light plays a crucial role in initiating the free radical halogenation of alkanes. This reaction proceeds via a free radical mechanism, which requires the formation of highly reactive free radicals to start the chain reaction.

UV light provides the necessary energy (photons) to homolytically cleave the halogen molecule (e.g., Cl2Cl_2 or Br2Br_2) into two halogen free radicals. Homolytic cleavage means each atom involved in the bond breaking retains one electron from the shared pair.

Without UV light, the halogen molecule is stable, and the reaction with alkanes, which are themselves quite stable, would not proceed under normal conditions due to a high activation energy barrier.

Why is methane not prepared by the Wurtz reaction?

Methane (CH4CH_4) cannot be prepared by the Wurtz reaction because the Wurtz reaction involves the coupling of two alkyl halide molecules to form a new carbon-carbon bond, effectively doubling the carbon chain or combining two different chains.

The smallest alkane that can be formed by the Wurtz reaction is ethane (CH3CH3CH_3-CH_3), which results from the coupling of two methyl halide molecules (CH3XCH_3X). Methane has only one carbon atom, and its formation does not involve the creation of a C-C bond through coupling.

Therefore, the fundamental mechanism of the Wurtz reaction is incompatible with the synthesis of methane.

What is pyrolysis or cracking of alkanes, and why is it important?

Pyrolysis, also known as cracking, is the process of heating higher alkanes to very high temperatures (typically 700800K700-800\,\text{K}) in the absence of air, causing them to break down into smaller alkanes, alkenes, and hydrogen.

This is a free radical process. Its importance is immense in the petroleum industry. Crude oil contains a large proportion of heavy, long-chain alkanes, which are less valuable as fuels. Cracking converts these less useful heavy fractions into more valuable, shorter-chain hydrocarbons like gasoline (petrol) components and alkenes.

Alkenes, in turn, are crucial raw materials for the synthesis of polymers (plastics) and various other organic chemicals, making cracking a cornerstone of petrochemical production.